ATE350013T1 - Nanopartikelzusammensetzungen enthaltend insulin - Google Patents
Nanopartikelzusammensetzungen enthaltend insulinInfo
- Publication number
- ATE350013T1 ATE350013T1 AT02775863T AT02775863T ATE350013T1 AT E350013 T1 ATE350013 T1 AT E350013T1 AT 02775863 T AT02775863 T AT 02775863T AT 02775863 T AT02775863 T AT 02775863T AT E350013 T1 ATE350013 T1 AT E350013T1
- Authority
- AT
- Austria
- Prior art keywords
- insulin
- compositions
- compositions containing
- nanoparticle compositions
- containing insulin
- Prior art date
Links
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 title abstract 12
- 102000004877 Insulin Human genes 0.000 title abstract 6
- 108090001061 Insulin Proteins 0.000 title abstract 6
- 229940125396 insulin Drugs 0.000 title abstract 6
- 239000000203 mixture Substances 0.000 title abstract 6
- 239000002105 nanoparticle Substances 0.000 title 1
- 239000002552 dosage form Substances 0.000 abstract 1
- 238000009472 formulation Methods 0.000 abstract 1
- 230000014759 maintenance of location Effects 0.000 abstract 1
- 238000000034 method Methods 0.000 abstract 1
- 239000002245 particle Substances 0.000 abstract 1
- 238000002560 therapeutic procedure Methods 0.000 abstract 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/14—Particulate form, e.g. powders, Processes for size reducing of pure drugs or the resulting products, Pure drug nanoparticles
- A61K9/141—Intimate drug-carrier mixtures characterised by the carrier, e.g. ordered mixtures, adsorbates, solid solutions, eutectica, co-dried, co-solubilised, co-kneaded, co-milled, co-ground products, co-precipitates, co-evaporates, co-extrudates, co-melts; Drug nanoparticles with adsorbed surface modifiers
- A61K9/146—Intimate drug-carrier mixtures characterised by the carrier, e.g. ordered mixtures, adsorbates, solid solutions, eutectica, co-dried, co-solubilised, co-kneaded, co-milled, co-ground products, co-precipitates, co-evaporates, co-extrudates, co-melts; Drug nanoparticles with adsorbed surface modifiers with organic macromolecular compounds
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K38/00—Medicinal preparations containing peptides
- A61K38/16—Peptides having more than 20 amino acids; Gastrins; Somatostatins; Melanotropins; Derivatives thereof
- A61K38/17—Peptides having more than 20 amino acids; Gastrins; Somatostatins; Melanotropins; Derivatives thereof from animals; from humans
- A61K38/22—Hormones
- A61K38/28—Insulins
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/14—Particulate form, e.g. powders, Processes for size reducing of pure drugs or the resulting products, Pure drug nanoparticles
- A61K9/141—Intimate drug-carrier mixtures characterised by the carrier, e.g. ordered mixtures, adsorbates, solid solutions, eutectica, co-dried, co-solubilised, co-kneaded, co-milled, co-ground products, co-precipitates, co-evaporates, co-extrudates, co-melts; Drug nanoparticles with adsorbed surface modifiers
- A61K9/145—Intimate drug-carrier mixtures characterised by the carrier, e.g. ordered mixtures, adsorbates, solid solutions, eutectica, co-dried, co-solubilised, co-kneaded, co-milled, co-ground products, co-precipitates, co-evaporates, co-extrudates, co-melts; Drug nanoparticles with adsorbed surface modifiers with organic compounds
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
- A61P3/10—Drugs for disorders of the metabolism for glucose homeostasis for hyperglycaemia, e.g. antidiabetics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
Landscapes
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Epidemiology (AREA)
- Diabetes (AREA)
- Endocrinology (AREA)
- Gastroenterology & Hepatology (AREA)
- Immunology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Zoology (AREA)
- Organic Chemistry (AREA)
- Hematology (AREA)
- Obesity (AREA)
- Emergency Medicine (AREA)
- Medicinal Preparation (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Peptides Or Proteins (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US32345901P | 2001-09-19 | 2001-09-19 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ATE350013T1 true ATE350013T1 (de) | 2007-01-15 |
Family
ID=23259284
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT02775863T ATE350013T1 (de) | 2001-09-19 | 2002-09-19 | Nanopartikelzusammensetzungen enthaltend insulin |
Country Status (11)
| Country | Link |
|---|---|
| US (2) | US20030095928A1 (enExample) |
| EP (1) | EP1429731B1 (enExample) |
| JP (2) | JP4464129B2 (enExample) |
| AT (1) | ATE350013T1 (enExample) |
| CA (1) | CA2460867C (enExample) |
| CY (1) | CY1106420T1 (enExample) |
| DE (1) | DE60217367T2 (enExample) |
| DK (1) | DK1429731T3 (enExample) |
| ES (1) | ES2280582T3 (enExample) |
| PT (1) | PT1429731E (enExample) |
| WO (1) | WO2003024425A1 (enExample) |
Families Citing this family (63)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20070160675A1 (en) * | 1998-11-02 | 2007-07-12 | Elan Corporation, Plc | Nanoparticulate and controlled release compositions comprising a cephalosporin |
| DK1126826T6 (en) * | 1998-11-02 | 2019-06-24 | Alkermes Pharma Ireland Ltd | Multiparticulate modified release of methylphenidate |
| US20090297602A1 (en) * | 1998-11-02 | 2009-12-03 | Devane John G | Modified Release Loxoprofen Compositions |
| MXPA03011935A (es) * | 2001-06-22 | 2004-03-26 | Pfizer Prod Inc | Composiciones farmaceuticas que contienen conjuntos de polimero y farmaco. |
| ES2343405T3 (es) | 2002-02-04 | 2010-07-30 | Elan Pharma International Ltd. | Composiciones nanoparticuladas que tienen lisozima como un estabilizador de superficie. |
| AU2003224808A1 (en) * | 2002-03-28 | 2003-10-13 | Imcor Pharmaceutical Company | Compositions and methods for delivering pharmaceutically active agents using nanoparticulates |
| CA2500908A1 (en) * | 2002-10-04 | 2004-04-22 | Elan Pharma International Limited | Gamma irradiation of solid nanoparticulate active agents |
| EP1626742A1 (en) * | 2003-05-22 | 2006-02-22 | Elan Pharma International Limited | Sterilization of dispersions of nanoparticulate active agents with gamma radiation |
| KR100638041B1 (ko) * | 2003-12-24 | 2006-10-23 | 주식회사 삼양사 | 수용성 약물의 경구투여용 나노입자 조성물 및 그의제조방법 |
| EP1730516A1 (en) * | 2004-03-30 | 2006-12-13 | Pfizer Products Incorporated | Method and device for evaluation of pharmaceutical compositions |
| US20070219131A1 (en) * | 2004-04-15 | 2007-09-20 | Ben-Sasson Shmuel A | Compositions capable of facilitating penetration across a biological barrier |
| KR20070044805A (ko) | 2004-04-15 | 2007-04-30 | 키아스마, 인코포레이티드 | 생물학적 장벽 투과를 촉진시킬 수 있는 조성물 |
| US20140162965A1 (en) | 2004-08-25 | 2014-06-12 | Aegis Therapeutics, Inc. | Compositions for oral drug administration |
| US20060046962A1 (en) | 2004-08-25 | 2006-03-02 | Aegis Therapeutics Llc | Absorption enhancers for drug administration |
| US9895444B2 (en) | 2004-08-25 | 2018-02-20 | Aegis Therapeutics, Llc | Compositions for drug administration |
| US20090155331A1 (en) * | 2005-11-16 | 2009-06-18 | Elan Pharma International Limited | Injectable nanoparticulate olanzapine formulations |
| US20080254114A1 (en) * | 2005-03-03 | 2008-10-16 | Elan Corporation Plc | Controlled Release Compositions Comprising Heterocyclic Amide Derivative Nanoparticles |
| WO2006132752A1 (en) * | 2005-05-10 | 2006-12-14 | Elan Pharma International Limited | Nanoparticulate and controlled release compositions comprising vitamin k2 |
| EP1888037A2 (en) * | 2005-05-10 | 2008-02-20 | Elan Pharma International Limited | Nanoparticulate clopidogrel formulations |
| US20100028439A1 (en) * | 2005-05-23 | 2010-02-04 | Elan Pharma International Limited | Nanoparticulate stabilized anti-hypertensive compositions |
| US20070042049A1 (en) * | 2005-06-03 | 2007-02-22 | Elan Pharma International, Limited | Nanoparticulate benidipine compositions |
| EA015336B1 (ru) * | 2005-06-03 | 2011-06-30 | Элан Фарма Интернэшнл Лтд. | Стабильная композиция с наночастицами ацетаминофена |
| EA201100022A1 (ru) * | 2005-06-03 | 2011-06-30 | Элан Фарма Интернэшнл Лтд. | Способ получения композиции наночастиц мезилата иматиниба |
| DE112006001606T5 (de) | 2005-06-08 | 2009-07-09 | Elan Pharma International Ltd., Athlone | Nanopartikuläre und eine kontrollierte Freisetzung aufweisende Zusammensetzung, die Cefditoren umfassen |
| CA2611475A1 (en) * | 2005-06-09 | 2006-12-21 | Elan Pharma International, Limited | Nanoparticulate ebastine formulations |
| KR20080016952A (ko) * | 2005-06-13 | 2008-02-22 | 엘란 파마 인터내셔널 리미티드 | 나노입자형 클로피도그렐과 아스피린의 배합 제제 |
| EP1931340A2 (en) * | 2005-06-15 | 2008-06-18 | Elan Pharma International Limited | Nanoparticulate azelnidipine formulations |
| CA2614412A1 (en) * | 2005-07-07 | 2007-01-18 | Elan Pharma International, Limited | Nanoparticulate clarithromycin formulations |
| US20070104792A1 (en) * | 2005-09-13 | 2007-05-10 | Elan Pharma International, Limited | Nanoparticulate tadalafil formulations |
| CA2622758A1 (en) * | 2005-09-15 | 2007-03-29 | Elan Pharma International, Limited | Nanoparticulate aripiprazole formulations |
| SE0600091L (sv) | 2006-01-18 | 2007-04-17 | Bows Pharmaceuticals Ag | Förfarande för framställning av en dextranmatris för kontrollerad frisättning av insulin |
| CN101495096A (zh) | 2006-05-30 | 2009-07-29 | 伊兰制药国际有限公司 | 纳米微粒泊沙康唑制剂 |
| US8226949B2 (en) | 2006-06-23 | 2012-07-24 | Aegis Therapeutics Llc | Stabilizing alkylglycoside compositions and methods thereof |
| WO2008008733A2 (en) * | 2006-07-10 | 2008-01-17 | Elan Pharma International Ltd. | Nanoparticulate sorafenib formulations |
| WO2008034273A1 (de) * | 2006-09-22 | 2008-03-27 | Mivital Ag | Emulsionen enthaltend gummi arabicum |
| WO2008065502A1 (en) * | 2006-11-29 | 2008-06-05 | Pfizer Products Inc. | Pharmaceutical compositions based on a) nanoparticles comprising enteric polymers and b) casein |
| US20100119612A1 (en) * | 2007-04-17 | 2010-05-13 | Bend Research, Inc | Nanoparticles comprising non-crystalline drug |
| US20100080852A1 (en) * | 2007-05-03 | 2010-04-01 | Ronald Arthur Beyerinck | Phamaceutical composition comprising nanoparticles and casein |
| WO2008135828A2 (en) * | 2007-05-03 | 2008-11-13 | Pfizer Products Inc. | Nanoparticles comprising a drug, ethylcellulose, and a bile salt |
| WO2008135855A2 (en) * | 2007-05-03 | 2008-11-13 | Pfizer Products Inc. | Nanoparticles comprising a cholesteryl ester transfer protein inhibitor and a nonionizable polymer |
| WO2008149230A2 (en) | 2007-06-04 | 2008-12-11 | Pfizer Products Inc. | Nanoparticles comprising drug, a non-ionizable cellulosic polymer and tocopheryl polyethylene glycol succinate |
| WO2008149192A2 (en) * | 2007-06-04 | 2008-12-11 | Pfizer Products Inc. | Nanoparticles comprising a non-ionizable cellulosic polymer and an amphiphilic non-ionizable block copolymer |
| EP2178518A2 (en) * | 2007-07-13 | 2010-04-28 | Bend Research, Inc | Nanoparticles comprising ionizable, poorly water soluble cellulosic polymers |
| WO2009073215A1 (en) * | 2007-12-06 | 2009-06-11 | Bend Research, Inc. | Pharmaceutical compositions comprising nanoparticles and a resuspending material |
| US9233078B2 (en) * | 2007-12-06 | 2016-01-12 | Bend Research, Inc. | Nanoparticles comprising a non-ionizable polymer and an Amine-functionalized methacrylate copolymer |
| DE102007060175A1 (de) * | 2007-12-13 | 2009-06-18 | Johannes Gutenberg-Universität Mainz | Quartärnisierung des Zusatzstoffs Aminoalkyl Methacrylat Copolymer E zur Verbesserung der Permeabilität und Löslichkeit von Arzneistoffen |
| US20090238867A1 (en) * | 2007-12-13 | 2009-09-24 | Scott Jenkins | Nanoparticulate Anidulafungin Compositions and Methods for Making the Same |
| JP2011520779A (ja) * | 2008-03-21 | 2011-07-21 | エラン・ファルマ・インターナショナル・リミテッド | イマチニブの部位特異的送達のための組成物および使用の方法 |
| WO2009121039A2 (en) | 2008-03-28 | 2009-10-01 | Hale Biopharma Ventures, Llc | Administration of benzodiazepine compositions |
| US20100105627A1 (en) | 2008-09-17 | 2010-04-29 | Paul Salama | Pharmaceutical compositions and related methods of delivery |
| US20100316725A1 (en) | 2009-05-27 | 2010-12-16 | Elan Pharma International Ltd. | Reduction of flake-like aggregation in nanoparticulate active agent compositions |
| CA2782056C (en) | 2009-11-25 | 2021-03-09 | Arisgen Sa | Mucosal delivery of peptides |
| EP2526971A1 (en) | 2011-05-25 | 2012-11-28 | ArisGen SA | Mucosal delivery of drugs |
| ES2683902T3 (es) | 2011-06-14 | 2018-09-28 | Hale Biopharma Ventures, Llc | Administración de benzodiacepina |
| US8859004B2 (en) * | 2011-08-04 | 2014-10-14 | Nano And Advanced Materials Institute Limited | pH-sensitive nanoparticles for oral insulin delivery |
| EP2964198A2 (en) * | 2013-03-04 | 2016-01-13 | vTv Therapeutics LLC | Stable glucokinase activator compositions |
| LT3253401T (lt) | 2015-02-03 | 2025-07-10 | Amryt Endo, Inc. | Akromegalijos gydymas geriamuoju oktreotidu |
| US11491114B2 (en) | 2016-10-12 | 2022-11-08 | Curioralrx, Llc | Formulations for enteric delivery of therapeutic agents |
| US11141457B1 (en) | 2020-12-28 | 2021-10-12 | Amryt Endo, Inc. | Oral octreotide therapy and contraceptive methods |
| EP4433028A1 (en) * | 2021-11-19 | 2024-09-25 | Nanoform Finland Oyj | A composition comprising nanosized active pharmaceutical ingredient |
| EP4651898A1 (en) | 2023-01-20 | 2025-11-26 | Basf Se | Stabilized biopolymer composition, their manufacture and use |
| WO2025245387A1 (en) * | 2024-05-22 | 2025-11-27 | Superior Nano Llc | Oral administration of insulin |
| CN119792245A (zh) * | 2025-01-08 | 2025-04-11 | 中国药科大学 | 一种可注射缓释制剂及其制备方法 |
Family Cites Families (94)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US12675A (en) * | 1855-04-10 | Portable doob-pastewee | ||
| US110597A (en) * | 1870-12-27 | Improvement in combined tramways and pavements | ||
| US3661655A (en) * | 1970-11-17 | 1972-05-09 | North American Rockwell | Metallic articles and the manufacture thereof |
| US4474752A (en) * | 1983-05-16 | 1984-10-02 | Merck & Co., Inc. | Drug delivery system utilizing thermosetting gels |
| US4826689A (en) * | 1984-05-21 | 1989-05-02 | University Of Rochester | Method for making uniformly sized particles from water-insoluble organic compounds |
| US4839341A (en) * | 1984-05-29 | 1989-06-13 | Eli Lilly And Company | Stabilized insulin formulations |
| US4783484A (en) * | 1984-10-05 | 1988-11-08 | University Of Rochester | Particulate composition and use thereof as antimicrobial agent |
| US5690954A (en) * | 1987-05-22 | 1997-11-25 | Danbiosyst Uk Limited | Enhanced uptake drug delivery system having microspheres containing an active drug and a bioavailability improving material |
| US4887662A (en) * | 1987-09-24 | 1989-12-19 | Shigenori Tanaka | Cooling drum for continuous-casting machines for manufacturing thin metallic strip |
| AU7880991A (en) * | 1990-05-10 | 1991-11-27 | Novo Nordisk A/S | A pharmaceutical preparation containing n-glycofurols and n-ethylene glycols |
| US5145684A (en) * | 1991-01-25 | 1992-09-08 | Sterling Drug Inc. | Surface modified drug nanoparticles |
| AU642066B2 (en) * | 1991-01-25 | 1993-10-07 | Nanosystems L.L.C. | X-ray contrast compositions useful in medical imaging |
| US5399363A (en) * | 1991-01-25 | 1995-03-21 | Eastman Kodak Company | Surface modified anticancer nanoparticles |
| US5552160A (en) * | 1991-01-25 | 1996-09-03 | Nanosystems L.L.C. | Surface modified NSAID nanoparticles |
| CA2112905A1 (en) * | 1991-07-05 | 1993-01-21 | Michael R. Violante | Ultrasmall non-aggregated porous particles entrapping gas-bubbles |
| JPH0578798A (ja) * | 1991-09-24 | 1993-03-30 | Mazda Motor Corp | アルミニウム合金製部材の表面改質方法 |
| CA2127877A1 (en) * | 1992-01-21 | 1993-07-22 | Robert M. Platz | Improved process for preparing micronized polypeptide drugs |
| IL101007A (en) * | 1992-02-18 | 1997-08-14 | Pharmos Ltd | Dry stable compositions prepared by lyophilization |
| GB9211268D0 (en) * | 1992-05-28 | 1992-07-15 | Ici Plc | Salts of basic peptides with carboxyterminated polyesters |
| AU660852B2 (en) * | 1992-11-25 | 1995-07-06 | Elan Pharma International Limited | Method of grinding pharmaceutical substances |
| US5349957A (en) * | 1992-12-02 | 1994-09-27 | Sterling Winthrop Inc. | Preparation and magnetic properties of very small magnetite-dextran particles |
| US5346702A (en) * | 1992-12-04 | 1994-09-13 | Sterling Winthrop Inc. | Use of non-ionic cloud point modifiers to minimize nanoparticle aggregation during sterilization |
| US5298262A (en) * | 1992-12-04 | 1994-03-29 | Sterling Winthrop Inc. | Use of ionic cloud point modifiers to prevent particle aggregation during sterilization |
| US5302401A (en) * | 1992-12-09 | 1994-04-12 | Sterling Winthrop Inc. | Method to reduce particle size growth during lyophilization |
| US5340564A (en) * | 1992-12-10 | 1994-08-23 | Sterling Winthrop Inc. | Formulations comprising olin 10-G to prevent particle aggregation and increase stability |
| US5336507A (en) * | 1992-12-11 | 1994-08-09 | Sterling Winthrop Inc. | Use of charged phospholipids to reduce nanoparticle aggregation |
| US5429824A (en) * | 1992-12-15 | 1995-07-04 | Eastman Kodak Company | Use of tyloxapole as a nanoparticle stabilizer and dispersant |
| US5352459A (en) * | 1992-12-16 | 1994-10-04 | Sterling Winthrop Inc. | Use of purified surface modifiers to prevent particle aggregation during sterilization |
| US5401492A (en) * | 1992-12-17 | 1995-03-28 | Sterling Winthrop, Inc. | Water insoluble non-magnetic manganese particles as magnetic resonance contract enhancement agents |
| US5326552A (en) * | 1992-12-17 | 1994-07-05 | Sterling Winthrop Inc. | Formulations for nanoparticulate x-ray blood pool contrast agents using high molecular weight nonionic surfactants |
| GB9300875D0 (en) * | 1993-01-18 | 1993-03-10 | Ucb Sa | Nanocapsule containing pharmaceutical compositions |
| US5264610A (en) * | 1993-03-29 | 1993-11-23 | Sterling Winthrop Inc. | Iodinated aromatic propanedioates |
| US5830853A (en) * | 1994-06-23 | 1998-11-03 | Astra Aktiebolag | Systemic administration of a therapeutic preparation |
| CZ295827B6 (cs) * | 1994-03-07 | 2005-11-16 | Nektar Therapeutics | Způsob aerosolizace dávky inzulinu, inzulinový přípravek a jeho použití |
| US5718388A (en) * | 1994-05-25 | 1998-02-17 | Eastman Kodak | Continuous method of grinding pharmaceutical substances |
| TW384224B (en) * | 1994-05-25 | 2000-03-11 | Nano Sys Llc | Method of preparing submicron particles of a therapeutic or diagnostic agent |
| US6165976A (en) * | 1994-06-23 | 2000-12-26 | Astra Aktiebolag | Therapeutic preparation for inhalation |
| US5525328A (en) * | 1994-06-24 | 1996-06-11 | Nanosystems L.L.C. | Nanoparticulate diagnostic diatrizoxy ester X-ray contrast agents for blood pool and lymphatic system imaging |
| US5587143A (en) * | 1994-06-28 | 1996-12-24 | Nanosystems L.L.C. | Butylene oxide-ethylene oxide block copolymer surfactants as stabilizer coatings for nanoparticle compositions |
| US6215097B1 (en) * | 1994-12-22 | 2001-04-10 | General Electric Company | On the fly laser shock peening |
| US5585108A (en) * | 1994-12-30 | 1996-12-17 | Nanosystems L.L.C. | Formulations of oral gastrointestinal therapeutic agents in combination with pharmaceutically acceptable clays |
| US5628981A (en) * | 1994-12-30 | 1997-05-13 | Nano Systems L.L.C. | Formulations of oral gastrointestinal diagnostic x-ray contrast agents and oral gastrointestinal therapeutic agents |
| US5466440A (en) * | 1994-12-30 | 1995-11-14 | Eastman Kodak Company | Formulations of oral gastrointestinal diagnostic X-ray contrast agents in combination with pharmaceutically acceptable clays |
| US5569448A (en) * | 1995-01-24 | 1996-10-29 | Nano Systems L.L.C. | Sulfated nonionic block copolymer surfactants as stabilizer coatings for nanoparticle compositions |
| US5560931A (en) * | 1995-02-14 | 1996-10-01 | Nawosystems L.L.C. | Formulations of compounds as nanoparticulate dispersions in digestible oils or fatty acids |
| US5571536A (en) * | 1995-02-06 | 1996-11-05 | Nano Systems L.L.C. | Formulations of compounds as nanoparticulate dispersions in digestible oils or fatty acids |
| US5593657A (en) * | 1995-02-09 | 1997-01-14 | Nanosystems L.L.C. | Barium salt formulations stabilized by non-ionic and anionic stabilizers |
| US5518738A (en) * | 1995-02-09 | 1996-05-21 | Nanosystem L.L.C. | Nanoparticulate nsaid compositions |
| US5622938A (en) * | 1995-02-09 | 1997-04-22 | Nano Systems L.L.C. | Sugar base surfactant for nanocrystals |
| US5500204A (en) * | 1995-02-10 | 1996-03-19 | Eastman Kodak Company | Nanoparticulate diagnostic dimers as x-ray contrast agents for blood pool and lymphatic system imaging |
| US5591456A (en) * | 1995-02-10 | 1997-01-07 | Nanosystems L.L.C. | Milled naproxen with hydroxypropyl cellulose as a dispersion stabilizer |
| US5573783A (en) * | 1995-02-13 | 1996-11-12 | Nano Systems L.L.C. | Redispersible nanoparticulate film matrices with protective overcoats |
| US5510118A (en) * | 1995-02-14 | 1996-04-23 | Nanosystems Llc | Process for preparing therapeutic compositions containing nanoparticles |
| US5543133A (en) * | 1995-02-14 | 1996-08-06 | Nanosystems L.L.C. | Process of preparing x-ray contrast compositions containing nanoparticles |
| US5580579A (en) * | 1995-02-15 | 1996-12-03 | Nano Systems L.L.C. | Site-specific adhesion within the GI tract using nanoparticles stabilized by high molecular weight, linear poly (ethylene oxide) polymers |
| US5718919A (en) * | 1995-02-24 | 1998-02-17 | Nanosystems L.L.C. | Nanoparticles containing the R(-)enantiomer of ibuprofen |
| CA2213638C (en) * | 1995-02-24 | 2004-05-04 | Nanosystems L.L.C. | Aerosols containing nanoparticle dispersions |
| US5747001A (en) * | 1995-02-24 | 1998-05-05 | Nanosystems, L.L.C. | Aerosols containing beclomethazone nanoparticle dispersions |
| US5565188A (en) * | 1995-02-24 | 1996-10-15 | Nanosystems L.L.C. | Polyalkylene block copolymers as surface modifiers for nanoparticles |
| US5525429A (en) * | 1995-03-06 | 1996-06-11 | General Electric Company | Laser shock peening surface enhancement for gas turbine engine high strength rotor alloy repair |
| US5569018A (en) * | 1995-03-06 | 1996-10-29 | General Electric Company | Technique to prevent or divert cracks |
| US5643552A (en) * | 1995-03-09 | 1997-07-01 | Nanosystems L.L.C. | Nanoparticulate diagnostic mixed carbonic anhydrides as x-ray contrast agents for blood pool and lymphatic system imaging |
| US5472683A (en) * | 1995-03-09 | 1995-12-05 | Eastman Kodak Company | Nanoparticulate diagnostic mixed carbamic anhydrides as X-ray contrast agents for blood pool and lymphatic system imaging |
| US5573749A (en) * | 1995-03-09 | 1996-11-12 | Nano Systems L.L.C. | Nanoparticulate diagnostic mixed carboxylic anhydrides as X-ray contrast agents for blood pool and lymphatic system imaging |
| IE80468B1 (en) * | 1995-04-04 | 1998-07-29 | Elan Corp Plc | Controlled release biodegradable nanoparticles containing insulin |
| US6309671B1 (en) * | 1995-04-14 | 2001-10-30 | Inhale Therapeutic Systems | Stable glassy state powder formulations |
| US5521218A (en) * | 1995-05-15 | 1996-05-28 | Nanosystems L.L.C. | Nanoparticulate iodipamide derivatives for use as x-ray contrast agents |
| US5653987A (en) * | 1995-05-16 | 1997-08-05 | Modi; Pankaj | Liquid formulations for proteinic pharmaceuticals |
| US5573750A (en) * | 1995-05-22 | 1996-11-12 | Nanosystems L.L.C. | Diagnostic imaging x-ray contrast agents |
| US5834025A (en) * | 1995-09-29 | 1998-11-10 | Nanosystems L.L.C. | Reduction of intravenously administered nanoparticulate-formulation-induced adverse physiological reactions |
| US5674328A (en) * | 1996-04-26 | 1997-10-07 | General Electric Company | Dry tape covered laser shock peening |
| WO1998035666A1 (en) * | 1997-02-13 | 1998-08-20 | Nanosystems Llc | Formulations of nanoparticle naproxen tablets |
| US6045829A (en) * | 1997-02-13 | 2000-04-04 | Elan Pharma International Limited | Nanocrystalline formulations of human immunodeficiency virus (HIV) protease inhibitors using cellulosic surface stabilizers |
| GB9706195D0 (en) * | 1997-03-25 | 1997-05-14 | Univ London Pharmacy | Particulate drug carriers |
| US5771729A (en) * | 1997-06-30 | 1998-06-30 | General Electric Company | Precision deep peening with mechanical indicator |
| US6281175B1 (en) * | 1997-09-23 | 2001-08-28 | Scimed Life Systems, Inc. | Medical emulsion for lubrication and delivery of drugs |
| CA2306905A1 (en) * | 1997-10-24 | 1999-05-06 | Eli Lilly And Company | Fatty acid-acylated insulin analogs |
| US6144012A (en) * | 1997-11-05 | 2000-11-07 | Lsp Technologies, Inc. | Efficient laser peening |
| US6153225A (en) * | 1998-08-13 | 2000-11-28 | Elan Pharma International Limited | Injectable formulations of nanoparticulate naproxen |
| US6165506A (en) * | 1998-09-04 | 2000-12-26 | Elan Pharma International Ltd. | Solid dose form of nanoparticulate naproxen |
| US6051694A (en) * | 1998-09-17 | 2000-04-18 | Castor; Trevor Percival | Method for size reduction of proteins |
| US8293277B2 (en) * | 1998-10-01 | 2012-10-23 | Alkermes Pharma Ireland Limited | Controlled-release nanoparticulate compositions |
| US6428814B1 (en) * | 1999-10-08 | 2002-08-06 | Elan Pharma International Ltd. | Bioadhesive nanoparticulate compositions having cationic surface stabilizers |
| US6375986B1 (en) * | 2000-09-21 | 2002-04-23 | Elan Pharma International Ltd. | Solid dose nanoparticulate compositions comprising a synergistic combination of a polymeric surface stabilizer and dioctyl sodium sulfosuccinate |
| US7521068B2 (en) * | 1998-11-12 | 2009-04-21 | Elan Pharma International Ltd. | Dry powder aerosols of nanoparticulate drugs |
| US6270806B1 (en) * | 1999-03-03 | 2001-08-07 | Elan Pharma International Limited | Use of peg-derivatized lipids as surface stabilizers for nanoparticulate compositions |
| US6267989B1 (en) * | 1999-03-08 | 2001-07-31 | Klan Pharma International Ltd. | Methods for preventing crystal growth and particle aggregation in nanoparticulate compositions |
| US6223974B1 (en) * | 1999-10-13 | 2001-05-01 | Madhavji A. Unde | Trailing edge stress relief process (TESR) for welds |
| US6465425B1 (en) * | 2000-02-10 | 2002-10-15 | Alkermes Controlled Therapeutics, Inc. | Microencapsulation and sustained release of biologically active acid-stable or free sulfhydryl-containing proteins |
| GB0009773D0 (en) * | 2000-04-19 | 2000-06-07 | Univ Cardiff | Particulate composition |
| US6316029B1 (en) * | 2000-05-18 | 2001-11-13 | Flak Pharma International, Ltd. | Rapidly disintegrating solid oral dosage form |
| CA2348834A1 (en) * | 2000-05-30 | 2001-11-30 | George I Prokopenko | Device for ultrasonic peening of metals |
| CA2420597C (en) * | 2000-08-31 | 2011-05-17 | Rtp Pharma Inc. | Milled particles |
| GB2367028B (en) * | 2000-09-22 | 2004-06-09 | Rolls Royce Plc | Gas turbine engine rotor blades |
-
2002
- 2002-09-19 EP EP02775863A patent/EP1429731B1/en not_active Expired - Lifetime
- 2002-09-19 WO PCT/US2002/029679 patent/WO2003024425A1/en not_active Ceased
- 2002-09-19 ES ES02775863T patent/ES2280582T3/es not_active Expired - Lifetime
- 2002-09-19 DE DE60217367T patent/DE60217367T2/de not_active Expired - Lifetime
- 2002-09-19 AT AT02775863T patent/ATE350013T1/de active
- 2002-09-19 DK DK02775863T patent/DK1429731T3/da active
- 2002-09-19 JP JP2003528522A patent/JP4464129B2/ja not_active Expired - Fee Related
- 2002-09-19 US US10/246,751 patent/US20030095928A1/en not_active Abandoned
- 2002-09-19 CA CA2460867A patent/CA2460867C/en not_active Expired - Fee Related
- 2002-09-19 PT PT02775863T patent/PT1429731E/pt unknown
-
2007
- 2007-01-26 US US11/698,151 patent/US20070122486A1/en not_active Abandoned
- 2007-03-29 CY CY20071100434T patent/CY1106420T1/el unknown
-
2009
- 2009-08-24 JP JP2009193163A patent/JP2010006826A/ja not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| EP1429731B1 (en) | 2007-01-03 |
| US20070122486A1 (en) | 2007-05-31 |
| DK1429731T3 (da) | 2007-05-14 |
| WO2003024425A1 (en) | 2003-03-27 |
| PT1429731E (pt) | 2007-04-30 |
| JP2005511507A (ja) | 2005-04-28 |
| CY1106420T1 (el) | 2011-10-12 |
| CA2460867C (en) | 2011-04-12 |
| JP4464129B2 (ja) | 2010-05-19 |
| US20030095928A1 (en) | 2003-05-22 |
| CA2460867A1 (en) | 2003-03-27 |
| DE60217367D1 (de) | 2007-02-15 |
| ES2280582T3 (es) | 2007-09-16 |
| JP2010006826A (ja) | 2010-01-14 |
| DE60217367T2 (de) | 2007-10-18 |
| EP1429731A1 (en) | 2004-06-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ATE350013T1 (de) | Nanopartikelzusammensetzungen enthaltend insulin | |
| DK1553927T3 (da) | Gel-stabiliserede, nanopartikulære aktivstof-sammensætninger | |
| ATE381317T1 (de) | Nanopartikuläre zusammensetzungen in form festen darreichungen | |
| ATE419835T1 (de) | Nystatin-nanopartikelzusammensetzungen | |
| DE69840495D1 (de) | Darreichungsform, welche rasche dispersionseigenschaften entfaltet, anwendungsverfahren sowie verfahren zur herstellung derselben | |
| EP2258351A3 (en) | Granules containing lansoprazole in large amount | |
| EA200702638A1 (ru) | Стабильная композиция (рецептура) с наночастицами ацетаминофена | |
| ATE238042T1 (de) | Injektierbare formulierungen mit nanopartikulärem naproxen | |
| CA2468916A1 (en) | A stable oxaliplatin solution formulation | |
| HUP0301405A2 (hu) | Fokozott oldékonyságú gyógyhatású komponenseket tartalmazó készítmények | |
| KR960700735A (ko) | 경질 자성 입자를 함유하는 혈액 공급 개선용 제제(preparation for improving the blood supply containing hard magentic particles) | |
| WO2005049091A3 (en) | Antibody-targeted nanoparticulate active agent delivery | |
| ATE318295T1 (de) | Nanopartikuläre zubereitung | |
| EA200301275A1 (ru) | Капсулы для ингаляции | |
| IL157955A0 (en) | Solid pharmaceutical composition comprising 4-cyano-trifluoro-3-(4-fluorophenylsulphonyl)-2-hydroxy-2-methylpropiono-m toluidide and pvp | |
| ATE453382T1 (de) | Pulver zur nasalen verabreichung von wirkstoffen | |
| ATE422155T1 (de) | Nanopartikelzusammensetzungen enthaltend fenofibrat | |
| DE60137362D1 (de) | Nanopartikel bestehend aus einem arzneistoff und copolymeren von vinyl pyrrolidon und vinyl acetat als oberflächenstabilisatoren | |
| CA2535013A1 (en) | Micro-particle fatty acid salt solid dosage formulations for therapeutic agents | |
| DE60310605D1 (de) | Nanoteilchen zur verabreichung von wirkstoffen, verfahren zur herstellung dieser teilchen und diese enthaltende zusammensetzung | |
| SI1433478T1 (sl) | Farmacevtske formulacije za tiroidne hormone in postopki za njihovo pripravo | |
| EA200500387A1 (ru) | Композиции для ингаляции с высоким содержанием лекарственных веществ | |
| ITMI20022549A1 (it) | Composizione quaternaria comprendente come sostanza attiva la propolis. | |
| DE50114335D1 (de) | Lh-rh-antagonisten, deren herstellung und verwendung als arzneimittel | |
| CA2423572A1 (en) | Stabilization of solid thyroid drug formulations |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| UEP | Publication of translation of european patent specification |
Ref document number: 1429731 Country of ref document: EP |