AU2017363369A1 - Methods for modulating RNA splicing - Google Patents
Methods for modulating RNA splicing Download PDFInfo
- Publication number
- AU2017363369A1 AU2017363369A1 AU2017363369A AU2017363369A AU2017363369A1 AU 2017363369 A1 AU2017363369 A1 AU 2017363369A1 AU 2017363369 A AU2017363369 A AU 2017363369A AU 2017363369 A AU2017363369 A AU 2017363369A AU 2017363369 A1 AU2017363369 A1 AU 2017363369A1
- Authority
- AU
- Australia
- Prior art keywords
- amino
- 8alkyl
- salkyl
- hydroxy
- heterocyclyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 238000000034 method Methods 0.000 title claims abstract description 152
- 108090000623 proteins and genes Proteins 0.000 claims abstract description 176
- 150000001875 compounds Chemical class 0.000 claims abstract description 163
- 102000004169 proteins and genes Human genes 0.000 claims abstract description 42
- 108700005078 Synthetic Genes Proteins 0.000 claims abstract description 34
- 239000003607 modifier Substances 0.000 claims abstract description 22
- 239000002773 nucleotide Substances 0.000 claims description 187
- 125000003729 nucleotide group Chemical group 0.000 claims description 187
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 168
- -1 C14orfl32 Proteins 0.000 claims description 164
- UYTPUPDQBNUYGX-UHFFFAOYSA-N guanine Chemical group O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 claims description 158
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 claims description 136
- 108091032973 (ribonucleotides)n+m Proteins 0.000 claims description 127
- 229910052757 nitrogen Inorganic materials 0.000 claims description 108
- 108020005067 RNA Splice Sites Proteins 0.000 claims description 95
- 229930024421 Adenine Natural products 0.000 claims description 79
- 229960000643 adenine Drugs 0.000 claims description 79
- GFFGJBXGBJISGV-UHFFFAOYSA-N adenyl group Chemical group N1=CN=C2N=CNC2=C1N GFFGJBXGBJISGV-UHFFFAOYSA-N 0.000 claims description 79
- 125000000623 heterocyclic group Chemical group 0.000 claims description 72
- 108091028043 Nucleic acid sequence Proteins 0.000 claims description 62
- 125000003118 aryl group Chemical group 0.000 claims description 48
- 229910052736 halogen Inorganic materials 0.000 claims description 48
- 150000002367 halogens Chemical class 0.000 claims description 48
- 125000001072 heteroaryl group Chemical group 0.000 claims description 48
- 125000001424 substituent group Chemical group 0.000 claims description 48
- 108020004999 messenger RNA Proteins 0.000 claims description 35
- 238000011144 upstream manufacturing Methods 0.000 claims description 30
- 108700024394 Exon Proteins 0.000 claims description 28
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 claims description 24
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 24
- 229910052805 deuterium Inorganic materials 0.000 claims description 24
- 229910052739 hydrogen Inorganic materials 0.000 claims description 24
- 239000001257 hydrogen Substances 0.000 claims description 24
- 125000005241 heteroarylamino group Chemical group 0.000 claims description 16
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 16
- FWMNVWWHGCHHJJ-SKKKGAJSSA-N 4-amino-1-[(2r)-6-amino-2-[[(2r)-2-[[(2r)-2-[[(2r)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoyl]amino]hexanoyl]piperidine-4-carboxylic acid Chemical compound C([C@H](C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CCCCN)C(=O)N1CCC(N)(CC1)C(O)=O)NC(=O)[C@H](N)CC=1C=CC=CC=1)C1=CC=CC=C1 FWMNVWWHGCHHJJ-SKKKGAJSSA-N 0.000 claims description 11
- 108091027974 Mature messenger RNA Proteins 0.000 claims description 9
- 125000005100 aryl amino carbonyl group Chemical group 0.000 claims description 8
- 125000001769 aryl amino group Chemical group 0.000 claims description 8
- 125000006517 heterocyclyl carbonyl group Chemical group 0.000 claims description 8
- 125000005844 heterocyclyloxy group Chemical group 0.000 claims description 8
- 125000004043 oxo group Chemical group O=* 0.000 claims description 8
- 102100031593 DNA-directed RNA polymerase I subunit RPA1 Human genes 0.000 claims description 7
- 101000729474 Homo sapiens DNA-directed RNA polymerase I subunit RPA1 Proteins 0.000 claims description 7
- 101001025967 Homo sapiens Lysine-specific demethylase 6A Proteins 0.000 claims description 7
- 102100037462 Lysine-specific demethylase 6A Human genes 0.000 claims description 7
- 102100034786 Cell migration-inducing and hyaluronan-binding protein Human genes 0.000 claims description 6
- 102100028554 Dual specificity tyrosine-phosphorylation-regulated kinase 1A Human genes 0.000 claims description 6
- 102100035102 E3 ubiquitin-protein ligase MYCBP2 Human genes 0.000 claims description 6
- 101000890401 Homo sapiens Amyloid beta precursor like protein 2 Proteins 0.000 claims description 6
- 101000945881 Homo sapiens Cell migration-inducing and hyaluronan-binding protein Proteins 0.000 claims description 6
- 101000838016 Homo sapiens Dual specificity tyrosine-phosphorylation-regulated kinase 1A Proteins 0.000 claims description 6
- 101001065536 Homo sapiens LYR motif-containing protein 1 Proteins 0.000 claims description 6
- 101001103036 Homo sapiens Nuclear receptor ROR-alpha Proteins 0.000 claims description 6
- 101000848700 Homo sapiens Rap guanine nucleotide exchange factor 1 Proteins 0.000 claims description 6
- 101000684514 Homo sapiens Sentrin-specific protease 6 Proteins 0.000 claims description 6
- 101000596771 Homo sapiens Transcription factor 7-like 2 Proteins 0.000 claims description 6
- 108090000320 Hyaluronan Synthases Proteins 0.000 claims description 6
- 102000003918 Hyaluronan Synthases Human genes 0.000 claims description 6
- 102100032135 LYR motif-containing protein 1 Human genes 0.000 claims description 6
- 108091007877 MYCBP2 Proteins 0.000 claims description 6
- 102100028134 Mitochondrial potassium channel ATP-binding subunit Human genes 0.000 claims description 6
- 101710106113 Mitochondrial potassium channel ATP-binding subunit Proteins 0.000 claims description 6
- 102100039614 Nuclear receptor ROR-alpha Human genes 0.000 claims description 6
- 102100034589 Rap guanine nucleotide exchange factor 1 Human genes 0.000 claims description 6
- 102100023713 Sentrin-specific protease 6 Human genes 0.000 claims description 6
- 102100035551 Transcription termination factor 3, mitochondrial Human genes 0.000 claims description 6
- 102100039822 39S ribosomal protein L55, mitochondrial Human genes 0.000 claims description 5
- 102100023165 Alpha-mannosidase 2C1 Human genes 0.000 claims description 5
- 102100034564 Ankyrin repeat domain-containing protein 36A Human genes 0.000 claims description 5
- 102100024003 Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1 Human genes 0.000 claims description 5
- 102100035921 Arginine/serine-rich protein PNISR Human genes 0.000 claims description 5
- 108010092776 Autophagy-Related Protein 5 Proteins 0.000 claims description 5
- 102000016614 Autophagy-Related Protein 5 Human genes 0.000 claims description 5
- 102100027515 Baculoviral IAP repeat-containing protein 6 Human genes 0.000 claims description 5
- 102100034467 Clathrin light chain A Human genes 0.000 claims description 5
- 102100038688 Cysteine-rich secretory protein LCCL domain-containing 2 Human genes 0.000 claims description 5
- 102100029988 Endoplasmic reticulum-Golgi intermediate compartment protein 3 Human genes 0.000 claims description 5
- 102100037343 F-box/LRR-repeat protein 6 Human genes 0.000 claims description 5
- 102100031510 Fibrillin-2 Human genes 0.000 claims description 5
- 102100023525 Glucoside xylosyltransferase 1 Human genes 0.000 claims description 5
- 102100033070 Histone acetyltransferase KAT6B Human genes 0.000 claims description 5
- 102100027768 Histone-lysine N-methyltransferase 2D Human genes 0.000 claims description 5
- 101000667530 Homo sapiens 39S ribosomal protein L55, mitochondrial Proteins 0.000 claims description 5
- 101000979029 Homo sapiens Alpha-mannosidase 2C1 Proteins 0.000 claims description 5
- 101000924343 Homo sapiens Ankyrin repeat domain-containing protein 36A Proteins 0.000 claims description 5
- 101000975752 Homo sapiens Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1 Proteins 0.000 claims description 5
- 101001000549 Homo sapiens Arginine/serine-rich protein PNISR Proteins 0.000 claims description 5
- 101000936081 Homo sapiens Baculoviral IAP repeat-containing protein 6 Proteins 0.000 claims description 5
- 101000710244 Homo sapiens Clathrin light chain A Proteins 0.000 claims description 5
- 101000957715 Homo sapiens Cysteine-rich secretory protein LCCL domain-containing 2 Proteins 0.000 claims description 5
- 101001010804 Homo sapiens Endoplasmic reticulum-Golgi intermediate compartment protein 3 Proteins 0.000 claims description 5
- 101001026845 Homo sapiens F-box/LRR-repeat protein 6 Proteins 0.000 claims description 5
- 101000846890 Homo sapiens Fibrillin-2 Proteins 0.000 claims description 5
- 101000906417 Homo sapiens Glucoside xylosyltransferase 1 Proteins 0.000 claims description 5
- 101000944174 Homo sapiens Histone acetyltransferase KAT6B Proteins 0.000 claims description 5
- 101001008894 Homo sapiens Histone-lysine N-methyltransferase 2D Proteins 0.000 claims description 5
- 101000902205 Homo sapiens Inactive cytidine monophosphate-N-acetylneuraminic acid hydroxylase Proteins 0.000 claims description 5
- 101000581507 Homo sapiens Methyl-CpG-binding domain protein 1 Proteins 0.000 claims description 5
- 101000752520 Homo sapiens Protein ARMCX6 Proteins 0.000 claims description 5
- 101000581155 Homo sapiens Rho GTPase-activating protein 12 Proteins 0.000 claims description 5
- 101000654564 Homo sapiens SH3 domain-containing YSC84-like protein 1 Proteins 0.000 claims description 5
- 101000801114 Homo sapiens Transmembrane protein 134 Proteins 0.000 claims description 5
- 102100022247 Inactive cytidine monophosphate-N-acetylneuraminic acid hydroxylase Human genes 0.000 claims description 5
- 102100022029 Protein ARMCX6 Human genes 0.000 claims description 5
- 102100027663 Rho GTPase-activating protein 12 Human genes 0.000 claims description 5
- 102100032637 SH3 domain-containing YSC84-like protein 1 Human genes 0.000 claims description 5
- 102100033701 Transmembrane protein 134 Human genes 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 102100030471 1-acyl-sn-glycerol-3-phosphate acyltransferase delta Human genes 0.000 claims description 4
- 102100038028 1-phosphatidylinositol 3-phosphate 5-kinase Human genes 0.000 claims description 4
- SIVJKYRAPQKLIM-UHFFFAOYSA-N 3-(3,4-difluorophenyl)-n-(3-fluoro-5-morpholin-4-ylphenyl)propanamide Chemical compound C=1C(N2CCOCC2)=CC(F)=CC=1NC(=O)CCC1=CC=C(F)C(F)=C1 SIVJKYRAPQKLIM-UHFFFAOYSA-N 0.000 claims description 4
- 102100023340 3-ketodihydrosphingosine reductase Human genes 0.000 claims description 4
- 102100033756 39S ribosomal protein L45, mitochondrial Human genes 0.000 claims description 4
- 102100026744 40S ribosomal protein S10 Human genes 0.000 claims description 4
- 102100027398 A disintegrin and metalloproteinase with thrombospondin motifs 1 Human genes 0.000 claims description 4
- 102100031910 A-kinase anchor protein 3 Human genes 0.000 claims description 4
- 108091005660 ADAMTS1 Proteins 0.000 claims description 4
- 102100022910 ADP-ribosylation factor-like protein 15 Human genes 0.000 claims description 4
- 102100023166 ADP-ribosylation factor-like protein 9 Human genes 0.000 claims description 4
- 102100024387 AF4/FMR2 family member 3 Human genes 0.000 claims description 4
- 102100030835 AT-rich interactive domain-containing protein 5B Human genes 0.000 claims description 4
- 102100036622 ATP-binding cassette sub-family A member 10 Human genes 0.000 claims description 4
- 102100028162 ATP-binding cassette sub-family C member 3 Human genes 0.000 claims description 4
- 102100035720 ATP-dependent RNA helicase DDX42 Human genes 0.000 claims description 4
- 102100024768 ATP-dependent RNA helicase DDX50 Human genes 0.000 claims description 4
- 102100034213 ATPase family protein 2 homolog Human genes 0.000 claims description 4
- 102100021624 Acid-sensing ion channel 1 Human genes 0.000 claims description 4
- 101710099904 Acid-sensing ion channel 1 Proteins 0.000 claims description 4
- 102100036732 Actin, aortic smooth muscle Human genes 0.000 claims description 4
- 102100040023 Adhesion G-protein coupled receptor G6 Human genes 0.000 claims description 4
- 102100031794 Alcohol dehydrogenase 6 Human genes 0.000 claims description 4
- 102100034033 Alpha-adducin Human genes 0.000 claims description 4
- 102100024075 Alpha-internexin Human genes 0.000 claims description 4
- 102100034562 Ankyrin repeat domain-containing protein 33B Human genes 0.000 claims description 4
- 102100031329 Ankyrin repeat family A protein 2 Human genes 0.000 claims description 4
- 102100031366 Ankyrin-1 Human genes 0.000 claims description 4
- 102100036817 Ankyrin-3 Human genes 0.000 claims description 4
- 102100028118 Annexin A11 Human genes 0.000 claims description 4
- 102100028449 Arginine-glutamic acid dipeptide repeats protein Human genes 0.000 claims description 4
- 102000007372 Ataxin-1 Human genes 0.000 claims description 4
- 108010032963 Ataxin-1 Proteins 0.000 claims description 4
- 108700003785 Baculoviral IAP Repeat-Containing 3 Proteins 0.000 claims description 4
- 102100021662 Baculoviral IAP repeat-containing protein 3 Human genes 0.000 claims description 4
- 102100021896 Bcl-2-like protein 15 Human genes 0.000 claims description 4
- 102100021251 Beclin-1 Human genes 0.000 claims description 4
- 102100039888 Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase Human genes 0.000 claims description 4
- 102100032440 Beta-1,3-galactosyltransferase 2 Human genes 0.000 claims description 4
- 102100031500 Beta-1,4-glucuronyltransferase 1 Human genes 0.000 claims description 4
- 101150104237 Birc3 gene Proteins 0.000 claims description 4
- 102100027138 Butyrophilin subfamily 3 member A1 Human genes 0.000 claims description 4
- 108091058539 C10orf54 Proteins 0.000 claims description 4
- 102100033611 CB1 cannabinoid receptor-interacting protein 1 Human genes 0.000 claims description 4
- 101710038256 CEP112 Proteins 0.000 claims description 4
- 102100025659 Cadherin EGF LAG seven-pass G-type receptor 1 Human genes 0.000 claims description 4
- 102100030621 Carboxypeptidase A4 Human genes 0.000 claims description 4
- 102100026679 Carboxypeptidase Q Human genes 0.000 claims description 4
- 102100027473 Cartilage oligomeric matrix protein Human genes 0.000 claims description 4
- 101710176668 Cartilage oligomeric matrix protein Proteins 0.000 claims description 4
- 102100037398 Casein kinase I isoform epsilon Human genes 0.000 claims description 4
- 102100037397 Casein kinase I isoform gamma-1 Human genes 0.000 claims description 4
- 102100038902 Caspase-7 Human genes 0.000 claims description 4
- 102100037182 Cation-independent mannose-6-phosphate receptor Human genes 0.000 claims description 4
- 108010072135 Cell Adhesion Molecule-1 Proteins 0.000 claims description 4
- 102100024649 Cell adhesion molecule 1 Human genes 0.000 claims description 4
- 102100023343 Centromere protein I Human genes 0.000 claims description 4
- 102100033129 Centrosomal protein of 112 kDa Human genes 0.000 claims description 4
- 102100036179 Centrosomal protein of 170 kDa Human genes 0.000 claims description 4
- 101710142011 Centrosomal protein of 170 kDa Proteins 0.000 claims description 4
- 102100035954 Choline transporter-like protein 2 Human genes 0.000 claims description 4
- 102100032247 Cilium assembly protein DZIP1L Human genes 0.000 claims description 4
- 102100040552 Claudin-23 Human genes 0.000 claims description 4
- 102100030953 Cleavage and polyadenylation specificity factor subunit 4 Human genes 0.000 claims description 4
- 102100036631 Coiled-coil domain-containing glutamate-rich protein 2 Human genes 0.000 claims description 4
- 102100023668 Coiled-coil domain-containing protein 122 Human genes 0.000 claims description 4
- 102100031457 Collagen alpha-1(V) chain Human genes 0.000 claims description 4
- 102100024337 Collagen alpha-1(VIII) chain Human genes 0.000 claims description 4
- 102100033825 Collagen alpha-1(XI) chain Human genes 0.000 claims description 4
- 102100024203 Collagen alpha-1(XIV) chain Human genes 0.000 claims description 4
- 102100022640 Collagen alpha-1(XV) chain Human genes 0.000 claims description 4
- 102100031501 Collagen alpha-3(V) chain Human genes 0.000 claims description 4
- 102100024334 Collagen alpha-6(VI) chain Human genes 0.000 claims description 4
- 102100024330 Collectin-12 Human genes 0.000 claims description 4
- 102100035432 Complement factor H Human genes 0.000 claims description 4
- 102100024382 Cullin-associated NEDD8-dissociated protein 2 Human genes 0.000 claims description 4
- 102100029157 Cyclic nucleotide-gated cation channel alpha-4 Human genes 0.000 claims description 4
- 102100022052 Cyclin N-terminal domain-containing protein 1 Human genes 0.000 claims description 4
- 102100038254 Cyclin-F Human genes 0.000 claims description 4
- 102100027417 Cytochrome P450 1B1 Human genes 0.000 claims description 4
- 102100034126 Cytoglobin Human genes 0.000 claims description 4
- 102100038493 Cytokine receptor-like factor 1 Human genes 0.000 claims description 4
- 102100028530 Cytoplasmic dynein 1 intermediate chain 1 Human genes 0.000 claims description 4
- 102100028697 D-glucuronyl C5-epimerase Human genes 0.000 claims description 4
- 102100029581 DDB1- and CUL4-associated factor 17 Human genes 0.000 claims description 4
- 102100033466 DENN domain-containing protein 1A Human genes 0.000 claims description 4
- 102100025267 DENN domain-containing protein 5A Human genes 0.000 claims description 4
- 102100029816 DEP domain-containing mTOR-interacting protein Human genes 0.000 claims description 4
- 102100025900 DNA damage-inducible transcript 4-like protein Human genes 0.000 claims description 4
- 102100031868 DNA excision repair protein ERCC-8 Human genes 0.000 claims description 4
- 102100022286 DNA repair-scaffolding protein Human genes 0.000 claims description 4
- 102100035784 Decorin Human genes 0.000 claims description 4
- 102100031598 Dedicator of cytokinesis protein 1 Human genes 0.000 claims description 4
- 102100031601 Dedicator of cytokinesis protein 11 Human genes 0.000 claims description 4
- 102100022735 Diacylglycerol kinase alpha Human genes 0.000 claims description 4
- 102100024746 Dihydrofolate reductase Human genes 0.000 claims description 4
- 102100022258 Disks large homolog 5 Human genes 0.000 claims description 4
- 102100034109 DnaJ homolog subfamily C member 13 Human genes 0.000 claims description 4
- 102100024105 DnaJ homolog subfamily C member 27 Human genes 0.000 claims description 4
- 102100024821 Dynamin-binding protein Human genes 0.000 claims description 4
- 102100031637 Dynein axonemal heavy chain 8 Human genes 0.000 claims description 4
- 102100037734 Dynein regulatory complex protein 9 Human genes 0.000 claims description 4
- 102100031814 EGF-containing fibulin-like extracellular matrix protein 1 Human genes 0.000 claims description 4
- 102100031856 ERBB receptor feedback inhibitor 1 Human genes 0.000 claims description 4
- 102100021717 Early growth response protein 3 Human genes 0.000 claims description 4
- 102100037074 Ellis-van Creveld syndrome protein Human genes 0.000 claims description 4
- 102100035090 Elongator complex protein 4 Human genes 0.000 claims description 4
- 101710167759 Elongator complex protein 4 Proteins 0.000 claims description 4
- 102100031726 Endoplasmic reticulum junction formation protein lunapark Human genes 0.000 claims description 4
- 102100036823 Erlin-2 Human genes 0.000 claims description 4
- 102100037122 Extracellular matrix organizing protein FRAS1 Human genes 0.000 claims description 4
- 102100026104 F-BAR domain only protein 1 Human genes 0.000 claims description 4
- 102100027267 FERM, ARHGEF and pleckstrin domain-containing protein 1 Human genes 0.000 claims description 4
- 102100027868 FHF complex subunit HOOK interacting protein 1A Human genes 0.000 claims description 4
- 102100037819 Fas apoptotic inhibitory molecule 1 Human genes 0.000 claims description 4
- 102100038522 Fascin-2 Human genes 0.000 claims description 4
- 102100023600 Fibroblast growth factor receptor 2 Human genes 0.000 claims description 4
- 101710182389 Fibroblast growth factor receptor 2 Proteins 0.000 claims description 4
- 102100038647 Fibroleukin Human genes 0.000 claims description 4
- 102100031813 Fibulin-2 Human genes 0.000 claims description 4
- 102100021245 G-protein coupled receptor 183 Human genes 0.000 claims description 4
- 102100032523 G-protein coupled receptor family C group 5 member B Human genes 0.000 claims description 4
- 102100035189 GPI ethanolamine phosphate transferase 1 Human genes 0.000 claims description 4
- 102100037948 GTP-binding protein Di-Ras3 Human genes 0.000 claims description 4
- 102100028496 Galactocerebrosidase Human genes 0.000 claims description 4
- 102100028464 Galactose-3-O-sulfotransferase 4 Human genes 0.000 claims description 4
- 102100024375 Gamma-glutamylaminecyclotransferase Human genes 0.000 claims description 4
- 101710201613 Gamma-glutamylaminecyclotransferase Proteins 0.000 claims description 4
- 102100039847 Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1 Human genes 0.000 claims description 4
- 101710088083 Glomulin Proteins 0.000 claims description 4
- 102100041033 Golgin subfamily B member 1 Human genes 0.000 claims description 4
- 102100023001 Growth hormone-regulated TBC protein 1 Human genes 0.000 claims description 4
- 102100035368 Growth/differentiation factor 6 Human genes 0.000 claims description 4
- 102100032134 Guanine nucleotide exchange factor VAV2 Human genes 0.000 claims description 4
- 102100025334 Guanine nucleotide-binding protein G(q) subunit alpha Human genes 0.000 claims description 4
- 102100033968 Guanylyl cyclase-activating protein 2 Human genes 0.000 claims description 4
- 108700039143 HMGA2 Proteins 0.000 claims description 4
- 108010081348 HRT1 protein Hairy Proteins 0.000 claims description 4
- 102100021881 Hairy/enhancer-of-split related with YRPW motif protein 1 Human genes 0.000 claims description 4
- 102100040408 Heat shock 70 kDa protein 1-like Human genes 0.000 claims description 4
- 102100027489 Helicase-like transcription factor Human genes 0.000 claims description 4
- 108010007707 Hepatitis A Virus Cellular Receptor 2 Proteins 0.000 claims description 4
- 102100034458 Hepatitis A virus cellular receptor 2 Human genes 0.000 claims description 4
- 102100031188 Hephaestin Human genes 0.000 claims description 4
- 102100028999 High mobility group protein HMGI-C Human genes 0.000 claims description 4
- 102100038561 Highly divergent homeobox Human genes 0.000 claims description 4
- 102100029076 Histamine N-methyltransferase Human genes 0.000 claims description 4
- 102100038885 Histone acetyltransferase p300 Human genes 0.000 claims description 4
- 102100021453 Histone deacetylase 5 Human genes 0.000 claims description 4
- 101150073387 Hmga2 gene Proteins 0.000 claims description 4
- 101001126450 Homo sapiens 1-acyl-sn-glycerol-3-phosphate acyltransferase delta Proteins 0.000 claims description 4
- 101000727483 Homo sapiens 28S ribosomal protein S28, mitochondrial Proteins 0.000 claims description 4
- 101000689823 Homo sapiens 28S ribosomal protein S35, mitochondrial Proteins 0.000 claims description 4
- 101001050680 Homo sapiens 3-ketodihydrosphingosine reductase Proteins 0.000 claims description 4
- 101000733888 Homo sapiens 39S ribosomal protein L45, mitochondrial Proteins 0.000 claims description 4
- 101001119189 Homo sapiens 40S ribosomal protein S10 Proteins 0.000 claims description 4
- 101000774732 Homo sapiens A-kinase anchor protein 3 Proteins 0.000 claims description 4
- 101000974504 Homo sapiens ADP-ribosylation factor-like protein 15 Proteins 0.000 claims description 4
- 101000685218 Homo sapiens ADP-ribosylation factor-like protein 9 Proteins 0.000 claims description 4
- 101000833166 Homo sapiens AF4/FMR2 family member 3 Proteins 0.000 claims description 4
- 101000792947 Homo sapiens AT-rich interactive domain-containing protein 5B Proteins 0.000 claims description 4
- 101000929654 Homo sapiens ATP-binding cassette sub-family A member 10 Proteins 0.000 claims description 4
- 101000986633 Homo sapiens ATP-binding cassette sub-family C member 3 Proteins 0.000 claims description 4
- 101000874173 Homo sapiens ATP-dependent RNA helicase DDX42 Proteins 0.000 claims description 4
- 101000830424 Homo sapiens ATP-dependent RNA helicase DDX50 Proteins 0.000 claims description 4
- 101000780587 Homo sapiens ATPase family protein 2 homolog Proteins 0.000 claims description 4
- 101000874516 Homo sapiens Acetylgalactosaminyl-O-glycosyl-glycoprotein beta-1,3-N-acetylglucosaminyltransferase Proteins 0.000 claims description 4
- 101000929319 Homo sapiens Actin, aortic smooth muscle Proteins 0.000 claims description 4
- 101000959328 Homo sapiens Adenylate cyclase type 3 Proteins 0.000 claims description 4
- 101000775481 Homo sapiens Adenylate cyclase type 8 Proteins 0.000 claims description 4
- 101000959602 Homo sapiens Adhesion G-protein coupled receptor G6 Proteins 0.000 claims description 4
- 101000775460 Homo sapiens Alcohol dehydrogenase 6 Proteins 0.000 claims description 4
- 101000799076 Homo sapiens Alpha-adducin Proteins 0.000 claims description 4
- 101000833549 Homo sapiens Alpha-internexin Proteins 0.000 claims description 4
- 101000924356 Homo sapiens Ankyrin repeat domain-containing protein 33B Proteins 0.000 claims description 4
- 101000796083 Homo sapiens Ankyrin repeat family A protein 2 Proteins 0.000 claims description 4
- 101000796140 Homo sapiens Ankyrin-1 Proteins 0.000 claims description 4
- 101000928342 Homo sapiens Ankyrin-3 Proteins 0.000 claims description 4
- 101000768066 Homo sapiens Annexin A11 Proteins 0.000 claims description 4
- 101001061654 Homo sapiens Arginine-glutamic acid dipeptide repeats protein Proteins 0.000 claims description 4
- 101000971075 Homo sapiens Bcl-2-like protein 15 Proteins 0.000 claims description 4
- 101000894649 Homo sapiens Beclin-1 Proteins 0.000 claims description 4
- 101000887645 Homo sapiens Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase Proteins 0.000 claims description 4
- 101000798387 Homo sapiens Beta-1,3-galactosyltransferase 2 Proteins 0.000 claims description 4
- 101000729794 Homo sapiens Beta-1,4-glucuronyltransferase 1 Proteins 0.000 claims description 4
- 101000984934 Homo sapiens Butyrophilin subfamily 3 member A1 Proteins 0.000 claims description 4
- 101000945426 Homo sapiens CB1 cannabinoid receptor-interacting protein 1 Proteins 0.000 claims description 4
- 101000914155 Homo sapiens Cadherin EGF LAG seven-pass G-type receptor 1 Proteins 0.000 claims description 4
- 101000772572 Homo sapiens Carboxypeptidase A4 Proteins 0.000 claims description 4
- 101000910846 Homo sapiens Carboxypeptidase Q Proteins 0.000 claims description 4
- 101001026376 Homo sapiens Casein kinase I isoform epsilon Proteins 0.000 claims description 4
- 101001026384 Homo sapiens Casein kinase I isoform gamma-1 Proteins 0.000 claims description 4
- 101000741014 Homo sapiens Caspase-7 Proteins 0.000 claims description 4
- 101001028831 Homo sapiens Cation-independent mannose-6-phosphate receptor Proteins 0.000 claims description 4
- 101000907944 Homo sapiens Centromere protein I Proteins 0.000 claims description 4
- 101001016178 Homo sapiens Cilium assembly protein DZIP1L Proteins 0.000 claims description 4
- 101000749344 Homo sapiens Claudin-23 Proteins 0.000 claims description 4
- 101000727105 Homo sapiens Cleavage and polyadenylation specificity factor subunit 4 Proteins 0.000 claims description 4
- 101000715266 Homo sapiens Coiled-coil domain-containing glutamate-rich protein 2 Proteins 0.000 claims description 4
- 101000978258 Homo sapiens Coiled-coil domain-containing protein 122 Proteins 0.000 claims description 4
- 101000941708 Homo sapiens Collagen alpha-1(V) chain Proteins 0.000 claims description 4
- 101000909492 Homo sapiens Collagen alpha-1(VIII) chain Proteins 0.000 claims description 4
- 101000710623 Homo sapiens Collagen alpha-1(XI) chain Proteins 0.000 claims description 4
- 101000909626 Homo sapiens Collagen alpha-1(XIV) chain Proteins 0.000 claims description 4
- 101000899935 Homo sapiens Collagen alpha-1(XV) chain Proteins 0.000 claims description 4
- 101000941596 Homo sapiens Collagen alpha-3(V) chain Proteins 0.000 claims description 4
- 101000909495 Homo sapiens Collagen alpha-6(VI) chain Proteins 0.000 claims description 4
- 101000909528 Homo sapiens Collectin-12 Proteins 0.000 claims description 4
- 101000910263 Homo sapiens Cullin-associated NEDD8-dissociated protein 2 Proteins 0.000 claims description 4
- 101000771069 Homo sapiens Cyclic nucleotide-gated cation channel alpha-4 Proteins 0.000 claims description 4
- 101000900815 Homo sapiens Cyclin N-terminal domain-containing protein 1 Proteins 0.000 claims description 4
- 101000884183 Homo sapiens Cyclin-F Proteins 0.000 claims description 4
- 101000725164 Homo sapiens Cytochrome P450 1B1 Proteins 0.000 claims description 4
- 101000870148 Homo sapiens Cytoglobin Proteins 0.000 claims description 4
- 101000956431 Homo sapiens Cytokine receptor-like factor 1 Proteins 0.000 claims description 4
- 101000915295 Homo sapiens Cytoplasmic dynein 1 intermediate chain 1 Proteins 0.000 claims description 4
- 101001058422 Homo sapiens D-glucuronyl C5-epimerase Proteins 0.000 claims description 4
- 101000917433 Homo sapiens DDB1- and CUL4-associated factor 17 Proteins 0.000 claims description 4
- 101000870904 Homo sapiens DENN domain-containing protein 1A Proteins 0.000 claims description 4
- 101000722275 Homo sapiens DENN domain-containing protein 5A Proteins 0.000 claims description 4
- 101000865183 Homo sapiens DEP domain-containing mTOR-interacting protein Proteins 0.000 claims description 4
- 101000720858 Homo sapiens DNA damage-inducible transcript 4-like protein Proteins 0.000 claims description 4
- 101000920778 Homo sapiens DNA excision repair protein ERCC-8 Proteins 0.000 claims description 4
- 101000825159 Homo sapiens DNA repair-scaffolding protein Proteins 0.000 claims description 4
- 101001000206 Homo sapiens Decorin Proteins 0.000 claims description 4
- 101000866235 Homo sapiens Dedicator of cytokinesis protein 1 Proteins 0.000 claims description 4
- 101000866270 Homo sapiens Dedicator of cytokinesis protein 11 Proteins 0.000 claims description 4
- 101001044817 Homo sapiens Diacylglycerol kinase alpha Proteins 0.000 claims description 4
- 101000902114 Homo sapiens Disks large homolog 5 Proteins 0.000 claims description 4
- 101000870239 Homo sapiens DnaJ homolog subfamily C member 13 Proteins 0.000 claims description 4
- 101001054007 Homo sapiens DnaJ homolog subfamily C member 27 Proteins 0.000 claims description 4
- 101000909230 Homo sapiens Dynamin-binding protein Proteins 0.000 claims description 4
- 101000866323 Homo sapiens Dynein axonemal heavy chain 8 Proteins 0.000 claims description 4
- 101000880811 Homo sapiens Dynein regulatory complex protein 9 Proteins 0.000 claims description 4
- 101001065272 Homo sapiens EGF-containing fibulin-like extracellular matrix protein 1 Proteins 0.000 claims description 4
- 101000920812 Homo sapiens ERBB receptor feedback inhibitor 1 Proteins 0.000 claims description 4
- 101000896450 Homo sapiens Early growth response protein 3 Proteins 0.000 claims description 4
- 101000851054 Homo sapiens Elastin Proteins 0.000 claims description 4
- 101000881890 Homo sapiens Ellis-van Creveld syndrome protein Proteins 0.000 claims description 4
- 101000941029 Homo sapiens Endoplasmic reticulum junction formation protein lunapark Proteins 0.000 claims description 4
- 101000851719 Homo sapiens Erlin-2 Proteins 0.000 claims description 4
- 101001029168 Homo sapiens Extracellular matrix organizing protein FRAS1 Proteins 0.000 claims description 4
- 101000913095 Homo sapiens F-BAR domain only protein 1 Proteins 0.000 claims description 4
- 101000914701 Homo sapiens FERM, ARHGEF and pleckstrin domain-containing protein 1 Proteins 0.000 claims description 4
- 101001060551 Homo sapiens FHF complex subunit HOOK interacting protein 1A Proteins 0.000 claims description 4
- 101000878509 Homo sapiens Fas apoptotic inhibitory molecule 1 Proteins 0.000 claims description 4
- 101001030534 Homo sapiens Fascin-2 Proteins 0.000 claims description 4
- 101001031613 Homo sapiens Fibroleukin Proteins 0.000 claims description 4
- 101001065274 Homo sapiens Fibulin-2 Proteins 0.000 claims description 4
- 101001040801 Homo sapiens G-protein coupled receptor 183 Proteins 0.000 claims description 4
- 101001014684 Homo sapiens G-protein coupled receptor family C group 5 member B Proteins 0.000 claims description 4
- 101001093751 Homo sapiens GPI ethanolamine phosphate transferase 1 Proteins 0.000 claims description 4
- 101000951235 Homo sapiens GTP-binding protein Di-Ras3 Proteins 0.000 claims description 4
- 101000860395 Homo sapiens Galactocerebrosidase Proteins 0.000 claims description 4
- 101001061348 Homo sapiens Galactose-3-O-sulfotransferase 4 Proteins 0.000 claims description 4
- 101000887519 Homo sapiens Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1 Proteins 0.000 claims description 4
- 101001039321 Homo sapiens Golgin subfamily B member 1 Proteins 0.000 claims description 4
- 101000903509 Homo sapiens Growth hormone-regulated TBC protein 1 Proteins 0.000 claims description 4
- 101001023964 Homo sapiens Growth/differentiation factor 6 Proteins 0.000 claims description 4
- 101000775776 Homo sapiens Guanine nucleotide exchange factor VAV2 Proteins 0.000 claims description 4
- 101000857888 Homo sapiens Guanine nucleotide-binding protein G(q) subunit alpha Proteins 0.000 claims description 4
- 101001068475 Homo sapiens Guanylyl cyclase-activating protein 2 Proteins 0.000 claims description 4
- 101001037977 Homo sapiens Heat shock 70 kDa protein 1-like Proteins 0.000 claims description 4
- 101001081105 Homo sapiens Helicase-like transcription factor Proteins 0.000 claims description 4
- 101000993183 Homo sapiens Hephaestin Proteins 0.000 claims description 4
- 101001030706 Homo sapiens Highly divergent homeobox Proteins 0.000 claims description 4
- 101000988655 Homo sapiens Histamine N-methyltransferase Proteins 0.000 claims description 4
- 101000882390 Homo sapiens Histone acetyltransferase p300 Proteins 0.000 claims description 4
- 101000899255 Homo sapiens Histone deacetylase 5 Proteins 0.000 claims description 4
- 101001079904 Homo sapiens Hyaluronan and proteoglycan link protein 1 Proteins 0.000 claims description 4
- 101001078445 Homo sapiens Hyaluronan and proteoglycan link protein 2 Proteins 0.000 claims description 4
- 101001045123 Homo sapiens Hyccin Proteins 0.000 claims description 4
- 101001034663 Homo sapiens Immunoglobulin superfamily DCC subclass member 4 Proteins 0.000 claims description 4
- 101001067522 Homo sapiens Inactive polypeptide N-acetylgalactosaminyltransferase-like protein 5 Proteins 0.000 claims description 4
- 101000953488 Homo sapiens Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 2 Proteins 0.000 claims description 4
- 101000852596 Homo sapiens Inositol-trisphosphate 3-kinase A Proteins 0.000 claims description 4
- 101001044927 Homo sapiens Insulin-like growth factor-binding protein 3 Proteins 0.000 claims description 4
- 101001078151 Homo sapiens Integrin alpha-11 Proteins 0.000 claims description 4
- 101000994322 Homo sapiens Integrin alpha-8 Proteins 0.000 claims description 4
- 101000997670 Homo sapiens Integrin beta-8 Proteins 0.000 claims description 4
- 101001010842 Homo sapiens Intraflagellar transport protein 57 homolog Proteins 0.000 claims description 4
- 101000975512 Homo sapiens Junctional protein associated with coronary artery disease Proteins 0.000 claims description 4
- 101000975502 Homo sapiens Keratin, type II cytoskeletal 7 Proteins 0.000 claims description 4
- 101000944957 Homo sapiens Keratin-associated protein 1-5 Proteins 0.000 claims description 4
- 101000971533 Homo sapiens Killer cell lectin-like receptor subfamily G member 1 Proteins 0.000 claims description 4
- 101001046589 Homo sapiens Krueppel-like factor 17 Proteins 0.000 claims description 4
- 101000608555 Homo sapiens LETM1 domain-containing protein LETM2, mitochondrial Proteins 0.000 claims description 4
- 101000745469 Homo sapiens Lambda-crystallin homolog Proteins 0.000 claims description 4
- 101000966290 Homo sapiens Lethal(3)malignant brain tumor-like protein 2 Proteins 0.000 claims description 4
- 101000984841 Homo sapiens Leucine-rich repeat-containing protein 42 Proteins 0.000 claims description 4
- 101001017592 Homo sapiens Mediator of RNA polymerase II transcription subunit 13-like Proteins 0.000 claims description 4
- 101001116388 Homo sapiens Melatonin-related receptor Proteins 0.000 claims description 4
- 101000823485 Homo sapiens Membrane protein FAM174A Proteins 0.000 claims description 4
- 101001018717 Homo sapiens Mitofusin-2 Proteins 0.000 claims description 4
- 101000998596 Homo sapiens NADH-cytochrome b5 reductase 2 Proteins 0.000 claims description 4
- 101000812677 Homo sapiens Nucleotide pyrophosphatase Proteins 0.000 claims description 4
- 101001018109 Homo sapiens Nucleotidyltransferase MB21D2 Proteins 0.000 claims description 4
- 101000839399 Homo sapiens Oxidoreductase HTATIP2 Proteins 0.000 claims description 4
- 101100174573 Homo sapiens PIKFYVE gene Proteins 0.000 claims description 4
- 101000871508 Homo sapiens PTB domain-containing engulfment adapter protein 1 Proteins 0.000 claims description 4
- 101001131972 Homo sapiens PX domain-containing protein kinase-like protein Proteins 0.000 claims description 4
- 101001001817 Homo sapiens Pejvakin Proteins 0.000 claims description 4
- 101000741790 Homo sapiens Peroxisome proliferator-activated receptor gamma Proteins 0.000 claims description 4
- 101001120056 Homo sapiens Phosphatidylinositol 3-kinase regulatory subunit alpha Proteins 0.000 claims description 4
- 101000595746 Homo sapiens Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit delta isoform Proteins 0.000 claims description 4
- 101001067396 Homo sapiens Phospholipid scramblase 1 Proteins 0.000 claims description 4
- 101001096190 Homo sapiens Pleckstrin homology domain-containing family A member 1 Proteins 0.000 claims description 4
- 101000829538 Homo sapiens Polypeptide N-acetylgalactosaminyltransferase 15 Proteins 0.000 claims description 4
- 101000888117 Homo sapiens Polypeptide N-acetylgalactosaminyltransferase 18 Proteins 0.000 claims description 4
- 101001077449 Homo sapiens Potassium voltage-gated channel subfamily S member 1 Proteins 0.000 claims description 4
- 101001077448 Homo sapiens Potassium voltage-gated channel subfamily S member 2 Proteins 0.000 claims description 4
- 101000874919 Homo sapiens Probable arginine-tRNA ligase, mitochondrial Proteins 0.000 claims description 4
- 101000649043 Homo sapiens Probable tRNA methyltransferase 9B Proteins 0.000 claims description 4
- 101000933604 Homo sapiens Protein BTG2 Proteins 0.000 claims description 4
- 101000989787 Homo sapiens Protein C12orf4 Proteins 0.000 claims description 4
- 101000766826 Homo sapiens Protein CIP2A Proteins 0.000 claims description 4
- 101001062760 Homo sapiens Protein FAM13A Proteins 0.000 claims description 4
- 101001048811 Homo sapiens Protein FAM162A Proteins 0.000 claims description 4
- 101000866633 Homo sapiens Protein Hook homolog 3 Proteins 0.000 claims description 4
- 101000583797 Homo sapiens Protein MCM10 homolog Proteins 0.000 claims description 4
- 101001094684 Homo sapiens Protein O-mannosyl-transferase 2 Proteins 0.000 claims description 4
- 101000652172 Homo sapiens Protein Smaug homolog 1 Proteins 0.000 claims description 4
- 101000928406 Homo sapiens Protein diaphanous homolog 3 Proteins 0.000 claims description 4
- 101000877404 Homo sapiens Protein enabled homolog Proteins 0.000 claims description 4
- 101000993776 Homo sapiens Protein inturned Proteins 0.000 claims description 4
- 101000742071 Homo sapiens Protein phosphatase 1 regulatory subunit 26 Proteins 0.000 claims description 4
- 101000685923 Homo sapiens Protein transport protein Sec24A Proteins 0.000 claims description 4
- 101001098529 Homo sapiens Proteinase-activated receptor 1 Proteins 0.000 claims description 4
- 101001062751 Homo sapiens Pseudokinase FAM20A Proteins 0.000 claims description 4
- 101000914635 Homo sapiens Putative uncharacterized protein C8orf44 Proteins 0.000 claims description 4
- 101001092125 Homo sapiens Replication protein A 70 kDa DNA-binding subunit Proteins 0.000 claims description 4
- 101001100101 Homo sapiens Retinoic acid-induced protein 3 Proteins 0.000 claims description 4
- 101001106406 Homo sapiens Rho GTPase-activating protein 1 Proteins 0.000 claims description 4
- 101000704874 Homo sapiens Rho family-interacting cell polarization regulator 2 Proteins 0.000 claims description 4
- 101000731726 Homo sapiens Rho guanine nucleotide exchange factor 16 Proteins 0.000 claims description 4
- 101000717377 Homo sapiens Ribokinase Proteins 0.000 claims description 4
- 101000933386 Homo sapiens S-methylmethionine-homocysteine S-methyltransferase BHMT2 Proteins 0.000 claims description 4
- 101000587811 Homo sapiens SPRY domain-containing protein 7 Proteins 0.000 claims description 4
- 101000936917 Homo sapiens Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Proteins 0.000 claims description 4
- 101000879836 Homo sapiens Secretion-regulating guanine nucleotide exchange factor Proteins 0.000 claims description 4
- 101000829211 Homo sapiens Serine/arginine repetitive matrix protein 1 Proteins 0.000 claims description 4
- 101000777293 Homo sapiens Serine/threonine-protein kinase Chk1 Proteins 0.000 claims description 4
- 101000885321 Homo sapiens Serine/threonine-protein kinase DCLK1 Proteins 0.000 claims description 4
- 101000864831 Homo sapiens Serine/threonine-protein kinase Sgk3 Proteins 0.000 claims description 4
- 101000770770 Homo sapiens Serine/threonine-protein kinase WNK1 Proteins 0.000 claims description 4
- 101000609926 Homo sapiens Sister chromatid cohesion protein PDS5 homolog B Proteins 0.000 claims description 4
- 101000687673 Homo sapiens Small integral membrane protein 6 Proteins 0.000 claims description 4
- 101000665023 Homo sapiens Sorting nexin-7 Proteins 0.000 claims description 4
- 101000952234 Homo sapiens Sphingolipid delta(4)-desaturase DES1 Proteins 0.000 claims description 4
- 101000716763 Homo sapiens Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial Proteins 0.000 claims description 4
- 101000820490 Homo sapiens Syntaxin-binding protein 6 Proteins 0.000 claims description 4
- 101000834988 Homo sapiens Telomere repeats-binding bouquet formation protein 1 Proteins 0.000 claims description 4
- 101000666421 Homo sapiens Terminal nucleotidyltransferase 5B Proteins 0.000 claims description 4
- 101000845201 Homo sapiens Tetratricopeptide repeat protein 7B Proteins 0.000 claims description 4
- 101000674603 Homo sapiens Threonine aspartase 1 Proteins 0.000 claims description 4
- 101001041525 Homo sapiens Transcription factor 12 Proteins 0.000 claims description 4
- 101000976959 Homo sapiens Transcription factor 4 Proteins 0.000 claims description 4
- 101000819088 Homo sapiens Transcription factor GATA-6 Proteins 0.000 claims description 4
- 101000625358 Homo sapiens Transcription initiation factor TFIID subunit 2 Proteins 0.000 claims description 4
- 101001049688 Homo sapiens Translation initiation factor eIF-2B subunit gamma Proteins 0.000 claims description 4
- 101000638078 Homo sapiens Transmembrane channel-like protein 3 Proteins 0.000 claims description 4
- 101000851588 Homo sapiens Transmembrane protein 214 Proteins 0.000 claims description 4
- 101000611194 Homo sapiens Trinucleotide repeat-containing gene 6A protein Proteins 0.000 claims description 4
- 101000610557 Homo sapiens U4/U6 small nuclear ribonucleoprotein Prp31 Proteins 0.000 claims description 4
- 101000906689 Homo sapiens Uncharacterized protein C12orf56 Proteins 0.000 claims description 4
- 101000956356 Homo sapiens Uncharacterized protein C19orf47 Proteins 0.000 claims description 4
- 101000709994 Homo sapiens Uncharacterized protein C7orf31 Proteins 0.000 claims description 4
- 101000944558 Homo sapiens Uncharacterized protein C8orf88 Proteins 0.000 claims description 4
- 101000776508 Homo sapiens Up-regulator of cell proliferation Proteins 0.000 claims description 4
- 101000851018 Homo sapiens Vascular endothelial growth factor receptor 1 Proteins 0.000 claims description 4
- 101000859452 Homo sapiens Very large A-kinase anchor protein Proteins 0.000 claims description 4
- 101000806266 Homo sapiens Very-long-chain 3-oxoacyl-CoA reductase Proteins 0.000 claims description 4
- 101000932850 Homo sapiens Voltage-dependent L-type calcium channel subunit beta-1 Proteins 0.000 claims description 4
- 101000740759 Homo sapiens Voltage-dependent calcium channel subunit alpha-2/delta-2 Proteins 0.000 claims description 4
- 101000743193 Homo sapiens WD repeat-containing protein 27 Proteins 0.000 claims description 4
- 101000650035 Homo sapiens WD repeat-containing protein 91 Proteins 0.000 claims description 4
- 101000788847 Homo sapiens Zinc finger CCHC domain-containing protein 8 Proteins 0.000 claims description 4
- 101000759241 Homo sapiens Zinc finger protein 138 Proteins 0.000 claims description 4
- 101000782169 Homo sapiens Zinc finger protein 232 Proteins 0.000 claims description 4
- 101000818450 Homo sapiens Zinc finger protein 82 homolog Proteins 0.000 claims description 4
- 101000940142 Homo sapiens tRNA wybutosine-synthesizing protein 5 Proteins 0.000 claims description 4
- 102100028084 Hyaluronan and proteoglycan link protein 1 Human genes 0.000 claims description 4
- 102100025264 Hyaluronan and proteoglycan link protein 2 Human genes 0.000 claims description 4
- 102100022652 Hyccin Human genes 0.000 claims description 4
- 102100034132 Hydroxyacid-oxoacid transhydrogenase, mitochondrial Human genes 0.000 claims description 4
- 102100039724 Immunoglobulin superfamily DCC subclass member 4 Human genes 0.000 claims description 4
- 102100037736 Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 2 Human genes 0.000 claims description 4
- 102100036405 Inositol-trisphosphate 3-kinase A Human genes 0.000 claims description 4
- 102100022708 Insulin-like growth factor-binding protein 3 Human genes 0.000 claims description 4
- 102100025320 Integrin alpha-11 Human genes 0.000 claims description 4
- 102100032825 Integrin alpha-8 Human genes 0.000 claims description 4
- 102100033336 Integrin beta-8 Human genes 0.000 claims description 4
- 101800003050 Interleukin-16 Proteins 0.000 claims description 4
- 102100029996 Intraflagellar transport protein 57 homolog Human genes 0.000 claims description 4
- 108091092195 Intron Proteins 0.000 claims description 4
- 102100025392 Isovaleryl-CoA dehydrogenase, mitochondrial Human genes 0.000 claims description 4
- 101710201965 Isovaleryl-CoA dehydrogenase, mitochondrial Proteins 0.000 claims description 4
- 102100023957 Junctional protein associated with coronary artery disease Human genes 0.000 claims description 4
- 101710059433 KIAA1755 Proteins 0.000 claims description 4
- 102100023974 Keratin, type II cytoskeletal 7 Human genes 0.000 claims description 4
- 102100033546 Keratin-associated protein 1-5 Human genes 0.000 claims description 4
- 102100021457 Killer cell lectin-like receptor subfamily G member 1 Human genes 0.000 claims description 4
- 102100022249 Krueppel-like factor 17 Human genes 0.000 claims description 4
- 102100039183 LETM1 domain-containing protein LETM2, mitochondrial Human genes 0.000 claims description 4
- 102100039324 Lambda-crystallin homolog Human genes 0.000 claims description 4
- 102100040546 Lethal(3)malignant brain tumor-like protein 2 Human genes 0.000 claims description 4
- 102100027170 Leucine-rich repeat-containing protein 42 Human genes 0.000 claims description 4
- 108050003065 Limbin Proteins 0.000 claims description 4
- 102100035135 Limbin Human genes 0.000 claims description 4
- 101710045703 MTERF3 Proteins 0.000 claims description 4
- 102100034164 Mediator of RNA polymerase II transcription subunit 13-like Human genes 0.000 claims description 4
- 102100024972 Melatonin-related receptor Human genes 0.000 claims description 4
- 102100022634 Membrane protein FAM174A Human genes 0.000 claims description 4
- 102100033703 Mitofusin-2 Human genes 0.000 claims description 4
- 102100033168 NADH-cytochrome b5 reductase 2 Human genes 0.000 claims description 4
- 108010025020 Nerve Growth Factor Proteins 0.000 claims description 4
- 102100039306 Nucleotide pyrophosphatase Human genes 0.000 claims description 4
- 102100033052 Nucleotidyltransferase MB21D2 Human genes 0.000 claims description 4
- 102100027952 Oxidoreductase HTATIP2 Human genes 0.000 claims description 4
- 102100033719 PTB domain-containing engulfment adapter protein 1 Human genes 0.000 claims description 4
- 102100034602 PX domain-containing protein kinase-like protein Human genes 0.000 claims description 4
- 102100036328 Pejvakin Human genes 0.000 claims description 4
- 102100020954 Peroxisomal membrane protein PMP34 Human genes 0.000 claims description 4
- 102100038825 Peroxisome proliferator-activated receptor gamma Human genes 0.000 claims description 4
- 102100026169 Phosphatidylinositol 3-kinase regulatory subunit alpha Human genes 0.000 claims description 4
- 102100036056 Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit delta isoform Human genes 0.000 claims description 4
- 102100034627 Phospholipid scramblase 1 Human genes 0.000 claims description 4
- 102100037862 Pleckstrin homology domain-containing family A member 1 Human genes 0.000 claims description 4
- 102100023229 Polypeptide N-acetylgalactosaminyltransferase 15 Human genes 0.000 claims description 4
- 102100025066 Potassium voltage-gated channel subfamily S member 1 Human genes 0.000 claims description 4
- 102100025065 Potassium voltage-gated channel subfamily S member 2 Human genes 0.000 claims description 4
- 102100026884 Pro-interleukin-16 Human genes 0.000 claims description 4
- 102100036134 Probable arginine-tRNA ligase, mitochondrial Human genes 0.000 claims description 4
- 102100028105 Probable tRNA methyltransferase 9B Human genes 0.000 claims description 4
- 102100023832 Prolyl endopeptidase FAP Human genes 0.000 claims description 4
- 102100026034 Protein BTG2 Human genes 0.000 claims description 4
- 102100029336 Protein C12orf4 Human genes 0.000 claims description 4
- 102100028634 Protein CIP2A Human genes 0.000 claims description 4
- 102100030557 Protein FAM13A Human genes 0.000 claims description 4
- 102100023788 Protein FAM162A Human genes 0.000 claims description 4
- 102100031717 Protein Hook homolog 3 Human genes 0.000 claims description 4
- 102100030962 Protein MCM10 homolog Human genes 0.000 claims description 4
- 102100035490 Protein O-mannosyl-transferase 2 Human genes 0.000 claims description 4
- 102100030591 Protein Smaug homolog 1 Human genes 0.000 claims description 4
- 102100036468 Protein diaphanous homolog 3 Human genes 0.000 claims description 4
- 102100035093 Protein enabled homolog Human genes 0.000 claims description 4
- 102100031753 Protein inturned Human genes 0.000 claims description 4
- 102100038674 Protein phosphatase 1 regulatory subunit 26 Human genes 0.000 claims description 4
- 102100023368 Protein transport protein Sec24A Human genes 0.000 claims description 4
- 102100037136 Proteinase-activated receptor 1 Human genes 0.000 claims description 4
- 102100030553 Pseudokinase FAM20A Human genes 0.000 claims description 4
- 102100027175 Putative uncharacterized protein C8orf44 Human genes 0.000 claims description 4
- 101000629598 Rattus norvegicus Sterol regulatory element-binding protein 1 Proteins 0.000 claims description 4
- 102100038453 Retinoic acid-induced protein 3 Human genes 0.000 claims description 4
- 102100021433 Rho GTPase-activating protein 1 Human genes 0.000 claims description 4
- 102100032023 Rho family-interacting cell polarization regulator 2 Human genes 0.000 claims description 4
- 102100032436 Rho guanine nucleotide exchange factor 16 Human genes 0.000 claims description 4
- 102100020783 Ribokinase Human genes 0.000 claims description 4
- 102100025992 S-methylmethionine-homocysteine S-methyltransferase BHMT2 Human genes 0.000 claims description 4
- 108091006620 SLC12A2 Proteins 0.000 claims description 4
- 108091006431 SLC25A17 Proteins 0.000 claims description 4
- 108091007001 SLC44A2 Proteins 0.000 claims description 4
- 102100037356 SLIT-ROBO Rho GTPase-activating protein 1 Human genes 0.000 claims description 4
- 102100031123 SPRY domain-containing protein 7 Human genes 0.000 claims description 4
- 101100379220 Saccharomyces cerevisiae (strain ATCC 204508 / S288c) API2 gene Proteins 0.000 claims description 4
- 102100027733 Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Human genes 0.000 claims description 4
- 102100037341 Secretion-regulating guanine nucleotide exchange factor Human genes 0.000 claims description 4
- 102100023664 Serine/arginine repetitive matrix protein 1 Human genes 0.000 claims description 4
- 102100031081 Serine/threonine-protein kinase Chk1 Human genes 0.000 claims description 4
- 102100039758 Serine/threonine-protein kinase DCLK1 Human genes 0.000 claims description 4
- 102100030071 Serine/threonine-protein kinase Sgk3 Human genes 0.000 claims description 4
- 102100029064 Serine/threonine-protein kinase WNK1 Human genes 0.000 claims description 4
- 102100039163 Sister chromatid cohesion protein PDS5 homolog B Human genes 0.000 claims description 4
- 102100024806 Small integral membrane protein 6 Human genes 0.000 claims description 4
- 102100038627 Sorting nexin-7 Human genes 0.000 claims description 4
- 102100037416 Sphingolipid delta(4)-desaturase DES1 Human genes 0.000 claims description 4
- 101150066728 Srgap1 gene Proteins 0.000 claims description 4
- 102100020868 Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial Human genes 0.000 claims description 4
- 102100021681 Syntaxin-binding protein 6 Human genes 0.000 claims description 4
- 108010001288 T-Lymphoma Invasion and Metastasis-inducing Protein 1 Proteins 0.000 claims description 4
- 102000002154 T-Lymphoma Invasion and Metastasis-inducing Protein 1 Human genes 0.000 claims description 4
- 102100026147 Telomere repeats-binding bouquet formation protein 1 Human genes 0.000 claims description 4
- 102100038310 Terminal nucleotidyltransferase 5B Human genes 0.000 claims description 4
- 102100031270 Tetratricopeptide repeat protein 7B Human genes 0.000 claims description 4
- 102100040483 Threonine aspartase 1 Human genes 0.000 claims description 4
- 102100021123 Transcription factor 12 Human genes 0.000 claims description 4
- 102100035101 Transcription factor 7-like 2 Human genes 0.000 claims description 4
- 102100021382 Transcription factor GATA-6 Human genes 0.000 claims description 4
- 102100025041 Transcription initiation factor TFIID subunit 2 Human genes 0.000 claims description 4
- 102100023225 Translation initiation factor eIF-2B subunit gamma Human genes 0.000 claims description 4
- 102100032048 Transmembrane channel-like protein 3 Human genes 0.000 claims description 4
- 102100036748 Transmembrane protein 214 Human genes 0.000 claims description 4
- 102100040241 Trinucleotide repeat-containing gene 6A protein Human genes 0.000 claims description 4
- 102100024537 Tyrosine-protein kinase Fer Human genes 0.000 claims description 4
- 102100040118 U4/U6 small nuclear ribonucleoprotein Prp31 Human genes 0.000 claims description 4
- 102100023446 Uncharacterized protein C12orf56 Human genes 0.000 claims description 4
- 102100038502 Uncharacterized protein C19orf47 Human genes 0.000 claims description 4
- 102100034637 Uncharacterized protein C7orf31 Human genes 0.000 claims description 4
- 102100033666 Uncharacterized protein C8orf88 Human genes 0.000 claims description 4
- 102100022856 Uncharacterized protein KIAA1755 Human genes 0.000 claims description 4
- 102100031205 Up-regulator of cell proliferation Human genes 0.000 claims description 4
- 102100038282 V-type immunoglobulin domain-containing suppressor of T-cell activation Human genes 0.000 claims description 4
- 102100033178 Vascular endothelial growth factor receptor 1 Human genes 0.000 claims description 4
- 102100027989 Very large A-kinase anchor protein Human genes 0.000 claims description 4
- 102100037438 Very-long-chain 3-oxoacyl-CoA reductase Human genes 0.000 claims description 4
- 102100025568 Voltage-dependent L-type calcium channel subunit beta-1 Human genes 0.000 claims description 4
- 102100037058 Voltage-dependent calcium channel subunit alpha-2/delta-2 Human genes 0.000 claims description 4
- 102100038159 WD repeat-containing protein 27 Human genes 0.000 claims description 4
- 102100028273 WD repeat-containing protein 91 Human genes 0.000 claims description 4
- 102100025400 Zinc finger CCHC domain-containing protein 8 Human genes 0.000 claims description 4
- 102100023394 Zinc finger protein 138 Human genes 0.000 claims description 4
- 102100036549 Zinc finger protein 232 Human genes 0.000 claims description 4
- 102100021138 Zinc finger protein 82 homolog Human genes 0.000 claims description 4
- 101150031702 adhfe1 gene Proteins 0.000 claims description 4
- 108020001096 dihydrofolate reductase Proteins 0.000 claims description 4
- 108010067366 proto-oncogene protein c-fes-fps Proteins 0.000 claims description 4
- 102100031143 tRNA wybutosine-synthesizing protein 5 Human genes 0.000 claims description 4
- OTJMDLIUFVHKNU-UHFFFAOYSA-N 2-hydroxy-5-methylidene-3-(piperidin-1-ylamino)cyclopent-2-en-1-one Chemical compound C1C(=C)C(=O)C(O)=C1NN1CCCCC1 OTJMDLIUFVHKNU-UHFFFAOYSA-N 0.000 claims description 3
- 102100039222 5'-3' exoribonuclease 2 Human genes 0.000 claims description 3
- 102100021548 5-methylcytosine rRNA methyltransferase NSUN4 Human genes 0.000 claims description 3
- 108091007505 ADAM17 Proteins 0.000 claims description 3
- 102100032792 ATPase family AAA domain-containing protein 2B Human genes 0.000 claims description 3
- 102100021761 Alpha-mannosidase 2 Human genes 0.000 claims description 3
- 101710191958 Amino-acid acetyltransferase Proteins 0.000 claims description 3
- 101710185938 Amino-acid acetyltransferase, mitochondrial Proteins 0.000 claims description 3
- 102100036131 Arginine-tRNA ligase, cytoplasmic Human genes 0.000 claims description 3
- 102100022108 Aspartyl/asparaginyl beta-hydroxylase Human genes 0.000 claims description 3
- 102100031173 CCN family member 4 Human genes 0.000 claims description 3
- 101710036791 CEP192 Proteins 0.000 claims description 3
- 102000015347 COP1 Human genes 0.000 claims description 3
- 108060001826 COP1 Proteins 0.000 claims description 3
- 102100028244 COP9 signalosome complex subunit 7b Human genes 0.000 claims description 3
- 102100024154 Cadherin-13 Human genes 0.000 claims description 3
- 102100024317 Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1C Human genes 0.000 claims description 3
- 102100039370 Carbohydrate deacetylase Human genes 0.000 claims description 3
- 102100025045 Cell cycle checkpoint control protein RAD9B Human genes 0.000 claims description 3
- 102100036178 Centrosomal protein of 192 kDa Human genes 0.000 claims description 3
- 102100035300 Cystine/glutamate transporter Human genes 0.000 claims description 3
- 102100028712 Cytosolic purine 5'-nucleotidase Human genes 0.000 claims description 3
- 102100037165 DBH-like monooxygenase protein 1 Human genes 0.000 claims description 3
- 102100037098 DCN1-like protein 4 Human genes 0.000 claims description 3
- 102100039524 DNA endonuclease RBBP8 Human genes 0.000 claims description 3
- 102100035186 DNA excision repair protein ERCC-1 Human genes 0.000 claims description 3
- 102100029763 DNA polymerase nu Human genes 0.000 claims description 3
- 102100037794 Diacylglycerol lipase-beta Human genes 0.000 claims description 3
- 102100031111 Disintegrin and metalloproteinase domain-containing protein 17 Human genes 0.000 claims description 3
- 102100037983 Disks large-associated protein 4 Human genes 0.000 claims description 3
- 102100038415 ELKS/Rab6-interacting/CAST family member 1 Human genes 0.000 claims description 3
- 102100021655 Extracellular sulfatase Sulf-1 Human genes 0.000 claims description 3
- 102100027279 FAS-associated factor 1 Human genes 0.000 claims description 3
- 102100040129 FH1/FH2 domain-containing protein 3 Human genes 0.000 claims description 3
- 102100027560 Focadhesin Human genes 0.000 claims description 3
- 102100023941 G-protein-signaling modulator 2 Human genes 0.000 claims description 3
- 102100032560 Golgin subfamily A member 4 Human genes 0.000 claims description 3
- 102100021888 Helix-loop-helix protein 1 Human genes 0.000 claims description 3
- 102100028902 Hermansky-Pudlak syndrome 1 protein Human genes 0.000 claims description 3
- 102100024233 High affinity cAMP-specific 3',5'-cyclic phosphodiesterase 7A Human genes 0.000 claims description 3
- 102100032804 Histone-lysine N-methyltransferase SMYD3 Human genes 0.000 claims description 3
- 101000745788 Homo sapiens 5'-3' exoribonuclease 2 Proteins 0.000 claims description 3
- 101001108645 Homo sapiens 5-methylcytosine rRNA methyltransferase NSUN4 Proteins 0.000 claims description 3
- 101000923353 Homo sapiens ATPase family AAA domain-containing protein 2B Proteins 0.000 claims description 3
- 101000615953 Homo sapiens Alpha-mannosidase 2 Proteins 0.000 claims description 3
- 101000874860 Homo sapiens Arginine-tRNA ligase, cytoplasmic Proteins 0.000 claims description 3
- 101000901030 Homo sapiens Aspartyl/asparaginyl beta-hydroxylase Proteins 0.000 claims description 3
- 101000952934 Homo sapiens Atrial natriuretic peptide-converting enzyme Proteins 0.000 claims description 3
- 101000777560 Homo sapiens CCN family member 4 Proteins 0.000 claims description 3
- 101000860489 Homo sapiens COP9 signalosome complex subunit 7b Proteins 0.000 claims description 3
- 101000762243 Homo sapiens Cadherin-13 Proteins 0.000 claims description 3
- 101001117094 Homo sapiens Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1C Proteins 0.000 claims description 3
- 101000961486 Homo sapiens Carbohydrate deacetylase Proteins 0.000 claims description 3
- 101001077512 Homo sapiens Cell cycle checkpoint control protein RAD9B Proteins 0.000 claims description 3
- 101000915162 Homo sapiens Cytosolic purine 5'-nucleotidase Proteins 0.000 claims description 3
- 101001028766 Homo sapiens DBH-like monooxygenase protein 1 Proteins 0.000 claims description 3
- 101001053257 Homo sapiens DCC-interacting protein 13-beta Proteins 0.000 claims description 3
- 101000954846 Homo sapiens DCN1-like protein 4 Proteins 0.000 claims description 3
- 101000746134 Homo sapiens DNA endonuclease RBBP8 Proteins 0.000 claims description 3
- 101000876529 Homo sapiens DNA excision repair protein ERCC-1 Proteins 0.000 claims description 3
- 101000865101 Homo sapiens DNA polymerase nu Proteins 0.000 claims description 3
- 101000950829 Homo sapiens Diacylglycerol lipase-beta Proteins 0.000 claims description 3
- 101000951335 Homo sapiens Disks large-associated protein 4 Proteins 0.000 claims description 3
- 101001100208 Homo sapiens ELKS/Rab6-interacting/CAST family member 1 Proteins 0.000 claims description 3
- 101000820630 Homo sapiens Extracellular sulfatase Sulf-1 Proteins 0.000 claims description 3
- 101000914654 Homo sapiens FAS-associated factor 1 Proteins 0.000 claims description 3
- 101000890757 Homo sapiens FH1/FH2 domain-containing protein 3 Proteins 0.000 claims description 3
- 101000861534 Homo sapiens Focadhesin Proteins 0.000 claims description 3
- 101000904754 Homo sapiens G-protein-signaling modulator 2 Proteins 0.000 claims description 3
- 101001014636 Homo sapiens Golgin subfamily A member 4 Proteins 0.000 claims description 3
- 101000897691 Homo sapiens Helix-loop-helix protein 1 Proteins 0.000 claims description 3
- 101000838926 Homo sapiens Hermansky-Pudlak syndrome 1 protein Proteins 0.000 claims description 3
- 101001117267 Homo sapiens High affinity cAMP-specific 3',5'-cyclic phosphodiesterase 7A Proteins 0.000 claims description 3
- 101000708574 Homo sapiens Histone-lysine N-methyltransferase SMYD3 Proteins 0.000 claims description 3
- 101000635408 Homo sapiens Inactive N-acetylated-alpha-linked acidic dipeptidase-like protein 2 Proteins 0.000 claims description 3
- 101001103039 Homo sapiens Inactive tyrosine-protein kinase transmembrane receptor ROR1 Proteins 0.000 claims description 3
- 101000852489 Homo sapiens Inositol 1,4,5-triphosphate receptor associated 1 Proteins 0.000 claims description 3
- 101001053320 Homo sapiens Inositol polyphosphate 5-phosphatase K Proteins 0.000 claims description 3
- 101000862611 Homo sapiens Intron Large complex component GCFC2 Proteins 0.000 claims description 3
- 101000944951 Homo sapiens Keratin-associated protein 1-1 Proteins 0.000 claims description 3
- 101000619927 Homo sapiens LIM/homeobox protein Lhx9 Proteins 0.000 claims description 3
- 101001135086 Homo sapiens Leiomodin-1 Proteins 0.000 claims description 3
- 101000620458 Homo sapiens Leucine-rich repeat LGI family member 2 Proteins 0.000 claims description 3
- 101001063463 Homo sapiens Leucine-rich repeat-containing G-protein coupled receptor 4 Proteins 0.000 claims description 3
- 101000579894 Homo sapiens Leucine-rich repeat-containing protein 39 Proteins 0.000 claims description 3
- 101001017764 Homo sapiens Lipopolysaccharide-responsive and beige-like anchor protein Proteins 0.000 claims description 3
- 101001043598 Homo sapiens Low-density lipoprotein receptor-related protein 4 Proteins 0.000 claims description 3
- 101001065609 Homo sapiens Lumican Proteins 0.000 claims description 3
- 101001038505 Homo sapiens Ly6/PLAUR domain-containing protein 1 Proteins 0.000 claims description 3
- 101001057234 Homo sapiens MAM domain-containing protein 2 Proteins 0.000 claims description 3
- 101000977270 Homo sapiens MMS19 nucleotide excision repair protein homolog Proteins 0.000 claims description 3
- 101001055956 Homo sapiens Mannan-binding lectin serine protease 1 Proteins 0.000 claims description 3
- 101000627858 Homo sapiens Matrix metalloproteinase-24 Proteins 0.000 claims description 3
- 101000636209 Homo sapiens Matrix-remodeling-associated protein 5 Proteins 0.000 claims description 3
- 101000978418 Homo sapiens Melanocortin receptor 4 Proteins 0.000 claims description 3
- 101000583150 Homo sapiens Membrane-associated phosphatidylinositol transfer protein 3 Proteins 0.000 claims description 3
- 101001030284 Homo sapiens Methylthioribulose-1-phosphate dehydratase Proteins 0.000 claims description 3
- 101000628968 Homo sapiens Mitogen-activated protein kinase 13 Proteins 0.000 claims description 3
- 101000955263 Homo sapiens Multiple epidermal growth factor-like domains protein 6 Proteins 0.000 claims description 3
- 101000968674 Homo sapiens MutS protein homolog 4 Proteins 0.000 claims description 3
- 101001023037 Homo sapiens Myoferlin Proteins 0.000 claims description 3
- 101001022780 Homo sapiens Myosin light chain kinase, smooth muscle Proteins 0.000 claims description 3
- 101000979259 Homo sapiens Neurolysin, mitochondrial Proteins 0.000 claims description 3
- 101000577541 Homo sapiens Neuronal regeneration-related protein Proteins 0.000 claims description 3
- 101001086785 Homo sapiens Occludin Proteins 0.000 claims description 3
- 101000586302 Homo sapiens Oncostatin-M-specific receptor subunit beta Proteins 0.000 claims description 3
- 101000738901 Homo sapiens PMS1 protein homolog 1 Proteins 0.000 claims description 3
- 101000604110 Homo sapiens Palmitoleoyl-protein carboxylesterase NOTUM Proteins 0.000 claims description 3
- 101001082142 Homo sapiens Pentraxin-related protein PTX3 Proteins 0.000 claims description 3
- 101001134861 Homo sapiens Pericentriolar material 1 protein Proteins 0.000 claims description 3
- 101000610652 Homo sapiens Peripherin-2 Proteins 0.000 claims description 3
- 101001045218 Homo sapiens Peroxisomal multifunctional enzyme type 2 Proteins 0.000 claims description 3
- 101001113717 Homo sapiens Phenazine biosynthesis-like domain-containing protein Proteins 0.000 claims description 3
- 101001094017 Homo sapiens Phosphatase and actin regulator 3 Proteins 0.000 claims description 3
- 101000595868 Homo sapiens Phosphatidylinositol transfer protein beta isoform Proteins 0.000 claims description 3
- 101000606878 Homo sapiens Platelet endothelial aggregation receptor 1 Proteins 0.000 claims description 3
- 101000611892 Homo sapiens Platelet-derived growth factor D Proteins 0.000 claims description 3
- 101001096179 Homo sapiens Pleckstrin homology domain-containing family A member 6 Proteins 0.000 claims description 3
- 101000583225 Homo sapiens Pleckstrin homology domain-containing family H member 2 Proteins 0.000 claims description 3
- 101001126466 Homo sapiens Pleckstrin-2 Proteins 0.000 claims description 3
- 101000595182 Homo sapiens Podocan Proteins 0.000 claims description 3
- 101000833167 Homo sapiens Poly(A) RNA polymerase GLD2 Proteins 0.000 claims description 3
- 101000609264 Homo sapiens Polyadenylate-binding protein-interacting protein 2B Proteins 0.000 claims description 3
- 101001135385 Homo sapiens Prostacyclin synthase Proteins 0.000 claims description 3
- 101000577424 Homo sapiens Proteasome subunit alpha type-4 Proteins 0.000 claims description 3
- 101000718497 Homo sapiens Protein AF-10 Proteins 0.000 claims description 3
- 101000947115 Homo sapiens Protein CASC3 Proteins 0.000 claims description 3
- 101000979760 Homo sapiens Protein NDNF Proteins 0.000 claims description 3
- 101000707247 Homo sapiens Protein Shroom3 Proteins 0.000 claims description 3
- 101000770799 Homo sapiens Protein Wnt-10b Proteins 0.000 claims description 3
- 101000873612 Homo sapiens Protein bicaudal D homolog 1 Proteins 0.000 claims description 3
- 101001051777 Homo sapiens Protein kinase C alpha type Proteins 0.000 claims description 3
- 101000742052 Homo sapiens Protein phosphatase 1E Proteins 0.000 claims description 3
- 101000736906 Homo sapiens Protein prune homolog 2 Proteins 0.000 claims description 3
- 101000666171 Homo sapiens Protein-glutamine gamma-glutamyltransferase 2 Proteins 0.000 claims description 3
- 101000655540 Homo sapiens Protransforming growth factor alpha Proteins 0.000 claims description 3
- 101000776455 Homo sapiens Putative uncharacterized protein encoded by LINC00472 Proteins 0.000 claims description 3
- 101000734537 Homo sapiens Pyridoxal-dependent decarboxylase domain-containing protein 1 Proteins 0.000 claims description 3
- 101000604116 Homo sapiens RNA-binding protein Nova-2 Proteins 0.000 claims description 3
- 101001110308 Homo sapiens Radixin Proteins 0.000 claims description 3
- 101000620554 Homo sapiens Ras-related protein Rab-38 Proteins 0.000 claims description 3
- 101001099876 Homo sapiens Ras-related protein Rab-44 Proteins 0.000 claims description 3
- 101001092185 Homo sapiens Regulator of cell cycle RGCC Proteins 0.000 claims description 3
- 101001094537 Homo sapiens Retrotransposon Gag-like protein 3 Proteins 0.000 claims description 3
- 101001051714 Homo sapiens Ribosomal protein S6 kinase beta-2 Proteins 0.000 claims description 3
- 101000880777 Homo sapiens SH3 and cysteine-rich domain-containing protein 2 Proteins 0.000 claims description 3
- 101001069710 Homo sapiens Serine protease 23 Proteins 0.000 claims description 3
- 101000697600 Homo sapiens Serine/threonine-protein kinase 32B Proteins 0.000 claims description 3
- 101001001648 Homo sapiens Serine/threonine-protein kinase pim-2 Proteins 0.000 claims description 3
- 101000597662 Homo sapiens Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform Proteins 0.000 claims description 3
- 101000836954 Homo sapiens Sialic acid-binding Ig-like lectin 10 Proteins 0.000 claims description 3
- 101000701574 Homo sapiens Small regulatory polypeptide of amino acid response Proteins 0.000 claims description 3
- 101000864070 Homo sapiens Smoothelin Proteins 0.000 claims description 3
- 101000618181 Homo sapiens Speedy protein A Proteins 0.000 claims description 3
- 101000702102 Homo sapiens Sperm flagellar protein 2 Proteins 0.000 claims description 3
- 101000825598 Homo sapiens Spindle and kinetochore-associated protein 2 Proteins 0.000 claims description 3
- 101000648203 Homo sapiens Striatin-4 Proteins 0.000 claims description 3
- 101000577874 Homo sapiens Stromelysin-2 Proteins 0.000 claims description 3
- 101000716795 Homo sapiens Succinyl-CoA:3-ketoacid coenzyme A transferase 2, mitochondrial Proteins 0.000 claims description 3
- 101000868422 Homo sapiens Sushi, nidogen and EGF-like domain-containing protein 1 Proteins 0.000 claims description 3
- 101000662534 Homo sapiens Sushi, von Willebrand factor type A, EGF and pentraxin domain-containing protein 1 Proteins 0.000 claims description 3
- 101000664934 Homo sapiens Synaptogyrin-2 Proteins 0.000 claims description 3
- 101000659054 Homo sapiens Synaptopodin Proteins 0.000 claims description 3
- 101000674440 Homo sapiens Synaptopodin 2-like protein Proteins 0.000 claims description 3
- 101000659053 Homo sapiens Synaptopodin-2 Proteins 0.000 claims description 3
- 101000652300 Homo sapiens Synaptosomal-associated protein 23 Proteins 0.000 claims description 3
- 101000653585 Homo sapiens TBC1 domain family member 15 Proteins 0.000 claims description 3
- 101000798991 Homo sapiens Target of EGR1 protein 1 Proteins 0.000 claims description 3
- 101000633627 Homo sapiens Teashirt homolog 2 Proteins 0.000 claims description 3
- 101000626163 Homo sapiens Tenascin-X Proteins 0.000 claims description 3
- 101000626153 Homo sapiens Tensin-3 Proteins 0.000 claims description 3
- 101000794197 Homo sapiens Testis-specific serine/threonine-protein kinase 3 Proteins 0.000 claims description 3
- 101000759876 Homo sapiens Tetraspanin-11 Proteins 0.000 claims description 3
- 101000794187 Homo sapiens Tetraspanin-18 Proteins 0.000 claims description 3
- 101000658739 Homo sapiens Tetraspanin-2 Proteins 0.000 claims description 3
- 101000612838 Homo sapiens Tetraspanin-7 Proteins 0.000 claims description 3
- 101000796022 Homo sapiens Thioredoxin-interacting protein Proteins 0.000 claims description 3
- 101000633605 Homo sapiens Thrombospondin-2 Proteins 0.000 claims description 3
- 101000785523 Homo sapiens Tight junction protein ZO-2 Proteins 0.000 claims description 3
- 101000979190 Homo sapiens Transcription factor MafB Proteins 0.000 claims description 3
- 101000642523 Homo sapiens Transcription factor SOX-7 Proteins 0.000 claims description 3
- 101000652346 Homo sapiens Transcription factor SPT20 homolog Proteins 0.000 claims description 3
- 101001051166 Homo sapiens Transcriptional activator MN1 Proteins 0.000 claims description 3
- 101001004924 Homo sapiens Transforming growth factor beta activator LRRC32 Proteins 0.000 claims description 3
- 101001004913 Homo sapiens Transforming growth factor beta activator LRRC33 Proteins 0.000 claims description 3
- 101000635958 Homo sapiens Transforming growth factor beta-2 proprotein Proteins 0.000 claims description 3
- 101000652720 Homo sapiens Transgelin-3 Proteins 0.000 claims description 3
- 101000764634 Homo sapiens Transmembrane gamma-carboxyglutamic acid protein 4 Proteins 0.000 claims description 3
- 101000655133 Homo sapiens Transmembrane protein 102 Proteins 0.000 claims description 3
- 101000598051 Homo sapiens Transmembrane protein 119 Proteins 0.000 claims description 3
- 101000648531 Homo sapiens Transmembrane protein 50B Proteins 0.000 claims description 3
- 101000662995 Homo sapiens Transport and Golgi organization protein 6 homolog Proteins 0.000 claims description 3
- 101000838411 Homo sapiens Tubulin epsilon chain Proteins 0.000 claims description 3
- 101000636780 Homo sapiens Tumor necrosis factor alpha-induced protein 8-like protein 3 Proteins 0.000 claims description 3
- 101000648507 Homo sapiens Tumor necrosis factor receptor superfamily member 14 Proteins 0.000 claims description 3
- 101000830843 Homo sapiens Tumor protein p63-regulated gene 1 protein Proteins 0.000 claims description 3
- 101001103033 Homo sapiens Tyrosine-protein kinase transmembrane receptor ROR2 Proteins 0.000 claims description 3
- 101000777263 Homo sapiens UV radiation resistance-associated gene protein Proteins 0.000 claims description 3
- 101000939135 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 27 Proteins 0.000 claims description 3
- 101000939460 Homo sapiens Ubiquitin-associated protein 2-like Proteins 0.000 claims description 3
- 101000803711 Homo sapiens V-set and transmembrane domain-containing protein 2-like protein Proteins 0.000 claims description 3
- 101000771974 Homo sapiens Vacuolar protein sorting-associated protein 41 homolog Proteins 0.000 claims description 3
- 101000955107 Homo sapiens WD repeat-containing protein 37 Proteins 0.000 claims description 3
- 101000818566 Homo sapiens Zinc finger and BTB domain-containing protein 26 Proteins 0.000 claims description 3
- 101000744930 Homo sapiens Zinc finger protein 212 Proteins 0.000 claims description 3
- 101000788752 Homo sapiens Zinc finger protein 350 Proteins 0.000 claims description 3
- 101000818824 Homo sapiens Zinc finger protein 431 Proteins 0.000 claims description 3
- 101000785611 Homo sapiens Zinc finger protein 660 Proteins 0.000 claims description 3
- 101000743805 Homo sapiens Zinc finger protein 680 Proteins 0.000 claims description 3
- 101000964730 Homo sapiens Zinc finger protein 79 Proteins 0.000 claims description 3
- 101001046426 Homo sapiens cGMP-dependent protein kinase 1 Proteins 0.000 claims description 3
- 101000988412 Homo sapiens cGMP-specific 3',5'-cyclic phosphodiesterase Proteins 0.000 claims description 3
- 101000851815 Homo sapiens p53-regulated apoptosis-inducing protein 1 Proteins 0.000 claims description 3
- 102100031009 Inactive N-acetylated-alpha-linked acidic dipeptidase-like protein 2 Human genes 0.000 claims description 3
- 102100036344 Inositol 1,4,5-triphosphate receptor associated 1 Human genes 0.000 claims description 3
- 102100024368 Inositol polyphosphate 5-phosphatase K Human genes 0.000 claims description 3
- 102100030498 Intron Large complex component GCFC2 Human genes 0.000 claims description 3
- 102100033529 Keratin-associated protein 1-1 Human genes 0.000 claims description 3
- 102100022141 LIM/homeobox protein Lhx9 Human genes 0.000 claims description 3
- 102100033519 Leiomodin-1 Human genes 0.000 claims description 3
- 102100022270 Leucine-rich repeat LGI family member 2 Human genes 0.000 claims description 3
- 102100031035 Leucine-rich repeat-containing G-protein coupled receptor 4 Human genes 0.000 claims description 3
- 102100027494 Leucine-rich repeat-containing protein 39 Human genes 0.000 claims description 3
- 102100028263 Limbic system-associated membrane protein Human genes 0.000 claims description 3
- 101710162762 Limbic system-associated membrane protein Proteins 0.000 claims description 3
- 102100033353 Lipopolysaccharide-responsive and beige-like anchor protein Human genes 0.000 claims description 3
- 102100021918 Low-density lipoprotein receptor-related protein 4 Human genes 0.000 claims description 3
- 102100032114 Lumican Human genes 0.000 claims description 3
- 102100040284 Ly6/PLAUR domain-containing protein 1 Human genes 0.000 claims description 3
- 102100027237 MAM domain-containing protein 2 Human genes 0.000 claims description 3
- 102100023474 MMS19 nucleotide excision repair protein homolog Human genes 0.000 claims description 3
- 102100026061 Mannan-binding lectin serine protease 1 Human genes 0.000 claims description 3
- 102100024129 Matrix metalloproteinase-24 Human genes 0.000 claims description 3
- 102100030776 Matrix-remodeling-associated protein 5 Human genes 0.000 claims description 3
- 102100023724 Melanocortin receptor 4 Human genes 0.000 claims description 3
- 102100030351 Membrane-associated phosphatidylinositol transfer protein 3 Human genes 0.000 claims description 3
- 102100027383 Methyl-CpG-binding domain protein 1 Human genes 0.000 claims description 3
- 102100038593 Methylthioribulose-1-phosphate dehydratase Human genes 0.000 claims description 3
- 102100026930 Mitogen-activated protein kinase 13 Human genes 0.000 claims description 3
- 102100039005 Multiple epidermal growth factor-like domains protein 6 Human genes 0.000 claims description 3
- 102100021157 MutS protein homolog 4 Human genes 0.000 claims description 3
- 102100035083 Myoferlin Human genes 0.000 claims description 3
- 102100035044 Myosin light chain kinase, smooth muscle Human genes 0.000 claims description 3
- 102100032618 N-acetylglutamate synthase, mitochondrial Human genes 0.000 claims description 3
- 108010082699 NADPH Oxidase 4 Proteins 0.000 claims description 3
- 102100021872 NADPH oxidase 4 Human genes 0.000 claims description 3
- 108091007791 NAE1 Proteins 0.000 claims description 3
- 102100029781 NEDD8-activating enzyme E1 regulatory subunit Human genes 0.000 claims description 3
- 108010032605 Nerve Growth Factor Receptors Proteins 0.000 claims description 3
- 102100023072 Neurolysin, mitochondrial Human genes 0.000 claims description 3
- 102100028745 Neuronal regeneration-related protein Human genes 0.000 claims description 3
- 108010029756 Notch3 Receptor Proteins 0.000 claims description 3
- 102100032604 Occludin Human genes 0.000 claims description 3
- 102100030098 Oncostatin-M-specific receptor subunit beta Human genes 0.000 claims description 3
- 102100025386 Oxidized low-density lipoprotein receptor 1 Human genes 0.000 claims description 3
- 108091007056 PEDS1-UBE2V1 Proteins 0.000 claims description 3
- 102100037482 PMS1 protein homolog 1 Human genes 0.000 claims description 3
- 102100038424 Palmitoleoyl-protein carboxylesterase NOTUM Human genes 0.000 claims description 3
- BFHAYPLBUQVNNJ-UHFFFAOYSA-N Pectenotoxin 3 Natural products OC1C(C)CCOC1(O)C1OC2C=CC(C)=CC(C)CC(C)(O3)CCC3C(O3)(O4)CCC3(C=O)CC4C(O3)C(=O)CC3(C)C(O)C(O3)CCC3(O3)CCCC3C(C)C(=O)OC2C1 BFHAYPLBUQVNNJ-UHFFFAOYSA-N 0.000 claims description 3
- 102100027351 Pentraxin-related protein PTX3 Human genes 0.000 claims description 3
- 102100040375 Peripherin-2 Human genes 0.000 claims description 3
- 102100022587 Peroxisomal multifunctional enzyme type 2 Human genes 0.000 claims description 3
- 102100023743 Phenazine biosynthesis-like domain-containing protein Human genes 0.000 claims description 3
- 102100035269 Phosphatase and actin regulator 3 Human genes 0.000 claims description 3
- 102100036063 Phosphatidylinositol transfer protein beta isoform Human genes 0.000 claims description 3
- 102100039710 Platelet endothelial aggregation receptor 1 Human genes 0.000 claims description 3
- 108010051742 Platelet-Derived Growth Factor beta Receptor Proteins 0.000 claims description 3
- 102100040682 Platelet-derived growth factor D Human genes 0.000 claims description 3
- 102100026547 Platelet-derived growth factor receptor beta Human genes 0.000 claims description 3
- 102100037869 Pleckstrin homology domain-containing family A member 6 Human genes 0.000 claims description 3
- 102100030360 Pleckstrin homology domain-containing family H member 2 Human genes 0.000 claims description 3
- 102100030470 Pleckstrin-2 Human genes 0.000 claims description 3
- 102100036036 Podocan Human genes 0.000 claims description 3
- 102100024380 Poly(A) RNA polymerase GLD2 Human genes 0.000 claims description 3
- 102100039438 Polyadenylate-binding protein-interacting protein 2B Human genes 0.000 claims description 3
- 102100033075 Prostacyclin synthase Human genes 0.000 claims description 3
- 102100028813 Proteasome subunit alpha type-4 Human genes 0.000 claims description 3
- 102100026286 Protein AF-10 Human genes 0.000 claims description 3
- 102100035601 Protein CASC3 Human genes 0.000 claims description 3
- 102100024983 Protein NDNF Human genes 0.000 claims description 3
- 102100029062 Protein Wnt-10b Human genes 0.000 claims description 3
- 102100035898 Protein bicaudal D homolog 1 Human genes 0.000 claims description 3
- 102100024924 Protein kinase C alpha type Human genes 0.000 claims description 3
- 102100038701 Protein phosphatase 1E Human genes 0.000 claims description 3
- 102100036040 Protein prune homolog 2 Human genes 0.000 claims description 3
- 102100038095 Protein-glutamine gamma-glutamyltransferase 2 Human genes 0.000 claims description 3
- 102100032350 Protransforming growth factor alpha Human genes 0.000 claims description 3
- 102100030096 Putative thiamine transporter SLC35F3 Human genes 0.000 claims description 3
- 102100031223 Putative uncharacterized protein encoded by LINC00472 Human genes 0.000 claims description 3
- 102100034759 Pyridoxal-dependent decarboxylase domain-containing protein 1 Human genes 0.000 claims description 3
- 102100038461 RNA-binding protein Nova-2 Human genes 0.000 claims description 3
- 102000028598 Rab30 Human genes 0.000 claims description 3
- 108050007282 Rab30 Proteins 0.000 claims description 3
- 102100022127 Radixin Human genes 0.000 claims description 3
- 102100022305 Ras-related protein Rab-38 Human genes 0.000 claims description 3
- 102100038480 Ras-related protein Rab-44 Human genes 0.000 claims description 3
- 102100035542 Regulator of cell cycle RGCC Human genes 0.000 claims description 3
- 102100035122 Retrotransposon Gag-like protein 3 Human genes 0.000 claims description 3
- 102100024917 Ribosomal protein S6 kinase beta-2 Human genes 0.000 claims description 3
- 102100037722 SH3 and cysteine-rich domain-containing protein 2 Human genes 0.000 claims description 3
- 108091006699 SLC24A3 Proteins 0.000 claims description 3
- 108091006972 SLC35F3 Proteins 0.000 claims description 3
- 108091006941 SLC39A10 Proteins 0.000 claims description 3
- 108091007567 SLC46A2 Proteins 0.000 claims description 3
- 108091006267 SLC4A11 Proteins 0.000 claims description 3
- 102000005031 SLC6A15 Human genes 0.000 claims description 3
- 108060007754 SLC6A15 Proteins 0.000 claims description 3
- 108091006241 SLC7A11 Proteins 0.000 claims description 3
- 108091006649 SLC9A3 Proteins 0.000 claims description 3
- 101700004678 SLIT3 Proteins 0.000 claims description 3
- 108010044012 STAT1 Transcription Factor Proteins 0.000 claims description 3
- 108010019992 STAT4 Transcription Factor Proteins 0.000 claims description 3
- 102000005886 STAT4 Transcription Factor Human genes 0.000 claims description 3
- 101100100680 Schizosaccharomyces pombe (strain 972 / ATCC 24843) trp4 gene Proteins 0.000 claims description 3
- 102100033835 Serine protease 23 Human genes 0.000 claims description 3
- 102100028030 Serine/threonine-protein kinase 32B Human genes 0.000 claims description 3
- 102100036120 Serine/threonine-protein kinase pim-2 Human genes 0.000 claims description 3
- 102100035348 Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform Human genes 0.000 claims description 3
- 102100027164 Sialic acid-binding Ig-like lectin 10 Human genes 0.000 claims description 3
- 102100029904 Signal transducer and activator of transcription 1-alpha/beta Human genes 0.000 claims description 3
- 102100025490 Slit homolog 1 protein Human genes 0.000 claims description 3
- 102100030538 Small regulatory polypeptide of amino acid response Human genes 0.000 claims description 3
- 102100029937 Smoothelin Human genes 0.000 claims description 3
- 102100030375 Sodium/hydrogen exchanger 3 Human genes 0.000 claims description 3
- 102100032070 Sodium/potassium/calcium exchanger 3 Human genes 0.000 claims description 3
- 102100021885 Speedy protein A Human genes 0.000 claims description 3
- 102100030317 Sperm flagellar protein 2 Human genes 0.000 claims description 3
- 102100022924 Spindle and kinetochore-associated protein 2 Human genes 0.000 claims description 3
- 102100028806 Striatin-4 Human genes 0.000 claims description 3
- 102100028848 Stromelysin-2 Human genes 0.000 claims description 3
- 102100020869 Succinyl-CoA:3-ketoacid coenzyme A transferase 2, mitochondrial Human genes 0.000 claims description 3
- 102100032853 Sushi, nidogen and EGF-like domain-containing protein 1 Human genes 0.000 claims description 3
- 102100037409 Sushi, von Willebrand factor type A, EGF and pentraxin domain-containing protein 1 Human genes 0.000 claims description 3
- 102100038649 Synaptogyrin-2 Human genes 0.000 claims description 3
- 102100035604 Synaptopodin Human genes 0.000 claims description 3
- 102100040469 Synaptopodin 2-like protein Human genes 0.000 claims description 3
- 102100035603 Synaptopodin-2 Human genes 0.000 claims description 3
- 102100030545 Synaptosomal-associated protein 23 Human genes 0.000 claims description 3
- 102100029870 TBC1 domain family member 15 Human genes 0.000 claims description 3
- 102000004399 TNF receptor-associated factor 3 Human genes 0.000 claims description 3
- 108090000922 TNF receptor-associated factor 3 Proteins 0.000 claims description 3
- 108091007288 TRIM66 Proteins 0.000 claims description 3
- 102000003622 TRPC4 Human genes 0.000 claims description 3
- 102100034010 Target of EGR1 protein 1 Human genes 0.000 claims description 3
- 102100029218 Teashirt homolog 2 Human genes 0.000 claims description 3
- 102100024549 Tenascin-X Human genes 0.000 claims description 3
- 102100024548 Tensin-3 Human genes 0.000 claims description 3
- 102100030168 Testis-specific serine/threonine-protein kinase 3 Human genes 0.000 claims description 3
- 102100024987 Tetraspanin-11 Human genes 0.000 claims description 3
- 102100030175 Tetraspanin-18 Human genes 0.000 claims description 3
- 102100035873 Tetraspanin-2 Human genes 0.000 claims description 3
- 102100040952 Tetraspanin-7 Human genes 0.000 claims description 3
- 102100031344 Thioredoxin-interacting protein Human genes 0.000 claims description 3
- 102100029529 Thrombospondin-2 Human genes 0.000 claims description 3
- 102100031558 Thymic stromal cotransporter homolog Human genes 0.000 claims description 3
- 102100026637 Tight junction protein ZO-2 Human genes 0.000 claims description 3
- 102100023234 Transcription factor MafB Human genes 0.000 claims description 3
- 102100036730 Transcription factor SOX-7 Human genes 0.000 claims description 3
- 102100030256 Transcription factor SPT20 homolog Human genes 0.000 claims description 3
- 102100024592 Transcriptional activator MN1 Human genes 0.000 claims description 3
- 102100025946 Transforming growth factor beta activator LRRC32 Human genes 0.000 claims description 3
- 102100025954 Transforming growth factor beta activator LRRC33 Human genes 0.000 claims description 3
- 102100030737 Transforming growth factor beta-2 proprotein Human genes 0.000 claims description 3
- 102000056172 Transforming growth factor beta-3 Human genes 0.000 claims description 3
- 108090000097 Transforming growth factor beta-3 Proteins 0.000 claims description 3
- 102100030986 Transgelin-3 Human genes 0.000 claims description 3
- 102100026222 Transmembrane gamma-carboxyglutamic acid protein 4 Human genes 0.000 claims description 3
- 102100033026 Transmembrane protein 102 Human genes 0.000 claims description 3
- 102100037029 Transmembrane protein 119 Human genes 0.000 claims description 3
- 102100028769 Transmembrane protein 50B Human genes 0.000 claims description 3
- 102100037672 Transport and Golgi organization protein 6 homolog Human genes 0.000 claims description 3
- 102100025033 Tripartite motif-containing protein 66 Human genes 0.000 claims description 3
- 101150099990 Trpc4 gene Proteins 0.000 claims description 3
- 102100028984 Tubulin epsilon chain Human genes 0.000 claims description 3
- 102100031905 Tumor necrosis factor alpha-induced protein 8-like protein 3 Human genes 0.000 claims description 3
- 102100028785 Tumor necrosis factor receptor superfamily member 14 Human genes 0.000 claims description 3
- 102100033725 Tumor necrosis factor receptor superfamily member 16 Human genes 0.000 claims description 3
- 102100024934 Tumor protein p63-regulated gene 1 protein Human genes 0.000 claims description 3
- 102100031275 UV radiation resistance-associated gene protein Human genes 0.000 claims description 3
- 102100029736 Ubiquitin carboxyl-terminal hydrolase 27 Human genes 0.000 claims description 3
- 102100029817 Ubiquitin-associated protein 2-like Human genes 0.000 claims description 3
- 102100035141 V-set and transmembrane domain-containing protein 2-like protein Human genes 0.000 claims description 3
- 101150045640 VWF gene Proteins 0.000 claims description 3
- 102100029496 Vacuolar protein sorting-associated protein 41 homolog Human genes 0.000 claims description 3
- 102100038947 WD repeat-containing protein 37 Human genes 0.000 claims description 3
- 102100021128 Zinc finger and BTB domain-containing protein 26 Human genes 0.000 claims description 3
- 102100039979 Zinc finger protein 212 Human genes 0.000 claims description 3
- 102100025434 Zinc finger protein 350 Human genes 0.000 claims description 3
- 102100021349 Zinc finger protein 431 Human genes 0.000 claims description 3
- 102100026454 Zinc finger protein 660 Human genes 0.000 claims description 3
- 102100039056 Zinc finger protein 680 Human genes 0.000 claims description 3
- 102100040706 Zinc finger protein 79 Human genes 0.000 claims description 3
- 102100035243 Zinc transporter ZIP10 Human genes 0.000 claims description 3
- 102100022422 cGMP-dependent protein kinase 1 Human genes 0.000 claims description 3
- 102100029175 cGMP-specific 3',5'-cyclic phosphodiesterase Human genes 0.000 claims description 3
- 108091038867 miR-612 stem-loop Proteins 0.000 claims description 3
- 102100036520 p53-regulated apoptosis-inducing protein 1 Human genes 0.000 claims description 3
- 108091005418 scavenger receptor class E Proteins 0.000 claims description 3
- 102100036537 von Willebrand factor Human genes 0.000 claims description 3
- 102100032174 GTP-binding protein SAR1a Human genes 0.000 claims description 2
- 101000637622 Homo sapiens GTP-binding protein SAR1a Proteins 0.000 claims description 2
- 101000976697 Homo sapiens Inter-alpha-trypsin inhibitor heavy chain H1 Proteins 0.000 claims description 2
- 101000615030 Homo sapiens Mesenteric estrogen-dependent adipogenesis protein Proteins 0.000 claims description 2
- 101000914628 Homo sapiens Uncharacterized protein C8orf34 Proteins 0.000 claims description 2
- 102100023490 Inter-alpha-trypsin inhibitor heavy chain H1 Human genes 0.000 claims description 2
- 102100021078 Mesenteric estrogen-dependent adipogenesis protein Human genes 0.000 claims description 2
- 102100027225 Uncharacterized protein C8orf34 Human genes 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 12
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 12
- 102100024385 28S ribosomal protein S35, mitochondrial Human genes 0.000 claims 2
- 102100032153 Adenylate cyclase type 8 Human genes 0.000 claims 2
- 102000047724 Member 2 Solute Carrier Family 12 Human genes 0.000 claims 2
- 102000015336 Nerve Growth Factor Human genes 0.000 claims 2
- 239000006166 lysate Substances 0.000 claims 2
- 102100024398 DCC-interacting protein 13-beta Human genes 0.000 claims 1
- 101001008498 Homo sapiens Luc7-like protein 3 Proteins 0.000 claims 1
- 101000629088 Homo sapiens Mitochondria-eating protein Proteins 0.000 claims 1
- 101000716803 Homo sapiens Protein SCO1 homolog, mitochondrial Proteins 0.000 claims 1
- 102100027434 Luc7-like protein 3 Human genes 0.000 claims 1
- 102100027034 Mitochondria-eating protein Human genes 0.000 claims 1
- 102000001760 Notch3 Receptor Human genes 0.000 claims 1
- 102100020866 Protein SCO1 homolog, mitochondrial Human genes 0.000 claims 1
- 102100021475 Solute carrier family 4 member 11 Human genes 0.000 claims 1
- 101100495461 Vibrio cholerae serotype O1 (strain ATCC 39315 / El Tor Inaba N16961) cep gene Proteins 0.000 claims 1
- 239000013592 cell lysate Substances 0.000 claims 1
- 239000002243 precursor Substances 0.000 abstract description 43
- 230000014616 translation Effects 0.000 abstract description 4
- 241000282414 Homo sapiens Species 0.000 description 58
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 52
- 201000010099 disease Diseases 0.000 description 50
- 235000018102 proteins Nutrition 0.000 description 37
- 230000014509 gene expression Effects 0.000 description 33
- 239000003085 diluting agent Substances 0.000 description 30
- 239000000546 pharmaceutical excipient Substances 0.000 description 30
- 239000003937 drug carrier Substances 0.000 description 28
- 108020004414 DNA Proteins 0.000 description 27
- 239000008194 pharmaceutical composition Substances 0.000 description 27
- 230000009286 beneficial effect Effects 0.000 description 19
- 230000002265 prevention Effects 0.000 description 19
- 230000004075 alteration Effects 0.000 description 17
- 239000000047 product Substances 0.000 description 17
- 230000001594 aberrant effect Effects 0.000 description 15
- 210000004027 cell Anatomy 0.000 description 15
- 239000000411 inducer Substances 0.000 description 15
- 108010029485 Protein Isoforms Proteins 0.000 description 12
- 102000001708 Protein Isoforms Human genes 0.000 description 12
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 12
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 12
- 150000003384 small molecules Chemical class 0.000 description 11
- 108700026244 Open Reading Frames Proteins 0.000 description 9
- 108020003584 RNA Isoforms Proteins 0.000 description 9
- 108010003165 Small Nuclear Ribonucleoproteins Proteins 0.000 description 6
- 102000004598 Small Nuclear Ribonucleoproteins Human genes 0.000 description 6
- 102100040038 Amyloid beta precursor like protein 2 Human genes 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 230000003993 interaction Effects 0.000 description 5
- 230000001105 regulatory effect Effects 0.000 description 5
- 230000000717 retained effect Effects 0.000 description 5
- 102100029186 F-box only protein 9 Human genes 0.000 description 4
- 101000917834 Homo sapiens F-box only protein 9 Proteins 0.000 description 4
- 101001057131 Homo sapiens Melanoma-associated antigen D4 Proteins 0.000 description 4
- 102100027257 Melanoma-associated antigen D4 Human genes 0.000 description 4
- 108020004485 Nonsense Codon Proteins 0.000 description 4
- 238000012217 deletion Methods 0.000 description 4
- 230000037430 deletion Effects 0.000 description 4
- 230000037433 frameshift Effects 0.000 description 4
- 230000006870 function Effects 0.000 description 4
- 108091007507 ADAM12 Proteins 0.000 description 3
- 102100024378 AF4/FMR2 family member 2 Human genes 0.000 description 3
- 102100040800 AN1-type zinc finger protein 1 Human genes 0.000 description 3
- 101800001241 Acetylglutamate kinase Proteins 0.000 description 3
- 102100022388 Acylglycerol kinase, mitochondrial Human genes 0.000 description 3
- 102100034112 Alkyldihydroxyacetonephosphate synthase, peroxisomal Human genes 0.000 description 3
- 102100036818 Ankyrin-2 Human genes 0.000 description 3
- 102100034278 Annexin A6 Human genes 0.000 description 3
- 102100034304 Armadillo repeat-containing X-linked protein 3 Human genes 0.000 description 3
- 102100035682 Axin-1 Human genes 0.000 description 3
- 102100024485 Cell division cycle-associated protein 7 Human genes 0.000 description 3
- 102100027442 Collagen alpha-1(XII) chain Human genes 0.000 description 3
- 102100030549 Cytochrome b5 type B Human genes 0.000 description 3
- 102100037969 DIS3-like exonuclease 1 Human genes 0.000 description 3
- 102100031112 Disintegrin and metalloproteinase domain-containing protein 12 Human genes 0.000 description 3
- 108010008599 Forkhead Box Protein M1 Proteins 0.000 description 3
- 102100023374 Forkhead box protein M1 Human genes 0.000 description 3
- 102100040004 Gamma-glutamylcyclotransferase Human genes 0.000 description 3
- 102100040517 Golgi-associated kinase 1B Human genes 0.000 description 3
- 102100028006 Heme oxygenase 1 Human genes 0.000 description 3
- 102100024023 Histone PARylation factor 1 Human genes 0.000 description 3
- 102100030234 Homeobox protein cut-like 1 Human genes 0.000 description 3
- 101000833172 Homo sapiens AF4/FMR2 family member 2 Proteins 0.000 description 3
- 101000964570 Homo sapiens AN1-type zinc finger protein 1 Proteins 0.000 description 3
- 101000799143 Homo sapiens Alkyldihydroxyacetonephosphate synthase, peroxisomal Proteins 0.000 description 3
- 101000928344 Homo sapiens Ankyrin-2 Proteins 0.000 description 3
- 101000780137 Homo sapiens Annexin A6 Proteins 0.000 description 3
- 101000925948 Homo sapiens Armadillo repeat-containing X-linked protein 3 Proteins 0.000 description 3
- 101000874566 Homo sapiens Axin-1 Proteins 0.000 description 3
- 101000980893 Homo sapiens Cell division cycle-associated protein 7 Proteins 0.000 description 3
- 101000861874 Homo sapiens Collagen alpha-1(XII) chain Proteins 0.000 description 3
- 101000737574 Homo sapiens Complement factor H Proteins 0.000 description 3
- 101000726631 Homo sapiens Cytochrome b5 type B Proteins 0.000 description 3
- 101000951181 Homo sapiens DIS3-like exonuclease 1 Proteins 0.000 description 3
- 101001010541 Homo sapiens Electron transfer flavoprotein subunit alpha, mitochondrial Proteins 0.000 description 3
- 101000886680 Homo sapiens Gamma-glutamylcyclotransferase Proteins 0.000 description 3
- 101000893979 Homo sapiens Golgi-associated kinase 1B Proteins 0.000 description 3
- 101001079623 Homo sapiens Heme oxygenase 1 Proteins 0.000 description 3
- 101001047783 Homo sapiens Histone PARylation factor 1 Proteins 0.000 description 3
- 101000726740 Homo sapiens Homeobox protein cut-like 1 Proteins 0.000 description 3
- 101001050565 Homo sapiens Kinesin-like protein KIF3A Proteins 0.000 description 3
- 101001008442 Homo sapiens La-related protein 7 Proteins 0.000 description 3
- 101001059644 Homo sapiens MAP kinase-activating death domain protein Proteins 0.000 description 3
- 101000969812 Homo sapiens Multidrug resistance-associated protein 1 Proteins 0.000 description 3
- 101000761460 Homo sapiens Protein CASP Proteins 0.000 description 3
- 101000576901 Homo sapiens Serine/threonine-protein kinase MRCK alpha Proteins 0.000 description 3
- 101000663181 Homo sapiens Splicing regulatory glutamine/lysine-rich protein 1 Proteins 0.000 description 3
- 101000585019 Homo sapiens Striatin-3 Proteins 0.000 description 3
- 101000617738 Homo sapiens Survival motor neuron protein Proteins 0.000 description 3
- 101000737828 Homo sapiens Threonylcarbamoyladenosine tRNA methylthiotransferase Proteins 0.000 description 3
- 101000909637 Homo sapiens Transcription factor COE1 Proteins 0.000 description 3
- 101000958733 Homo sapiens Unconventional myosin-IXb Proteins 0.000 description 3
- 101000649946 Homo sapiens Vacuolar protein sorting-associated protein 29 Proteins 0.000 description 3
- 102100023425 Kinesin-like protein KIF3A Human genes 0.000 description 3
- 102100027436 La-related protein 7 Human genes 0.000 description 3
- 102100028822 MAP kinase-activating death domain protein Human genes 0.000 description 3
- 102100021339 Multidrug resistance-associated protein 1 Human genes 0.000 description 3
- 102100030706 Ras-related protein Rap-1A Human genes 0.000 description 3
- 102100025352 Serine/threonine-protein kinase MRCK alpha Human genes 0.000 description 3
- 102100037079 Splicing regulatory glutamine/lysine-rich protein 1 Human genes 0.000 description 3
- 102100029955 Striatin-3 Human genes 0.000 description 3
- 102100021947 Survival motor neuron protein Human genes 0.000 description 3
- 102100035310 Threonylcarbamoyladenosine tRNA methylthiotransferase Human genes 0.000 description 3
- 102100024207 Transcription factor COE1 Human genes 0.000 description 3
- 108010091281 U1 Small Nuclear Ribonucleoprotein Proteins 0.000 description 3
- 102000018165 U1 Small Nuclear Ribonucleoprotein Human genes 0.000 description 3
- 102100038325 Unconventional myosin-IXb Human genes 0.000 description 3
- 102100028290 Vacuolar protein sorting-associated protein 29 Human genes 0.000 description 3
- 230000027455 binding Effects 0.000 description 3
- 230000001404 mediated effect Effects 0.000 description 3
- 108010036805 rap1 GTP-Binding Proteins Proteins 0.000 description 3
- 230000001225 therapeutic effect Effects 0.000 description 3
- 239000013598 vector Substances 0.000 description 3
- 102100038368 1-acyl-sn-glycerol-3-phosphate acyltransferase gamma Human genes 0.000 description 2
- 102100024705 182 kDa tankyrase-1-binding protein Human genes 0.000 description 2
- OENIXTHWZWFYIV-UHFFFAOYSA-N 2-[4-[2-[5-(cyclopentylmethyl)-1h-imidazol-2-yl]ethyl]phenyl]benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(C=C1)=CC=C1CCC(N1)=NC=C1CC1CCCC1 OENIXTHWZWFYIV-UHFFFAOYSA-N 0.000 description 2
- KIAPWMKFHIKQOZ-UHFFFAOYSA-N 2-[[(4-fluorophenyl)-oxomethyl]amino]benzoic acid methyl ester Chemical compound COC(=O)C1=CC=CC=C1NC(=O)C1=CC=C(F)C=C1 KIAPWMKFHIKQOZ-UHFFFAOYSA-N 0.000 description 2
- 102100033097 26S proteasome non-ATPase regulatory subunit 6 Human genes 0.000 description 2
- 102100022644 26S proteasome regulatory subunit 4 Human genes 0.000 description 2
- 102100029830 28S ribosomal protein S28, mitochondrial Human genes 0.000 description 2
- 102100029077 3-hydroxy-3-methylglutaryl-coenzyme A reductase Human genes 0.000 description 2
- 102100039522 39S ribosomal protein L3, mitochondrial Human genes 0.000 description 2
- 102100022464 5'-nucleotidase Human genes 0.000 description 2
- 102100021546 60S ribosomal protein L10 Human genes 0.000 description 2
- 102100036512 7-dehydrocholesterol reductase Human genes 0.000 description 2
- 102100026137 7SK snRNA methylphosphate capping enzyme Human genes 0.000 description 2
- 102100031912 A-kinase anchor protein 1, mitochondrial Human genes 0.000 description 2
- 102100040084 A-kinase anchor protein 9 Human genes 0.000 description 2
- 101150092476 ABCA1 gene Proteins 0.000 description 2
- 101150059521 AHRR gene Proteins 0.000 description 2
- 102100032897 AMP deaminase 2 Human genes 0.000 description 2
- 102100036610 AN1-type zinc finger protein 5 Human genes 0.000 description 2
- 102100033347 AP-2 complex subunit beta Human genes 0.000 description 2
- 102100024408 AT-hook DNA-binding motif-containing protein 1 Human genes 0.000 description 2
- 102100023157 AT-rich interactive domain-containing protein 2 Human genes 0.000 description 2
- 102100022933 ATM interactor Human genes 0.000 description 2
- 108700005241 ATP Binding Cassette Transporter 1 Proteins 0.000 description 2
- 102100025514 ATP-dependent 6-phosphofructokinase, platelet type Human genes 0.000 description 2
- 102100030088 ATP-dependent RNA helicase A Human genes 0.000 description 2
- 102100030089 ATP-dependent RNA helicase DHX8 Human genes 0.000 description 2
- 102100028704 Acetyl-CoA acetyltransferase, cytosolic Human genes 0.000 description 2
- 102100039164 Acetyl-CoA carboxylase 1 Human genes 0.000 description 2
- 101710099902 Acid-sensing ion channel 2 Proteins 0.000 description 2
- 102100022997 Acidic leucine-rich nuclear phosphoprotein 32 family member A Human genes 0.000 description 2
- 102100020961 Actin-binding LIM protein 3 Human genes 0.000 description 2
- 108010075348 Activated-Leukocyte Cell Adhesion Molecule Proteins 0.000 description 2
- 102100030963 Activating transcription factor 7-interacting protein 1 Human genes 0.000 description 2
- 102100034542 Acyl-CoA (8-3)-desaturase Human genes 0.000 description 2
- 102100034544 Acyl-CoA 6-desaturase Human genes 0.000 description 2
- 102100022476 Adenosylhomocysteinase 3 Human genes 0.000 description 2
- 102100039659 Adenylate cyclase type 3 Human genes 0.000 description 2
- 102100020775 Adenylosuccinate lyase Human genes 0.000 description 2
- 108700040193 Adenylosuccinate lyases Proteins 0.000 description 2
- 102100036775 Afadin Human genes 0.000 description 2
- 102100036092 Alpha-endosulfine Human genes 0.000 description 2
- 102100033658 Alpha-globin transcription factor CP2 Human genes 0.000 description 2
- 102100034452 Alternative prion protein Human genes 0.000 description 2
- 101000798762 Anguilla anguilla Troponin C, skeletal muscle Proteins 0.000 description 2
- 102100039379 Ankyrin repeat and SAM domain-containing protein 6 Human genes 0.000 description 2
- 102100034609 Ankyrin repeat domain-containing protein 17 Human genes 0.000 description 2
- 102100034524 Apoptotic protease-activating factor 1 Human genes 0.000 description 2
- 102100024044 Aprataxin Human genes 0.000 description 2
- 101100339431 Arabidopsis thaliana HMGB2 gene Proteins 0.000 description 2
- 108700040066 Argininosuccinate lyases Proteins 0.000 description 2
- 102100026789 Aryl hydrocarbon receptor repressor Human genes 0.000 description 2
- 101150025804 Asl gene Proteins 0.000 description 2
- 102100023927 Asparagine synthetase [glutamine-hydrolyzing] Human genes 0.000 description 2
- 102100028820 Aspartate-tRNA ligase, cytoplasmic Human genes 0.000 description 2
- 108010032947 Ataxin-3 Proteins 0.000 description 2
- 102000007371 Ataxin-3 Human genes 0.000 description 2
- 102000004000 Aurora Kinase A Human genes 0.000 description 2
- 108090000461 Aurora Kinase A Proteins 0.000 description 2
- 102100020823 Autophagy-related protein 9A Human genes 0.000 description 2
- 102100027961 BAG family molecular chaperone regulator 2 Human genes 0.000 description 2
- 102100037546 BEN domain-containing protein 6 Human genes 0.000 description 2
- 102100022045 BTB/POZ domain-containing protein 10 Human genes 0.000 description 2
- 102100026348 Beta-1,4-galactosyltransferase 2 Human genes 0.000 description 2
- 102100023995 Beta-nerve growth factor Human genes 0.000 description 2
- 102100040904 Beta-parvin Human genes 0.000 description 2
- 102100021257 Beta-secretase 1 Human genes 0.000 description 2
- 101001042041 Bos taurus Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial Proteins 0.000 description 2
- 102100028252 Brain acid soluble protein 1 Human genes 0.000 description 2
- 102100028253 Breast cancer anti-estrogen resistance protein 3 Human genes 0.000 description 2
- 102100033641 Bromodomain-containing protein 2 Human genes 0.000 description 2
- 102100025752 CASP8 and FADD-like apoptosis regulator Human genes 0.000 description 2
- 102100024080 CASP8-associated protein 2 Human genes 0.000 description 2
- 102100031024 CCR4-NOT transcription complex subunit 1 Human genes 0.000 description 2
- 102100024210 CD166 antigen Human genes 0.000 description 2
- 102100038078 CD276 antigen Human genes 0.000 description 2
- 101700004197 CEP68 Proteins 0.000 description 2
- 102100040738 CSC1-like protein 1 Human genes 0.000 description 2
- 102100024155 Cadherin-11 Human genes 0.000 description 2
- 102100022533 Calcium-binding protein 39 Human genes 0.000 description 2
- 102100029801 Calcium-transporting ATPase type 2C member 1 Human genes 0.000 description 2
- 102100021535 Calcium/calmodulin-dependent protein kinase kinase 1 Human genes 0.000 description 2
- 102100029398 Calpain small subunit 1 Human genes 0.000 description 2
- 102100027667 Carboxy-terminal domain RNA polymerase II polypeptide A small phosphatase 2 Human genes 0.000 description 2
- 102100021753 Cardiolipin synthase (CMP-forming) Human genes 0.000 description 2
- 102100027848 Cartilage-associated protein Human genes 0.000 description 2
- 102100034357 Casein kinase I isoform alpha Human genes 0.000 description 2
- 102100028906 Catenin delta-1 Human genes 0.000 description 2
- 102100035888 Caveolin-1 Human genes 0.000 description 2
- 102100036569 Cell division cycle and apoptosis regulator protein 1 Human genes 0.000 description 2
- 102100033228 Centrosomal protein of 68 kDa Human genes 0.000 description 2
- 102100021198 Chemerin-like receptor 2 Human genes 0.000 description 2
- 102100034667 Chloride intracellular channel protein 1 Human genes 0.000 description 2
- 102100038165 Chromodomain-helicase-DNA-binding protein 8 Human genes 0.000 description 2
- 102100034497 Cip1-interacting zinc finger protein Human genes 0.000 description 2
- 102100023717 Coiled-coil domain-containing protein 77 Human genes 0.000 description 2
- 102100032355 Coiled-coil domain-containing protein 92 Human genes 0.000 description 2
- 102100031634 Cold shock domain-containing protein E1 Human genes 0.000 description 2
- 102100033601 Collagen alpha-1(I) chain Human genes 0.000 description 2
- 102100031519 Collagen alpha-1(VI) chain Human genes 0.000 description 2
- 102100030794 Conserved oligomeric Golgi complex subunit 1 Human genes 0.000 description 2
- 102100023376 Corrinoid adenosyltransferase Human genes 0.000 description 2
- 102100039193 Cullin-2 Human genes 0.000 description 2
- 102100028907 Cullin-4A Human genes 0.000 description 2
- 102100027309 Cyclic AMP-responsive element-binding protein 5 Human genes 0.000 description 2
- 102100037916 Cyclin-dependent kinase 11B Human genes 0.000 description 2
- 102100033245 Cyclin-dependent kinase 16 Human genes 0.000 description 2
- 102100039224 Cytoplasmic polyadenylation element-binding protein 2 Human genes 0.000 description 2
- 101150077031 DAXX gene Proteins 0.000 description 2
- 102100025182 DDB1- and CUL4-associated factor 10 Human genes 0.000 description 2
- 102100025183 DDB1- and CUL4-associated factor 11 Human genes 0.000 description 2
- 102100033462 DENN domain-containing protein 1B Human genes 0.000 description 2
- 102100034157 DNA mismatch repair protein Msh2 Human genes 0.000 description 2
- 102100021147 DNA mismatch repair protein Msh6 Human genes 0.000 description 2
- 102100029905 DNA polymerase epsilon subunit 3 Human genes 0.000 description 2
- 102100022204 DNA-dependent protein kinase catalytic subunit Human genes 0.000 description 2
- 102100039886 DNA-directed RNA polymerase III subunit RPC4 Human genes 0.000 description 2
- 102000015983 Dact1 Human genes 0.000 description 2
- 102100028559 Death domain-associated protein 6 Human genes 0.000 description 2
- 102100035890 Delta(24)-sterol reductase Human genes 0.000 description 2
- 102100022283 Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial Human genes 0.000 description 2
- 102100040577 Dermatan-sulfate epimerase-like protein Human genes 0.000 description 2
- 102000003668 Destrin Human genes 0.000 description 2
- 108090000082 Destrin Proteins 0.000 description 2
- 102100037985 Dickkopf-related protein 3 Human genes 0.000 description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 2
- 102100036968 Dipeptidyl peptidase 8 Human genes 0.000 description 2
- 102100036039 Diphosphoinositol polyphosphate phosphohydrolase 2 Human genes 0.000 description 2
- 102100038390 Diphosphomevalonate decarboxylase Human genes 0.000 description 2
- 102100028572 Disabled homolog 2 Human genes 0.000 description 2
- 102100027043 Discoidin, CUB and LCCL domain-containing protein 2 Human genes 0.000 description 2
- 102100031113 Disintegrin and metalloproteinase domain-containing protein 15 Human genes 0.000 description 2
- 102100025979 Disintegrin and metalloproteinase domain-containing protein 33 Human genes 0.000 description 2
- 102100028027 Double-stranded RNA-binding protein Staufen homolog 1 Human genes 0.000 description 2
- 102100040858 Dual specificity protein kinase CLK4 Human genes 0.000 description 2
- 108010044191 Dynamin II Proteins 0.000 description 2
- 102100021238 Dynamin-2 Human genes 0.000 description 2
- 102100032249 Dystonin Human genes 0.000 description 2
- 108050002772 E3 ubiquitin-protein ligase Mdm2 Proteins 0.000 description 2
- 102000012199 E3 ubiquitin-protein ligase Mdm2 Human genes 0.000 description 2
- 102100035489 E3 ubiquitin-protein ligase NEURL1B Human genes 0.000 description 2
- 102100040278 E3 ubiquitin-protein ligase RNF19A Human genes 0.000 description 2
- 102100026464 E3 ubiquitin-protein ligase RNF38 Human genes 0.000 description 2
- 102100035661 E3 ubiquitin-protein ligase RNFT1 Human genes 0.000 description 2
- 102100028660 E3 ubiquitin-protein ligase SH3RF1 Human genes 0.000 description 2
- 102100034596 E3 ubiquitin-protein ligase TRIM23 Human genes 0.000 description 2
- 102100037460 E3 ubiquitin-protein ligase Topors Human genes 0.000 description 2
- 102100037024 E3 ubiquitin-protein ligase XIAP Human genes 0.000 description 2
- 102100037358 EF-hand calcium-binding domain-containing protein 14 Human genes 0.000 description 2
- 102100039577 ETS translocation variant 5 Human genes 0.000 description 2
- 102100035078 ETS-related transcription factor Elf-2 Human genes 0.000 description 2
- 102100023078 Early endosome antigen 1 Human genes 0.000 description 2
- 102100023226 Early growth response protein 1 Human genes 0.000 description 2
- 102100021977 Ectonucleotide pyrophosphatase/phosphodiesterase family member 2 Human genes 0.000 description 2
- 102100030801 Elongation factor 1-alpha 1 Human genes 0.000 description 2
- 102100037241 Endoglin Human genes 0.000 description 2
- 102100031702 Endoplasmic reticulum membrane sensor NFE2L1 Human genes 0.000 description 2
- 102100036725 Epithelial discoidin domain-containing receptor 1 Human genes 0.000 description 2
- 101710131668 Epithelial discoidin domain-containing receptor 1 Proteins 0.000 description 2
- 102100030082 Epsin-1 Human genes 0.000 description 2
- 102100030341 Ethanolaminephosphotransferase 1 Human genes 0.000 description 2
- 102100039735 Eukaryotic translation initiation factor 4 gamma 1 Human genes 0.000 description 2
- 102100039737 Eukaryotic translation initiation factor 4 gamma 2 Human genes 0.000 description 2
- 102100040022 Eukaryotic translation initiation factor 4 gamma 3 Human genes 0.000 description 2
- 102100029075 Exonuclease 1 Human genes 0.000 description 2
- 102100035977 Exostosin-like 2 Human genes 0.000 description 2
- 102100030861 Eyes absent homolog 3 Human genes 0.000 description 2
- 102100031807 F-box DNA helicase 1 Human genes 0.000 description 2
- 102100040641 F-box only protein 34 Human genes 0.000 description 2
- 102100024516 F-box only protein 5 Human genes 0.000 description 2
- 102100035111 Farnesyl pyrophosphate synthase Human genes 0.000 description 2
- 102100037682 Fasciculation and elongation protein zeta-1 Human genes 0.000 description 2
- 102100026149 Fibroblast growth factor receptor-like 1 Human genes 0.000 description 2
- 102100037362 Fibronectin Human genes 0.000 description 2
- 102100026559 Filamin-B Human genes 0.000 description 2
- 102100035130 Forkhead box protein K1 Human genes 0.000 description 2
- 102100040680 Formin-binding protein 1 Human genes 0.000 description 2
- 108090000123 Fos-related antigen 1 Proteins 0.000 description 2
- 102000003817 Fos-related antigen 1 Human genes 0.000 description 2
- 102100023686 G protein-coupled receptor kinase 6 Human genes 0.000 description 2
- 102100035205 GA-binding protein subunit beta-1 Human genes 0.000 description 2
- 102100034265 GEM-interacting protein Human genes 0.000 description 2
- 101710102635 GEM-interacting protein Proteins 0.000 description 2
- 102100040014 GH3 domain-containing protein Human genes 0.000 description 2
- 102100040196 GRB10-interacting GYF protein 2 Human genes 0.000 description 2
- 102100039554 Galectin-8 Human genes 0.000 description 2
- 102100025624 Gap junction delta-3 protein Human genes 0.000 description 2
- 102100037390 Genetic suppressor element 1 Human genes 0.000 description 2
- 102100036769 Girdin Human genes 0.000 description 2
- 102100033299 Glia-derived nexin Human genes 0.000 description 2
- 102100033802 Golgi pH regulator A Human genes 0.000 description 2
- 102100036698 Golgi reassembly-stacking protein 1 Human genes 0.000 description 2
- 102100032564 Golgin subfamily A member 2 Human genes 0.000 description 2
- 102100038367 Gremlin-1 Human genes 0.000 description 2
- 102100031493 Growth arrest-specific protein 7 Human genes 0.000 description 2
- 102100032610 Guanine nucleotide-binding protein G(s) subunit alpha isoforms XLas Human genes 0.000 description 2
- 102100036703 Guanine nucleotide-binding protein subunit alpha-13 Human genes 0.000 description 2
- 102100021187 Guanine nucleotide-binding protein-like 3-like protein Human genes 0.000 description 2
- 102100039317 HAUS augmin-like complex subunit 3 Human genes 0.000 description 2
- 102100039318 HAUS augmin-like complex subunit 6 Human genes 0.000 description 2
- 102100028972 HLA class I histocompatibility antigen, A alpha chain Human genes 0.000 description 2
- 102100028970 HLA class I histocompatibility antigen, alpha chain E Human genes 0.000 description 2
- 108010075704 HLA-A Antigens Proteins 0.000 description 2
- 108700010013 HMGB1 Proteins 0.000 description 2
- 101150021904 HMGB1 gene Proteins 0.000 description 2
- 102100031880 Helicase SRCAP Human genes 0.000 description 2
- 102100037848 Heterochromatin protein 1-binding protein 3 Human genes 0.000 description 2
- 102100023999 Heterogeneous nuclear ribonucleoprotein R Human genes 0.000 description 2
- 102100033998 Heterogeneous nuclear ribonucleoprotein U-like protein 1 Human genes 0.000 description 2
- 102100037907 High mobility group protein B1 Human genes 0.000 description 2
- 102100029009 High mobility group protein HMG-I/HMG-Y Human genes 0.000 description 2
- 102100021467 Histone acetyltransferase type B catalytic subunit Human genes 0.000 description 2
- 102100038719 Histone deacetylase 7 Human genes 0.000 description 2
- 102100035864 Histone lysine demethylase PHF8 Human genes 0.000 description 2
- 102100035042 Histone-lysine N-methyltransferase EHMT2 Human genes 0.000 description 2
- 102100025663 Histone-lysine N-trimethyltransferase SMYD5 Human genes 0.000 description 2
- 102100034826 Homeobox protein Meis2 Human genes 0.000 description 2
- 102100028092 Homeobox protein Nkx-3.1 Human genes 0.000 description 2
- 101000605576 Homo sapiens 1-acyl-sn-glycerol-3-phosphate acyltransferase gamma Proteins 0.000 description 2
- 101000625743 Homo sapiens 182 kDa tankyrase-1-binding protein Proteins 0.000 description 2
- 101001135306 Homo sapiens 26S proteasome non-ATPase regulatory subunit 6 Proteins 0.000 description 2
- 101000619137 Homo sapiens 26S proteasome regulatory subunit 4 Proteins 0.000 description 2
- 101000988577 Homo sapiens 3-hydroxy-3-methylglutaryl-coenzyme A reductase Proteins 0.000 description 2
- 101000670350 Homo sapiens 39S ribosomal protein L3, mitochondrial Proteins 0.000 description 2
- 101000678236 Homo sapiens 5'-nucleotidase Proteins 0.000 description 2
- 101001108634 Homo sapiens 60S ribosomal protein L10 Proteins 0.000 description 2
- 101001117935 Homo sapiens 60S ribosomal protein L15 Proteins 0.000 description 2
- 101000928720 Homo sapiens 7-dehydrocholesterol reductase Proteins 0.000 description 2
- 101000774717 Homo sapiens A-kinase anchor protein 1, mitochondrial Proteins 0.000 description 2
- 101000890598 Homo sapiens A-kinase anchor protein 9 Proteins 0.000 description 2
- 101000797458 Homo sapiens AMP deaminase 2 Proteins 0.000 description 2
- 101000782077 Homo sapiens AN1-type zinc finger protein 5 Proteins 0.000 description 2
- 101000732341 Homo sapiens AP-2 complex subunit beta Proteins 0.000 description 2
- 101000833502 Homo sapiens AT-hook DNA-binding motif-containing protein 1 Proteins 0.000 description 2
- 101000685261 Homo sapiens AT-rich interactive domain-containing protein 2 Proteins 0.000 description 2
- 101000902754 Homo sapiens ATM interactor Proteins 0.000 description 2
- 101000693765 Homo sapiens ATP-dependent 6-phosphofructokinase, platelet type Proteins 0.000 description 2
- 101000864670 Homo sapiens ATP-dependent RNA helicase A Proteins 0.000 description 2
- 101000864666 Homo sapiens ATP-dependent RNA helicase DHX8 Proteins 0.000 description 2
- 101000837584 Homo sapiens Acetyl-CoA acetyltransferase, cytosolic Proteins 0.000 description 2
- 101000963424 Homo sapiens Acetyl-CoA carboxylase 1 Proteins 0.000 description 2
- 101000757200 Homo sapiens Acidic leucine-rich nuclear phosphoprotein 32 family member A Proteins 0.000 description 2
- 101000783819 Homo sapiens Actin-binding LIM protein 3 Proteins 0.000 description 2
- 101000583854 Homo sapiens Activating transcription factor 7-interacting protein 1 Proteins 0.000 description 2
- 101000848239 Homo sapiens Acyl-CoA (8-3)-desaturase Proteins 0.000 description 2
- 101000848255 Homo sapiens Acyl-CoA 6-desaturase Proteins 0.000 description 2
- 101000822527 Homo sapiens Adenosylhomocysteinase 3 Proteins 0.000 description 2
- 101000928246 Homo sapiens Afadin Proteins 0.000 description 2
- 101000876352 Homo sapiens Alpha-endosulfine Proteins 0.000 description 2
- 101000800875 Homo sapiens Alpha-globin transcription factor CP2 Proteins 0.000 description 2
- 101000924727 Homo sapiens Alternative prion protein Proteins 0.000 description 2
- 101000961279 Homo sapiens Ankyrin repeat and SAM domain-containing protein 6 Proteins 0.000 description 2
- 101000924481 Homo sapiens Ankyrin repeat domain-containing protein 17 Proteins 0.000 description 2
- 101000924629 Homo sapiens Apoptotic protease-activating factor 1 Proteins 0.000 description 2
- 101000757586 Homo sapiens Aprataxin Proteins 0.000 description 2
- 101000975992 Homo sapiens Asparagine synthetase [glutamine-hydrolyzing] Proteins 0.000 description 2
- 101000696909 Homo sapiens Aspartate-tRNA ligase, cytoplasmic Proteins 0.000 description 2
- 101000785057 Homo sapiens Autophagy-related protein 9A Proteins 0.000 description 2
- 101000697872 Homo sapiens BAG family molecular chaperone regulator 2 Proteins 0.000 description 2
- 101000739794 Homo sapiens BEN domain-containing protein 6 Proteins 0.000 description 2
- 101000896834 Homo sapiens BTB/POZ domain-containing protein 10 Proteins 0.000 description 2
- 101000766130 Homo sapiens Beta-1,4-galactosyltransferase 2 Proteins 0.000 description 2
- 101000613557 Homo sapiens Beta-parvin Proteins 0.000 description 2
- 101000894895 Homo sapiens Beta-secretase 1 Proteins 0.000 description 2
- 101000935689 Homo sapiens Brain acid soluble protein 1 Proteins 0.000 description 2
- 101000935648 Homo sapiens Breast cancer anti-estrogen resistance protein 3 Proteins 0.000 description 2
- 101000871850 Homo sapiens Bromodomain-containing protein 2 Proteins 0.000 description 2
- 101000914211 Homo sapiens CASP8 and FADD-like apoptosis regulator Proteins 0.000 description 2
- 101000910382 Homo sapiens CASP8-associated protein 2 Proteins 0.000 description 2
- 101000919672 Homo sapiens CCR4-NOT transcription complex subunit 1 Proteins 0.000 description 2
- 101000884279 Homo sapiens CD276 antigen Proteins 0.000 description 2
- 101100382122 Homo sapiens CIITA gene Proteins 0.000 description 2
- 101000891989 Homo sapiens CSC1-like protein 1 Proteins 0.000 description 2
- 101000762236 Homo sapiens Cadherin-11 Proteins 0.000 description 2
- 101000899411 Homo sapiens Calcium-binding protein 39 Proteins 0.000 description 2
- 101000728145 Homo sapiens Calcium-transporting ATPase type 2C member 1 Proteins 0.000 description 2
- 101000971625 Homo sapiens Calcium/calmodulin-dependent protein kinase kinase 1 Proteins 0.000 description 2
- 101000919194 Homo sapiens Calpain small subunit 1 Proteins 0.000 description 2
- 101000725947 Homo sapiens Carboxy-terminal domain RNA polymerase II polypeptide A small phosphatase 2 Proteins 0.000 description 2
- 101000895518 Homo sapiens Cardiolipin synthase (CMP-forming) Proteins 0.000 description 2
- 101000859758 Homo sapiens Cartilage-associated protein Proteins 0.000 description 2
- 101000994700 Homo sapiens Casein kinase I isoform alpha Proteins 0.000 description 2
- 101000916264 Homo sapiens Catenin delta-1 Proteins 0.000 description 2
- 101000715467 Homo sapiens Caveolin-1 Proteins 0.000 description 2
- 101000715197 Homo sapiens Cell division cycle and apoptosis regulator protein 1 Proteins 0.000 description 2
- 101000750094 Homo sapiens Chemerin-like receptor 2 Proteins 0.000 description 2
- 101000946430 Homo sapiens Chloride intracellular channel protein 1 Proteins 0.000 description 2
- 101000883545 Homo sapiens Chromodomain-helicase-DNA-binding protein 8 Proteins 0.000 description 2
- 101000710327 Homo sapiens Cip1-interacting zinc finger protein Proteins 0.000 description 2
- 101000978318 Homo sapiens Coiled-coil domain-containing protein 77 Proteins 0.000 description 2
- 101000797732 Homo sapiens Coiled-coil domain-containing protein 92 Proteins 0.000 description 2
- 101000940535 Homo sapiens Cold shock domain-containing protein E1 Proteins 0.000 description 2
- 101000941581 Homo sapiens Collagen alpha-1(VI) chain Proteins 0.000 description 2
- 101000920124 Homo sapiens Conserved oligomeric Golgi complex subunit 1 Proteins 0.000 description 2
- 101001114650 Homo sapiens Corrinoid adenosyltransferase Proteins 0.000 description 2
- 101000746072 Homo sapiens Cullin-2 Proteins 0.000 description 2
- 101000916245 Homo sapiens Cullin-4A Proteins 0.000 description 2
- 101000726193 Homo sapiens Cyclic AMP-responsive element-binding protein 5 Proteins 0.000 description 2
- 101000738400 Homo sapiens Cyclin-dependent kinase 11B Proteins 0.000 description 2
- 101000944357 Homo sapiens Cyclin-dependent kinase 16 Proteins 0.000 description 2
- 101000745751 Homo sapiens Cytoplasmic polyadenylation element-binding protein 2 Proteins 0.000 description 2
- 101000721261 Homo sapiens DDB1- and CUL4-associated factor 10 Proteins 0.000 description 2
- 101000721268 Homo sapiens DDB1- and CUL4-associated factor 11 Proteins 0.000 description 2
- 101000870914 Homo sapiens DENN domain-containing protein 1B Proteins 0.000 description 2
- 101001134036 Homo sapiens DNA mismatch repair protein Msh2 Proteins 0.000 description 2
- 101000968658 Homo sapiens DNA mismatch repair protein Msh6 Proteins 0.000 description 2
- 101000864175 Homo sapiens DNA polymerase epsilon subunit 3 Proteins 0.000 description 2
- 101000619536 Homo sapiens DNA-dependent protein kinase catalytic subunit Proteins 0.000 description 2
- 101000669237 Homo sapiens DNA-directed RNA polymerase III subunit RPC4 Proteins 0.000 description 2
- 101000856043 Homo sapiens Dapper homolog 1 Proteins 0.000 description 2
- 101001053992 Homo sapiens Deleted in lung and esophageal cancer protein 1 Proteins 0.000 description 2
- 101000929877 Homo sapiens Delta(24)-sterol reductase Proteins 0.000 description 2
- 101000755868 Homo sapiens Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial Proteins 0.000 description 2
- 101000816741 Homo sapiens Dermatan-sulfate epimerase-like protein Proteins 0.000 description 2
- 101000951342 Homo sapiens Dickkopf-related protein 3 Proteins 0.000 description 2
- 101000804947 Homo sapiens Dipeptidyl peptidase 8 Proteins 0.000 description 2
- 101000595333 Homo sapiens Diphosphoinositol polyphosphate phosphohydrolase 2 Proteins 0.000 description 2
- 101000958922 Homo sapiens Diphosphomevalonate decarboxylase Proteins 0.000 description 2
- 101000915391 Homo sapiens Disabled homolog 2 Proteins 0.000 description 2
- 101000911787 Homo sapiens Discoidin, CUB and LCCL domain-containing protein 2 Proteins 0.000 description 2
- 101000777455 Homo sapiens Disintegrin and metalloproteinase domain-containing protein 15 Proteins 0.000 description 2
- 101000720049 Homo sapiens Disintegrin and metalloproteinase domain-containing protein 33 Proteins 0.000 description 2
- 101000697574 Homo sapiens Double-stranded RNA-binding protein Staufen homolog 1 Proteins 0.000 description 2
- 101000749298 Homo sapiens Dual specificity protein kinase CLK4 Proteins 0.000 description 2
- 101000966403 Homo sapiens Dynein light chain 1, cytoplasmic Proteins 0.000 description 2
- 101001016186 Homo sapiens Dystonin Proteins 0.000 description 2
- 101001023726 Homo sapiens E3 ubiquitin-protein ligase NEURL1B Proteins 0.000 description 2
- 101000712013 Homo sapiens E3 ubiquitin-protein ligase RNF14 Proteins 0.000 description 2
- 101000692681 Homo sapiens E3 ubiquitin-protein ligase RNF38 Proteins 0.000 description 2
- 101000853944 Homo sapiens E3 ubiquitin-protein ligase RNFT1 Proteins 0.000 description 2
- 101000837060 Homo sapiens E3 ubiquitin-protein ligase SH3RF1 Proteins 0.000 description 2
- 101000848625 Homo sapiens E3 ubiquitin-protein ligase TRIM23 Proteins 0.000 description 2
- 101000662670 Homo sapiens E3 ubiquitin-protein ligase Topors Proteins 0.000 description 2
- 101000880230 Homo sapiens EF-hand calcium-binding domain-containing protein 14 Proteins 0.000 description 2
- 101000813745 Homo sapiens ETS translocation variant 5 Proteins 0.000 description 2
- 101000877377 Homo sapiens ETS-related transcription factor Elf-2 Proteins 0.000 description 2
- 101001050162 Homo sapiens Early endosome antigen 1 Proteins 0.000 description 2
- 101001049697 Homo sapiens Early growth response protein 1 Proteins 0.000 description 2
- 101000897035 Homo sapiens Ectonucleotide pyrophosphatase/phosphodiesterase family member 2 Proteins 0.000 description 2
- 101000920078 Homo sapiens Elongation factor 1-alpha 1 Proteins 0.000 description 2
- 101000881679 Homo sapiens Endoglin Proteins 0.000 description 2
- 101001012105 Homo sapiens Epsin-1 Proteins 0.000 description 2
- 101000938340 Homo sapiens Ethanolaminephosphotransferase 1 Proteins 0.000 description 2
- 101001034825 Homo sapiens Eukaryotic translation initiation factor 4 gamma 1 Proteins 0.000 description 2
- 101001034811 Homo sapiens Eukaryotic translation initiation factor 4 gamma 2 Proteins 0.000 description 2
- 101001034840 Homo sapiens Eukaryotic translation initiation factor 4 gamma 3 Proteins 0.000 description 2
- 101000918264 Homo sapiens Exonuclease 1 Proteins 0.000 description 2
- 101000875558 Homo sapiens Exostosin-like 2 Proteins 0.000 description 2
- 101000938441 Homo sapiens Eyes absent homolog 3 Proteins 0.000 description 2
- 101001065291 Homo sapiens F-box DNA helicase 1 Proteins 0.000 description 2
- 101000824114 Homo sapiens F-box only protein 31 Proteins 0.000 description 2
- 101000892349 Homo sapiens F-box only protein 34 Proteins 0.000 description 2
- 101001052797 Homo sapiens F-box only protein 5 Proteins 0.000 description 2
- 101001023007 Homo sapiens Farnesyl pyrophosphate synthase Proteins 0.000 description 2
- 101000912518 Homo sapiens Fibroblast growth factor receptor-like 1 Proteins 0.000 description 2
- 101001027128 Homo sapiens Fibronectin Proteins 0.000 description 2
- 101000913551 Homo sapiens Filamin-B Proteins 0.000 description 2
- 101001023398 Homo sapiens Forkhead box protein K1 Proteins 0.000 description 2
- 101000892722 Homo sapiens Formin-binding protein 1 Proteins 0.000 description 2
- 101000829473 Homo sapiens G protein-coupled receptor kinase 6 Proteins 0.000 description 2
- 101001022098 Homo sapiens GA-binding protein subunit beta-1 Proteins 0.000 description 2
- 101000886770 Homo sapiens GH3 domain-containing protein Proteins 0.000 description 2
- 101001037074 Homo sapiens GRB10-interacting GYF protein 2 Proteins 0.000 description 2
- 101000608769 Homo sapiens Galectin-8 Proteins 0.000 description 2
- 101000856663 Homo sapiens Gap junction delta-3 protein Proteins 0.000 description 2
- 101000746078 Homo sapiens Gap junction gamma-1 protein Proteins 0.000 description 2
- 101001026271 Homo sapiens Genetic suppressor element 1 Proteins 0.000 description 2
- 101001071367 Homo sapiens Girdin Proteins 0.000 description 2
- 101000997803 Homo sapiens Glia-derived nexin Proteins 0.000 description 2
- 101001069247 Homo sapiens Golgi pH regulator A Proteins 0.000 description 2
- 101001072488 Homo sapiens Golgi reassembly-stacking protein 1 Proteins 0.000 description 2
- 101001014629 Homo sapiens Golgin subfamily A member 2 Proteins 0.000 description 2
- 101001032872 Homo sapiens Gremlin-1 Proteins 0.000 description 2
- 101000923044 Homo sapiens Growth arrest-specific protein 7 Proteins 0.000 description 2
- 101001014590 Homo sapiens Guanine nucleotide-binding protein G(s) subunit alpha isoforms XLas Proteins 0.000 description 2
- 101001014594 Homo sapiens Guanine nucleotide-binding protein G(s) subunit alpha isoforms short Proteins 0.000 description 2
- 101001072481 Homo sapiens Guanine nucleotide-binding protein subunit alpha-13 Proteins 0.000 description 2
- 101001040761 Homo sapiens Guanine nucleotide-binding protein-like 3-like protein Proteins 0.000 description 2
- 101001035819 Homo sapiens HAUS augmin-like complex subunit 3 Proteins 0.000 description 2
- 101001035815 Homo sapiens HAUS augmin-like complex subunit 6 Proteins 0.000 description 2
- 101000986085 Homo sapiens HLA class I histocompatibility antigen, alpha chain E Proteins 0.000 description 2
- 101000704158 Homo sapiens Helicase SRCAP Proteins 0.000 description 2
- 101001025546 Homo sapiens Heterochromatin protein 1-binding protein 3 Proteins 0.000 description 2
- 101001047853 Homo sapiens Heterogeneous nuclear ribonucleoprotein R Proteins 0.000 description 2
- 101001017567 Homo sapiens Heterogeneous nuclear ribonucleoprotein U-like protein 1 Proteins 0.000 description 2
- 101000986380 Homo sapiens High mobility group protein HMG-I/HMG-Y Proteins 0.000 description 2
- 101001016841 Homo sapiens Histamine H1 receptor Proteins 0.000 description 2
- 101000898976 Homo sapiens Histone acetyltransferase type B catalytic subunit Proteins 0.000 description 2
- 101001032113 Homo sapiens Histone deacetylase 7 Proteins 0.000 description 2
- 101001000378 Homo sapiens Histone lysine demethylase PHF8 Proteins 0.000 description 2
- 101000877312 Homo sapiens Histone-lysine N-methyltransferase EHMT2 Proteins 0.000 description 2
- 101000835819 Homo sapiens Histone-lysine N-trimethyltransferase SMYD5 Proteins 0.000 description 2
- 101001019057 Homo sapiens Homeobox protein Meis2 Proteins 0.000 description 2
- 101000578249 Homo sapiens Homeobox protein Nkx-3.1 Proteins 0.000 description 2
- 101000839025 Homo sapiens Hydroxymethylglutaryl-CoA synthase, cytoplasmic Proteins 0.000 description 2
- 101001011421 Homo sapiens IQ domain-containing protein E Proteins 0.000 description 2
- 101001059713 Homo sapiens Inner nuclear membrane protein Man1 Proteins 0.000 description 2
- 101000953492 Homo sapiens Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Proteins 0.000 description 2
- 101000599779 Homo sapiens Insulin-like growth factor 2 mRNA-binding protein 2 Proteins 0.000 description 2
- 101000998810 Homo sapiens Insulin-like peptide INSL6 Proteins 0.000 description 2
- 101001056814 Homo sapiens Integral membrane protein 2C Proteins 0.000 description 2
- 101001003262 Homo sapiens Integral membrane protein DGCR2/IDD Proteins 0.000 description 2
- 101001046677 Homo sapiens Integrin alpha-V Proteins 0.000 description 2
- 101001015059 Homo sapiens Integrin beta-5 Proteins 0.000 description 2
- 101001011441 Homo sapiens Interferon regulatory factor 4 Proteins 0.000 description 2
- 101000599056 Homo sapiens Interleukin-6 receptor subunit beta Proteins 0.000 description 2
- 101001056724 Homo sapiens Intersectin-1 Proteins 0.000 description 2
- 101000677891 Homo sapiens Iron-sulfur clusters transporter ABCB7, mitochondrial Proteins 0.000 description 2
- 101000960234 Homo sapiens Isocitrate dehydrogenase [NADP] cytoplasmic Proteins 0.000 description 2
- 101000875582 Homo sapiens Isoleucine-tRNA ligase, cytoplasmic Proteins 0.000 description 2
- 101001081533 Homo sapiens Isopentenyl-diphosphate Delta-isomerase 1 Proteins 0.000 description 2
- 101001026582 Homo sapiens KAT8 regulatory NSL complex subunit 3 Proteins 0.000 description 2
- 101001008857 Homo sapiens Kelch-like protein 7 Proteins 0.000 description 2
- 101001007036 Homo sapiens Keratin, type I cuticular Ha4 Proteins 0.000 description 2
- 101000998020 Homo sapiens Keratin, type I cytoskeletal 18 Proteins 0.000 description 2
- 101000998011 Homo sapiens Keratin, type I cytoskeletal 19 Proteins 0.000 description 2
- 101000944965 Homo sapiens Keratin-associated protein 2-3 Proteins 0.000 description 2
- 101000605496 Homo sapiens Kinesin light chain 1 Proteins 0.000 description 2
- 101000605501 Homo sapiens Kinesin light chain 2 Proteins 0.000 description 2
- 101001008949 Homo sapiens Kinesin-like protein KIF14 Proteins 0.000 description 2
- 101001050577 Homo sapiens Kinesin-like protein KIF2A Proteins 0.000 description 2
- 101001139126 Homo sapiens Krueppel-like factor 6 Proteins 0.000 description 2
- 101001135088 Homo sapiens LIM domain only protein 7 Proteins 0.000 description 2
- 101000717987 Homo sapiens LIM domain-containing protein ajuba Proteins 0.000 description 2
- 101001138020 Homo sapiens La-related protein 4 Proteins 0.000 description 2
- 101001034314 Homo sapiens Lactadherin Proteins 0.000 description 2
- 101000972491 Homo sapiens Laminin subunit alpha-2 Proteins 0.000 description 2
- 101001008568 Homo sapiens Laminin subunit beta-1 Proteins 0.000 description 2
- 101000896726 Homo sapiens Lanosterol 14-alpha demethylase Proteins 0.000 description 2
- 101001065660 Homo sapiens Lanosterol synthase Proteins 0.000 description 2
- 101001038427 Homo sapiens Leucine zipper putative tumor suppressor 2 Proteins 0.000 description 2
- 101000941892 Homo sapiens Leucine-rich repeat and calponin homology domain-containing protein 4 Proteins 0.000 description 2
- 101000619640 Homo sapiens Leucine-rich repeats and immunoglobulin-like domains protein 1 Proteins 0.000 description 2
- 101000619643 Homo sapiens Ligand-dependent nuclear receptor-interacting factor 1 Proteins 0.000 description 2
- 101001064870 Homo sapiens Lon protease homolog, mitochondrial Proteins 0.000 description 2
- 101001051093 Homo sapiens Low-density lipoprotein receptor Proteins 0.000 description 2
- 101001039207 Homo sapiens Low-density lipoprotein receptor-related protein 8 Proteins 0.000 description 2
- 101000613958 Homo sapiens Lysine-specific demethylase 2A Proteins 0.000 description 2
- 101001039696 Homo sapiens Lysophospholipid acyltransferase 7 Proteins 0.000 description 2
- 101000624631 Homo sapiens M-phase inducer phosphatase 2 Proteins 0.000 description 2
- 101001018978 Homo sapiens MAP kinase-interacting serine/threonine-protein kinase 2 Proteins 0.000 description 2
- 101100345091 Homo sapiens MEPCE gene Proteins 0.000 description 2
- 101000578262 Homo sapiens Magnesium transporter NIPA1 Proteins 0.000 description 2
- 101000573901 Homo sapiens Major prion protein Proteins 0.000 description 2
- 101001014562 Homo sapiens Male-specific lethal 3 homolog Proteins 0.000 description 2
- 101000615932 Homo sapiens Mannosyl-oligosaccharide 1,2-alpha-mannosidase IB Proteins 0.000 description 2
- 101000962131 Homo sapiens Mediator of RNA polymerase II transcription subunit 1 Proteins 0.000 description 2
- 101000961414 Homo sapiens Membrane cofactor protein Proteins 0.000 description 2
- 101000583145 Homo sapiens Membrane-associated phosphatidylinositol transfer protein 1 Proteins 0.000 description 2
- 101000954986 Homo sapiens Merlin Proteins 0.000 description 2
- 101000969780 Homo sapiens Metallophosphoesterase 1 Proteins 0.000 description 2
- 101000645296 Homo sapiens Metalloproteinase inhibitor 2 Proteins 0.000 description 2
- 101000628535 Homo sapiens Metalloreductase STEAP2 Proteins 0.000 description 2
- 101001116314 Homo sapiens Methionine synthase reductase Proteins 0.000 description 2
- 101000615492 Homo sapiens Methyl-CpG-binding domain protein 4 Proteins 0.000 description 2
- 101000653369 Homo sapiens Methylcytosine dioxygenase TET3 Proteins 0.000 description 2
- 101000968916 Homo sapiens Methylsterol monooxygenase 1 Proteins 0.000 description 2
- 101000764216 Homo sapiens Mitochondrial import receptor subunit TOM40 homolog Proteins 0.000 description 2
- 101000764239 Homo sapiens Mitochondrial import receptor subunit TOM5 homolog Proteins 0.000 description 2
- 101001018157 Homo sapiens Mitogen-activated protein kinase kinase kinase 20 Proteins 0.000 description 2
- 101001059984 Homo sapiens Mitogen-activated protein kinase kinase kinase kinase 4 Proteins 0.000 description 2
- 101000573447 Homo sapiens Multiple inositol polyphosphate phosphatase 1 Proteins 0.000 description 2
- 101000958041 Homo sapiens Musculin Proteins 0.000 description 2
- 101000573513 Homo sapiens Muskelin Proteins 0.000 description 2
- 101000624898 Homo sapiens Myb/SANT-like DNA-binding domain-containing protein 3 Proteins 0.000 description 2
- 101000969763 Homo sapiens Myelin protein zero-like protein 1 Proteins 0.000 description 2
- 101001022726 Homo sapiens Myeloid-associated differentiation marker Proteins 0.000 description 2
- 101000591286 Homo sapiens Myocardin-related transcription factor A Proteins 0.000 description 2
- 101001116601 Homo sapiens Myotubularin-related protein 9 Proteins 0.000 description 2
- 101000873851 Homo sapiens N(G),N(G)-dimethylarginine dimethylaminohydrolase 1 Proteins 0.000 description 2
- 101000929583 Homo sapiens N(G),N(G)-dimethylarginine dimethylaminohydrolase 2 Proteins 0.000 description 2
- 101001128274 Homo sapiens N-alpha-acetyltransferase 35, NatC auxiliary subunit Proteins 0.000 description 2
- 101001112714 Homo sapiens NAD kinase Proteins 0.000 description 2
- 101001108356 Homo sapiens Nardilysin Proteins 0.000 description 2
- 101000979297 Homo sapiens Negative elongation factor A Proteins 0.000 description 2
- 101000624947 Homo sapiens Nesprin-1 Proteins 0.000 description 2
- 101000624956 Homo sapiens Nesprin-2 Proteins 0.000 description 2
- 101000624960 Homo sapiens Nesprin-3 Proteins 0.000 description 2
- 101000672316 Homo sapiens Netrin receptor UNC5B Proteins 0.000 description 2
- 101000604463 Homo sapiens Netrin-G1 Proteins 0.000 description 2
- 101000604469 Homo sapiens Netrin-G2 Proteins 0.000 description 2
- 101001014610 Homo sapiens Neuroendocrine secretory protein 55 Proteins 0.000 description 2
- 101000582002 Homo sapiens Neuron navigator 2 Proteins 0.000 description 2
- 101000578062 Homo sapiens Nicastrin Proteins 0.000 description 2
- 101000601048 Homo sapiens Nidogen-2 Proteins 0.000 description 2
- 101000578354 Homo sapiens Nodal modulator 3 Proteins 0.000 description 2
- 101000859679 Homo sapiens Non-lysosomal glucosylceramidase Proteins 0.000 description 2
- 101000970403 Homo sapiens Nuclear pore complex protein Nup153 Proteins 0.000 description 2
- 101001121654 Homo sapiens Nuclear pore complex protein Nup50 Proteins 0.000 description 2
- 101000602926 Homo sapiens Nuclear receptor coactivator 1 Proteins 0.000 description 2
- 101000974356 Homo sapiens Nuclear receptor coactivator 3 Proteins 0.000 description 2
- 101000974343 Homo sapiens Nuclear receptor coactivator 4 Proteins 0.000 description 2
- 101000991410 Homo sapiens Nucleolar and spindle-associated protein 1 Proteins 0.000 description 2
- 101001139122 Homo sapiens Nucleoporin NUP35 Proteins 0.000 description 2
- 101001121636 Homo sapiens Nucleoporin p58/p45 Proteins 0.000 description 2
- 101001120706 Homo sapiens Outer dense fiber protein 2 Proteins 0.000 description 2
- 101001134647 Homo sapiens PDZ and LIM domain protein 7 Proteins 0.000 description 2
- 101001129712 Homo sapiens PHD and RING finger domain-containing protein 1 Proteins 0.000 description 2
- 101001071236 Homo sapiens PHD finger protein 19 Proteins 0.000 description 2
- 101001000780 Homo sapiens POU domain, class 2, transcription factor 1 Proteins 0.000 description 2
- 101001131670 Homo sapiens PWWP domain-containing DNA repair factor 3A Proteins 0.000 description 2
- 101000677825 Homo sapiens Palmitoyl-protein thioesterase ABHD10, mitochondrial Proteins 0.000 description 2
- 101001135199 Homo sapiens Partitioning defective 3 homolog Proteins 0.000 description 2
- 101001098517 Homo sapiens Paxillin Proteins 0.000 description 2
- 101001134730 Homo sapiens Pecanex-like protein 2 Proteins 0.000 description 2
- 101000896765 Homo sapiens Peregrin Proteins 0.000 description 2
- 101001095308 Homo sapiens Periostin Proteins 0.000 description 2
- 101001122930 Homo sapiens Periphilin-1 Proteins 0.000 description 2
- 101001131990 Homo sapiens Peroxidasin homolog Proteins 0.000 description 2
- 101001073025 Homo sapiens Peroxisomal targeting signal 1 receptor Proteins 0.000 description 2
- 101000741788 Homo sapiens Peroxisome proliferator-activated receptor alpha Proteins 0.000 description 2
- 101000890327 Homo sapiens Peroxynitrite isomerase THAP4 Proteins 0.000 description 2
- 101001087045 Homo sapiens Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN Proteins 0.000 description 2
- 101000983253 Homo sapiens Phosphatidylinositol 4-kinase type 2-alpha Proteins 0.000 description 2
- 101000721645 Homo sapiens Phosphatidylinositol 4-phosphate 3-kinase C2 domain-containing subunit beta Proteins 0.000 description 2
- 101000604565 Homo sapiens Phosphatidylinositol glycan anchor biosynthesis class U protein Proteins 0.000 description 2
- 101000595859 Homo sapiens Phosphatidylinositol transfer protein alpha isoform Proteins 0.000 description 2
- 101000870428 Homo sapiens Phospholipase DDHD2 Proteins 0.000 description 2
- 101001126233 Homo sapiens Phospholipid phosphatase 4 Proteins 0.000 description 2
- 101000689377 Homo sapiens Phospholipid scramblase 3 Proteins 0.000 description 2
- 101001129789 Homo sapiens Piezo-type mechanosensitive ion channel component 1 Proteins 0.000 description 2
- 101000745252 Homo sapiens Plasma membrane ascorbate-dependent reductase CYBRD1 Proteins 0.000 description 2
- 101001126098 Homo sapiens Pleckstrin homology domain-containing family B member 2 Proteins 0.000 description 2
- 101001126471 Homo sapiens Plectin Proteins 0.000 description 2
- 101001067170 Homo sapiens Plexin-B2 Proteins 0.000 description 2
- 101001094872 Homo sapiens Plexin-C1 Proteins 0.000 description 2
- 101000586618 Homo sapiens Poliovirus receptor Proteins 0.000 description 2
- 101001113490 Homo sapiens Poly(A)-specific ribonuclease PARN Proteins 0.000 description 2
- 101001087352 Homo sapiens Poly(U)-binding-splicing factor PUF60 Proteins 0.000 description 2
- 101000735358 Homo sapiens Poly(rC)-binding protein 2 Proteins 0.000 description 2
- 101000735365 Homo sapiens Poly(rC)-binding protein 4 Proteins 0.000 description 2
- 101000613347 Homo sapiens Polycomb group RING finger protein 3 Proteins 0.000 description 2
- 101001002271 Homo sapiens Polypeptide N-acetylgalactosaminyltransferase 1 Proteins 0.000 description 2
- 101001122801 Homo sapiens Pre-mRNA-processing factor 17 Proteins 0.000 description 2
- 101000788412 Homo sapiens Probable methyltransferase TARBP1 Proteins 0.000 description 2
- 101000976219 Homo sapiens Probable ribonuclease ZC3H12C Proteins 0.000 description 2
- 101000614345 Homo sapiens Prolyl 4-hydroxylase subunit alpha-1 Proteins 0.000 description 2
- 101001098868 Homo sapiens Proprotein convertase subtilisin/kexin type 9 Proteins 0.000 description 2
- 101000797903 Homo sapiens Protein ALEX Proteins 0.000 description 2
- 101000918443 Homo sapiens Protein FAM219A Proteins 0.000 description 2
- 101000918451 Homo sapiens Protein FAM219B Proteins 0.000 description 2
- 101000891845 Homo sapiens Protein FAM3C Proteins 0.000 description 2
- 101000931462 Homo sapiens Protein FosB Proteins 0.000 description 2
- 101000872736 Homo sapiens Protein HEG homolog 1 Proteins 0.000 description 2
- 101000582610 Homo sapiens Protein MEMO1 Proteins 0.000 description 2
- 101000977257 Homo sapiens Protein MMS22-like Proteins 0.000 description 2
- 101001130763 Homo sapiens Protein OS-9 Proteins 0.000 description 2
- 101001129744 Homo sapiens Protein PHTF2 Proteins 0.000 description 2
- 101000652433 Homo sapiens Protein SON Proteins 0.000 description 2
- 101000657326 Homo sapiens Protein TANC2 Proteins 0.000 description 2
- 101000804804 Homo sapiens Protein Wnt-5b Proteins 0.000 description 2
- 101000757216 Homo sapiens Protein arginine N-methyltransferase 1 Proteins 0.000 description 2
- 101000861454 Homo sapiens Protein c-Fos Proteins 0.000 description 2
- 101000928791 Homo sapiens Protein diaphanous homolog 1 Proteins 0.000 description 2
- 101001072202 Homo sapiens Protein disulfide-isomerase Proteins 0.000 description 2
- 101000613615 Homo sapiens Protein mono-ADP-ribosyltransferase PARP14 Proteins 0.000 description 2
- 101000735463 Homo sapiens Protein mono-ADP-ribosyltransferase PARP4 Proteins 0.000 description 2
- 101001000061 Homo sapiens Protein phosphatase 1 regulatory subunit 12A Proteins 0.000 description 2
- 101001100767 Homo sapiens Protein quaking Proteins 0.000 description 2
- 101000684926 Homo sapiens Protein transport protein Sec24B Proteins 0.000 description 2
- 101000641111 Homo sapiens Protein transport protein Sec61 subunit alpha isoform 1 Proteins 0.000 description 2
- 101000786203 Homo sapiens Protein yippee-like 5 Proteins 0.000 description 2
- 101001134890 Homo sapiens Protein-L-isoaspartate O-methyltransferase domain-containing protein 2 Proteins 0.000 description 2
- 101000878540 Homo sapiens Protein-tyrosine kinase 2-beta Proteins 0.000 description 2
- 101000602018 Homo sapiens Protocadherin gamma-B3 Proteins 0.000 description 2
- 101000590549 Homo sapiens Pseudouridylate synthase 7 homolog Proteins 0.000 description 2
- 101000592517 Homo sapiens Puromycin-sensitive aminopeptidase Proteins 0.000 description 2
- 101001008492 Homo sapiens Putative RNA-binding protein Luc7-like 2 Proteins 0.000 description 2
- 101000665452 Homo sapiens RNA binding protein fox-1 homolog 2 Proteins 0.000 description 2
- 101000580092 Homo sapiens RNA-binding protein 10 Proteins 0.000 description 2
- 101000822233 Homo sapiens RWD domain-containing protein 4 Proteins 0.000 description 2
- 101000889795 Homo sapiens Rabankyrin-5 Proteins 0.000 description 2
- 101000579758 Homo sapiens Raftlin Proteins 0.000 description 2
- 101001081220 Homo sapiens RanBP-type and C3HC4-type zinc finger-containing protein 1 Proteins 0.000 description 2
- 101000926086 Homo sapiens Rap1 GTPase-GDP dissociation stimulator 1 Proteins 0.000 description 2
- 101000712982 Homo sapiens Ras association domain-containing protein 8 Proteins 0.000 description 2
- 101001130305 Homo sapiens Ras-related protein Rab-23 Proteins 0.000 description 2
- 101001060828 Homo sapiens Ras-related protein Rab-2B Proteins 0.000 description 2
- 101001060852 Homo sapiens Ras-related protein Rab-34 Proteins 0.000 description 2
- 101001128094 Homo sapiens Ras-related protein Rab-34, isoform NARR Proteins 0.000 description 2
- 101001130458 Homo sapiens Ras-related protein Ral-B Proteins 0.000 description 2
- 101000668416 Homo sapiens Regulator of chromosome condensation Proteins 0.000 description 2
- 101001132658 Homo sapiens Retinoic acid receptor gamma Proteins 0.000 description 2
- 101001091996 Homo sapiens Rho GTPase-activating protein 22 Proteins 0.000 description 2
- 101001106322 Homo sapiens Rho GTPase-activating protein 7 Proteins 0.000 description 2
- 101000575667 Homo sapiens Rho family-interacting cell polarization regulator 1 Proteins 0.000 description 2
- 101001051707 Homo sapiens Ribosomal protein S6 kinase delta-1 Proteins 0.000 description 2
- 101000683584 Homo sapiens Ribosome-binding protein 1 Proteins 0.000 description 2
- 101001093937 Homo sapiens SEC14-like protein 1 Proteins 0.000 description 2
- 101000716740 Homo sapiens SR-related and CTD-associated factor 4 Proteins 0.000 description 2
- 101000716748 Homo sapiens SR-related and CTD-associated factor 8 Proteins 0.000 description 2
- 101000687720 Homo sapiens SWI/SNF complex subunit SMARCC2 Proteins 0.000 description 2
- 101000898985 Homo sapiens Seipin Proteins 0.000 description 2
- 101000632056 Homo sapiens Septin-9 Proteins 0.000 description 2
- 101000644537 Homo sapiens Sequestosome-1 Proteins 0.000 description 2
- 101000875525 Homo sapiens Serine protease FAM111A Proteins 0.000 description 2
- 101000587434 Homo sapiens Serine/arginine-rich splicing factor 3 Proteins 0.000 description 2
- 101000939549 Homo sapiens Serine/threonine-protein kinase Kist Proteins 0.000 description 2
- 101001047637 Homo sapiens Serine/threonine-protein kinase LATS2 Proteins 0.000 description 2
- 101000987297 Homo sapiens Serine/threonine-protein kinase PAK 4 Proteins 0.000 description 2
- 101000864057 Homo sapiens Serine/threonine-protein kinase SMG1 Proteins 0.000 description 2
- 101000637839 Homo sapiens Serine/threonine-protein kinase tousled-like 1 Proteins 0.000 description 2
- 101001095386 Homo sapiens Serine/threonine-protein phosphatase 6 regulatory subunit 1 Proteins 0.000 description 2
- 101001095381 Homo sapiens Serine/threonine-protein phosphatase 6 regulatory subunit 2 Proteins 0.000 description 2
- 101000688543 Homo sapiens Shugoshin 2 Proteins 0.000 description 2
- 101000688996 Homo sapiens Ski-like protein Proteins 0.000 description 2
- 101000822448 Homo sapiens Sodium channel and clathrin linker 1 Proteins 0.000 description 2
- 101000713288 Homo sapiens Solute carrier family 22 member 5 Proteins 0.000 description 2
- 101000633169 Homo sapiens Sorting nexin-14 Proteins 0.000 description 2
- 101000701575 Homo sapiens Spartin Proteins 0.000 description 2
- 101000642328 Homo sapiens Spermatogenesis-associated protein 20 Proteins 0.000 description 2
- 101000824992 Homo sapiens Spermatogenesis-associated serine-rich protein 2 Proteins 0.000 description 2
- 101000868917 Homo sapiens Spermatogenesis-defective protein 39 homolog Proteins 0.000 description 2
- 101001108753 Homo sapiens Sphingomyelin phosphodiesterase 4 Proteins 0.000 description 2
- 101000908580 Homo sapiens Spliceosome RNA helicase DDX39B Proteins 0.000 description 2
- 101000864761 Homo sapiens Splicing factor 1 Proteins 0.000 description 2
- 101000651299 Homo sapiens Sprouty-related, EVH1 domain-containing protein 2 Proteins 0.000 description 2
- 101001056878 Homo sapiens Squalene monooxygenase Proteins 0.000 description 2
- 101000878981 Homo sapiens Squalene synthase Proteins 0.000 description 2
- 101000873927 Homo sapiens Squamous cell carcinoma antigen recognized by T-cells 3 Proteins 0.000 description 2
- 101000701446 Homo sapiens Stanniocalcin-2 Proteins 0.000 description 2
- 101000631826 Homo sapiens Stearoyl-CoA desaturase Proteins 0.000 description 2
- 101000641015 Homo sapiens Sterile alpha motif domain-containing protein 9 Proteins 0.000 description 2
- 101000822540 Homo sapiens Sterile alpha motif domain-containing protein 9-like Proteins 0.000 description 2
- 101000585255 Homo sapiens Steroidogenic factor 1 Proteins 0.000 description 2
- 101000642613 Homo sapiens Sterol O-acyltransferase 2 Proteins 0.000 description 2
- 101000629597 Homo sapiens Sterol regulatory element-binding protein 1 Proteins 0.000 description 2
- 101000648213 Homo sapiens Striatin-interacting protein 1 Proteins 0.000 description 2
- 101000825933 Homo sapiens Structural maintenance of chromosomes flexible hinge domain-containing protein 1 Proteins 0.000 description 2
- 101000825726 Homo sapiens Structural maintenance of chromosomes protein 4 Proteins 0.000 description 2
- 101000702566 Homo sapiens Structural maintenance of chromosomes protein 6 Proteins 0.000 description 2
- 101000587717 Homo sapiens Sulfide:quinone oxidoreductase, mitochondrial Proteins 0.000 description 2
- 101000626390 Homo sapiens Synaptotagmin-15 Proteins 0.000 description 2
- 101000658110 Homo sapiens Synaptotagmin-like protein 2 Proteins 0.000 description 2
- 101000706184 Homo sapiens Syntaxin-16 Proteins 0.000 description 2
- 101000740523 Homo sapiens Syntenin-1 Proteins 0.000 description 2
- 101000653469 Homo sapiens T-complex protein 1 subunit zeta Proteins 0.000 description 2
- 101000663000 Homo sapiens TNFAIP3-interacting protein 1 Proteins 0.000 description 2
- 101000795313 Homo sapiens TRMT1-like protein Proteins 0.000 description 2
- 101000633629 Homo sapiens Teashirt homolog 1 Proteins 0.000 description 2
- 101000626112 Homo sapiens Telomerase protein component 1 Proteins 0.000 description 2
- 101001095487 Homo sapiens Telomere-associated protein RIF1 Proteins 0.000 description 2
- 101000666340 Homo sapiens Tenascin Proteins 0.000 description 2
- 101000800633 Homo sapiens Teneurin-2 Proteins 0.000 description 2
- 101000626142 Homo sapiens Tensin-1 Proteins 0.000 description 2
- 101000851396 Homo sapiens Tensin-2 Proteins 0.000 description 2
- 101000642191 Homo sapiens Terminal uridylyltransferase 4 Proteins 0.000 description 2
- 101000845180 Homo sapiens Tetratricopeptide repeat protein 7A Proteins 0.000 description 2
- 101000844686 Homo sapiens Thioredoxin reductase 1, cytoplasmic Proteins 0.000 description 2
- 101000796121 Homo sapiens Thioredoxin-like protein 1 Proteins 0.000 description 2
- 101000674009 Homo sapiens Threonine-tRNA ligase 1, cytoplasmic Proteins 0.000 description 2
- 101000712600 Homo sapiens Thyroid hormone receptor beta Proteins 0.000 description 2
- 101000610726 Homo sapiens Trafficking kinesin-binding protein 1 Proteins 0.000 description 2
- 101000662708 Homo sapiens Trafficking protein particle complex subunit 12 Proteins 0.000 description 2
- 101000702545 Homo sapiens Transcription activator BRG1 Proteins 0.000 description 2
- 101000594302 Homo sapiens Transcription termination factor 3, mitochondrial Proteins 0.000 description 2
- 101000775102 Homo sapiens Transcriptional coactivator YAP1 Proteins 0.000 description 2
- 101001125582 Homo sapiens Transcriptional repressor NF-X1 Proteins 0.000 description 2
- 101000800590 Homo sapiens Transducin beta-like protein 2 Proteins 0.000 description 2
- 101000802109 Homo sapiens Transducin-like enhancer protein 3 Proteins 0.000 description 2
- 101000836154 Homo sapiens Transforming acidic coiled-coil-containing protein 1 Proteins 0.000 description 2
- 101000655536 Homo sapiens Transforming growth factor-beta receptor-associated protein 1 Proteins 0.000 description 2
- 101000894525 Homo sapiens Transforming growth factor-beta-induced protein ig-h3 Proteins 0.000 description 2
- 101000655149 Homo sapiens Transmembrane protein 154 Proteins 0.000 description 2
- 101000645439 Homo sapiens Transmembrane protein 250 Proteins 0.000 description 2
- 101000801314 Homo sapiens Transmembrane protein 47 Proteins 0.000 description 2
- 101000648497 Homo sapiens Transportin-3 Proteins 0.000 description 2
- 101000664599 Homo sapiens Tripartite motif-containing protein 2 Proteins 0.000 description 2
- 101000848653 Homo sapiens Tripartite motif-containing protein 26 Proteins 0.000 description 2
- 101000830228 Homo sapiens Tripartite motif-containing protein 65 Proteins 0.000 description 2
- 101000795659 Homo sapiens Tuberin Proteins 0.000 description 2
- 101000713575 Homo sapiens Tubulin beta-3 chain Proteins 0.000 description 2
- 101000713613 Homo sapiens Tubulin beta-4B chain Proteins 0.000 description 2
- 101000648505 Homo sapiens Tumor necrosis factor receptor superfamily member 12A Proteins 0.000 description 2
- 101000679857 Homo sapiens Tumor necrosis factor receptor superfamily member 3 Proteins 0.000 description 2
- 101000836174 Homo sapiens Tumor protein p53-inducible nuclear protein 1 Proteins 0.000 description 2
- 101000823271 Homo sapiens Tyrosine-protein kinase ABL2 Proteins 0.000 description 2
- 101000820294 Homo sapiens Tyrosine-protein kinase Yes Proteins 0.000 description 2
- 101001087426 Homo sapiens Tyrosine-protein phosphatase non-receptor type 14 Proteins 0.000 description 2
- 101000704170 Homo sapiens U2 snRNP-associated SURP motif-containing protein Proteins 0.000 description 2
- 101000768621 Homo sapiens UHRF1-binding protein 1-like Proteins 0.000 description 2
- 101000945528 Homo sapiens UPF0461 protein C5orf24 Proteins 0.000 description 2
- 101000717424 Homo sapiens UV excision repair protein RAD23 homolog B Proteins 0.000 description 2
- 101000607645 Homo sapiens Ubiquilin-4 Proteins 0.000 description 2
- 101000644843 Homo sapiens Ubiquitin carboxyl-terminal hydrolase 19 Proteins 0.000 description 2
- 101000809126 Homo sapiens Ubiquitin carboxyl-terminal hydrolase isozyme L5 Proteins 0.000 description 2
- 101000761646 Homo sapiens Ubiquitin-conjugating enzyme E2 G2 Proteins 0.000 description 2
- 101000808753 Homo sapiens Ubiquitin-conjugating enzyme E2 variant 1 Proteins 0.000 description 2
- 101000638886 Homo sapiens Urokinase-type plasminogen activator Proteins 0.000 description 2
- 101001038317 Homo sapiens VIP36-like protein Proteins 0.000 description 2
- 101000667092 Homo sapiens Vacuolar protein sorting-associated protein 13A Proteins 0.000 description 2
- 101000955962 Homo sapiens Vacuolar protein sorting-associated protein 51 homolog Proteins 0.000 description 2
- 101000787286 Homo sapiens Valine-tRNA ligase Proteins 0.000 description 2
- 101000787276 Homo sapiens Valine-tRNA ligase, mitochondrial Proteins 0.000 description 2
- 101000622427 Homo sapiens Vang-like protein 1 Proteins 0.000 description 2
- 101000760747 Homo sapiens Very long-chain specific acyl-CoA dehydrogenase, mitochondrial Proteins 0.000 description 2
- 101000654430 Homo sapiens Vesicle-trafficking protein SEC22a Proteins 0.000 description 2
- 101000621991 Homo sapiens Vinculin Proteins 0.000 description 2
- 101000965721 Homo sapiens Volume-regulated anion channel subunit LRRC8A Proteins 0.000 description 2
- 101000650141 Homo sapiens WAS/WASL-interacting protein family member 1 Proteins 0.000 description 2
- 101000743114 Homo sapiens WASH complex subunit 4 Proteins 0.000 description 2
- 101000804811 Homo sapiens WD repeat and SOCS box-containing protein 1 Proteins 0.000 description 2
- 101000667300 Homo sapiens WD repeat-containing protein 19 Proteins 0.000 description 2
- 101000814276 Homo sapiens WD repeat-containing protein 48 Proteins 0.000 description 2
- 101000650162 Homo sapiens WW domain-containing transcription regulator protein 1 Proteins 0.000 description 2
- 101000606589 Homo sapiens Xaa-Pro dipeptidase Proteins 0.000 description 2
- 101000744718 Homo sapiens YTH domain-containing family protein 3 Proteins 0.000 description 2
- 101000786383 Homo sapiens Zinc finger CCCH domain-containing protein 14 Proteins 0.000 description 2
- 101000723821 Homo sapiens Zinc finger CCCH domain-containing protein 18 Proteins 0.000 description 2
- 101000785626 Homo sapiens Zinc finger E-box-binding homeobox 1 Proteins 0.000 description 2
- 101000723833 Homo sapiens Zinc finger E-box-binding homeobox 2 Proteins 0.000 description 2
- 101000915477 Homo sapiens Zinc finger MIZ domain-containing protein 1 Proteins 0.000 description 2
- 101000788669 Homo sapiens Zinc finger MYM-type protein 2 Proteins 0.000 description 2
- 101000964419 Homo sapiens Zinc finger and BTB domain-containing protein 10 Proteins 0.000 description 2
- 101000818569 Homo sapiens Zinc finger and BTB domain-containing protein 24 Proteins 0.000 description 2
- 101000759547 Homo sapiens Zinc finger and BTB domain-containing protein 7A Proteins 0.000 description 2
- 101000818737 Homo sapiens Zinc finger protein 12 Proteins 0.000 description 2
- 101000759255 Homo sapiens Zinc finger protein 148 Proteins 0.000 description 2
- 101000782130 Homo sapiens Zinc finger protein 219 Proteins 0.000 description 2
- 101000782143 Homo sapiens Zinc finger protein 227 Proteins 0.000 description 2
- 101000723740 Homo sapiens Zinc finger protein 24 Proteins 0.000 description 2
- 101000785650 Homo sapiens Zinc finger protein 268 Proteins 0.000 description 2
- 101000723761 Homo sapiens Zinc finger protein 28 Proteins 0.000 description 2
- 101000785710 Homo sapiens Zinc finger protein 281 Proteins 0.000 description 2
- 101000760227 Homo sapiens Zinc finger protein 335 Proteins 0.000 description 2
- 101000788735 Homo sapiens Zinc finger protein 37A Proteins 0.000 description 2
- 101000964713 Homo sapiens Zinc finger protein 395 Proteins 0.000 description 2
- 101000760270 Homo sapiens Zinc finger protein 583 Proteins 0.000 description 2
- 101000782278 Homo sapiens Zinc finger protein 621 Proteins 0.000 description 2
- 101000785613 Homo sapiens Zinc finger protein 652 Proteins 0.000 description 2
- 101000785609 Homo sapiens Zinc finger protein 655 Proteins 0.000 description 2
- 101000743803 Homo sapiens Zinc finger protein 674 Proteins 0.000 description 2
- 101000964727 Homo sapiens Zinc finger protein 74 Proteins 0.000 description 2
- 101000802395 Homo sapiens Zinc finger protein 764 Proteins 0.000 description 2
- 101000915597 Homo sapiens Zinc finger protein 778 Proteins 0.000 description 2
- 101000976248 Homo sapiens Zinc finger protein 780A Proteins 0.000 description 2
- 101000782300 Homo sapiens Zinc finger protein 827 Proteins 0.000 description 2
- 101000782317 Homo sapiens Zinc finger protein 839 Proteins 0.000 description 2
- 101000743781 Homo sapiens Zinc finger protein 91 Proteins 0.000 description 2
- 101000772560 Homo sapiens Zinc finger transcription factor Trps1 Proteins 0.000 description 2
- 101000788658 Homo sapiens Zinc fingers and homeoboxes protein 3 Proteins 0.000 description 2
- 101000991029 Homo sapiens [F-actin]-monooxygenase MICAL2 Proteins 0.000 description 2
- 101000944219 Homo sapiens cAMP-dependent protein kinase catalytic subunit beta Proteins 0.000 description 2
- 101001098805 Homo sapiens cAMP-specific 3',5'-cyclic phosphodiesterase 4A Proteins 0.000 description 2
- 101000802734 Homo sapiens eIF5-mimic protein 2 Proteins 0.000 description 2
- 101000667264 Homo sapiens von Willebrand factor A domain-containing protein 8 Proteins 0.000 description 2
- 102100028888 Hydroxymethylglutaryl-CoA synthase, cytoplasmic Human genes 0.000 description 2
- 102100029840 IQ domain-containing protein E Human genes 0.000 description 2
- 102100027004 Inhibin beta A chain Human genes 0.000 description 2
- 102100028799 Inner nuclear membrane protein Man1 Human genes 0.000 description 2
- 102100037739 Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Human genes 0.000 description 2
- 102100037919 Insulin-like growth factor 2 mRNA-binding protein 2 Human genes 0.000 description 2
- 102100033235 Insulin-like peptide INSL6 Human genes 0.000 description 2
- 102100025464 Integral membrane protein 2C Human genes 0.000 description 2
- 102100020700 Integral membrane protein DGCR2/IDD Human genes 0.000 description 2
- 102100022337 Integrin alpha-V Human genes 0.000 description 2
- 102100033010 Integrin beta-5 Human genes 0.000 description 2
- 102100030126 Interferon regulatory factor 4 Human genes 0.000 description 2
- 102100037795 Interleukin-6 receptor subunit beta Human genes 0.000 description 2
- 102100025494 Intersectin-1 Human genes 0.000 description 2
- 102100021504 Iron-sulfur clusters transporter ABCB7, mitochondrial Human genes 0.000 description 2
- 102100039905 Isocitrate dehydrogenase [NADP] cytoplasmic Human genes 0.000 description 2
- 102100036015 Isoleucine-tRNA ligase, cytoplasmic Human genes 0.000 description 2
- 102100027665 Isopentenyl-diphosphate Delta-isomerase 1 Human genes 0.000 description 2
- 102100037489 KAT8 regulatory NSL complex subunit 3 Human genes 0.000 description 2
- 101710025069 KIAA1143 Proteins 0.000 description 2
- 101710060083 KIAA1522 Proteins 0.000 description 2
- 101710029140 KIAA1549 Proteins 0.000 description 2
- 102100027789 Kelch-like protein 7 Human genes 0.000 description 2
- 102100028355 Keratin, type I cuticular Ha4 Human genes 0.000 description 2
- 102100033421 Keratin, type I cytoskeletal 18 Human genes 0.000 description 2
- 102100033420 Keratin, type I cytoskeletal 19 Human genes 0.000 description 2
- 102100033542 Keratin-associated protein 2-3 Human genes 0.000 description 2
- 102100038306 Kinesin light chain 1 Human genes 0.000 description 2
- 102100038320 Kinesin light chain 3 Human genes 0.000 description 2
- 102100027631 Kinesin-like protein KIF14 Human genes 0.000 description 2
- 102100023426 Kinesin-like protein KIF2A Human genes 0.000 description 2
- 102100020679 Krueppel-like factor 6 Human genes 0.000 description 2
- 101710159002 L-lactate oxidase Proteins 0.000 description 2
- 102100033515 LIM domain only protein 7 Human genes 0.000 description 2
- 102100026447 LIM domain-containing protein ajuba Human genes 0.000 description 2
- 102100020861 La-related protein 4 Human genes 0.000 description 2
- 102100039648 Lactadherin Human genes 0.000 description 2
- 102100022745 Laminin subunit alpha-2 Human genes 0.000 description 2
- 102100027448 Laminin subunit beta-1 Human genes 0.000 description 2
- 102100021695 Lanosterol 14-alpha demethylase Human genes 0.000 description 2
- 102100032011 Lanosterol synthase Human genes 0.000 description 2
- 102100038235 Large neutral amino acids transporter small subunit 2 Human genes 0.000 description 2
- 101710142669 Leucine zipper putative tumor suppressor 1 Proteins 0.000 description 2
- 102100040276 Leucine zipper putative tumor suppressor 2 Human genes 0.000 description 2
- 102100032680 Leucine-rich repeat and calponin homology domain-containing protein 4 Human genes 0.000 description 2
- 102100022170 Leucine-rich repeats and immunoglobulin-like domains protein 1 Human genes 0.000 description 2
- 102100031955 Lon protease homolog, mitochondrial Human genes 0.000 description 2
- 102100024640 Low-density lipoprotein receptor Human genes 0.000 description 2
- 102100040705 Low-density lipoprotein receptor-related protein 8 Human genes 0.000 description 2
- 102100040598 Lysine-specific demethylase 2A Human genes 0.000 description 2
- 102100040986 Lysophospholipid acyltransferase 7 Human genes 0.000 description 2
- 102100023325 M-phase inducer phosphatase 2 Human genes 0.000 description 2
- 102100033610 MAP kinase-interacting serine/threonine-protein kinase 2 Human genes 0.000 description 2
- 108010018650 MEF2 Transcription Factors Proteins 0.000 description 2
- 102100026371 MHC class II transactivator Human genes 0.000 description 2
- 108700002010 MHC class II transactivator Proteins 0.000 description 2
- 101150088406 MLST8 gene Proteins 0.000 description 2
- 229910015837 MSH2 Inorganic materials 0.000 description 2
- 101150082088 MSRB3 gene Proteins 0.000 description 2
- 102100028112 Magnesium transporter NIPA1 Human genes 0.000 description 2
- 102100032515 Male-specific lethal 3 homolog Human genes 0.000 description 2
- 102100021767 Mannosyl-oligosaccharide 1,2-alpha-mannosidase IB Human genes 0.000 description 2
- 102100039373 Membrane cofactor protein Human genes 0.000 description 2
- 102100030353 Membrane-associated phosphatidylinositol transfer protein 1 Human genes 0.000 description 2
- 102100037106 Merlin Human genes 0.000 description 2
- 102100021274 Metallophosphoesterase 1 Human genes 0.000 description 2
- 102100026262 Metalloproteinase inhibitor 2 Human genes 0.000 description 2
- 102100026711 Metalloreductase STEAP2 Human genes 0.000 description 2
- 102100024614 Methionine synthase reductase Human genes 0.000 description 2
- 102100028720 Methionine-R-sulfoxide reductase B3 Human genes 0.000 description 2
- 102100021290 Methyl-CpG-binding domain protein 4 Human genes 0.000 description 2
- 102100030812 Methylcytosine dioxygenase TET3 Human genes 0.000 description 2
- 102100021091 Methylsterol monooxygenase 1 Human genes 0.000 description 2
- 102100022259 Mevalonate kinase Human genes 0.000 description 2
- 108700040132 Mevalonate kinases Proteins 0.000 description 2
- 102100026905 Mitochondrial import receptor subunit TOM40 homolog Human genes 0.000 description 2
- 102100026902 Mitochondrial import receptor subunit TOM5 homolog Human genes 0.000 description 2
- 102100033116 Mitogen-activated protein kinase kinase kinase 20 Human genes 0.000 description 2
- 102100028194 Mitogen-activated protein kinase kinase kinase kinase 4 Human genes 0.000 description 2
- 102100025394 Monofunctional C1-tetrahydrofolate synthase, mitochondrial Human genes 0.000 description 2
- 102100026284 Multiple inositol polyphosphate phosphatase 1 Human genes 0.000 description 2
- 102100038169 Musculin Human genes 0.000 description 2
- 102100026301 Muskelin Human genes 0.000 description 2
- 102100023254 Myb/SANT-like DNA-binding domain-containing protein 3 Human genes 0.000 description 2
- 102100021270 Myelin protein zero-like protein 1 Human genes 0.000 description 2
- 102100035050 Myeloid-associated differentiation marker Human genes 0.000 description 2
- 102100034099 Myocardin-related transcription factor A Human genes 0.000 description 2
- 102100039212 Myocyte-specific enhancer factor 2D Human genes 0.000 description 2
- 102100024941 Myotubularin-related protein 9 Human genes 0.000 description 2
- 102100035854 N(G),N(G)-dimethylarginine dimethylaminohydrolase 1 Human genes 0.000 description 2
- 102100036658 N(G),N(G)-dimethylarginine dimethylaminohydrolase 2 Human genes 0.000 description 2
- 102100031869 N-alpha-acetyltransferase 35, NatC auxiliary subunit Human genes 0.000 description 2
- 102100023515 NAD kinase Human genes 0.000 description 2
- 108010071380 NF-E2-Related Factor 1 Proteins 0.000 description 2
- 102000002587 NFX1 Human genes 0.000 description 2
- 102100021850 Nardilysin Human genes 0.000 description 2
- 102100023062 Negative elongation factor A Human genes 0.000 description 2
- 102100023306 Nesprin-1 Human genes 0.000 description 2
- 102100023305 Nesprin-2 Human genes 0.000 description 2
- 102100023307 Nesprin-3 Human genes 0.000 description 2
- 102100040289 Netrin receptor UNC5B Human genes 0.000 description 2
- 102100038699 Netrin-G2 Human genes 0.000 description 2
- 108090000556 Neuregulin-1 Proteins 0.000 description 2
- 102000048238 Neuregulin-1 Human genes 0.000 description 2
- 102100025247 Neurogenic locus notch homolog protein 3 Human genes 0.000 description 2
- 102100030465 Neuron navigator 2 Human genes 0.000 description 2
- 102100028056 Nicastrin Human genes 0.000 description 2
- 102100037371 Nidogen-2 Human genes 0.000 description 2
- 102100027966 Nodal modulator 3 Human genes 0.000 description 2
- 102100027814 Non-lysosomal glucosylceramidase Human genes 0.000 description 2
- 102100023904 Nuclear autoantigenic sperm protein Human genes 0.000 description 2
- 101710149564 Nuclear autoantigenic sperm protein Proteins 0.000 description 2
- 102100021706 Nuclear pore complex protein Nup153 Human genes 0.000 description 2
- 102100025447 Nuclear pore complex protein Nup50 Human genes 0.000 description 2
- 102100037223 Nuclear receptor coactivator 1 Human genes 0.000 description 2
- 102100022883 Nuclear receptor coactivator 3 Human genes 0.000 description 2
- 102100022927 Nuclear receptor coactivator 4 Human genes 0.000 description 2
- 102100030991 Nucleolar and spindle-associated protein 1 Human genes 0.000 description 2
- 102100020682 Nucleoporin NUP35 Human genes 0.000 description 2
- 102100025794 Nucleoporin p58/p45 Human genes 0.000 description 2
- 102100026069 Outer dense fiber protein 2 Human genes 0.000 description 2
- 102100033337 PDZ and LIM domain protein 7 Human genes 0.000 description 2
- 102100031567 PHD and RING finger domain-containing protein 1 Human genes 0.000 description 2
- 102100036870 PHD finger protein 19 Human genes 0.000 description 2
- 102100035593 POU domain, class 2, transcription factor 1 Human genes 0.000 description 2
- 102100021498 Palmitoyl-protein thioesterase ABHD10, mitochondrial Human genes 0.000 description 2
- 102100033496 Partitioning defective 3 homolog Human genes 0.000 description 2
- 102100033318 Pecanex-like protein 2 Human genes 0.000 description 2
- 102100021698 Peregrin Human genes 0.000 description 2
- 102100033422 Pericentriolar material 1 protein Human genes 0.000 description 2
- 102100037765 Periostin Human genes 0.000 description 2
- 102100028525 Periphilin-1 Human genes 0.000 description 2
- 102100034601 Peroxidasin homolog Human genes 0.000 description 2
- 102100036598 Peroxisomal targeting signal 1 receptor Human genes 0.000 description 2
- 102100038831 Peroxisome proliferator-activated receptor alpha Human genes 0.000 description 2
- 102100040041 Peroxynitrite isomerase THAP4 Human genes 0.000 description 2
- 102100032543 Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN Human genes 0.000 description 2
- 102100026876 Phosphatidylinositol 4-kinase type 2-alpha Human genes 0.000 description 2
- 102100025059 Phosphatidylinositol 4-phosphate 3-kinase C2 domain-containing subunit beta Human genes 0.000 description 2
- 102100038725 Phosphatidylinositol glycan anchor biosynthesis class U protein Human genes 0.000 description 2
- 102100036062 Phosphatidylinositol transfer protein alpha isoform Human genes 0.000 description 2
- 102100034179 Phospholipase DDHD2 Human genes 0.000 description 2
- 102100030451 Phospholipid phosphatase 4 Human genes 0.000 description 2
- 102100024496 Phospholipid scramblase 3 Human genes 0.000 description 2
- 102100033616 Phospholipid-transporting ATPase ABCA1 Human genes 0.000 description 2
- 102100031693 Piezo-type mechanosensitive ion channel component 1 Human genes 0.000 description 2
- 102100039902 Plasma membrane ascorbate-dependent reductase CYBRD1 Human genes 0.000 description 2
- 102100030463 Pleckstrin homology domain-containing family B member 2 Human genes 0.000 description 2
- 102100030477 Plectin Human genes 0.000 description 2
- 102100034383 Plexin-B2 Human genes 0.000 description 2
- 102100035381 Plexin-C1 Human genes 0.000 description 2
- 102100029740 Poliovirus receptor Human genes 0.000 description 2
- 108010012887 Poly(A)-Binding Protein I Proteins 0.000 description 2
- 102100023715 Poly(A)-specific ribonuclease PARN Human genes 0.000 description 2
- 102100033008 Poly(U)-binding-splicing factor PUF60 Human genes 0.000 description 2
- 102100034961 Poly(rC)-binding protein 2 Human genes 0.000 description 2
- 102100034956 Poly(rC)-binding protein 4 Human genes 0.000 description 2
- 102100026090 Polyadenylate-binding protein 1 Human genes 0.000 description 2
- 102100040920 Polycomb group RING finger protein 3 Human genes 0.000 description 2
- 102100020947 Polypeptide N-acetylgalactosaminyltransferase 1 Human genes 0.000 description 2
- 102100028730 Pre-mRNA-processing factor 17 Human genes 0.000 description 2
- 102100025214 Probable methyltransferase TARBP1 Human genes 0.000 description 2
- 102100023886 Probable ribonuclease ZC3H12C Human genes 0.000 description 2
- 102100040477 Prolyl 4-hydroxylase subunit alpha-1 Human genes 0.000 description 2
- 102100038955 Proprotein convertase subtilisin/kexin type 9 Human genes 0.000 description 2
- 102100029119 Protein FAM219A Human genes 0.000 description 2
- 102100029122 Protein FAM219B Human genes 0.000 description 2
- 102100040823 Protein FAM3C Human genes 0.000 description 2
- 102100020847 Protein FosB Human genes 0.000 description 2
- 102100034735 Protein HEG homolog 1 Human genes 0.000 description 2
- 102100030551 Protein MEMO1 Human genes 0.000 description 2
- 102100023475 Protein MMS22-like Human genes 0.000 description 2
- 102100031492 Protein OS-9 Human genes 0.000 description 2
- 102100031570 Protein PHTF2 Human genes 0.000 description 2
- 102100030232 Protein SON Human genes 0.000 description 2
- 102100034784 Protein TANC2 Human genes 0.000 description 2
- 102100035331 Protein Wnt-5b Human genes 0.000 description 2
- 102100022985 Protein arginine N-methyltransferase 1 Human genes 0.000 description 2
- 102100027584 Protein c-Fos Human genes 0.000 description 2
- 102100036490 Protein diaphanous homolog 1 Human genes 0.000 description 2
- 102100036352 Protein disulfide-isomerase Human genes 0.000 description 2
- 102100040848 Protein mono-ADP-ribosyltransferase PARP14 Human genes 0.000 description 2
- 102100034931 Protein mono-ADP-ribosyltransferase PARP4 Human genes 0.000 description 2
- 102100036547 Protein phosphatase 1 regulatory subunit 12A Human genes 0.000 description 2
- 102100038669 Protein quaking Human genes 0.000 description 2
- 102100023146 Protein transport protein Sec24B Human genes 0.000 description 2
- 102100034271 Protein transport protein Sec61 subunit alpha isoform 1 Human genes 0.000 description 2
- 102100025821 Protein yippee-like 5 Human genes 0.000 description 2
- 102100033430 Protein-L-isoaspartate O-methyltransferase domain-containing protein 2 Human genes 0.000 description 2
- 102100026858 Protein-lysine 6-oxidase Human genes 0.000 description 2
- 102100037787 Protein-tyrosine kinase 2-beta Human genes 0.000 description 2
- 102100037605 Protocadherin gamma-B3 Human genes 0.000 description 2
- 102100032494 Pseudouridylate synthase 7 homolog Human genes 0.000 description 2
- 102100033192 Puromycin-sensitive aminopeptidase Human genes 0.000 description 2
- 102100027435 Putative RNA-binding protein Luc7-like 2 Human genes 0.000 description 2
- 102100038187 RNA binding protein fox-1 homolog 2 Human genes 0.000 description 2
- 102100027514 RNA-binding protein 10 Human genes 0.000 description 2
- 102000001152 RNF14 Human genes 0.000 description 2
- 108091007326 RNF19A Proteins 0.000 description 2
- 102100021508 RWD domain-containing protein 4 Human genes 0.000 description 2
- 102100040160 Rabankyrin-5 Human genes 0.000 description 2
- 102100028208 Raftlin Human genes 0.000 description 2
- 102100027716 RanBP-type and C3HC4-type zinc finger-containing protein 1 Human genes 0.000 description 2
- 102100034329 Rap1 GTPase-GDP dissociation stimulator 1 Human genes 0.000 description 2
- 102100033218 Ras association domain-containing protein 8 Human genes 0.000 description 2
- 102100031522 Ras-related protein Rab-23 Human genes 0.000 description 2
- 102100027917 Ras-related protein Rab-2B Human genes 0.000 description 2
- 102100027916 Ras-related protein Rab-34 Human genes 0.000 description 2
- 102100031425 Ras-related protein Ral-B Human genes 0.000 description 2
- 101000832669 Rattus norvegicus Probable alcohol sulfotransferase Proteins 0.000 description 2
- 102100035773 Regulator of G-protein signaling 10 Human genes 0.000 description 2
- 101710148338 Regulator of G-protein signaling 10 Proteins 0.000 description 2
- 102100037415 Regulator of G-protein signaling 3 Human genes 0.000 description 2
- 101710140411 Regulator of G-protein signaling 3 Proteins 0.000 description 2
- 102100039977 Regulator of chromosome condensation Human genes 0.000 description 2
- 102100033912 Retinoic acid receptor gamma Human genes 0.000 description 2
- 102100035757 Rho GTPase-activating protein 22 Human genes 0.000 description 2
- 102100021446 Rho GTPase-activating protein 7 Human genes 0.000 description 2
- 102100025999 Rho family-interacting cell polarization regulator 1 Human genes 0.000 description 2
- 102100024913 Ribosomal protein S6 kinase delta-1 Human genes 0.000 description 2
- 102100023542 Ribosome-binding protein 1 Human genes 0.000 description 2
- 102100034187 S-methyl-5'-thioadenosine phosphorylase Human genes 0.000 description 2
- 101710136206 S-methyl-5'-thioadenosine phosphorylase Proteins 0.000 description 2
- 102100035214 SEC14-like protein 1 Human genes 0.000 description 2
- 108091006932 SLC39A3 Proteins 0.000 description 2
- 108091006983 SLC41A1 Proteins 0.000 description 2
- 102000016681 SLC4A Proteins Human genes 0.000 description 2
- 108091006262 SLC4A4 Proteins 0.000 description 2
- 108091006237 SLC7A6 Proteins 0.000 description 2
- 108091006238 SLC7A8 Proteins 0.000 description 2
- 102100020878 SR-related and CTD-associated factor 4 Human genes 0.000 description 2
- 102100020875 SR-related and CTD-associated factor 8 Human genes 0.000 description 2
- 108010017324 STAT3 Transcription Factor Proteins 0.000 description 2
- 102100024790 SWI/SNF complex subunit SMARCC2 Human genes 0.000 description 2
- 102100021463 Seipin Human genes 0.000 description 2
- 102100028024 Septin-9 Human genes 0.000 description 2
- 102100020814 Sequestosome-1 Human genes 0.000 description 2
- 102100035980 Serine protease FAM111A Human genes 0.000 description 2
- 102100029665 Serine/arginine-rich splicing factor 3 Human genes 0.000 description 2
- 102100029680 Serine/threonine-protein kinase Kist Human genes 0.000 description 2
- 102100024043 Serine/threonine-protein kinase LATS2 Human genes 0.000 description 2
- 102100027940 Serine/threonine-protein kinase PAK 4 Human genes 0.000 description 2
- 102100029938 Serine/threonine-protein kinase SMG1 Human genes 0.000 description 2
- 102100032015 Serine/threonine-protein kinase tousled-like 1 Human genes 0.000 description 2
- 102100037762 Serine/threonine-protein phosphatase 6 regulatory subunit 1 Human genes 0.000 description 2
- 102100037763 Serine/threonine-protein phosphatase 6 regulatory subunit 2 Human genes 0.000 description 2
- 102100024238 Shugoshin 2 Human genes 0.000 description 2
- 102100024040 Signal transducer and activator of transcription 3 Human genes 0.000 description 2
- 102100024451 Ski-like protein Human genes 0.000 description 2
- 102100022483 Sodium channel and clathrin linker 1 Human genes 0.000 description 2
- 102000006633 Sodium-Bicarbonate Symporters Human genes 0.000 description 2
- 102100034243 Solute carrier family 12 member 2 Human genes 0.000 description 2
- 102100036924 Solute carrier family 22 member 5 Human genes 0.000 description 2
- 102100032013 Solute carrier family 41 member 1 Human genes 0.000 description 2
- 102100029598 Sorting nexin-14 Human genes 0.000 description 2
- 102100030537 Spartin Human genes 0.000 description 2
- 102100036414 Spermatogenesis-associated protein 20 Human genes 0.000 description 2
- 102100022445 Spermatogenesis-associated serine-rich protein 2 Human genes 0.000 description 2
- 102100032313 Spermatogenesis-defective protein 39 homolog Human genes 0.000 description 2
- 102100021460 Sphingomyelin phosphodiesterase 4 Human genes 0.000 description 2
- 102100024690 Spliceosome RNA helicase DDX39B Human genes 0.000 description 2
- 102100027650 Sprouty-related, EVH1 domain-containing protein 2 Human genes 0.000 description 2
- 102100025560 Squalene monooxygenase Human genes 0.000 description 2
- 102100037997 Squalene synthase Human genes 0.000 description 2
- 102100035748 Squamous cell carcinoma antigen recognized by T-cells 3 Human genes 0.000 description 2
- 102100026718 StAR-related lipid transfer protein 4 Human genes 0.000 description 2
- 102100030510 Stanniocalcin-2 Human genes 0.000 description 2
- 101150082484 Stard4 gene Proteins 0.000 description 2
- 102100034291 Sterile alpha motif domain-containing protein 9 Human genes 0.000 description 2
- 102100022459 Sterile alpha motif domain-containing protein 9-like Human genes 0.000 description 2
- 102100029856 Steroidogenic factor 1 Human genes 0.000 description 2
- 102100026839 Sterol regulatory element-binding protein 1 Human genes 0.000 description 2
- 102100028804 Striatin-interacting protein 1 Human genes 0.000 description 2
- 102100022770 Structural maintenance of chromosomes flexible hinge domain-containing protein 1 Human genes 0.000 description 2
- 102100022842 Structural maintenance of chromosomes protein 4 Human genes 0.000 description 2
- 102100031030 Structural maintenance of chromosomes protein 6 Human genes 0.000 description 2
- 102100031138 Sulfide:quinone oxidoreductase, mitochondrial Human genes 0.000 description 2
- 102100024613 Synaptotagmin-15 Human genes 0.000 description 2
- 102100035007 Synaptotagmin-like protein 2 Human genes 0.000 description 2
- 102100031100 Syntaxin-16 Human genes 0.000 description 2
- 102100037219 Syntenin-1 Human genes 0.000 description 2
- 102100030664 T-complex protein 1 subunit zeta Human genes 0.000 description 2
- 102100033456 TGF-beta receptor type-1 Human genes 0.000 description 2
- 102100037667 TNFAIP3-interacting protein 1 Human genes 0.000 description 2
- 102100029664 TRMT1-like protein Human genes 0.000 description 2
- 102100027802 Target of rapamycin complex subunit LST8 Human genes 0.000 description 2
- 102100029223 Teashirt homolog 1 Human genes 0.000 description 2
- 102100038126 Tenascin Human genes 0.000 description 2
- 102100033227 Teneurin-2 Human genes 0.000 description 2
- 102100024547 Tensin-1 Human genes 0.000 description 2
- 102100036852 Tensin-2 Human genes 0.000 description 2
- 102100033225 Terminal uridylyltransferase 4 Human genes 0.000 description 2
- 102100031282 Tetratricopeptide repeat protein 7A Human genes 0.000 description 2
- 102100031208 Thioredoxin reductase 1, cytoplasmic Human genes 0.000 description 2
- 102100031373 Thioredoxin-like protein 1 Human genes 0.000 description 2
- 102100040537 Threonine-tRNA ligase 1, cytoplasmic Human genes 0.000 description 2
- 102100033451 Thyroid hormone receptor beta Human genes 0.000 description 2
- 102100040379 Trafficking kinesin-binding protein 1 Human genes 0.000 description 2
- 102100037451 Trafficking protein particle complex subunit 12 Human genes 0.000 description 2
- 102100031027 Transcription activator BRG1 Human genes 0.000 description 2
- 102100023489 Transcription factor 4 Human genes 0.000 description 2
- 102100022012 Transcription intermediary factor 1-beta Human genes 0.000 description 2
- 101710177718 Transcription intermediary factor 1-beta Proteins 0.000 description 2
- 102100031873 Transcriptional coactivator YAP1 Human genes 0.000 description 2
- 102100033248 Transducin beta-like protein 2 Human genes 0.000 description 2
- 102100034698 Transducin-like enhancer protein 3 Human genes 0.000 description 2
- 108010011702 Transforming Growth Factor-beta Type I Receptor Proteins 0.000 description 2
- 102100027049 Transforming acidic coiled-coil-containing protein 1 Human genes 0.000 description 2
- 102100032349 Transforming growth factor-beta receptor-associated protein 1 Human genes 0.000 description 2
- 102100021398 Transforming growth factor-beta-induced protein ig-h3 Human genes 0.000 description 2
- 102100033042 Transmembrane protein 154 Human genes 0.000 description 2
- 102100025715 Transmembrane protein 250 Human genes 0.000 description 2
- 102100033526 Transmembrane protein 47 Human genes 0.000 description 2
- 102100028746 Transportin-3 Human genes 0.000 description 2
- 102100038799 Tripartite motif-containing protein 2 Human genes 0.000 description 2
- 102100034593 Tripartite motif-containing protein 26 Human genes 0.000 description 2
- 102100025016 Tripartite motif-containing protein 65 Human genes 0.000 description 2
- 102100031638 Tuberin Human genes 0.000 description 2
- 102100036790 Tubulin beta-3 chain Human genes 0.000 description 2
- 102100036821 Tubulin beta-4B chain Human genes 0.000 description 2
- 108010047933 Tumor Necrosis Factor alpha-Induced Protein 3 Proteins 0.000 description 2
- 102100024596 Tumor necrosis factor alpha-induced protein 3 Human genes 0.000 description 2
- 102100028786 Tumor necrosis factor receptor superfamily member 12A Human genes 0.000 description 2
- 102100022156 Tumor necrosis factor receptor superfamily member 3 Human genes 0.000 description 2
- 102100027224 Tumor protein p53-inducible nuclear protein 1 Human genes 0.000 description 2
- 102100022651 Tyrosine-protein kinase ABL2 Human genes 0.000 description 2
- 102100021788 Tyrosine-protein kinase Yes Human genes 0.000 description 2
- 102100033015 Tyrosine-protein phosphatase non-receptor type 14 Human genes 0.000 description 2
- 102100031884 U2 snRNP-associated SURP motif-containing protein Human genes 0.000 description 2
- 102100027977 UHRF1-binding protein 1-like Human genes 0.000 description 2
- 102100034828 UPF0461 protein C5orf24 Human genes 0.000 description 2
- 102100022865 UPF0606 protein KIAA1549 Human genes 0.000 description 2
- 101150020913 USP7 gene Proteins 0.000 description 2
- 102100020779 UV excision repair protein RAD23 homolog B Human genes 0.000 description 2
- 102100039932 Ubiquilin-4 Human genes 0.000 description 2
- 102100020728 Ubiquitin carboxyl-terminal hydrolase 19 Human genes 0.000 description 2
- 102100021013 Ubiquitin carboxyl-terminal hydrolase 7 Human genes 0.000 description 2
- 102100038443 Ubiquitin carboxyl-terminal hydrolase isozyme L5 Human genes 0.000 description 2
- 108700011958 Ubiquitin-Specific Peptidase 7 Proteins 0.000 description 2
- 102100024870 Ubiquitin-conjugating enzyme E2 G2 Human genes 0.000 description 2
- 102100038467 Ubiquitin-conjugating enzyme E2 variant 1 Human genes 0.000 description 2
- 229940126752 Ubiquitin-specific protease 7 inhibitor Drugs 0.000 description 2
- 102100025379 Uncharacterized protein KIAA1143 Human genes 0.000 description 2
- 102100025382 Uncharacterized protein KIAA1522 Human genes 0.000 description 2
- 102100031358 Urokinase-type plasminogen activator Human genes 0.000 description 2
- 102100040248 VIP36-like protein Human genes 0.000 description 2
- 102100039114 Vacuolar protein sorting-associated protein 13A Human genes 0.000 description 2
- 102100038936 Vacuolar protein sorting-associated protein 51 homolog Human genes 0.000 description 2
- 102100025607 Valine-tRNA ligase Human genes 0.000 description 2
- 102100023517 Vang-like protein 1 Human genes 0.000 description 2
- 102100024591 Very long-chain specific acyl-CoA dehydrogenase, mitochondrial Human genes 0.000 description 2
- 102100031495 Vesicle-trafficking protein SEC22a Human genes 0.000 description 2
- 102100023486 Vinculin Human genes 0.000 description 2
- 102100034074 Voltage-gated potassium channel subunit beta-2 Human genes 0.000 description 2
- 102100040985 Volume-regulated anion channel subunit LRRC8A Human genes 0.000 description 2
- 102100027538 WAS/WASL-interacting protein family member 1 Human genes 0.000 description 2
- 102100038143 WASH complex subunit 4 Human genes 0.000 description 2
- 102100035334 WD repeat and SOCS box-containing protein 1 Human genes 0.000 description 2
- 102100039744 WD repeat-containing protein 19 Human genes 0.000 description 2
- 102100039414 WD repeat-containing protein 48 Human genes 0.000 description 2
- 102100027548 WW domain-containing transcription regulator protein 1 Human genes 0.000 description 2
- 108700031544 X-Linked Inhibitor of Apoptosis Proteins 0.000 description 2
- 102100039662 Xaa-Pro dipeptidase Human genes 0.000 description 2
- 102100032803 Y+L amino acid transporter 2 Human genes 0.000 description 2
- 102100039674 YTH domain-containing family protein 3 Human genes 0.000 description 2
- 102100025685 Zinc finger CCCH domain-containing protein 14 Human genes 0.000 description 2
- 102100028476 Zinc finger CCCH domain-containing protein 18 Human genes 0.000 description 2
- 102100026457 Zinc finger E-box-binding homeobox 1 Human genes 0.000 description 2
- 102100028458 Zinc finger E-box-binding homeobox 2 Human genes 0.000 description 2
- 102100028535 Zinc finger MIZ domain-containing protein 1 Human genes 0.000 description 2
- 102100025085 Zinc finger MYM-type protein 2 Human genes 0.000 description 2
- 102100040327 Zinc finger and BTB domain-containing protein 10 Human genes 0.000 description 2
- 102100021129 Zinc finger and BTB domain-containing protein 24 Human genes 0.000 description 2
- 102100023264 Zinc finger and BTB domain-containing protein 7A Human genes 0.000 description 2
- 102100021058 Zinc finger protein 12 Human genes 0.000 description 2
- 102100023442 Zinc finger protein 148 Human genes 0.000 description 2
- 102100036594 Zinc finger protein 219 Human genes 0.000 description 2
- 102100036566 Zinc finger protein 227 Human genes 0.000 description 2
- 102100028365 Zinc finger protein 24 Human genes 0.000 description 2
- 102100026516 Zinc finger protein 268 Human genes 0.000 description 2
- 102100028399 Zinc finger protein 28 Human genes 0.000 description 2
- 102100026316 Zinc finger protein 281 Human genes 0.000 description 2
- 102100024773 Zinc finger protein 335 Human genes 0.000 description 2
- 102100025435 Zinc finger protein 37A Human genes 0.000 description 2
- 102100040733 Zinc finger protein 395 Human genes 0.000 description 2
- 102100024713 Zinc finger protein 583 Human genes 0.000 description 2
- 102100035818 Zinc finger protein 621 Human genes 0.000 description 2
- 102100026453 Zinc finger protein 652 Human genes 0.000 description 2
- 102100026494 Zinc finger protein 655 Human genes 0.000 description 2
- 102100039040 Zinc finger protein 674 Human genes 0.000 description 2
- 102100040711 Zinc finger protein 74 Human genes 0.000 description 2
- 102100034973 Zinc finger protein 764 Human genes 0.000 description 2
- 102100028586 Zinc finger protein 778 Human genes 0.000 description 2
- 102100023873 Zinc finger protein 780A Human genes 0.000 description 2
- 102100035802 Zinc finger protein 827 Human genes 0.000 description 2
- 102100035783 Zinc finger protein 839 Human genes 0.000 description 2
- 102100039070 Zinc finger protein 91 Human genes 0.000 description 2
- 102100027904 Zinc finger protein basonuclin-1 Human genes 0.000 description 2
- 102100030619 Zinc finger transcription factor Trps1 Human genes 0.000 description 2
- 102100025095 Zinc fingers and homeoboxes protein 3 Human genes 0.000 description 2
- 102100025446 Zinc transporter ZIP3 Human genes 0.000 description 2
- 102100030295 [F-actin]-monooxygenase MICAL2 Human genes 0.000 description 2
- 108010029483 alpha 1 Chain Collagen Type I Proteins 0.000 description 2
- 102100033065 cAMP-dependent protein kinase catalytic subunit beta Human genes 0.000 description 2
- 102100037092 cAMP-specific 3',5'-cyclic phosphodiesterase 4A Human genes 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- 102100035859 eIF5-mimic protein 2 Human genes 0.000 description 2
- 108010022790 formyl-methenyl-methylenetetrahydrofolate synthetase Proteins 0.000 description 2
- 230000001939 inductive effect Effects 0.000 description 2
- 206010022000 influenza Diseases 0.000 description 2
- 108010019691 inhibin beta A subunit Proteins 0.000 description 2
- 238000003780 insertion Methods 0.000 description 2
- 230000037431 insertion Effects 0.000 description 2
- 230000010189 intracellular transport Effects 0.000 description 2
- TWBYWOBDOCUKOW-UHFFFAOYSA-N isonicotinic acid Chemical compound OC(=O)C1=CC=NC=C1 TWBYWOBDOCUKOW-UHFFFAOYSA-N 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 101150091791 mvk gene Proteins 0.000 description 2
- 229920002791 poly-4-hydroxybutyrate Polymers 0.000 description 2
- 108010083945 potassium channel protein TREK-1 Proteins 0.000 description 2
- 239000002213 purine nucleotide Substances 0.000 description 2
- 150000003212 purines Chemical class 0.000 description 2
- 210000001324 spliceosome Anatomy 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 239000011269 tar Substances 0.000 description 2
- 208000011317 telomere syndrome Diseases 0.000 description 2
- 238000013519 translation Methods 0.000 description 2
- 102100039135 von Willebrand factor A domain-containing protein 8 Human genes 0.000 description 2
- NQBHBXSQWRBTIE-VKHMYHEASA-N (2s)-2-(carbamoylamino)pentanediamide Chemical compound NC(=O)CC[C@@H](C(N)=O)NC(N)=O NQBHBXSQWRBTIE-VKHMYHEASA-N 0.000 description 1
- 108010052418 (N-(2-((4-((2-((4-(9-acridinylamino)phenyl)amino)-2-oxoethyl)amino)-4-oxobutyl)amino)-1-(1H-imidazol-4-ylmethyl)-1-oxoethyl)-6-(((-2-aminoethyl)amino)methyl)-2-pyridinecarboxamidato) iron(1+) Proteins 0.000 description 1
- 102000051389 ADAMTS5 Human genes 0.000 description 1
- 108091005663 ADAMTS5 Proteins 0.000 description 1
- 102100032091 ALK and LTK ligand 2 Human genes 0.000 description 1
- 102100034580 AT-rich interactive domain-containing protein 1A Human genes 0.000 description 1
- 101100152876 Arabidopsis thaliana CYP705A5 gene Proteins 0.000 description 1
- 101100002344 Caenorhabditis elegans arid-1 gene Proteins 0.000 description 1
- 102100038581 F-box only protein 10 Human genes 0.000 description 1
- 241001123946 Gaga Species 0.000 description 1
- 101000776351 Homo sapiens ALK and LTK ligand 2 Proteins 0.000 description 1
- 101000924266 Homo sapiens AT-rich interactive domain-containing protein 1A Proteins 0.000 description 1
- 101001030684 Homo sapiens F-box only protein 10 Proteins 0.000 description 1
- 101000992392 Homo sapiens Oxysterol-binding protein-related protein 6 Proteins 0.000 description 1
- 101000869690 Homo sapiens Protein S100-A8 Proteins 0.000 description 1
- 101000707546 Homo sapiens Splicing factor 3A subunit 1 Proteins 0.000 description 1
- 101000707561 Homo sapiens Splicing factor 3A subunit 2 Proteins 0.000 description 1
- 101000707569 Homo sapiens Splicing factor 3A subunit 3 Proteins 0.000 description 1
- 101000808799 Homo sapiens Splicing factor U2AF 35 kDa subunit Proteins 0.000 description 1
- 101000666234 Homo sapiens Thyroid adenoma-associated protein Proteins 0.000 description 1
- 101001022129 Homo sapiens Tyrosine-protein kinase Fyn Proteins 0.000 description 1
- 101000782309 Homo sapiens Zinc finger protein 837 Proteins 0.000 description 1
- 102100032149 Oxysterol-binding protein-related protein 6 Human genes 0.000 description 1
- 102100032442 Protein S100-A8 Human genes 0.000 description 1
- 102000015097 RNA Splicing Factors Human genes 0.000 description 1
- 108010039259 RNA Splicing Factors Proteins 0.000 description 1
- 102000003890 RNA-binding protein FUS Human genes 0.000 description 1
- 108090000292 RNA-binding protein FUS Proteins 0.000 description 1
- 102100031713 Splicing factor 3A subunit 1 Human genes 0.000 description 1
- 102100031712 Splicing factor 3A subunit 2 Human genes 0.000 description 1
- 102100031710 Splicing factor 3A subunit 3 Human genes 0.000 description 1
- 102100038501 Splicing factor U2AF 35 kDa subunit Human genes 0.000 description 1
- 102100035040 Splicing factor U2AF 65 kDa subunit Human genes 0.000 description 1
- 101710186483 Splicing factor U2AF 65 kDa subunit Proteins 0.000 description 1
- 102100038148 Thyroid adenoma-associated protein Human genes 0.000 description 1
- 102100035221 Tyrosine-protein kinase Fyn Human genes 0.000 description 1
- 108010072724 U2 Small Nuclear Ribonucleoprotein Proteins 0.000 description 1
- 102000006986 U2 Small Nuclear Ribonucleoprotein Human genes 0.000 description 1
- 102100035781 Zinc finger protein 837 Human genes 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 238000004113 cell culture Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000001415 gene therapy Methods 0.000 description 1
- 230000001965 increasing effect Effects 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 230000027039 spliceosomal complex assembly Effects 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 230000008685 targeting Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N15/00—Mutation or genetic engineering; DNA or RNA concerning genetic engineering, vectors, e.g. plasmids, or their isolation, preparation or purification; Use of hosts therefor
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/02—Stomatological preparations, e.g. drugs for caries, aphtae, periodontitis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/04—Drugs for disorders of the alimentary tract or the digestive system for ulcers, gastritis or reflux esophagitis, e.g. antacids, inhibitors of acid secretion, mucosal protectants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P1/00—Drugs for disorders of the alimentary tract or the digestive system
- A61P1/18—Drugs for disorders of the alimentary tract or the digestive system for pancreatic disorders, e.g. pancreatic enzymes
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
- A61P11/02—Nasal agents, e.g. decongestants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
- A61P11/04—Drugs for disorders of the respiratory system for throat disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P13/00—Drugs for disorders of the urinary system
- A61P13/02—Drugs for disorders of the urinary system of urine or of the urinary tract, e.g. urine acidifiers
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P13/00—Drugs for disorders of the urinary system
- A61P13/08—Drugs for disorders of the urinary system of the prostate
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P13/00—Drugs for disorders of the urinary system
- A61P13/10—Drugs for disorders of the urinary system of the bladder
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P15/00—Drugs for genital or sexual disorders; Contraceptives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
- A61P17/02—Drugs for dermatological disorders for treating wounds, ulcers, burns, scars, keloids, or the like
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
- A61P17/06—Antipsoriatics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/02—Drugs for skeletal disorders for joint disorders, e.g. arthritis, arthrosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P21/00—Drugs for disorders of the muscular or neuromuscular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P21/00—Drugs for disorders of the muscular or neuromuscular system
- A61P21/04—Drugs for disorders of the muscular or neuromuscular system for myasthenia gravis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/04—Centrally acting analgesics, e.g. opioids
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/08—Antiepileptics; Anticonvulsants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/14—Drugs for disorders of the nervous system for treating abnormal movements, e.g. chorea, dyskinesia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/14—Drugs for disorders of the nervous system for treating abnormal movements, e.g. chorea, dyskinesia
- A61P25/16—Anti-Parkinson drugs
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/18—Antipsychotics, i.e. neuroleptics; Drugs for mania or schizophrenia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/24—Antidepressants
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/28—Drugs for disorders of the nervous system for treating neurodegenerative disorders of the central nervous system, e.g. nootropic agents, cognition enhancers, drugs for treating Alzheimer's disease or other forms of dementia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/02—Ophthalmic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/02—Ophthalmic agents
- A61P27/04—Artificial tears; Irrigation solutions
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/02—Ophthalmic agents
- A61P27/06—Antiglaucoma agents or miotics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/02—Ophthalmic agents
- A61P27/12—Ophthalmic agents for cataracts
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/02—Nutrients, e.g. vitamins, minerals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/04—Anorexiants; Antiobesity agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/10—Antimycotics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
- A61P31/14—Antivirals for RNA viruses
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
- A61P31/20—Antivirals for DNA viruses
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
- A61P31/20—Antivirals for DNA viruses
- A61P31/22—Antivirals for DNA viruses for herpes viruses
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P33/00—Antiparasitic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
- A61P35/02—Antineoplastic agents specific for leukemia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/02—Immunomodulators
- A61P37/06—Immunosuppressants, e.g. drugs for graft rejection
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P7/00—Drugs for disorders of the blood or the extracellular fluid
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C291/00—Compounds containing carbon and nitrogen and having functional groups not covered by groups C07C201/00 - C07C281/00
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N15/00—Mutation or genetic engineering; DNA or RNA concerning genetic engineering, vectors, e.g. plasmids, or their isolation, preparation or purification; Use of hosts therefor
- C12N15/09—Recombinant DNA-technology
- C12N15/10—Processes for the isolation, preparation or purification of DNA or RNA
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N15/00—Mutation or genetic engineering; DNA or RNA concerning genetic engineering, vectors, e.g. plasmids, or their isolation, preparation or purification; Use of hosts therefor
- C12N15/09—Recombinant DNA-technology
- C12N15/10—Processes for the isolation, preparation or purification of DNA or RNA
- C12N15/102—Mutagenizing nucleic acids
-
- C—CHEMISTRY; METALLURGY
- C12—BIOCHEMISTRY; BEER; SPIRITS; WINE; VINEGAR; MICROBIOLOGY; ENZYMOLOGY; MUTATION OR GENETIC ENGINEERING
- C12N—MICROORGANISMS OR ENZYMES; COMPOSITIONS THEREOF; PROPAGATING, PRESERVING, OR MAINTAINING MICROORGANISMS; MUTATION OR GENETIC ENGINEERING; CULTURE MEDIA
- C12N15/00—Mutation or genetic engineering; DNA or RNA concerning genetic engineering, vectors, e.g. plasmids, or their isolation, preparation or purification; Use of hosts therefor
- C12N15/09—Recombinant DNA-technology
- C12N15/63—Introduction of foreign genetic material using vectors; Vectors; Use of hosts therefor; Regulation of expression
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- General Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Animal Behavior & Ethology (AREA)
- Medicinal Chemistry (AREA)
- Public Health (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Genetics & Genomics (AREA)
- Biomedical Technology (AREA)
- Biotechnology (AREA)
- Zoology (AREA)
- Wood Science & Technology (AREA)
- General Engineering & Computer Science (AREA)
- Molecular Biology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Biophysics (AREA)
- Microbiology (AREA)
- Plant Pathology (AREA)
- Biochemistry (AREA)
- Physics & Mathematics (AREA)
- Virology (AREA)
- Immunology (AREA)
- Oncology (AREA)
- Communicable Diseases (AREA)
- Ophthalmology & Optometry (AREA)
- Crystallography & Structural Chemistry (AREA)
- Hematology (AREA)
- Pain & Pain Management (AREA)
- Pulmonology (AREA)
- Physical Education & Sports Medicine (AREA)
- Diabetes (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US201662426619P | 2016-11-28 | 2016-11-28 | |
| US62/426,619 | 2016-11-28 | ||
| PCT/US2017/063323 WO2018098446A1 (en) | 2016-11-28 | 2017-11-27 | Methods for modulating rna splicing |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AU2017363369A1 true AU2017363369A1 (en) | 2019-05-30 |
Family
ID=62195368
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU2017363369A Abandoned AU2017363369A1 (en) | 2016-11-28 | 2017-11-27 | Methods for modulating RNA splicing |
Country Status (9)
| Country | Link |
|---|---|
| US (2) | US11702646B2 (enExample) |
| EP (1) | EP3544435A4 (enExample) |
| JP (2) | JP2019535789A (enExample) |
| CN (1) | CN110352007A (enExample) |
| AU (1) | AU2017363369A1 (enExample) |
| CA (1) | CA3043755A1 (enExample) |
| EA (1) | EA201991309A1 (enExample) |
| MX (1) | MX2019005588A (enExample) |
| WO (1) | WO2018098446A1 (enExample) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP3310169B1 (en) | 2015-05-30 | 2023-05-17 | PTC Therapeutics, Inc. | Methods for modulating rna splicing |
| AU2017363369A1 (en) | 2016-11-28 | 2019-05-30 | Ptc Therapeutics, Inc | Methods for modulating RNA splicing |
| US11608501B2 (en) | 2017-06-14 | 2023-03-21 | Ptc Therapeutics, Inc. | Methods for modifying RNA splicing |
| MX2020001425A (es) | 2017-08-04 | 2020-08-06 | Skyhawk Therapeutics Inc | Metodos y composiciones para modular el empalme. |
| US20210355509A1 (en) * | 2018-08-07 | 2021-11-18 | The Children's Hospital Of Philadelphia | Alternative splicing regulation of gene expression and therapeutic methods |
| CA3113817A1 (en) * | 2018-10-09 | 2020-04-16 | The University Of North Carolina At Chapel Hill | Regulated gene editing system |
| CN114007613A (zh) | 2019-02-05 | 2022-02-01 | 斯基霍克疗法公司 | 用于调节剪接的方法和组合物 |
| JP7603595B2 (ja) | 2019-02-06 | 2024-12-20 | スカイホーク・セラピューティクス・インコーポレーテッド | スプライシングを調節するための方法および組成物 |
| US11129829B2 (en) | 2019-06-17 | 2021-09-28 | Skyhawk Therapeutics, Inc. | Methods for modulating splicing |
| EP4004213A1 (en) | 2019-07-25 | 2022-06-01 | Novartis AG | Regulatable expression systems |
| CN114746550A (zh) * | 2019-08-19 | 2022-07-12 | 斯托克制药公司 | 用于调节剪接和蛋白质表达的组合物和方法 |
| AU2020394867A1 (en) | 2019-12-02 | 2022-05-26 | Storm Therapeutics Limited | Polyheterocyclic compounds as METTL3 inhibitors |
| IL295542A (en) * | 2020-02-12 | 2022-10-01 | Childrens Hospital Philadelphia | Compositions and methods for inducible alternative splicing regulation of gene expression |
| CA3169676A1 (en) | 2020-02-28 | 2021-09-02 | Dominic Reynolds | Compounds and methods for modulating splicing |
| CN115551847A (zh) | 2020-02-28 | 2022-12-30 | 雷密克斯医疗公司 | 用于调节核酸剪接的哒嗪衍生物 |
| US20240226098A1 (en) | 2020-02-28 | 2024-07-11 | Remix Therapeutics Inc. | Compounds and methods for modulating splicing |
| AU2021228770A1 (en) | 2020-02-28 | 2022-09-29 | Remix Therapeutics Inc. | Thiophenyl derivatives useful for modulating nucleic acid splicing |
| MX2022012678A (es) | 2020-04-08 | 2023-01-11 | Remix Therapeutics Inc | Compuestos y metodos para modular el corte y empalme. |
| KR20230005210A (ko) | 2020-04-08 | 2023-01-09 | 레믹스 테라퓨틱스 인크. | 스플라이싱을 조절하기 위한 화합물 및 방법 |
| AU2021272972A1 (en) | 2020-05-13 | 2022-12-08 | Chdi Foundation, Inc. | HTT modulators for treating Huntington's disease |
| IL299543A (en) | 2020-07-02 | 2023-02-01 | Remix Therapeutics Inc | 2-(indazol-5-yl)-6-(piperidin-4-yl)-1,7-naphthyridine derivatives and related compounds as modulators for splicing nucleic acids and for the treatment of proliferative diseases |
| JP2023532331A (ja) | 2020-07-02 | 2023-07-27 | リミックス セラピューティクス インコーポレイテッド | 核酸をスプライシングするため及び増殖性疾患を処置するための修飾因子としての5-[5-(ピペリジン-4-イル)チエノ[3,2-c]ピラゾール-2-イル]インダゾール誘導体及び関連する化合物並びにスプライシングを調節するための化合物及び方法 |
| WO2022214520A1 (en) * | 2021-04-07 | 2022-10-13 | Janssen Sciences Ireland Unlimited Company | Antibacterial compounds |
| CN116087519B (zh) * | 2021-05-17 | 2025-03-14 | 郑州大学第一附属医院 | 一种用于高危人群贲门腺癌早期筛查的标志物及其应用 |
| CN113604566B (zh) * | 2021-07-13 | 2023-05-16 | 中山大学孙逸仙纪念医院 | lncRNA BCYRN1在膀胱癌预后、治疗中的应用 |
| EP4395889A1 (en) | 2021-08-30 | 2024-07-10 | Remix Therapeutics Inc. | Compounds and methods for modulating splicing |
| WO2023034836A1 (en) | 2021-08-30 | 2023-03-09 | Remix Therapeutics Inc. | Compounds and methods for modulating splicing |
| US20240368163A1 (en) | 2021-08-30 | 2024-11-07 | Remix Therapeutics Inc. | Compounds and methods for modulating splicing |
| KR20240102938A (ko) | 2021-08-30 | 2024-07-03 | 레믹스 테라퓨틱스 인크. | 스플라이싱 조절을 위한 화합물 및 방법 |
| WO2023034812A1 (en) | 2021-08-30 | 2023-03-09 | Remix Therapeutics Inc. | Compounds and methods for modulating splicing |
| WO2023064879A1 (en) | 2021-10-13 | 2023-04-20 | Remix Therapeutics Inc. | Compounds and methods for modulating nucleic acid splicing |
| TW202333689A (zh) | 2021-10-13 | 2023-09-01 | 美商雷密克斯醫療公司 | 調節剪接之化合物及方法 |
| AU2022394333A1 (en) | 2021-11-17 | 2024-06-27 | Chdi Foundation, Inc. | HTT modulators for treating Huntington’s disease |
| WO2023133229A2 (en) | 2022-01-05 | 2023-07-13 | Remix Therapeutics Inc. | Compounds and methods for modulating splicing |
| US20250326748A1 (en) | 2022-01-05 | 2025-10-23 | Remix Therapeutics Inc. | Compounds and methods for modulating splicing |
| TW202337442A (zh) | 2022-01-05 | 2023-10-01 | 美商雷密克斯醫療公司 | 用於調節剪切之化合物及方法 |
| CN118647405A (zh) * | 2022-01-25 | 2024-09-13 | 上海魁特迪生物科技有限公司 | 改善认知障碍的方法 |
| EP4568962A2 (en) * | 2022-08-09 | 2025-06-18 | PTC Therapeutics, Inc. | Methods for modulating rna splicing |
Family Cites Families (60)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3558618A (en) | 1968-04-01 | 1971-01-26 | Dow Chemical Co | Novel 4h-pyrazino(1,2-a)pyrimidine-4-ones |
| US4122274A (en) | 1977-05-25 | 1978-10-24 | Bristol-Myers Company | 3-Tetrazolo-5,6,7,8-substituted-pyrido[1,2-a]pyrimidin-4-ones |
| JPS56150091A (en) | 1980-03-28 | 1981-11-20 | Janssen Pharmaceutica Nv | 3-(1-piperidinylalkyl)-4h-pyrido(1,2-a)pyrimidine- 4-one derivative and its manufacture |
| US4342870A (en) | 1980-03-28 | 1982-08-03 | Janssen Pharmaceutica N.V. | Novel 3-(1-piperidinylalkyl)-4H-pyrido[1,2-a]pyrimidin-4-one derivatives |
| US5089633A (en) | 1987-04-28 | 1992-02-18 | Georgia Tech Research Corporation | Substituted isocoumarins |
| US5726182A (en) | 1990-05-02 | 1998-03-10 | Abbott Laboratories | Quinolizinone type compounds |
| WO1993023398A1 (en) | 1992-05-13 | 1993-11-25 | E.I. Du Pont De Nemours And Company | Substituted pyrido[1,2-a]pyrimidinone derivatives as fungicides |
| CA2222322A1 (en) | 1995-06-06 | 1996-12-12 | Abbott Laboratories | Quinolizinone type compounds |
| US5869500A (en) | 1996-12-13 | 1999-02-09 | Hoffmann-La Roche Inc. | Pyridone compounds useful in treating Alzheimer's disease |
| WO2000017197A1 (en) | 1998-09-21 | 2000-03-30 | Biochem Pharma Inc. | Quinolizinones as integrin inhibitors |
| ATE312820T1 (de) | 1999-10-28 | 2005-12-15 | Trine Pharmaceuticals Inc | Pumpeninhibitoren zur freisetzung von medikamenten |
| DE60128655T2 (de) | 2000-01-24 | 2008-02-07 | Astrazeneca Ab | Durch einen morpholinrest substituierte therapeutische verbindungen |
| WO2002053576A1 (en) | 2001-01-05 | 2002-07-11 | The General Hospital Corporation | Viral delivery system for infectious transfer of large genomic dna inserts |
| CA2445697A1 (en) | 2001-04-26 | 2002-11-07 | Daiichi Pharmaceutical Co., Ltd. | Drug efflux pump inhibitor |
| MXPA04005510A (es) | 2001-12-07 | 2006-02-24 | Vertex Pharma | Compuestos basados en pirimidina utiles como inhibidores de gsk-3. |
| GB0205281D0 (en) | 2002-03-06 | 2002-04-17 | Novartis Ag | Organic compounds |
| ATE548354T1 (de) | 2002-07-24 | 2012-03-15 | Ptc Therapeutics Inc | Ureido-substituierte benzoesäureverbindungen und ihre verwendung für die nonsense-suppression und behandlung von erkrankungen |
| US9068234B2 (en) | 2003-01-21 | 2015-06-30 | Ptc Therapeutics, Inc. | Methods and agents for screening for compounds capable of modulating gene expression |
| AU2004249730A1 (en) | 2003-06-20 | 2004-12-29 | Novartis Vaccines And Diagnostics, Inc. | Pyridino(1,2-A)pyrimidin-4-one compounds as anticancer agents |
| DE602005002562T2 (de) | 2004-05-04 | 2008-01-31 | Warner-Lambert Company Llc | Pyrrolylsubstituierte pyridoä2,3-düpyrimidin-7-one und derivate davon als therapeutische mittel |
| US7399767B2 (en) | 2005-01-21 | 2008-07-15 | Ortho-Mcneil Pharmaceutical, Inc. | Heterocyclic benzo[c]chromene derivatives useful as modulators of the estrogen receptors |
| CN101213203A (zh) * | 2005-04-29 | 2008-07-02 | 教堂山北卡罗莱纳州大学 | 在转录后水平调节核酸表达的方法和组合物 |
| US7563601B1 (en) | 2005-06-01 | 2009-07-21 | City Of Hope | Artificial riboswitch for controlling pre-mRNA splicing |
| EP1910569A4 (en) * | 2005-06-17 | 2009-08-05 | Genizon Biosciences Inc | GENEMAP GENE CARD OF HUMAN GENES ASSOCIATED WITH LONGEVITY |
| CA2625262A1 (en) | 2005-10-13 | 2007-10-04 | Bc Cancer Agency | Modular genomes for synthetic biology and metabolic engineering |
| AR059339A1 (es) | 2006-02-09 | 2008-03-26 | Chugai Pharmaceutical Co Ltd | Derivados de la cumarina para trastornos proliferativos de celulas, composicion farmaceutica y agente terapeutico que los contiene |
| US8110681B2 (en) | 2006-03-17 | 2012-02-07 | The United States Of America As Represented By The Secretary, Department Of Health And Human Services | Compounds for the treatment of spinal muscular atrophy and other uses |
| US8337941B2 (en) | 2006-07-27 | 2012-12-25 | The Trustees Of Columbia University In The City Of New York | Fluorescent substrates for monoamine transporters as optical false neurotransmitters |
| WO2008077188A1 (en) | 2006-12-22 | 2008-07-03 | Avexa Limited | Bicyclic pyrimidinones and uses thereof |
| WO2009151546A2 (en) | 2008-05-27 | 2009-12-17 | Ptc Therapeutics, Inc. | Methods for treating spinal muscular atrophy |
| EP2138493A1 (en) | 2008-06-26 | 2009-12-30 | Sanofi-Aventis | Substituted pyrimidone derivatives |
| BRPI0913934A2 (pt) | 2008-07-02 | 2015-10-20 | Avexa Ltd | compostos tendo propriedades antivirais |
| WO2010019243A1 (en) | 2008-08-13 | 2010-02-18 | Ptc Therapeutics, Inc. | Methods for treating viral infections |
| WO2010083338A2 (en) | 2009-01-14 | 2010-07-22 | Philadelphia Health And Education Corporation | Modulation of pre-mrna using splice modulating oligonucleotides as therapeutic agents in the treatment of disease |
| US20100303776A1 (en) | 2009-04-16 | 2010-12-02 | The University Of North Carolina At Chapel Hill | Methods and compositions for regulated expression of multiple nucleic acids |
| WO2011050245A1 (en) | 2009-10-23 | 2011-04-28 | Yangbo Feng | Bicyclic heteroaryls as kinase inhibitors |
| US8754220B2 (en) | 2009-11-20 | 2014-06-17 | Merck Sharp & Dohme Corp. | Quinolizidinone carboxamide M1 receptor positive allosteric modulators |
| US20130012506A1 (en) | 2010-01-13 | 2013-01-10 | Zaesung No | Anti-infective pyrido (1,2-a) pyrimidines |
| EP3034078A1 (en) | 2010-09-27 | 2016-06-22 | Emergent Product Development Gaithersburg Inc. | 2-pyridone antimicrobial compositions |
| US9662314B2 (en) | 2011-10-21 | 2017-05-30 | Tufts Medical Center, Inc. | Compounds and methods for the treatment of muscular disease, and related screening methods |
| WO2013101974A1 (en) | 2011-12-30 | 2013-07-04 | Ptc Therapeutics, Inc. | Compounds for treating spinal muscular atrophy |
| BR112014018027B1 (pt) | 2012-01-26 | 2020-10-27 | Ptc Therapeutics, Inc | composto, composição farmacêutica e usos dos mesmos e métodos para aumentar a inclusão de éxon 7 de ame2 em rnam que é transcrito a partir do gene ame2 e para aumentar a quantidade de proteína smn |
| EP2812004B1 (en) | 2012-02-10 | 2018-06-27 | PTC Therapeutics, Inc. | Compounds for treating spinal muscular atrophy |
| BR112014021531B1 (pt) | 2012-03-01 | 2022-10-04 | Ptc Therapeutics, Inc. | Composto, composição farmacêutica e usos dos mesmos |
| CN104470909B (zh) | 2012-03-23 | 2018-04-24 | Ptc医疗公司 | 用于治疗脊髓性肌萎缩的化合物 |
| WO2014012050A2 (en) | 2012-07-13 | 2014-01-16 | Indiana University Research & Technology Corporation | Compounds for treatment of spinal muscular atrophy |
| US9040712B2 (en) | 2013-01-23 | 2015-05-26 | Novartis Ag | Thiadiazole analogs thereof and methods for treating SMN-deficiency-related-conditions |
| MX372669B (es) | 2013-08-19 | 2020-04-23 | Hoffmann La Roche | Un compuesto que modifica el empalme del gen de foxm1 para usarse en la profilaxis o tratamiento de cáncer. |
| US10195202B2 (en) | 2013-12-19 | 2019-02-05 | Ptc Therapeutics, Inc. | Methods for modulating the amount of RNA transcripts |
| WO2015095449A1 (en) | 2013-12-19 | 2015-06-25 | Ptc Therapeutics, Inc. | Methods for modulating the amount rna transcripts |
| WO2015095446A1 (en) | 2013-12-19 | 2015-06-25 | Ptc Therapeutics, Inc. | Methods for modulating the amount of rna transcripts |
| HRP20230637T1 (hr) * | 2014-05-15 | 2023-09-29 | F. Hoffmann - La Roche Ag | Postupak za proizvodnju spojeva korisnih za liječenje spinalne mišićne atrofije |
| WO2016042015A1 (en) * | 2014-09-16 | 2016-03-24 | Centre National De La Recherche Scientifique (Cnrs) | Method for evaluating developmental competence of an oocyte |
| JP6884102B2 (ja) * | 2015-02-09 | 2021-06-09 | エフ・ホフマン−ラ・ロシュ・アクチェンゲゼルシャフト | がんの治療のための化合物 |
| EP3298017B1 (en) | 2015-05-20 | 2019-08-14 | H. Hoffnabb-La Roche Ag | Compounds for treating spinal muscular atrophy |
| EP3310169B1 (en) | 2015-05-30 | 2023-05-17 | PTC Therapeutics, Inc. | Methods for modulating rna splicing |
| AU2017363369A1 (en) | 2016-11-28 | 2019-05-30 | Ptc Therapeutics, Inc | Methods for modulating RNA splicing |
| US11608501B2 (en) | 2017-06-14 | 2023-03-21 | Ptc Therapeutics, Inc. | Methods for modifying RNA splicing |
| MX2020001425A (es) | 2017-08-04 | 2020-08-06 | Skyhawk Therapeutics Inc | Metodos y composiciones para modular el empalme. |
| KR20200057071A (ko) | 2017-09-25 | 2020-05-25 | 스카이호크 테라퓨틱스, 인코포레이티드 | 스플라이싱 조절제의 스크리닝 및 확인을 위한 방법 및 조성물 |
-
2017
- 2017-11-27 AU AU2017363369A patent/AU2017363369A1/en not_active Abandoned
- 2017-11-27 CA CA3043755A patent/CA3043755A1/en active Pending
- 2017-11-27 EP EP17873550.2A patent/EP3544435A4/en not_active Withdrawn
- 2017-11-27 CN CN201780084649.8A patent/CN110352007A/zh active Pending
- 2017-11-27 MX MX2019005588A patent/MX2019005588A/es unknown
- 2017-11-27 US US16/463,775 patent/US11702646B2/en active Active
- 2017-11-27 JP JP2019528527A patent/JP2019535789A/ja active Pending
- 2017-11-27 EA EA201991309A patent/EA201991309A1/ru unknown
- 2017-11-27 WO PCT/US2017/063323 patent/WO2018098446A1/en not_active Ceased
-
2022
- 2022-07-05 JP JP2022108509A patent/JP2022153413A/ja active Pending
-
2023
- 2023-05-12 US US18/316,871 patent/US20230272367A1/en not_active Abandoned
Also Published As
| Publication number | Publication date |
|---|---|
| US11702646B2 (en) | 2023-07-18 |
| CN110352007A (zh) | 2019-10-18 |
| MX2019005588A (es) | 2019-10-15 |
| EP3544435A1 (en) | 2019-10-02 |
| EA201991309A1 (ru) | 2019-11-29 |
| US20190330615A1 (en) | 2019-10-31 |
| JP2019535789A (ja) | 2019-12-12 |
| EP3544435A4 (en) | 2020-11-04 |
| CA3043755A1 (en) | 2018-05-31 |
| WO2018098446A1 (en) | 2018-05-31 |
| JP2022153413A (ja) | 2022-10-12 |
| US20230272367A1 (en) | 2023-08-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US20230272367A1 (en) | Methods for modulating rna splicing | |
| US20230310651A1 (en) | Methods for modulating rna splicing | |
| US10688099B2 (en) | Methods for modulating the amount of RNA transcripts | |
| US11608501B2 (en) | Methods for modifying RNA splicing | |
| CA2863874C (en) | Compounds for treating spinal muscular atrophy | |
| WO2015095449A1 (en) | Methods for modulating the amount rna transcripts | |
| CN104470909B (zh) | 用于治疗脊髓性肌萎缩的化合物 | |
| JP6193888B2 (ja) | 脊髄性筋萎縮症を治療するための化合物 | |
| WO2015095446A1 (en) | Methods for modulating the amount of rna transcripts | |
| WO2022204471A1 (en) | Regulation of transgene expression using a small molecule inducible splicing switch | |
| HK40016425A (en) | Methods for modulating rna splicing | |
| HK1200056B (en) | Compounds for treating spinal muscular atrophy | |
| HK1200056A1 (en) | Compounds for treating spinal muscular atrophy |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MK5 | Application lapsed section 142(2)(e) - patent request and compl. specification not accepted |