CA1061363A - Acylhydrazinothiourea derivatives as photographic nucleating agents - Google Patents
Acylhydrazinothiourea derivatives as photographic nucleating agentsInfo
- Publication number
- CA1061363A CA1061363A CA258,495A CA258495A CA1061363A CA 1061363 A CA1061363 A CA 1061363A CA 258495 A CA258495 A CA 258495A CA 1061363 A CA1061363 A CA 1061363A
- Authority
- CA
- Canada
- Prior art keywords
- phenyl
- alkyl
- silver halide
- substituent
- carbon atoms
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002667 nucleating agent Substances 0.000 title claims description 74
- -1 silver halide Chemical class 0.000 claims abstract description 178
- 229910052709 silver Inorganic materials 0.000 claims abstract description 135
- 239000004332 silver Substances 0.000 claims abstract description 135
- 239000000203 mixture Substances 0.000 claims abstract description 76
- 230000005855 radiation Effects 0.000 claims abstract description 25
- 239000003795 chemical substances by application Substances 0.000 claims abstract description 16
- 239000011248 coating agent Substances 0.000 claims abstract description 10
- 238000000576 coating method Methods 0.000 claims abstract description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 91
- 239000000839 emulsion Substances 0.000 claims description 75
- 125000000217 alkyl group Chemical group 0.000 claims description 63
- 125000004432 carbon atom Chemical group C* 0.000 claims description 54
- 238000000034 method Methods 0.000 claims description 39
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 37
- 150000001875 compounds Chemical class 0.000 claims description 34
- 238000012545 processing Methods 0.000 claims description 30
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 27
- 239000000463 material Substances 0.000 claims description 27
- 229910052739 hydrogen Inorganic materials 0.000 claims description 25
- 239000001257 hydrogen Substances 0.000 claims description 25
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 22
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 19
- 125000001188 haloalkyl group Chemical group 0.000 claims description 19
- 125000001424 substituent group Chemical group 0.000 claims description 18
- 150000003839 salts Chemical group 0.000 claims description 17
- 150000004820 halides Chemical class 0.000 claims description 16
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 15
- 238000012546 transfer Methods 0.000 claims description 15
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 14
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 claims description 14
- 125000003545 alkoxy group Chemical group 0.000 claims description 13
- 150000007857 hydrazones Chemical class 0.000 claims description 13
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 claims description 11
- 125000001624 naphthyl group Chemical group 0.000 claims description 11
- 230000003287 optical effect Effects 0.000 claims description 10
- 238000012360 testing method Methods 0.000 claims description 10
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 claims description 9
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 claims description 8
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 8
- 230000006872 improvement Effects 0.000 claims description 8
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 7
- 235000010265 sodium sulphite Nutrition 0.000 claims description 7
- 125000006307 alkoxy benzyl group Chemical group 0.000 claims description 6
- 125000006177 alkyl benzyl group Chemical group 0.000 claims description 6
- 125000006277 halobenzyl group Chemical group 0.000 claims description 6
- WSSDYHKIQCNKTD-UHFFFAOYSA-N n-[4-[(4-cyanophenyl)carbamothioylamino]anilino]formamide Chemical compound C1=CC(NNC=O)=CC=C1NC(=S)NC1=CC=C(C#N)C=C1 WSSDYHKIQCNKTD-UHFFFAOYSA-N 0.000 claims description 6
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 claims description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 claims description 6
- 239000000084 colloidal system Substances 0.000 claims description 5
- 239000002019 doping agent Substances 0.000 claims description 5
- 229910052751 metal Inorganic materials 0.000 claims description 5
- 239000002184 metal Substances 0.000 claims description 5
- GHFHIODPODXVKB-UHFFFAOYSA-N 1-[4-(2-acetylhydrazinyl)phenyl]-3-ethylthiourea Chemical compound CCNC(=S)NC1=CC=C(NNC(C)=O)C=C1 GHFHIODPODXVKB-UHFFFAOYSA-N 0.000 claims description 4
- HACVJHFQTOLQAV-UHFFFAOYSA-N 1-benzyl-3-[4-[2-(4-chlorobenzoyl)hydrazinyl]phenyl]thiourea Chemical compound C1=CC(Cl)=CC=C1C(=O)NNC(C=C1)=CC=C1NC(=S)NCC1=CC=CC=C1 HACVJHFQTOLQAV-UHFFFAOYSA-N 0.000 claims description 4
- MLZQJFJGKKNBTP-UHFFFAOYSA-N n-[4-(heptylcarbamothioylamino)anilino]formamide Chemical compound CCCCCCCNC(=S)NC1=CC=C(NNC=O)C=C1 MLZQJFJGKKNBTP-UHFFFAOYSA-N 0.000 claims description 4
- MRWRHBKHZLXULK-UHFFFAOYSA-N n-[4-[(4-methoxyphenyl)carbamothioylamino]anilino]formamide Chemical compound C1=CC(OC)=CC=C1NC(=S)NC1=CC=C(NNC=O)C=C1 MRWRHBKHZLXULK-UHFFFAOYSA-N 0.000 claims description 4
- VCXCUQUCTGMCDZ-UHFFFAOYSA-N 1,3-bis[4-(2-acetylhydrazinyl)phenyl]thiourea Chemical compound C1=CC(NNC(=O)C)=CC=C1NC(=S)NC1=CC=C(NNC(C)=O)C=C1 VCXCUQUCTGMCDZ-UHFFFAOYSA-N 0.000 claims description 3
- UBNAPMLUOCTDCT-UHFFFAOYSA-N 1-[4-(2-acetylhydrazinyl)phenyl]-1-[(4-methoxyphenyl)methyl]-3-phenylthiourea Chemical compound C1=CC(OC)=CC=C1CN(C=1C=CC(NNC(C)=O)=CC=1)C(=S)NC1=CC=CC=C1 UBNAPMLUOCTDCT-UHFFFAOYSA-N 0.000 claims description 3
- KNNINMLTARCQMU-UHFFFAOYSA-N 1-[4-(2-acetylhydrazinyl)phenyl]-3-phenylthiourea Chemical compound C1=CC(NNC(=O)C)=CC=C1NC(=S)NC1=CC=CC=C1 KNNINMLTARCQMU-UHFFFAOYSA-N 0.000 claims description 3
- YEFWFCUFWNTTMW-UHFFFAOYSA-N 1-[4-[2-(4-methoxybenzoyl)hydrazinyl]phenyl]-3-phenylthiourea Chemical compound C1=CC(OC)=CC=C1C(=O)NNC(C=C1)=CC=C1NC(=S)NC1=CC=CC=C1 YEFWFCUFWNTTMW-UHFFFAOYSA-N 0.000 claims description 3
- QUPPKFQQNJUYBW-UHFFFAOYSA-N 1-[4-[2-(4-methylbenzoyl)hydrazinyl]phenyl]-3-phenylthiourea Chemical compound C1=CC(C)=CC=C1C(=O)NNC(C=C1)=CC=C1NC(=S)NC1=CC=CC=C1 QUPPKFQQNJUYBW-UHFFFAOYSA-N 0.000 claims description 3
- AQIXUEIPEHRNHA-UHFFFAOYSA-N 1-phenyl-3-[4-[2-(2,2,2-trifluoroacetyl)hydrazinyl]phenyl]thiourea Chemical compound C1=CC(NNC(=O)C(F)(F)F)=CC=C1NC(=S)NC1=CC=CC=C1 AQIXUEIPEHRNHA-UHFFFAOYSA-N 0.000 claims description 3
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 claims description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 3
- SWUBHTUVLHZVKB-UHFFFAOYSA-N n-[4-(benzylcarbamothioylamino)anilino]formamide Chemical compound C1=CC(NNC=O)=CC=C1NC(=S)NCC1=CC=CC=C1 SWUBHTUVLHZVKB-UHFFFAOYSA-N 0.000 claims description 3
- RJFVAEVVWXVFNC-UHFFFAOYSA-N n-[4-(butylcarbamothioylamino)-2-methoxyanilino]formamide Chemical compound CCCCNC(=S)NC1=CC=C(NNC=O)C(OC)=C1 RJFVAEVVWXVFNC-UHFFFAOYSA-N 0.000 claims description 3
- UIGSDAQHACDNFY-UHFFFAOYSA-N n-[4-(cyclohexylcarbamothioylamino)-2-methoxyanilino]formamide Chemical compound C1=C(NNC=O)C(OC)=CC(NC(=S)NC2CCCCC2)=C1 UIGSDAQHACDNFY-UHFFFAOYSA-N 0.000 claims description 3
- NAOBJCZMSURSHI-UHFFFAOYSA-N n-[4-[[4-(2-formylhydrazinyl)phenyl]carbamothioylamino]anilino]formamide Chemical compound C1=CC(NNC=O)=CC=C1NC(=S)NC1=CC=C(NNC=O)C=C1 NAOBJCZMSURSHI-UHFFFAOYSA-N 0.000 claims description 3
- NVIFVTYDZMXWGX-UHFFFAOYSA-N sodium metaborate Chemical compound [Na+].[O-]B=O NVIFVTYDZMXWGX-UHFFFAOYSA-N 0.000 claims description 3
- UMNQNFHDJBOOLA-UHFFFAOYSA-N 1-benzyl-3-[4-[2-(4-fluorobenzoyl)hydrazinyl]phenyl]thiourea Chemical compound C1=CC(F)=CC=C1C(=O)NNC(C=C1)=CC=C1NC(=S)NCC1=CC=CC=C1 UMNQNFHDJBOOLA-UHFFFAOYSA-N 0.000 claims description 2
- WDKHWSZIPKOLPN-UHFFFAOYSA-N n-[2-methoxy-4-(phenylcarbamothioylamino)anilino]formamide Chemical compound C1=C(NNC=O)C(OC)=CC(NC(=S)NC=2C=CC=CC=2)=C1 WDKHWSZIPKOLPN-UHFFFAOYSA-N 0.000 claims description 2
- QTPVXNYHTYRHGU-UHFFFAOYSA-N n-[4-(methylcarbamothioylamino)anilino]formamide Chemical compound CNC(=S)NC1=CC=C(NNC=O)C=C1 QTPVXNYHTYRHGU-UHFFFAOYSA-N 0.000 claims description 2
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims description 2
- 229940009188 silver Drugs 0.000 claims 36
- 125000005037 alkyl phenyl group Chemical group 0.000 claims 6
- 125000005059 halophenyl group Chemical group 0.000 claims 6
- 125000005036 alkoxyphenyl group Chemical group 0.000 claims 3
- 125000004802 cyanophenyl group Chemical group 0.000 claims 3
- ZVNPWFOVUDMGRP-UHFFFAOYSA-N 4-methylaminophenol sulfate Chemical compound OS(O)(=O)=O.CNC1=CC=C(O)C=C1.CNC1=CC=C(O)C=C1 ZVNPWFOVUDMGRP-UHFFFAOYSA-N 0.000 claims 2
- WIXYCUALYZJESU-UHFFFAOYSA-N 1,3-bis[4-(2-benzoylhydrazinyl)phenyl]thiourea Chemical compound C=1C=CC=CC=1C(=O)NNC(C=C1)=CC=C1NC(=S)NC(C=C1)=CC=C1NNC(=O)C1=CC=CC=C1 WIXYCUALYZJESU-UHFFFAOYSA-N 0.000 claims 1
- ZOEOWBZCQRNZNT-UHFFFAOYSA-N 1-[4-(2-acetylhydrazinyl)phenyl]-1-benzyl-3-phenylthiourea Chemical compound C1=CC(NNC(=O)C)=CC=C1N(C(=S)NC=1C=CC=CC=1)CC1=CC=CC=C1 ZOEOWBZCQRNZNT-UHFFFAOYSA-N 0.000 claims 1
- NUNFHJPMRVAPQJ-UHFFFAOYSA-N 1-[4-(2-benzoylhydrazinyl)phenyl]-3-phenylthiourea Chemical compound C=1C=CC=CC=1C(=O)NNC(C=C1)=CC=C1NC(=S)NC1=CC=CC=C1 NUNFHJPMRVAPQJ-UHFFFAOYSA-N 0.000 claims 1
- IOYDVNDAWNUYEK-UHFFFAOYSA-N 1-[4-[2-(4-chlorobenzoyl)hydrazinyl]phenyl]-3-phenylthiourea Chemical compound C1=CC(Cl)=CC=C1C(=O)NNC(C=C1)=CC=C1NC(=S)NC1=CC=CC=C1 IOYDVNDAWNUYEK-UHFFFAOYSA-N 0.000 claims 1
- VHVIASLVUSFKCX-UHFFFAOYSA-N 1-[4-[2-(4-fluorobenzoyl)hydrazinyl]phenyl]-3-phenylthiourea Chemical compound C1=CC(F)=CC=C1C(=O)NNC(C=C1)=CC=C1NC(=S)NC1=CC=CC=C1 VHVIASLVUSFKCX-UHFFFAOYSA-N 0.000 claims 1
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 claims 1
- 125000001475 halogen functional group Chemical group 0.000 claims 1
- UYZLIFAWVUUBNG-UHFFFAOYSA-N n-[2-methoxy-4-[(4-methoxyphenyl)carbamothioylamino]anilino]formamide Chemical compound C1=CC(OC)=CC=C1NC(=S)NC1=CC=C(NNC=O)C(OC)=C1 UYZLIFAWVUUBNG-UHFFFAOYSA-N 0.000 claims 1
- JBVLYWIJMOCYHU-UHFFFAOYSA-N n-[4-(butylcarbamothioylamino)anilino]formamide Chemical compound CCCCNC(=S)NC1=CC=C(NNC=O)C=C1 JBVLYWIJMOCYHU-UHFFFAOYSA-N 0.000 claims 1
- DCQIVCBMUJBAGB-UHFFFAOYSA-N n-[4-(cyclohexylcarbamothioylamino)anilino]formamide Chemical compound C1=CC(NNC=O)=CC=C1NC(=S)NC1CCCCC1 DCQIVCBMUJBAGB-UHFFFAOYSA-N 0.000 claims 1
- 125000005650 substituted phenylene group Chemical group 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 87
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Substances NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 82
- 239000010410 layer Substances 0.000 description 71
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical group NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 33
- 239000000047 product Substances 0.000 description 32
- 239000000975 dye Substances 0.000 description 29
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 27
- 108010010803 Gelatin Proteins 0.000 description 27
- 229920000159 gelatin Polymers 0.000 description 27
- 239000008273 gelatin Substances 0.000 description 27
- 235000019322 gelatine Nutrition 0.000 description 27
- 235000011852 gelatine desserts Nutrition 0.000 description 27
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- 239000011541 reaction mixture Substances 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 20
- 239000007787 solid Substances 0.000 description 20
- QKFJKGMPGYROCL-UHFFFAOYSA-N phenyl isothiocyanate Chemical compound S=C=NC1=CC=CC=C1 QKFJKGMPGYROCL-UHFFFAOYSA-N 0.000 description 18
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 16
- 239000000243 solution Substances 0.000 description 16
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- 239000002253 acid Substances 0.000 description 11
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 11
- 239000000126 substance Substances 0.000 description 11
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 10
- 238000011161 development Methods 0.000 description 10
- 125000000623 heterocyclic group Chemical group 0.000 description 10
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 9
- 230000018109 developmental process Effects 0.000 description 9
- 229940117953 phenylisothiocyanate Drugs 0.000 description 9
- 239000000843 powder Substances 0.000 description 9
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 8
- 150000002429 hydrazines Chemical class 0.000 description 8
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 229910052799 carbon Inorganic materials 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- LGDSHSYDSCRFAB-UHFFFAOYSA-N Methyl isothiocyanate Chemical compound CN=C=S LGDSHSYDSCRFAB-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 6
- 125000003118 aryl group Chemical group 0.000 description 6
- MDKCFLQDBWCQCV-UHFFFAOYSA-N benzyl isothiocyanate Chemical compound S=C=NCC1=CC=CC=C1 MDKCFLQDBWCQCV-UHFFFAOYSA-N 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 6
- 125000001495 ethyl group Chemical class [H]C([H])([H])C([H])([H])* 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 6
- 150000003254 radicals Chemical class 0.000 description 6
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 6
- 230000003595 spectral effect Effects 0.000 description 6
- KMVPXBDOWDXXEN-UHFFFAOYSA-N 4-nitrophenylhydrazine Chemical compound NNC1=CC=C([N+]([O-])=O)C=C1 KMVPXBDOWDXXEN-UHFFFAOYSA-N 0.000 description 5
- 239000005711 Benzoic acid Substances 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- FULZLIGZKMKICU-UHFFFAOYSA-N N-phenylthiourea Chemical compound NC(=S)NC1=CC=CC=C1 FULZLIGZKMKICU-UHFFFAOYSA-N 0.000 description 5
- 206010070834 Sensitisation Diseases 0.000 description 5
- 125000002252 acyl group Chemical group 0.000 description 5
- 125000004429 atom Chemical group 0.000 description 5
- 235000010233 benzoic acid Nutrition 0.000 description 5
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 125000004093 cyano group Chemical group *C#N 0.000 description 5
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 5
- JIJNOXGGMCEUMF-UHFFFAOYSA-N n-(4-aminoanilino)formamide Chemical compound NC1=CC=C(NNC=O)C=C1 JIJNOXGGMCEUMF-UHFFFAOYSA-N 0.000 description 5
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 125000001436 propyl group Chemical class [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 238000006748 scratching Methods 0.000 description 5
- 230000002393 scratching effect Effects 0.000 description 5
- 230000008313 sensitization Effects 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 4
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- 238000013459 approach Methods 0.000 description 4
- LIMQQADUEULBSO-UHFFFAOYSA-N butyl isothiocyanate Chemical compound CCCCN=C=S LIMQQADUEULBSO-UHFFFAOYSA-N 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- 229940000425 combination drug Drugs 0.000 description 4
- 230000000875 corresponding effect Effects 0.000 description 4
- 238000000326 densiometry Methods 0.000 description 4
- 238000009826 distribution Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 235000019253 formic acid Nutrition 0.000 description 4
- 150000002540 isothiocyanates Chemical class 0.000 description 4
- 239000005020 polyethylene terephthalate Substances 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 4
- 229910052721 tungsten Inorganic materials 0.000 description 4
- 239000010937 tungsten Substances 0.000 description 4
- DTGKSKDOIYIVQL-WEDXCCLWSA-N (+)-borneol Chemical group C1C[C@@]2(C)[C@@H](O)C[C@@H]1C2(C)C DTGKSKDOIYIVQL-WEDXCCLWSA-N 0.000 description 3
- DDGHBOLOCQWPKE-UHFFFAOYSA-N 1,3-thiazole;hydrobromide Chemical compound [Br-].C1=CSC=[NH+]1 DDGHBOLOCQWPKE-UHFFFAOYSA-N 0.000 description 3
- LRUDIIUSNGCQKF-UHFFFAOYSA-N 5-methyl-1H-benzotriazole Chemical compound C1=C(C)C=CC2=NNN=C21 LRUDIIUSNGCQKF-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- QAADZYUXQLUXFX-UHFFFAOYSA-N N-phenylmethylthioformamide Natural products S=CNCC1=CC=CC=C1 QAADZYUXQLUXFX-UHFFFAOYSA-N 0.000 description 3
- 241000282320 Panthera leo Species 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- BGNXCDMCOKJUMV-UHFFFAOYSA-N Tert-Butylhydroquinone Chemical compound CC(C)(C)C1=CC(O)=CC=C1O BGNXCDMCOKJUMV-UHFFFAOYSA-N 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- 235000019445 benzyl alcohol Nutrition 0.000 description 3
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 3
- 125000004122 cyclic group Chemical group 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000011229 interlayer Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910021645 metal ion Inorganic materials 0.000 description 3
- 125000002496 methyl group Chemical class [H]C([H])([H])* 0.000 description 3
- 230000003472 neutralizing effect Effects 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- 229920000139 polyethylene terephthalate Polymers 0.000 description 3
- 239000011343 solid material Substances 0.000 description 3
- 239000004408 titanium dioxide Substances 0.000 description 3
- JFILLLZWNHOVHV-UHFFFAOYSA-N (3-nitrophenyl)hydrazine Chemical compound NNC1=CC=CC([N+]([O-])=O)=C1 JFILLLZWNHOVHV-UHFFFAOYSA-N 0.000 description 2
- SRYLJBWDZZMDSK-UHFFFAOYSA-N (4-methoxyphenyl)thiourea Chemical compound COC1=CC=C(NC(N)=S)C=C1 SRYLJBWDZZMDSK-UHFFFAOYSA-N 0.000 description 2
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- NXCBDDGSOXJEFZ-UHFFFAOYSA-N 1-benzyl-3-phenylthiourea Chemical compound C=1C=CC=CC=1NC(=S)NCC1=CC=CC=C1 NXCBDDGSOXJEFZ-UHFFFAOYSA-N 0.000 description 2
- NOGFHTGYPKWWRX-UHFFFAOYSA-N 2,2,6,6-tetramethyloxan-4-one Chemical compound CC1(C)CC(=O)CC(C)(C)O1 NOGFHTGYPKWWRX-UHFFFAOYSA-N 0.000 description 2
- PAPNRQCYSFBWDI-UHFFFAOYSA-N 2,5-Dimethyl-1H-pyrrole Chemical compound CC1=CC=C(C)N1 PAPNRQCYSFBWDI-UHFFFAOYSA-N 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 2
- 229940126062 Compound A Drugs 0.000 description 2
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 2
- 239000004280 Sodium formate Substances 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 150000005840 aryl radicals Chemical class 0.000 description 2
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 2
- 150000001565 benzotriazoles Chemical class 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 229910052797 bismuth Inorganic materials 0.000 description 2
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 229920002301 cellulose acetate Polymers 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000002704 decyl group Chemical class [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 229910001873 dinitrogen Inorganic materials 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- ILRSCQWREDREME-UHFFFAOYSA-N dodecanamide Chemical compound CCCCCCCCCCCC(N)=O ILRSCQWREDREME-UHFFFAOYSA-N 0.000 description 2
- HBNYJWAFDZLWRS-UHFFFAOYSA-N ethyl isothiocyanate Chemical compound CCN=C=S HBNYJWAFDZLWRS-UHFFFAOYSA-N 0.000 description 2
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 2
- HYBBIBNJHNGZAN-UHFFFAOYSA-N furfural Chemical compound O=CC1=CC=CO1 HYBBIBNJHNGZAN-UHFFFAOYSA-N 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 229910052741 iridium Inorganic materials 0.000 description 2
- MZSJGCPBOVTKHR-UHFFFAOYSA-N isothiocyanatocyclohexane Chemical compound S=C=NC1CCCCC1 MZSJGCPBOVTKHR-UHFFFAOYSA-N 0.000 description 2
- 239000004816 latex Substances 0.000 description 2
- 229920000126 latex Polymers 0.000 description 2
- DZVCFNFOPIZQKX-LTHRDKTGSA-M merocyanine Chemical compound [Na+].O=C1N(CCCC)C(=O)N(CCCC)C(=O)C1=C\C=C\C=C/1N(CCCS([O-])(=O)=O)C2=CC=CC=C2O\1 DZVCFNFOPIZQKX-LTHRDKTGSA-M 0.000 description 2
- 150000002734 metacrylic acid derivatives Chemical class 0.000 description 2
- QFGIHQPJCJXNBB-UHFFFAOYSA-N n'-(4-aminophenyl)-4-chlorobenzohydrazide;hydrochloride Chemical compound Cl.C1=CC(N)=CC=C1NNC(=O)C1=CC=C(Cl)C=C1 QFGIHQPJCJXNBB-UHFFFAOYSA-N 0.000 description 2
- IFJLICOFCUJLTJ-UHFFFAOYSA-N n-(4-amino-2-methoxyanilino)formamide Chemical compound COC1=CC(N)=CC=C1NNC=O IFJLICOFCUJLTJ-UHFFFAOYSA-N 0.000 description 2
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- CFHIDWOYWUOIHU-UHFFFAOYSA-N oxomethyl Chemical compound O=[CH] CFHIDWOYWUOIHU-UHFFFAOYSA-N 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- CMCWWLVWPDLCRM-UHFFFAOYSA-N phenidone Chemical compound N1C(=O)CCN1C1=CC=CC=C1 CMCWWLVWPDLCRM-UHFFFAOYSA-N 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- 229920000768 polyamine Polymers 0.000 description 2
- 235000020004 porter Nutrition 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 108090000623 proteins and genes Proteins 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 229910052707 ruthenium Inorganic materials 0.000 description 2
- 229910052711 selenium Inorganic materials 0.000 description 2
- 239000011669 selenium Substances 0.000 description 2
- 230000001235 sensitizing effect Effects 0.000 description 2
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 2
- 235000019254 sodium formate Nutrition 0.000 description 2
- PFNFFQXMRSDOHW-UHFFFAOYSA-N spermine Chemical compound NCCCNCCCCNCCCN PFNFFQXMRSDOHW-UHFFFAOYSA-N 0.000 description 2
- 125000003107 substituted aryl group Chemical group 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- ANRHNWWPFJCPAZ-UHFFFAOYSA-M thionine Chemical compound [Cl-].C1=CC(N)=CC2=[S+]C3=CC(N)=CC=C3N=C21 ANRHNWWPFJCPAZ-UHFFFAOYSA-M 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- 239000001043 yellow dye Substances 0.000 description 2
- FRBUNLLUASHNDJ-UHFFFAOYSA-N (2-nitrophenyl)hydrazine Chemical compound NNC1=CC=CC=C1[N+]([O-])=O FRBUNLLUASHNDJ-UHFFFAOYSA-N 0.000 description 1
- SWGZHHCRMZDRSN-BTJKTKAUSA-N (Z)-but-2-enedioic acid 1-phenoxypropan-2-ylhydrazine Chemical compound OC(=O)\C=C/C(O)=O.NNC(C)COC1=CC=CC=C1 SWGZHHCRMZDRSN-BTJKTKAUSA-N 0.000 description 1
- PSBDWGZCVUAZQS-UHFFFAOYSA-N (dimethylsulfonio)acetate Chemical group C[S+](C)CC([O-])=O PSBDWGZCVUAZQS-UHFFFAOYSA-N 0.000 description 1
- 150000005206 1,2-dihydroxybenzenes Chemical class 0.000 description 1
- HQWALKUMPUZAIR-UHFFFAOYSA-N 1,3-benzoselenazol-3-ium;bromide Chemical compound [Br-].C1=CC=C2[se]C=[NH+]C2=C1 HQWALKUMPUZAIR-UHFFFAOYSA-N 0.000 description 1
- WUIJCMJIYQWIMF-UHFFFAOYSA-N 1,3-benzothiazole;hydroiodide Chemical compound [I-].C1=CC=C2SC=[NH+]C2=C1 WUIJCMJIYQWIMF-UHFFFAOYSA-N 0.000 description 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical class C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- 150000000183 1,3-benzoxazoles Chemical class 0.000 description 1
- SLEWHFNVJNASHI-UHFFFAOYSA-N 1,3-bis[4-(2-hexanoylhydrazinyl)phenyl]thiourea Chemical compound C1=CC(NNC(=O)CCCCC)=CC=C1NC(=S)NC1=CC=C(NNC(=O)CCCCC)C=C1 SLEWHFNVJNASHI-UHFFFAOYSA-N 0.000 description 1
- QTFLUVRZOBQTBW-UHFFFAOYSA-N 1,3-thiazol-3-ium;iodide Chemical compound [I-].C1=CSC=[NH+]1 QTFLUVRZOBQTBW-UHFFFAOYSA-N 0.000 description 1
- NFESZXDZXNPBEB-UHFFFAOYSA-N 1-[4-[2-(4-cyanobenzoyl)hydrazinyl]phenyl]-3-phenylthiourea Chemical compound C=1C=C(C#N)C=CC=1C(=O)NNC(C=C1)=CC=C1NC(=S)NC1=CC=CC=C1 NFESZXDZXNPBEB-UHFFFAOYSA-N 0.000 description 1
- MNCMBBIFTVWHIP-UHFFFAOYSA-N 1-anthracen-9-yl-2,2,2-trifluoroethanone Chemical group C1=CC=C2C(C(=O)C(F)(F)F)=C(C=CC=C3)C3=CC2=C1 MNCMBBIFTVWHIP-UHFFFAOYSA-N 0.000 description 1
- QKAOOWJWWKWWOZ-UHFFFAOYSA-N 1-isothiocyanato-2-methoxybenzene Chemical compound COC1=CC=CC=C1N=C=S QKAOOWJWWKWWOZ-UHFFFAOYSA-N 0.000 description 1
- VRPQCVLBOZOYCG-UHFFFAOYSA-N 1-isothiocyanato-4-methoxybenzene Chemical compound COC1=CC=C(N=C=S)C=C1 VRPQCVLBOZOYCG-UHFFFAOYSA-N 0.000 description 1
- LIPUQNPCPLDDBO-UHFFFAOYSA-N 1-isothiocyanatoheptane Chemical compound CCCCCCCN=C=S LIPUQNPCPLDDBO-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- MFMFFPZXWWECFM-UHFFFAOYSA-N 2,2,2-trifluoro-n'-(4-nitrophenyl)acetohydrazide Chemical compound [O-][N+](=O)C1=CC=C(NNC(=O)C(F)(F)F)C=C1 MFMFFPZXWWECFM-UHFFFAOYSA-N 0.000 description 1
- NWUNKFTVLXWQQC-UHFFFAOYSA-N 2,5-di(dodecan-2-yl)benzene-1,4-diol Chemical compound CCCCCCCCCCC(C)C1=CC(O)=C(C(C)CCCCCCCCCC)C=C1O NWUNKFTVLXWQQC-UHFFFAOYSA-N 0.000 description 1
- SVTFGFLBXLUFME-UHFFFAOYSA-N 2,5-dihydroxy-4-octadecan-2-ylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCCCCCC(C)C1=CC(O)=C(S(O)(=O)=O)C=C1O SVTFGFLBXLUFME-UHFFFAOYSA-N 0.000 description 1
- GQECANUIPBFPLA-UHFFFAOYSA-N 2-(carboxymethylsulfanylcarbothioylsulfanyl)acetic acid Chemical compound OC(=O)CSC(=S)SCC(O)=O GQECANUIPBFPLA-UHFFFAOYSA-N 0.000 description 1
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical class NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 1
- LOJPTDKUUGQNMC-UHFFFAOYSA-N 2-decyl-3,6-dihydroxybenzenesulfonic acid Chemical compound CCCCCCCCCCC1=C(O)C=CC(O)=C1S(O)(=O)=O LOJPTDKUUGQNMC-UHFFFAOYSA-N 0.000 description 1
- QEKQBVQYETUTOA-UHFFFAOYSA-N 2-dithiocarboxysulfanylacetic acid Chemical compound OC(=O)CSC(S)=S QEKQBVQYETUTOA-UHFFFAOYSA-N 0.000 description 1
- YPIFLXOVPCARGI-UHFFFAOYSA-N 2-ethyl-1,3-benzoxazole Chemical compound C1=CC=C2OC(CC)=NC2=C1 YPIFLXOVPCARGI-UHFFFAOYSA-N 0.000 description 1
- GVBHRNIWBGTNQA-UHFFFAOYSA-N 2-methoxy-4-nitroaniline Chemical compound COC1=CC([N+]([O-])=O)=CC=C1N GVBHRNIWBGTNQA-UHFFFAOYSA-N 0.000 description 1
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 1
- NJXWZWXCHBNOOG-UHFFFAOYSA-N 3,3-diphenylpropyl(1-phenylethyl)azanium;chloride Chemical compound [Cl-].C=1C=CC=CC=1C(C)[NH2+]CCC(C=1C=CC=CC=1)C1=CC=CC=C1 NJXWZWXCHBNOOG-UHFFFAOYSA-N 0.000 description 1
- LCQCMPQEIPZFCY-UHFFFAOYSA-N 3-(2-methylbenzo[f][1,3]benzothiazol-3-ium-3-yl)propanal Chemical class C1=CC=C2C=C([N+](=C(C)S3)CCC=O)C3=CC2=C1 LCQCMPQEIPZFCY-UHFFFAOYSA-N 0.000 description 1
- ZQKQRMGZTRBCOY-UHFFFAOYSA-M 3-(4-methylquinolin-1-ium-1-yl)propanal bromide Chemical compound [Br-].C1=CC=C2C(C)=CC=[N+](CCC=O)C2=C1 ZQKQRMGZTRBCOY-UHFFFAOYSA-M 0.000 description 1
- CFGRXZNIEFYVDO-UHFFFAOYSA-N 3-[[4-(2-benzylidenehydrazinyl)phenyl]carbamoyl]benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC(C(=O)NC=2C=CC(NN=CC=3C=CC=CC=3)=CC=2)=C1 CFGRXZNIEFYVDO-UHFFFAOYSA-N 0.000 description 1
- HJMYCWIIUWJGGN-UHFFFAOYSA-N 3-octadecoxybenzaldehyde Chemical compound CCCCCCCCCCCCCCCCCCOC1=CC=CC(C=O)=C1 HJMYCWIIUWJGGN-UHFFFAOYSA-N 0.000 description 1
- DSVIHYOAKPVFEH-UHFFFAOYSA-N 4-(hydroxymethyl)-4-methyl-1-phenylpyrazolidin-3-one Chemical compound N1C(=O)C(C)(CO)CN1C1=CC=CC=C1 DSVIHYOAKPVFEH-UHFFFAOYSA-N 0.000 description 1
- VTUSZVXQUXFZGC-UHFFFAOYSA-N 4-chloro-n'-(4-nitrophenyl)benzohydrazide Chemical compound C1=CC([N+](=O)[O-])=CC=C1NNC(=O)C1=CC=C(Cl)C=C1 VTUSZVXQUXFZGC-UHFFFAOYSA-N 0.000 description 1
- USEDMAWWQDFMFY-UHFFFAOYSA-N 4-cyanobenzoyl chloride Chemical group ClC(=O)C1=CC=C(C#N)C=C1 USEDMAWWQDFMFY-UHFFFAOYSA-N 0.000 description 1
- CZKLEJHVLCMVQR-UHFFFAOYSA-N 4-fluorobenzoyl chloride Chemical group FC1=CC=C(C(Cl)=O)C=C1 CZKLEJHVLCMVQR-UHFFFAOYSA-N 0.000 description 1
- DZFKAXLNKZXNHD-UHFFFAOYSA-N 4-isothiocyanatobenzonitrile Chemical compound S=C=NC1=CC=C(C#N)C=C1 DZFKAXLNKZXNHD-UHFFFAOYSA-N 0.000 description 1
- ZRSNZINYAWTAHE-PTQBSOBMSA-N 4-methoxybenzaldehyde Chemical group COC1=CC=C([13CH]=O)C=C1 ZRSNZINYAWTAHE-PTQBSOBMSA-N 0.000 description 1
- VVDKLNALHXDTGK-UHFFFAOYSA-N 4-methyl-n-(propan-2-ylideneamino)aniline Chemical compound CC(C)=NNC1=CC=C(C)C=C1 VVDKLNALHXDTGK-UHFFFAOYSA-N 0.000 description 1
- NQUVCRCCRXRJCK-UHFFFAOYSA-N 4-methylbenzoyl chloride Chemical group CC1=CC=C(C(Cl)=O)C=C1 NQUVCRCCRXRJCK-UHFFFAOYSA-N 0.000 description 1
- LLLVZDVNHNWSDS-UHFFFAOYSA-N 4-methylidene-3,5-dioxabicyclo[5.2.2]undeca-1(9),7,10-triene-2,6-dione Chemical compound C1(C2=CC=C(C(=O)OC(=C)O1)C=C2)=O LLLVZDVNHNWSDS-UHFFFAOYSA-N 0.000 description 1
- BSFJRSQEDHTPKQ-UHFFFAOYSA-N 5-[[3-(anilinocarbamoyl)-4-[2,4-bis(2-methylbutan-2-yl)phenoxy]phenyl]carbamoyl]benzene-1,3-disulfonic acid Chemical compound CCC(C)(C)C1=CC(C(C)(C)CC)=CC=C1OC(C(=C1)C(=O)NNC=2C=CC=CC=2)=CC=C1NC(=O)C1=CC(S(O)(=O)=O)=CC(S(O)(=O)=O)=C1 BSFJRSQEDHTPKQ-UHFFFAOYSA-N 0.000 description 1
- ZWTWLIOPZJFEOO-UHFFFAOYSA-N 5-ethyl-2h-benzotriazole Chemical compound C1=C(CC)C=CC2=NNN=C21 ZWTWLIOPZJFEOO-UHFFFAOYSA-N 0.000 description 1
- SEBIXVUYSFOUEL-UHFFFAOYSA-N 5-methyl-1,3-benzothiazole Chemical compound CC1=CC=C2SC=NC2=C1 SEBIXVUYSFOUEL-UHFFFAOYSA-N 0.000 description 1
- AEUQLELVLDMMKB-UHFFFAOYSA-N 5-nitro-1,3-benzothiazole Chemical compound [O-][N+](=O)C1=CC=C2SC=NC2=C1 AEUQLELVLDMMKB-UHFFFAOYSA-N 0.000 description 1
- MARUHZGHZWCEQU-UHFFFAOYSA-N 5-phenyl-2h-tetrazole Chemical compound C1=CC=CC=C1C1=NNN=N1 MARUHZGHZWCEQU-UHFFFAOYSA-N 0.000 description 1
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Natural products CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- ZRSNZINYAWTAHE-UHFFFAOYSA-N Anisaldehyde Natural products COC1=CC=C(C=O)C=C1 ZRSNZINYAWTAHE-UHFFFAOYSA-N 0.000 description 1
- NXBSYVFBNUJQTH-UHFFFAOYSA-N C1=CC(NC(=O)C)=CC=C1NN=CC1=CC=NC2=CC=CC=C12 Chemical compound C1=CC(NC(=O)C)=CC=C1NN=CC1=CC=NC2=CC=CC=C12 NXBSYVFBNUJQTH-UHFFFAOYSA-N 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- 241001663154 Electron Species 0.000 description 1
- 241000483002 Euproctis similis Species 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- CWNSVVHTTQBGQB-UHFFFAOYSA-N N,N-Diethyldodecanamide Chemical compound CCCCCCCCCCCC(=O)N(CC)CC CWNSVVHTTQBGQB-UHFFFAOYSA-N 0.000 description 1
- KQJQICVXLJTWQD-UHFFFAOYSA-N N-Methylthiourea Chemical compound CNC(N)=S KQJQICVXLJTWQD-UHFFFAOYSA-N 0.000 description 1
- NWKLLPVOXFYXCK-UHFFFAOYSA-N N-[4-[(naphthalen-1-ylamino)sulfamoyl]phenyl]acetamide Chemical compound C1=CC(NC(=O)C)=CC=C1S(=O)(=O)NNC1=CC=CC2=CC=CC=C12 NWKLLPVOXFYXCK-UHFFFAOYSA-N 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 150000004753 Schiff bases Chemical group 0.000 description 1
- 241000978776 Senegalia senegal Species 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 229920000147 Styrene maleic anhydride Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 241001061127 Thione Species 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- SJOOOZPMQAWAOP-UHFFFAOYSA-N [Ag].BrCl Chemical compound [Ag].BrCl SJOOOZPMQAWAOP-UHFFFAOYSA-N 0.000 description 1
- YYDZNUMDZXMMCI-ZEMYHKRKSA-N ac1l315s Chemical compound C12=C3N4C5=CC=CC=C5C3=C3C(=O)NC(=O)C3=C2C2=CC=CC=C2N1[C@@H]1C[C@@H](N(C)C(=O)OCC)[C@H](OC)[C@]4(C)O1 YYDZNUMDZXMMCI-ZEMYHKRKSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- TUCNEACPLKLKNU-UHFFFAOYSA-N acetyl Chemical compound C[C]=O TUCNEACPLKLKNU-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000032683 aging Effects 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 125000005250 alkyl acrylate group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000005422 alkyl sulfonamido group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 125000005421 aryl sulfonamido group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000003851 azoles Chemical class 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- 150000001556 benzimidazoles Chemical class 0.000 description 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 description 1
- 239000012964 benzotriazole Substances 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- ANPXZSRATHKOGI-UHFFFAOYSA-N benzyl-ethenyl-dimethylazanium Chemical compound C=C[N+](C)(C)CC1=CC=CC=C1 ANPXZSRATHKOGI-UHFFFAOYSA-N 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000000484 butyl group Chemical class [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 229910052729 chemical element Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical group 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 230000000593 degrading effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- OBZWKGSOIDQJGH-UHFFFAOYSA-N ethyl 2-oxo-2-(2-phenylhydrazinyl)acetate Chemical compound CCOC(=O)C(=O)NNC1=CC=CC=C1 OBZWKGSOIDQJGH-UHFFFAOYSA-N 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000003187 heptyl group Chemical class [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- YWGHUJQYGPDNKT-UHFFFAOYSA-N hexanoyl chloride Chemical compound CCCCCC(Cl)=O YWGHUJQYGPDNKT-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical class [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002431 hydrogen Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000003475 lamination Methods 0.000 description 1
- 229940116335 lauramide Drugs 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- MMXJEFATGGKADQ-UHFFFAOYSA-N n'-(4-aminophenyl)-2,2,2-trifluoroacetohydrazide Chemical compound NC1=CC=C(NNC(=O)C(F)(F)F)C=C1 MMXJEFATGGKADQ-UHFFFAOYSA-N 0.000 description 1
- YXJBPJUOONLSAU-UHFFFAOYSA-N n'-(4-aminophenyl)-4-fluorobenzohydrazide;hydrochloride Chemical compound Cl.C1=CC(N)=CC=C1NNC(=O)C1=CC=C(F)C=C1 YXJBPJUOONLSAU-UHFFFAOYSA-N 0.000 description 1
- VXKCLASILCBCAW-UHFFFAOYSA-N n'-(4-hydroxyphenyl)acetohydrazide Chemical compound CC(=O)NNC1=CC=C(O)C=C1 VXKCLASILCBCAW-UHFFFAOYSA-N 0.000 description 1
- CXXPSOUBODTKJI-UHFFFAOYSA-N n'-(4-methylphenyl)acetohydrazide Chemical compound CC(=O)NNC1=CC=C(C)C=C1 CXXPSOUBODTKJI-UHFFFAOYSA-N 0.000 description 1
- IIMWRTQIZFXIPJ-UHFFFAOYSA-N n'-[4-(benzylamino)phenyl]acetohydrazide Chemical compound C1=CC(NNC(=O)C)=CC=C1NCC1=CC=CC=C1 IIMWRTQIZFXIPJ-UHFFFAOYSA-N 0.000 description 1
- MCTOAIGYOCDURQ-UHFFFAOYSA-N n'-[4-(benzylideneamino)phenyl]acetohydrazide Chemical compound C1=CC(NNC(=O)C)=CC=C1N=CC1=CC=CC=C1 MCTOAIGYOCDURQ-UHFFFAOYSA-N 0.000 description 1
- JXXUCNZIMVWATB-UHFFFAOYSA-N n'-[4-[(4-methoxyphenyl)methylamino]phenyl]acetohydrazide Chemical compound C1=CC(OC)=CC=C1CNC1=CC=C(NNC(C)=O)C=C1 JXXUCNZIMVWATB-UHFFFAOYSA-N 0.000 description 1
- CKLPECFHCLIYKN-UHFFFAOYSA-N n'-phenylbenzohydrazide Chemical compound C=1C=CC=CC=1C(=O)NNC1=CC=CC=C1 CKLPECFHCLIYKN-UHFFFAOYSA-N 0.000 description 1
- ZQMMTPDFUOCITG-UHFFFAOYSA-N n'-phenyldodecanehydrazide Chemical compound CCCCCCCCCCCC(=O)NNC1=CC=CC=C1 ZQMMTPDFUOCITG-UHFFFAOYSA-N 0.000 description 1
- UQPFSVMPYHXOFG-UHFFFAOYSA-N n'-phenylmethanesulfonohydrazide Chemical compound CS(=O)(=O)NNC1=CC=CC=C1 UQPFSVMPYHXOFG-UHFFFAOYSA-N 0.000 description 1
- UXXLVQZHONBLGE-UHFFFAOYSA-N n-(2-methoxy-4-nitroanilino)formamide Chemical compound COC1=CC([N+]([O-])=O)=CC=C1NNC=O UXXLVQZHONBLGE-UHFFFAOYSA-N 0.000 description 1
- ILWSAUNMQFNDPO-UHFFFAOYSA-N n-(benzylideneamino)-4-methoxyaniline Chemical compound C1=CC(OC)=CC=C1NN=CC1=CC=CC=C1 ILWSAUNMQFNDPO-UHFFFAOYSA-N 0.000 description 1
- LAEIUWMKHPUVSB-UHFFFAOYSA-N n-[(3-octadecoxyphenyl)methylideneamino]aniline Chemical compound CCCCCCCCCCCCCCCCCCOC1=CC=CC(C=NNC=2C=CC=CC=2)=C1 LAEIUWMKHPUVSB-UHFFFAOYSA-N 0.000 description 1
- VHFXSORUCJHJCO-UHFFFAOYSA-N n-[2-(phenylcarbamothioylamino)anilino]formamide Chemical compound O=CNNC1=CC=CC=C1NC(=S)NC1=CC=CC=C1 VHFXSORUCJHJCO-UHFFFAOYSA-N 0.000 description 1
- IHKFLZDHIAMCFS-UHFFFAOYSA-N n-[3-(2-methylsulfonylhydrazinyl)phenyl]benzenesulfonamide Chemical compound CS(=O)(=O)NNC1=CC=CC(NS(=O)(=O)C=2C=CC=CC=2)=C1 IHKFLZDHIAMCFS-UHFFFAOYSA-N 0.000 description 1
- PERVWWHIABPWTB-UHFFFAOYSA-N n-[3-(phenylcarbamothioylamino)anilino]formamide Chemical compound O=CNNC1=CC=CC(NC(=S)NC=2C=CC=CC=2)=C1 PERVWWHIABPWTB-UHFFFAOYSA-N 0.000 description 1
- PJOHYBFGXHXFGV-UHFFFAOYSA-N n-[4-(2-acetylhydrazinyl)phenyl]acetamide Chemical compound CC(=O)NNC1=CC=C(NC(C)=O)C=C1 PJOHYBFGXHXFGV-UHFFFAOYSA-N 0.000 description 1
- ZMMPXXIGFAXHLJ-UHFFFAOYSA-N n-[4-(2-acetylhydrazinyl)phenyl]benzamide Chemical compound C1=CC(NNC(=O)C)=CC=C1NC(=O)C1=CC=CC=C1 ZMMPXXIGFAXHLJ-UHFFFAOYSA-N 0.000 description 1
- KMRSEYAKZSCBJD-UHFFFAOYSA-N n-[4-(2-benzoylhydrazinyl)phenyl]benzamide Chemical compound C=1C=CC=CC=1C(=O)NNC(C=C1)=CC=C1NC(=O)C1=CC=CC=C1 KMRSEYAKZSCBJD-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 229910000510 noble metal Inorganic materials 0.000 description 1
- 125000001400 nonyl group Chemical class [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical class [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 125000001147 pentyl group Chemical class C(CCCC)* 0.000 description 1
- 239000007793 ph indicator Substances 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 150000004986 phenylenediamines Chemical class 0.000 description 1
- LEVJVKGPFAQPOI-UHFFFAOYSA-N phenylmethanone Chemical compound O=[C]C1=CC=CC=C1 LEVJVKGPFAQPOI-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 239000004848 polyfunctional curative Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- LVTJOONKWUXEFR-FZRMHRINSA-N protoneodioscin Natural products O(C[C@@H](CC[C@]1(O)[C@H](C)[C@@H]2[C@]3(C)[C@H]([C@H]4[C@@H]([C@]5(C)C(=CC4)C[C@@H](O[C@@H]4[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@@H](O)[C@H](O[C@H]6[C@@H](O)[C@@H](O)[C@@H](O)[C@H](C)O6)[C@H](CO)O4)CC5)CC3)C[C@@H]2O1)C)[C@H]1[C@H](O)[C@H](O)[C@H](O)[C@@H](CO)O1 LVTJOONKWUXEFR-FZRMHRINSA-N 0.000 description 1
- NDGRWYRVNANFNB-UHFFFAOYSA-N pyrazolidin-3-one Chemical class O=C1CCNN1 NDGRWYRVNANFNB-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- QJZUKDFHGGYHMC-UHFFFAOYSA-N pyridine-3-carbaldehyde Chemical compound O=CC1=CC=CN=C1 QJZUKDFHGGYHMC-UHFFFAOYSA-N 0.000 description 1
- 150000003233 pyrroles Chemical class 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000000837 restrainer Substances 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 102220133487 rs149819112 Human genes 0.000 description 1
- ZUNKMNLKJXRCDM-UHFFFAOYSA-N silver bromoiodide Chemical compound [Ag].IBr ZUNKMNLKJXRCDM-UHFFFAOYSA-N 0.000 description 1
- 229910001961 silver nitrate Inorganic materials 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 229940063675 spermine Drugs 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 229910052714 tellurium Inorganic materials 0.000 description 1
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000012956 testing procedure Methods 0.000 description 1
- 150000003567 thiocyanates Chemical class 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 1
- 150000004764 thiosulfuric acid derivatives Chemical class 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- HIZCIEIDIFGZSS-UHFFFAOYSA-L trithiocarbonate Chemical compound [S-]C([S-])=S HIZCIEIDIFGZSS-UHFFFAOYSA-L 0.000 description 1
- 239000012989 trithiocarbonate Substances 0.000 description 1
- KMPQYAYAQWNLME-UHFFFAOYSA-N undecanal Chemical compound CCCCCCCCCCC=O KMPQYAYAQWNLME-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000001429 visible spectrum Methods 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229920003176 water-insoluble polymer Polymers 0.000 description 1
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/04—Derivatives of thiourea
- C07C335/16—Derivatives of thiourea having nitrogen atoms of thiourea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C335/20—Derivatives of thiourea having nitrogen atoms of thiourea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by nitrogen atoms, not being part of nitro or nitroso groups
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/005—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein
- G03C1/485—Direct positive emulsions
- G03C1/48538—Direct positive emulsions non-prefogged, i.e. fogged after imagewise exposure
- G03C1/48546—Direct positive emulsions non-prefogged, i.e. fogged after imagewise exposure characterised by the nucleating/fogging agent
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/005—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein
- G03C1/485—Direct positive emulsions
- G03C1/48538—Direct positive emulsions non-prefogged, i.e. fogged after imagewise exposure
- G03C1/48546—Direct positive emulsions non-prefogged, i.e. fogged after imagewise exposure characterised by the nucleating/fogging agent
- G03C1/48561—Direct positive emulsions non-prefogged, i.e. fogged after imagewise exposure characterised by the nucleating/fogging agent hydrazine compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (4)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
US60188875A | 1975-08-06 | 1975-08-06 | |
US60189175A | 1975-08-06 | 1975-08-06 | |
US05/701,050 US4030925A (en) | 1975-08-06 | 1976-06-29 | Photographic compositions and elements including internal latent image silver halide grains and acylhydrazinophenylthiourea nucleating agents therefor |
US05/700,982 US4031127A (en) | 1975-08-06 | 1976-06-29 | Acyl hydrazino thiourea derivatives as photographic nucleating agents |
Publications (1)
Publication Number | Publication Date |
---|---|
CA1061363A true CA1061363A (en) | 1979-08-28 |
Family
ID=27505055
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CA258,495A Expired CA1061363A (en) | 1975-08-06 | 1976-08-05 | Acylhydrazinothiourea derivatives as photographic nucleating agents |
Country Status (5)
Country | Link |
---|---|
JP (1) | JPS601616B2 (enrdf_load_stackoverflow) |
CA (1) | CA1061363A (enrdf_load_stackoverflow) |
DE (2) | DE2635316C3 (enrdf_load_stackoverflow) |
FR (1) | FR2320290A1 (enrdf_load_stackoverflow) |
GB (1) | GB1550946A (enrdf_load_stackoverflow) |
Families Citing this family (11)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4080207A (en) * | 1976-06-29 | 1978-03-21 | Eastman Kodak Company | Radiation-sensitive compositions and photographic elements containing N-(acylhydrazinophenyl) thioamide nucleating agents |
FR2409533A1 (fr) * | 1977-11-17 | 1979-06-15 | Kodak Pathe | Compose arylazocarboxylate et produit photographique le contenant a titre d'agent de nucleation |
JPS5937492B2 (ja) * | 1977-11-28 | 1984-09-10 | 富士写真フイルム株式会社 | 直接ポジハロゲン化銀感光材料 |
JPS5931691B2 (ja) * | 1978-11-30 | 1984-08-03 | 富士写真フイルム株式会社 | 直接ポジハロゲン化銀感光材料 |
EP0023780B1 (en) * | 1979-07-11 | 1984-04-11 | EASTMAN KODAK COMPANY (a New Jersey corporation) | Silver halide emulsions containing a nucleating agent, photographic elements, film unit and processes for the production of direct positive images |
FR2497367B1 (fr) * | 1980-10-16 | 1987-08-14 | Kodak Pathe | Emulsion positive-directe aux halogenures d'argent avec agent de nucleation incorpore |
EP0050558B1 (en) * | 1980-10-16 | 1985-07-17 | EASTMAN KODAK COMPANY (a New Jersey corporation) | Photographic emulsions and elements capable of forming direct-positive images |
JPS60443A (ja) * | 1983-06-17 | 1985-01-05 | Fuji Photo Film Co Ltd | 再反転ネガ像の抑制された直接ポジハロゲン化銀写真感光材料 |
JPS61250636A (ja) | 1985-04-30 | 1986-11-07 | Fuji Photo Film Co Ltd | 熱現像感光材料 |
AU593305B2 (en) | 1985-11-21 | 1990-02-08 | Fuji Photo Film Co., Ltd. | Light-sensitive material employing microcapsules containing polymerisable compound and silver halide, and light-sensitive material employing the same |
JPH0619570B2 (ja) | 1986-02-07 | 1994-03-16 | 富士写真フイルム株式会社 | 感光材料 |
-
1976
- 1976-08-04 FR FR7623777A patent/FR2320290A1/fr active Granted
- 1976-08-05 CA CA258,495A patent/CA1061363A/en not_active Expired
- 1976-08-05 DE DE19762635316 patent/DE2635316C3/de not_active Expired
- 1976-08-05 DE DE19762635317 patent/DE2635317C2/de not_active Expired
- 1976-08-06 JP JP9391676A patent/JPS601616B2/ja not_active Expired
- 1976-08-06 GB GB3282776A patent/GB1550946A/en not_active Expired
Also Published As
Publication number | Publication date |
---|---|
JPS5320318A (en) | 1978-02-24 |
FR2320290B1 (enrdf_load_stackoverflow) | 1979-05-04 |
GB1550946A (en) | 1979-08-22 |
DE2635317A1 (de) | 1977-02-24 |
DE2635316C3 (de) | 1981-07-02 |
FR2320290A1 (fr) | 1977-03-04 |
JPS601616B2 (ja) | 1985-01-16 |
DE2635317C2 (de) | 1982-06-03 |
DE2635316A1 (de) | 1977-03-03 |
DE2635316B2 (de) | 1980-10-02 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US4030925A (en) | Photographic compositions and elements including internal latent image silver halide grains and acylhydrazinophenylthiourea nucleating agents therefor | |
US4471044A (en) | Silver halide emulsions and photographic elements containing adsorbable alkynyl substituted heterocyclic quaternary ammonium salts | |
US4031127A (en) | Acyl hydrazino thiourea derivatives as photographic nucleating agents | |
US4478928A (en) | Application of activated arylhydrazides to silver halide photography | |
EP0126000B1 (en) | Adsorbable arylhydrazides and applications thereof to silver halide photography | |
CA1078848A (en) | Nucleating agents, radiation-sensitive compositions and photographic elements | |
US4276364A (en) | Acylhydrazinophenylthiourea nucleating agents and photographic emulsions and elements containing such agents | |
EP0079583B1 (en) | Radiation-sensitive emulsion and direct-positive photographic element containing the same | |
US5601964A (en) | Silver halide photographic materials | |
US4278748A (en) | Absorbed hydrazide nucleating agents and photographic elements containing such agents | |
CA1061363A (en) | Acylhydrazinothiourea derivatives as photographic nucleating agents | |
US5006445A (en) | Silver halide photographic material | |
US4374923A (en) | Direct positive silver halide photographic light-sensitive material | |
US5100761A (en) | Silver halide photographic materials | |
EP0106730A2 (en) | Radiation sensitive emulsion and direct-positive photographic element containing the same | |
GB2054880A (en) | Direct-positive silver halide light-sensitive material | |
US4950578A (en) | Silver halide photographic material | |
EP0140371B1 (en) | Internal latent image-type direct positive silver halide light-sensitive material | |
JPS63226652A (ja) | 直接ポジカラ−画像の形成方法 | |
EP0278666B1 (en) | Method of making a direct positive silver halide light- sensitive photographic material | |
CA1120936A (en) | Acylhydrazinophenylthiourea nucleating agents and photographic elements containing such agents | |
JPS63234245A (ja) | ハロゲン化銀写真感光材料 | |
EP0023780B1 (en) | Silver halide emulsions containing a nucleating agent, photographic elements, film unit and processes for the production of direct positive images | |
US4737439A (en) | Photographic compositions and elements including internal latent image silver halide grains and nucleating agents therefor | |
JPH0738071B2 (ja) | ハロゲン化銀写真感光材料 |