CA1042907A - Halogen derivatives of iso-lasalocid a - Google Patents
Halogen derivatives of iso-lasalocid aInfo
- Publication number
- CA1042907A CA1042907A CA223,495A CA223495A CA1042907A CA 1042907 A CA1042907 A CA 1042907A CA 223495 A CA223495 A CA 223495A CA 1042907 A CA1042907 A CA 1042907A
- Authority
- CA
- Canada
- Prior art keywords
- lasalocid
- iso
- formula
- compound
- bromine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910052736 halogen Inorganic materials 0.000 title claims abstract description 8
- -1 Halogen derivatives of iso-lasalocid a Chemical class 0.000 title description 3
- 150000003839 salts Chemical class 0.000 claims abstract description 24
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims abstract description 10
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims abstract description 10
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 10
- 150000002367 halogens Chemical class 0.000 claims abstract description 7
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 6
- 239000000460 chlorine Substances 0.000 claims abstract description 6
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims abstract description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims abstract description 4
- 238000000034 method Methods 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 7
- 230000026030 halogenation Effects 0.000 claims description 6
- 238000005658 halogenation reaction Methods 0.000 claims description 6
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 6
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- QZRGKCOWNLSUDK-UHFFFAOYSA-N Iodochlorine Chemical compound ICl QZRGKCOWNLSUDK-UHFFFAOYSA-N 0.000 claims description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims description 2
- 239000011630 iodine Substances 0.000 claims description 2
- 230000031709 bromination Effects 0.000 claims 1
- 238000005893 bromination reaction Methods 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 238000002360 preparation method Methods 0.000 abstract description 6
- 230000000844 anti-bacterial effect Effects 0.000 abstract description 3
- 230000000842 anti-protozoal effect Effects 0.000 abstract description 2
- XZJLJFYPIJKWCY-ANXQGEBNSA-N 6-[(3r,4s,5s,7r)-7-[(2s,3s,5s)-5-ethyl-5-[(2r,5s)-5-ethyl-5-[(1r)-1-hydroxyethyl]oxolan-2-yl]-3-methyloxolan-2-yl]-4-hydroxy-3,5-dimethyl-6-oxononyl]-2-hydroxy-3-methylbenzoic acid Chemical compound C([C@@H]1[C@@]2(CC)O[C@@H]([C@H](C2)C)[C@@H](CC)C(=O)[C@@H](C)[C@@H](O)[C@H](C)CCC=2C(=C(O)C(C)=CC=2)C(O)=O)C[C@@](CC)([C@@H](C)O)O1 XZJLJFYPIJKWCY-ANXQGEBNSA-N 0.000 description 21
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 238000000855 fermentation Methods 0.000 description 9
- 230000004151 fermentation Effects 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- BBMULGJBVDDDNI-OWKLGTHSSA-N lasalocid Chemical compound C([C@@H]1[C@@]2(CC)O[C@@H]([C@H](C2)C)[C@@H](CC)C(=O)[C@@H](C)[C@@H](O)[C@H](C)CCC=2C(=C(O)C(C)=CC=2)C(O)=O)C[C@](O)(CC)[C@H](C)O1 BBMULGJBVDDDNI-OWKLGTHSSA-N 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 230000003115 biocidal effect Effects 0.000 description 6
- BBMULGJBVDDDNI-UHFFFAOYSA-N lasalocid A Natural products C=1C=C(C)C(O)=C(C(O)=O)C=1CCC(C)C(O)C(C)C(=O)C(CC)C(C(C1)C)OC1(CC)C1CCC(O)(CC)C(C)O1 BBMULGJBVDDDNI-UHFFFAOYSA-N 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 238000000605 extraction Methods 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- PVFOHMXILQEIHX-UHFFFAOYSA-N 8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-9-[2-(2-bromophenyl)ethyl]purin-6-amine Chemical compound C=1C=2OCOC=2C=C(Br)C=1SC1=NC=2C(N)=NC=NC=2N1CCC1=CC=CC=C1Br PVFOHMXILQEIHX-UHFFFAOYSA-N 0.000 description 3
- 241000194110 Bacillus sp. (in: Bacteria) Species 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 241000187747 Streptomyces Species 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000006260 foam Substances 0.000 description 3
- 238000002955 isolation Methods 0.000 description 3
- 229960000320 lasalocid Drugs 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 241000193830 Bacillus <bacterium> Species 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- 239000010699 lard oil Substances 0.000 description 2
- 235000012054 meals Nutrition 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 244000005700 microbiome Species 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000011160 research Methods 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000011343 solid material Substances 0.000 description 2
- 238000000638 solvent extraction Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- 229920001817 Agar Polymers 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 235000019737 Animal fat Nutrition 0.000 description 1
- 241000194107 Bacillus megaterium Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- 229930182504 Lasalocid Natural products 0.000 description 1
- 241000191938 Micrococcus luteus Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 241000364057 Peoria Species 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- 235000010582 Pisum sativum Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 235000019764 Soybean Meal Nutrition 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000003904 antiprotozoal agent Substances 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 159000000009 barium salts Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 229940099112 cornstarch Drugs 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 229910000396 dipotassium phosphate Inorganic materials 0.000 description 1
- BCXDJYNKADGKDK-UHFFFAOYSA-N ethyl acetate;heptane;methanol;hydrate Chemical compound O.OC.CCOC(C)=O.CCCCCCC BCXDJYNKADGKDK-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 210000000540 fraction c Anatomy 0.000 description 1
- 238000005227 gel permeation chromatography Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000002054 inoculum Substances 0.000 description 1
- 230000026045 iodination Effects 0.000 description 1
- 238000006192 iodination reaction Methods 0.000 description 1
- 231100001231 less toxic Toxicity 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000000622 liquid--liquid extraction Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 235000013379 molasses Nutrition 0.000 description 1
- 230000000877 morphologic effect Effects 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000012827 research and development Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000004455 soybean meal Substances 0.000 description 1
- 235000012424 soybean oil Nutrition 0.000 description 1
- 239000003549 soybean oil Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 239000011573 trace mineral Substances 0.000 description 1
- 235000013619 trace mineral Nutrition 0.000 description 1
- 235000019871 vegetable fat Nutrition 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/04—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D307/10—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/12—Radicals substituted by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Furan Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/457,298 US3944573A (en) | 1974-04-02 | 1974-04-02 | Iso-lasalocid A |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1042907A true CA1042907A (en) | 1978-11-21 |
Family
ID=23816183
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA223,495A Expired CA1042907A (en) | 1974-04-02 | 1975-04-01 | Halogen derivatives of iso-lasalocid a |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US3944573A (OSRAM) |
| JP (1) | JPS50140439A (OSRAM) |
| AR (1) | AR212801A1 (OSRAM) |
| AT (1) | AT345455B (OSRAM) |
| BE (1) | BE827416A (OSRAM) |
| CA (1) | CA1042907A (OSRAM) |
| CH (1) | CH594653A5 (OSRAM) |
| DD (1) | DD119228A5 (OSRAM) |
| DE (1) | DE2514185A1 (OSRAM) |
| DK (1) | DK138321B (OSRAM) |
| ES (1) | ES436176A1 (OSRAM) |
| FI (1) | FI750967A7 (OSRAM) |
| FR (1) | FR2265362B1 (OSRAM) |
| GB (1) | GB1501144A (OSRAM) |
| IE (1) | IE40897B1 (OSRAM) |
| IL (1) | IL46969A (OSRAM) |
| LU (1) | LU72177A1 (OSRAM) |
| NL (1) | NL7503906A (OSRAM) |
| NO (1) | NO143026C (OSRAM) |
| PH (1) | PH12450A (OSRAM) |
| SE (1) | SE417713B (OSRAM) |
| SU (1) | SU648099A3 (OSRAM) |
| ZA (1) | ZA751802B (OSRAM) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4164586A (en) * | 1974-07-19 | 1979-08-14 | Hoffmann-La Roche Inc. | Therapeutic agent for improving cardiovascular function |
| US4228293A (en) * | 1978-10-11 | 1980-10-14 | Eli Lilly And Company | Iodo-A-23187 derivatives |
| US4227002A (en) * | 1978-10-11 | 1980-10-07 | Eli Lilly And Company | Halo-A-23187 derivatives |
| US4227003A (en) * | 1978-10-11 | 1980-10-07 | Eli Lilly And Company | Bromo-A-23187 derivatives |
| US4302450A (en) * | 1979-01-15 | 1981-11-24 | Hoffmann-La Roche Inc. | Polyether ionophores as antiobesity and hypotriglyceridemic agents |
| US4218443A (en) * | 1979-01-15 | 1980-08-19 | Hoffmann-La Roche Inc. | Polyether ionophores as antiobesity and hypotriglyceridemic agents |
| IE49936B1 (en) * | 1979-07-11 | 1986-01-08 | Int Minerals & Chem Corp | Zinc-containing antibiotic agents |
| US4288629A (en) * | 1980-04-03 | 1981-09-08 | American Cyanamid Company | 1-Hydroxymethyl-11-deoxy-15-hydroxy-prosten-1-ol-derivatives |
| US4410712A (en) * | 1982-03-10 | 1983-10-18 | Hoffmann-La Roche Inc. | Antibiotics X-14873 A, G and H |
| ES2097818T3 (es) * | 1990-10-01 | 1997-04-16 | Pfizer | Antibiotico de eter policiclico anticoccidiano y estimulante del crecimiento. |
| CN116836892B (zh) * | 2023-08-30 | 2023-11-14 | 中国热带农业科学院三亚研究院 | 一种同时产生香豆素和水杨酸的5406链霉菌培养方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3702333A (en) * | 1967-08-11 | 1972-11-07 | Yoshitomi Pharmaceutical | Cyclopropanecarboxylic acid esters possessing pesticidal properties |
-
1974
- 1974-04-02 US US05/457,298 patent/US3944573A/en not_active Expired - Lifetime
-
1975
- 1975-03-20 CH CH356775A patent/CH594653A5/xx not_active IP Right Cessation
- 1975-03-21 ZA ZA00751802A patent/ZA751802B/xx unknown
- 1975-03-31 IL IL46969A patent/IL46969A/xx unknown
- 1975-03-31 PH PH16996A patent/PH12450A/en unknown
- 1975-04-01 ES ES436176A patent/ES436176A1/es not_active Expired
- 1975-04-01 AR AR258207A patent/AR212801A1/es active
- 1975-04-01 SE SE7503717A patent/SE417713B/xx unknown
- 1975-04-01 DE DE19752514185 patent/DE2514185A1/de not_active Withdrawn
- 1975-04-01 AT AT244775A patent/AT345455B/de not_active IP Right Cessation
- 1975-04-01 NO NO751098A patent/NO143026C/no unknown
- 1975-04-01 DK DK137775AA patent/DK138321B/da not_active IP Right Cessation
- 1975-04-01 BE BE154968A patent/BE827416A/xx unknown
- 1975-04-01 SU SU752117908A patent/SU648099A3/ru active
- 1975-04-01 DD DD185151A patent/DD119228A5/xx unknown
- 1975-04-01 FI FI750967A patent/FI750967A7/fi not_active Application Discontinuation
- 1975-04-01 LU LU72177A patent/LU72177A1/xx unknown
- 1975-04-01 FR FR7510094A patent/FR2265362B1/fr not_active Expired
- 1975-04-01 CA CA223,495A patent/CA1042907A/en not_active Expired
- 1975-04-01 GB GB13219/75A patent/GB1501144A/en not_active Expired
- 1975-04-02 JP JP50040214A patent/JPS50140439A/ja active Pending
- 1975-04-02 NL NL7503906A patent/NL7503906A/xx not_active Application Discontinuation
- 1975-04-02 IE IE719/75A patent/IE40897B1/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SE7503717L (OSRAM) | 1975-10-03 |
| DK137775A (OSRAM) | 1975-10-03 |
| NO751098L (OSRAM) | 1975-10-03 |
| ES436176A1 (es) | 1977-02-01 |
| NL7503906A (nl) | 1975-10-06 |
| NO143026C (no) | 1980-12-03 |
| ATA244775A (de) | 1978-01-15 |
| IL46969A0 (en) | 1975-05-22 |
| JPS50140439A (OSRAM) | 1975-11-11 |
| BE827416A (fr) | 1975-10-01 |
| AU7974175A (en) | 1976-10-07 |
| SE417713B (sv) | 1981-04-06 |
| DD119228A5 (OSRAM) | 1976-04-12 |
| IE40897L (en) | 1975-10-02 |
| DE2514185A1 (de) | 1975-10-09 |
| GB1501144A (en) | 1978-02-15 |
| IL46969A (en) | 1978-09-29 |
| AR212801A1 (es) | 1978-10-13 |
| CH594653A5 (OSRAM) | 1978-01-13 |
| SU648099A3 (ru) | 1979-02-15 |
| PH12450A (en) | 1979-03-08 |
| IE40897B1 (en) | 1979-09-12 |
| DK138321B (da) | 1978-08-14 |
| NO143026B (no) | 1980-08-25 |
| FI750967A7 (OSRAM) | 1975-10-03 |
| FR2265362B1 (OSRAM) | 1979-02-23 |
| AT345455B (de) | 1978-09-25 |
| US3944573A (en) | 1976-03-16 |
| ZA751802B (en) | 1976-02-25 |
| LU72177A1 (OSRAM) | 1977-02-01 |
| DK138321C (OSRAM) | 1979-01-22 |
| FR2265362A1 (OSRAM) | 1975-10-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU797591A3 (ru) | Способ получени антибиотика сс-1065 | |
| GB2166436A (en) | Antibiotic compounds and their preparation | |
| CA1042907A (en) | Halogen derivatives of iso-lasalocid a | |
| JPH082907B2 (ja) | 新規免疫抑制剤 | |
| JP3039780B2 (ja) | 免疫抑制剤の生産法 | |
| EP0371509B1 (en) | Antibiotics and process for producing them | |
| US5089521A (en) | 10-membered ring lactones, a process for the preparation thereof, and the use thereof | |
| DE2124711A1 (OSRAM) | ||
| EP0048585A1 (en) | Antibiotics TM-531 B and TM-531 C | |
| EP0043280B1 (en) | Process for preparing a macrolide | |
| US3856938A (en) | Antibiotic em{14 49 | |
| JP2833181B2 (ja) | Fr901375物質およびその製造法 | |
| US5290772A (en) | Immunosuppressant agent | |
| EP0466365A2 (en) | Novel immunosuppressant fermentation products of a microorganism | |
| JPH0737B2 (ja) | スタウロスポリン発酵法 | |
| US3701787A (en) | Preparation of 5,6-dihydro-5-hydroxy-6-propenyl-2-pyrone by fermentation and derivatives thereof | |
| EP0042172B1 (en) | Antibiotic compounds, pharmaceutical compositions containing such compounds, process for production thereof | |
| EP0002589B1 (en) | A-40104 antibiotics, their preparation, and formulations containing them | |
| US3810924A (en) | 5-dihydrocoriolin c | |
| AU611642B2 (en) | Novel pharmacologically active phenoxazinones, processes for their preparation and their use | |
| JPH05170769A (ja) | 新規q−11270化合物又はその製造法 | |
| JPH0613499B2 (ja) | パチュロリドおよびその製造法 | |
| US4303647A (en) | Method of treating coccidiosis with antibiotic A-32887K | |
| JP2844214B2 (ja) | 4a―ヒドロキシミルベマイシンα類の製造法 | |
| US3555075A (en) | Novel antifungal agents |