AT248704B - Verfahren zur Herstellung gehärteter Epoxydharze mit hoher Temperaturbeständigkeit - Google Patents
Verfahren zur Herstellung gehärteter Epoxydharze mit hoher TemperaturbeständigkeitInfo
- Publication number
- AT248704B AT248704B AT73764A AT73764A AT248704B AT 248704 B AT248704 B AT 248704B AT 73764 A AT73764 A AT 73764A AT 73764 A AT73764 A AT 73764A AT 248704 B AT248704 B AT 248704B
- Authority
- AT
- Austria
- Prior art keywords
- production
- high temperature
- epoxy resins
- temperature resistance
- hardened epoxy
- Prior art date
Links
- 239000003822 epoxy resin Substances 0.000 title 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 title 1
- 229920000647 polyepoxide Polymers 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/18—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing
- C08G59/20—Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups ; e.g. general methods of curing characterised by the epoxy compounds used
- C08G59/32—Epoxy compounds containing three or more epoxy groups
- C08G59/3236—Heterocylic compounds
- C08G59/3245—Heterocylic compounds containing only nitrogen as a heteroatom
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Epoxy Resins (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE1963H0048118 DE1242879C2 (de) | 1963-01-31 | 1963-01-31 | Verfahren zur herstellung von formkoerpern auf der basis von isocyanursaeureglycidylester-polyaddukten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AT248704B true AT248704B (de) | 1966-08-10 |
Family
ID=7156595
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT73764A AT248704B (de) | 1963-01-31 | 1964-01-30 | Verfahren zur Herstellung gehärteter Epoxydharze mit hoher Temperaturbeständigkeit |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3337509A (enExample) |
| AT (1) | AT248704B (enExample) |
| BE (1) | BE643163A (enExample) |
| CH (1) | CH458747A (enExample) |
| DE (1) | DE1242879C2 (enExample) |
| GB (1) | GB996723A (enExample) |
| NL (2) | NL302361A (enExample) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3324081A (en) * | 1963-12-31 | 1967-06-06 | Gulf Research Development Co | Polyepoxy resin-biaryl anhydride composition |
| US3910908A (en) * | 1965-05-17 | 1975-10-07 | Celanese Coatings Co | Triglycidyl isocyanurate preparation |
| CH459563A (de) * | 1965-09-21 | 1968-07-15 | Ciba Geigy | Epoxyharz-Pressmasse |
| GB1119829A (en) * | 1965-11-08 | 1968-07-17 | Ici Ltd | Adhesive compositions |
| DE1595792B2 (de) * | 1966-02-16 | 1976-04-15 | Henkel & Cie GmbH, 4000 Düsseldorf | Verfahren zur herstellung von gehaerteten epoxidharzen |
| US3404195A (en) * | 1966-04-06 | 1968-10-01 | Henkel & Cie Gmbh | Process for improving the thermal properties of hardened epoxide resins |
| DE1595807B2 (de) * | 1966-08-18 | 1977-03-10 | Henkel & Cie GmbH, 4000 Düsseldorf | Verfahren zur herstellung von pressmassen auf basis von mehr als eine epoxidgruppe im molekuel enthaltenden verbindungen |
| DE1595810B2 (de) * | 1966-11-18 | 1976-12-09 | Henkel & Cie GmbH, 4000 Düsseldorf | Verfahren zur herstellung von haertbaren mischungen auf basis von triglycidylisocyanurat |
| DE1595812B2 (de) * | 1966-11-30 | 1976-09-23 | Henkel & Cie GmbH, 4000 Düsseldorf | Verfahren zur herstellung von innerlich weichgemachten epoxidharzen |
| DE1695172A1 (de) * | 1966-11-30 | 1970-12-10 | Henkel & Cie Gmbh | Verfahren zur Herstellung von modifiziertem Glyeidylisocyanurat |
| DE1595813B2 (de) * | 1966-11-30 | 1976-12-09 | Henkel & Cie GmbH, 4000 Düsseldorf | Verfahren zur herstellung von innerlich weichgemachten epoxidharzen |
| DE1644832C3 (de) * | 1966-11-30 | 1975-11-06 | Henkel & Cie Gmbh, 4000 Duesseldorf | Herstellung von Überzügen, Verklebungen, und VerguBfugen auf Basis von TrIgIy cidylisocyanurat |
| DE1669181B2 (de) * | 1966-12-07 | 1974-02-21 | Henkel & Cie Gmbh, 4000 Duesseldorf | Verfahren zur Herstellung von Bindemitteln auf Basis von Alkalisilikaten |
| US3454570A (en) * | 1966-12-09 | 1969-07-08 | Shell Oil Co | Process for preparing epoxyalkyl derivatives |
| CH488727A (de) * | 1967-06-13 | 1970-04-15 | Ciba Geigy | Verfahren zur Herstellung von Triglycidyl-isocyanurat |
| CH515925A (de) * | 1968-11-21 | 1971-11-30 | Ciba Geigy Ag | Verfahren zur Herstellung neuer B-Methylglycidyl-isocyanurate und ihre Verwendung zur Herstellung härtbarer Massen |
| GB1381262A (en) * | 1970-12-23 | 1975-01-22 | Unilever Ltd | Coating composition |
| DE2328013C3 (de) * | 1973-06-01 | 1982-01-14 | Bayer Ag, 5090 Leverkusen | Pulverförmige Bindemittel |
| JPS54107882A (en) * | 1978-02-13 | 1979-08-24 | Toray Ind Inc | Semipermeable membrane |
| US4195140A (en) * | 1978-02-28 | 1980-03-25 | Lord Corporation | Adhesive-promoting compositions |
| US4327032A (en) * | 1979-01-16 | 1982-04-27 | Ciba-Geigy Corporation | Acicular aluminium salts of carboxylic acids and processes for their preparation |
| IT1123206B (it) * | 1979-09-18 | 1986-04-30 | Montedison Spa | Composizini polimeriche autoestinguenti |
| TWI243169B (en) * | 1998-03-02 | 2005-11-11 | Nissan Chemical Ind Ltd | Optically active epoxy compound |
| TW550263B (en) * | 1998-09-01 | 2003-09-01 | Nissan Chemical Ind Ltd | Method for reducing an organic solvent remaining in tris-(2,3-epoxypropyl)-isocyanurate crystals |
| CN117107236B (zh) * | 2023-10-20 | 2023-12-22 | 山西海诚智能制造有限公司 | 一种中部槽合金涂层及其激光熔覆工艺 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE20185C (de) * | CH. A. W. SCHÖN, General-Konsul in-Hamburg | Neuerungen an Glasschmelzwannen und Glashäfen | ||
| US2741607A (en) * | 1954-02-23 | 1956-04-10 | Shell Dev | Triglycidyl cyanurate and polymers thereof |
| US2809942A (en) * | 1955-10-21 | 1957-10-15 | Devoe & Raynolds Co | Process for making polyglycidyl cyanurates |
| NL218410A (enExample) * | 1956-06-26 | |||
| US3095429A (en) * | 1959-05-19 | 1963-06-25 | Dow Chemical Co | Process for the preparation of crystalline diglycidyl ether of bisphenol a |
-
0
- NL NL128835D patent/NL128835C/xx active
- NL NL302361D patent/NL302361A/xx unknown
-
1963
- 1963-01-31 DE DE1963H0048118 patent/DE1242879C2/de not_active Expired
- 1963-07-03 US US292725A patent/US3337509A/en not_active Expired - Lifetime
- 1963-11-29 GB GB47180/63A patent/GB996723A/en not_active Expired
-
1964
- 1964-01-29 CH CH103164A patent/CH458747A/de unknown
- 1964-01-30 AT AT73764A patent/AT248704B/de active
- 1964-01-30 BE BE643163A patent/BE643163A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL128835C (enExample) | |
| BE643163A (enExample) | 1964-07-30 |
| DE1242879C2 (de) | 1976-01-29 |
| GB996723A (en) | 1965-06-30 |
| CH458747A (de) | 1968-06-30 |
| DE1242879B (de) | 1967-06-22 |
| NL302361A (enExample) | |
| US3337509A (en) | 1967-08-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT248704B (de) | Verfahren zur Herstellung gehärteter Epoxydharze mit hoher Temperaturbeständigkeit | |
| CH445118A (de) | Verfahren zur Herstellung von Gebilden aus Polycarbonatharz mit verbesserter UV-Beständigkeit | |
| AT316141B (de) | Verfahren zur Herstellung von durch Füllstoffe verstärkten Polyamiden | |
| AT259871B (de) | Verfahren zur Herstellung von cyanatgruppenhaltigen Phenolharzen | |
| CH448513A (de) | Verfahren zur Herstellung von geformten Gebilden auf Basis von Epoxydharzen | |
| CH451507A (de) | Harzmasse zur Herstellung von Überzügen | |
| CH472456A (de) | Verfahren zur Herstellung von Epoxydharzen | |
| AT276756B (de) | Verfahren zur Herstellung von silymodifizierten Epoxidharzen | |
| CH411347A (de) | Verfahren zur Herstellung von Epoxydharzkörpern mit erhöhter Warmformbeständigkeit | |
| AT268685B (de) | Verfahren zur Herstellung von gehärteten Epoxydharzen | |
| AT244596B (de) | Verfahren zur Herstellung von gehärteten Harzen | |
| AT275161B (de) | Verfahren zur Herstellung von mit Härtern zu flammwidrigen Form- und Überzugsmassen umsetzbaren Epoxydharzen | |
| CH433767A (de) | Verfahren zur Herstellung von Epoxydharzen | |
| CH461639A (de) | Verfahren zur Herstellung eines elektrolumineszierenden Halbleiterelementes | |
| CH431093A (de) | Verfahren zur Herstellung von Epoxydharzen | |
| AT251290B (de) | Verfahren zur Herstellung von Esterimidharz | |
| CH449262A (de) | Verfahren zur Herstellung härtbarer Kunstharze | |
| AT268684B (de) | Verfahren zur Herstellung von gehärteten Epoxidharzen | |
| AT280603B (de) | Verfahren zur Herstellung von gehärteten Epoxydharzen | |
| AT271024B (de) | Verfahren zur Herstellung von innerlich weichgemachten Epoxydharzen | |
| CH445130A (de) | Verfahren zur Herstellung von Epoxydharzen | |
| CH482772A (de) | Verfahren zur Herstellung von faserverstärkten Harzen | |
| CH475297A (de) | Verfahren zur Herstellung von gehärteten Kunstharzen | |
| CH456633A (de) | Verfahren zur Herstellung von Trioxan | |
| AT314833B (de) | Verfahren zur Herstellung von Epoxyharzen |