US3706768A - Xanthone derivatives - Google Patents
Xanthone derivatives Download PDFInfo
- Publication number
- US3706768A US3706768A US90444A US3706768DA US3706768A US 3706768 A US3706768 A US 3706768A US 90444 A US90444 A US 90444A US 3706768D A US3706768D A US 3706768DA US 3706768 A US3706768 A US 3706768A
- Authority
- US
- United States
- Prior art keywords
- xanthene
- oxo
- acid
- carboxylic acid
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 150000007964 xanthones Chemical class 0.000 title description 5
- -1 CARBOXYL Chemical group 0.000 abstract description 67
- 150000001875 compounds Chemical class 0.000 abstract description 49
- 238000006243 chemical reaction Methods 0.000 abstract description 14
- 150000003839 salts Chemical class 0.000 abstract description 10
- 239000003506 spasmogen Substances 0.000 abstract description 3
- 230000000144 pharmacologic effect Effects 0.000 abstract description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 abstract 4
- YZCKVEUIGOORGS-UHFFFAOYSA-N Hydrogen atom Chemical compound [H] YZCKVEUIGOORGS-UHFFFAOYSA-N 0.000 abstract 3
- 229910052799 carbon Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical group 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 108
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 73
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 72
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 51
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 40
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 33
- 239000002244 precipitate Substances 0.000 description 33
- 239000000203 mixture Substances 0.000 description 31
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- 239000002253 acid Substances 0.000 description 25
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- 229960000583 acetic acid Drugs 0.000 description 20
- 239000000243 solution Substances 0.000 description 20
- 125000004432 carbon atom Chemical group C* 0.000 description 19
- 239000007787 solid Substances 0.000 description 19
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 18
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 16
- 239000001117 sulphuric acid Substances 0.000 description 16
- 235000011149 sulphuric acid Nutrition 0.000 description 16
- 238000002425 crystallisation Methods 0.000 description 14
- 125000000217 alkyl group Chemical group 0.000 description 13
- 150000002825 nitriles Chemical class 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- 238000000034 method Methods 0.000 description 12
- 159000000000 sodium salts Chemical class 0.000 description 12
- JNELGWHKGNBSMD-UHFFFAOYSA-N xanthone Chemical class C1=CC=C2C(=O)C3=CC=CC=C3OC2=C1 JNELGWHKGNBSMD-UHFFFAOYSA-N 0.000 description 11
- CVNOWLNNPYYEOH-UHFFFAOYSA-N 4-cyanophenol Chemical compound OC1=CC=C(C#N)C=C1 CVNOWLNNPYYEOH-UHFFFAOYSA-N 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 10
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 10
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 9
- 239000004480 active ingredient Substances 0.000 description 9
- 229910000027 potassium carbonate Inorganic materials 0.000 description 9
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 8
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 8
- 150000004702 methyl esters Chemical class 0.000 description 8
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 8
- 238000001953 recrystallisation Methods 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- 229910052708 sodium Inorganic materials 0.000 description 8
- 150000002148 esters Chemical class 0.000 description 7
- 239000012362 glacial acetic acid Substances 0.000 description 7
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 6
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 125000003545 alkoxy group Chemical group 0.000 description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 6
- 239000000284 extract Substances 0.000 description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 6
- 229920000137 polyphosphoric acid Polymers 0.000 description 6
- 239000008096 xylene Substances 0.000 description 6
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 5
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 5
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 5
- 239000000443 aerosol Substances 0.000 description 5
- 150000001408 amides Chemical class 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 5
- 125000005843 halogen group Chemical group 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 231100000252 nontoxic Toxicity 0.000 description 5
- 230000003000 nontoxic effect Effects 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 239000001119 stannous chloride Substances 0.000 description 5
- 235000011150 stannous chloride Nutrition 0.000 description 5
- AZWVHAYEMGWPMK-UHFFFAOYSA-N 2-(4-methylphenoxy)-5-nitrobenzoic acid Chemical compound C1=CC(C)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1C(O)=O AZWVHAYEMGWPMK-UHFFFAOYSA-N 0.000 description 4
- UFLPEZUZTHLBJE-UHFFFAOYSA-N 7-methoxy-9-oxoxanthene-2-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(=O)C3=CC(OC)=CC=C3OC2=C1 UFLPEZUZTHLBJE-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 235000019270 ammonium chloride Nutrition 0.000 description 4
- 235000010986 ammonium phosphatide Nutrition 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 125000004663 dialkyl amino group Chemical group 0.000 description 4
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 4
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 4
- 125000004494 ethyl ester group Chemical group 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- AXQFBAXYUXOPRG-UHFFFAOYSA-N 7-amino-9-oxoxanthene-2-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(=O)C3=CC(N)=CC=C3OC2=C1 AXQFBAXYUXOPRG-UHFFFAOYSA-N 0.000 description 3
- AFSYRZQBNVRQSR-UHFFFAOYSA-N 7-nitro-9-oxoxanthene-2-carboxylic acid Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)C3=CC(C(=O)O)=CC=C3OC2=C1 AFSYRZQBNVRQSR-UHFFFAOYSA-N 0.000 description 3
- 239000005711 Benzoic acid Substances 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 235000010233 benzoic acid Nutrition 0.000 description 3
- WXBLLCUINBKULX-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1.OC(=O)C1=CC=CC=C1 WXBLLCUINBKULX-UHFFFAOYSA-N 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 238000006073 displacement reaction Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 3
- 230000020477 pH reduction Effects 0.000 description 3
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 150000003536 tetrazoles Chemical class 0.000 description 3
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 3
- GEVAPOOKLDQPPR-UHFFFAOYSA-N 2-(4-cyanophenoxy)-5-methoxybenzoic acid Chemical compound OC(=O)C1=CC(OC)=CC=C1OC1=CC=C(C#N)C=C1 GEVAPOOKLDQPPR-UHFFFAOYSA-N 0.000 description 2
- MBLOIUMJSZHUQA-UHFFFAOYSA-N 2-(4-cyanophenoxy)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1OC1=CC=C(C#N)C=C1 MBLOIUMJSZHUQA-UHFFFAOYSA-N 0.000 description 2
- ICRVTIMCQKTPDH-UHFFFAOYSA-N 2-(dimethylamino)-7-(2H-tetrazol-5-yl)xanthen-9-one Chemical compound CN(C1=CC=C2OC=3C=CC(=CC3C(C2=C1)=O)C1=NN=NN1)C ICRVTIMCQKTPDH-UHFFFAOYSA-N 0.000 description 2
- YNOPZLWHBMWCPX-UHFFFAOYSA-N 2-chloro-4,5-dinitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=C([N+]([O-])=O)C=C1Cl YNOPZLWHBMWCPX-UHFFFAOYSA-N 0.000 description 2
- QUEKGYQTRJVEQC-UHFFFAOYSA-N 2516-96-3 Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1Cl QUEKGYQTRJVEQC-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- NQZZMMVWNJYZIE-UHFFFAOYSA-N 6,7-dimethoxy-9-oxoxanthene-2-carboxylic acid Chemical compound O1C2=CC=C(C(O)=O)C=C2C(=O)C2=C1C=C(OC)C(OC)=C2 NQZZMMVWNJYZIE-UHFFFAOYSA-N 0.000 description 2
- NADDLRWCPPNNBA-UHFFFAOYSA-N 7-(2-hydroxyethoxy)-9-oxoxanthene-2-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(=O)C3=CC(OCCO)=CC=C3OC2=C1 NADDLRWCPPNNBA-UHFFFAOYSA-N 0.000 description 2
- YSQILULUGGLMCI-UHFFFAOYSA-N 7-(dimethylamino)-9-oxoxanthene-2-carboxylic acid Chemical compound CN(C1=CC=C2OC=3C=CC(=CC3C(C2=C1)=O)C(=O)O)C YSQILULUGGLMCI-UHFFFAOYSA-N 0.000 description 2
- XSJMSVIASUBQJJ-UHFFFAOYSA-N 7-hydroxy-9-oxoxanthene-2-carboxylic acid Chemical compound C1=C(O)C=C2C(=O)C3=CC(C(=O)O)=CC=C3OC2=C1 XSJMSVIASUBQJJ-UHFFFAOYSA-N 0.000 description 2
- VWTBVGHRRPHHLS-UHFFFAOYSA-N 7-methoxy-9-oxoxanthene-2-carboxamide Chemical compound COC1=CC=C2OC=3C=CC(=CC3C(C2=C1)=O)C(=O)N VWTBVGHRRPHHLS-UHFFFAOYSA-N 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 2
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000004703 alkoxides Chemical class 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 239000000427 antigen Substances 0.000 description 2
- 102000036639 antigens Human genes 0.000 description 2
- 108091007433 antigens Proteins 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 229960002887 deanol Drugs 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- LHGVFZTZFXWLCP-UHFFFAOYSA-N guaiacol Chemical compound COC1=CC=CC=C1O LHGVFZTZFXWLCP-UHFFFAOYSA-N 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 150000004682 monohydrates Chemical class 0.000 description 2
- 150000002780 morpholines Chemical class 0.000 description 2
- 150000002828 nitro derivatives Chemical class 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 150000003141 primary amines Chemical class 0.000 description 2
- YPFDHNVEDLHUCE-UHFFFAOYSA-N propane-1,3-diol Chemical compound OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 150000004684 trihydrates Chemical class 0.000 description 2
- 238000010792 warming Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- HVCQSNXTTXPIAD-UHFFFAOYSA-N 1-chloroxanthen-9-one Chemical compound O1C2=CC=CC=C2C(=O)C2=C1C=CC=C2Cl HVCQSNXTTXPIAD-UHFFFAOYSA-N 0.000 description 1
- ATJQWMBNMAOYDQ-UHFFFAOYSA-N 2-(2-methoxyphenoxy)-5-methylbenzoic acid Chemical compound COC1=CC=CC=C1OC1=CC=C(C)C=C1C(O)=O ATJQWMBNMAOYDQ-UHFFFAOYSA-N 0.000 description 1
- XNYUVWDHIMVMAY-UHFFFAOYSA-N 2-(4-cyanophenoxy)-4,5-dimethoxybenzoic acid Chemical compound C(#N)C1=CC=C(OC2=C(C(=O)O)C=C(C(=C2)OC)OC)C=C1 XNYUVWDHIMVMAY-UHFFFAOYSA-N 0.000 description 1
- OEJYXLGGLKTIQG-UHFFFAOYSA-N 2-(4-cyanophenoxy)-4-nitrobenzoic acid Chemical compound OC(=O)C1=CC=C([N+]([O-])=O)C=C1OC1=CC=C(C#N)C=C1 OEJYXLGGLKTIQG-UHFFFAOYSA-N 0.000 description 1
- WGBQSDWPKNFOHJ-UHFFFAOYSA-N 2-(4-cyanophenoxy)-5-nitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1OC1=CC=C(C#N)C=C1 WGBQSDWPKNFOHJ-UHFFFAOYSA-N 0.000 description 1
- QRZWQIKFHYAHFP-UHFFFAOYSA-N 2-(4-methoxyphenoxy)-5-nitrobenzoic acid Chemical compound C1=CC(OC)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1C(O)=O QRZWQIKFHYAHFP-UHFFFAOYSA-N 0.000 description 1
- QHOHOOCXVFEPQA-UHFFFAOYSA-N 2-amino-7-methoxyxanthen-9-one Chemical compound COC1=CC=C2OC=3C=CC(=CC3C(C2=C1)=O)N QHOHOOCXVFEPQA-UHFFFAOYSA-N 0.000 description 1
- ODHJOROUCITYNF-UHFFFAOYSA-N 2-bromo-5-methoxybenzoic acid Chemical compound COC1=CC=C(Br)C(C(O)=O)=C1 ODHJOROUCITYNF-UHFFFAOYSA-N 0.000 description 1
- WDHCRWZNSBIWKL-UHFFFAOYSA-N 2-chloro-4-methoxy-5-nitrobenzoic acid Chemical compound COC1=CC(Cl)=C(C(O)=O)C=C1[N+]([O-])=O WDHCRWZNSBIWKL-UHFFFAOYSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- XXCOTUOKWGZKHS-UHFFFAOYSA-N 2-methoxy-7-nitroxanthen-9-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)C3=CC(OC)=CC=C3OC2=C1 XXCOTUOKWGZKHS-UHFFFAOYSA-N 0.000 description 1
- SLAMLWHELXOEJZ-UHFFFAOYSA-N 2-nitrobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1[N+]([O-])=O SLAMLWHELXOEJZ-UHFFFAOYSA-N 0.000 description 1
- MGQHZZZXJQJBQY-UHFFFAOYSA-N 4-(2-methoxyphenoxy)benzene-1,3-dicarboxylic acid Chemical compound COC1=C(OC2=C(C=C(C(=O)O)C=C2)C(=O)O)C=CC=C1 MGQHZZZXJQJBQY-UHFFFAOYSA-N 0.000 description 1
- AUUHCMOKLLGHTD-UHFFFAOYSA-N 6,7-dimethoxy-9-oxoxanthene-2-carbonitrile Chemical compound COC=1C=C2OC=3C=CC(=CC3C(C2=CC1OC)=O)C#N AUUHCMOKLLGHTD-UHFFFAOYSA-N 0.000 description 1
- XOOZQUXIJSWLBR-UHFFFAOYSA-N 6,7-dimethoxy-9-oxoxanthene-2-carboxamide Chemical compound COC=1C=C2OC=3C=CC(=CC3C(C2=CC1OC)=O)C(=O)N XOOZQUXIJSWLBR-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- KKKRYEUMKMFCBR-UHFFFAOYSA-N 6-methoxy-9-oxoxanthene-2-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(=O)C3=CC=C(OC)C=C3OC2=C1 KKKRYEUMKMFCBR-UHFFFAOYSA-N 0.000 description 1
- KJPBCZGBJXTZBP-UHFFFAOYSA-N 7-(methanesulfonamido)-9-oxoxanthene-2-carboxylic acid Chemical compound CS(=O)(=O)NC1=CC=C2OC=3C=CC(=CC3C(C2=C1)=O)C(=O)O KJPBCZGBJXTZBP-UHFFFAOYSA-N 0.000 description 1
- MDIRFXJLFQTTGN-UHFFFAOYSA-N 7-amino-9-oxoxanthene-2-carbonitrile Chemical compound NC1=CC=C2OC=3C=CC(=CC3C(C2=C1)=O)C#N MDIRFXJLFQTTGN-UHFFFAOYSA-N 0.000 description 1
- VQTMHJSUIGMOLT-UHFFFAOYSA-N 7-chloro-9-oxoxanthene-2-carboxylic acid Chemical compound C1=C(Cl)C=C2C(=O)C3=CC(C(=O)O)=CC=C3OC2=C1 VQTMHJSUIGMOLT-UHFFFAOYSA-N 0.000 description 1
- CEMQGWZVYKCUJI-UHFFFAOYSA-N 7-methoxy-9-oxoxanthene-2-carbonitrile Chemical compound C1=C(C#N)C=C2C(=O)C3=CC(OC)=CC=C3OC2=C1 CEMQGWZVYKCUJI-UHFFFAOYSA-N 0.000 description 1
- ONNWIRVBHUTRCL-UHFFFAOYSA-N 7-nitro-9-oxoxanthene-2-carbonitrile Chemical compound [N+](=O)([O-])C1=CC=C2OC=3C=CC(=CC3C(C2=C1)=O)C#N ONNWIRVBHUTRCL-UHFFFAOYSA-N 0.000 description 1
- AQFFXPQJLZFABJ-UHFFFAOYSA-N 9-oxo-6-propan-2-yloxy-2-xanthenecarboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(=O)C3=CC=C(OC(C)C)C=C3OC2=C1 AQFFXPQJLZFABJ-UHFFFAOYSA-N 0.000 description 1
- NYKPKXPWOWUPJV-UHFFFAOYSA-N 9-oxo-7-propan-2-yloxyxanthene-2-carboxylic acid Chemical compound C1=C(C(O)=O)C=C2C(=O)C3=CC(OC(C)C)=CC=C3OC2=C1 NYKPKXPWOWUPJV-UHFFFAOYSA-N 0.000 description 1
- JNPRWSKMJDGYAN-UHFFFAOYSA-N 9-oxoxanthene-2-carboxylic acid Chemical compound C1=CC=C2C(=O)C3=CC(C(=O)O)=CC=C3OC2=C1 JNPRWSKMJDGYAN-UHFFFAOYSA-N 0.000 description 1
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 1
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 1
- 206010002198 Anaphylactic reaction Diseases 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 201000004624 Dermatitis Diseases 0.000 description 1
- 206010012438 Dermatitis atopic Diseases 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- 208000024780 Urticaria Diseases 0.000 description 1
- PQLVXDKIJBQVDF-UHFFFAOYSA-N acetic acid;hydrate Chemical compound O.CC(O)=O PQLVXDKIJBQVDF-UHFFFAOYSA-N 0.000 description 1
- 150000001335 aliphatic alkanes Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N alpha-methyl toluene Natural products CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 125000005122 aminoalkylamino group Chemical group 0.000 description 1
- 230000036783 anaphylactic response Effects 0.000 description 1
- 208000003455 anaphylaxis Diseases 0.000 description 1
- 230000001387 anti-histamine Effects 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 239000002249 anxiolytic agent Substances 0.000 description 1
- 230000000949 anxiolytic effect Effects 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 201000008937 atopic dermatitis Diseases 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- UAZDIGCOBKKMPU-UHFFFAOYSA-O azanium;azide Chemical compound [NH4+].[N-]=[N+]=[N-] UAZDIGCOBKKMPU-UHFFFAOYSA-O 0.000 description 1
- RTEXIPZMMDUXMR-UHFFFAOYSA-N benzene;ethyl acetate Chemical compound CCOC(C)=O.C1=CC=CC=C1 RTEXIPZMMDUXMR-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229940124630 bronchodilator Drugs 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229960000265 cromoglicic acid Drugs 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- FHHZOYXKOICLGH-UHFFFAOYSA-N dichloromethane;ethanol Chemical compound CCO.ClCCl FHHZOYXKOICLGH-UHFFFAOYSA-N 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- VLARUOGDXDTHEH-UHFFFAOYSA-L disodium cromoglycate Chemical compound [Na+].[Na+].O1C(C([O-])=O)=CC(=O)C2=C1C=CC=C2OCC(O)COC1=CC=CC2=C1C(=O)C=C(C([O-])=O)O2 VLARUOGDXDTHEH-UHFFFAOYSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 208000024711 extrinsic asthma Diseases 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 125000005908 glyceryl ester group Chemical group 0.000 description 1
- 229960001867 guaiacol Drugs 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- LAIZPRYFQUWUBN-UHFFFAOYSA-L nickel chloride hexahydrate Chemical compound O.O.O.O.O.O.[Cl-].[Cl-].[Ni+2] LAIZPRYFQUWUBN-UHFFFAOYSA-L 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000004289 sodium hydrogen sulphite Substances 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- LRCMGVINGKJPDG-UHFFFAOYSA-M sodium;7-(2-hydroxyethoxy)-9-oxoxanthene-2-carboxylate Chemical compound [Na+].C1=C(C([O-])=O)C=C2C(=O)C3=CC(OCCO)=CC=C3OC2=C1 LRCMGVINGKJPDG-UHFFFAOYSA-M 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000003204 tranquilizing agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/78—Ring systems having three or more relevant rings
- C07D311/80—Dibenzopyrans; Hydrogenated dibenzopyrans
- C07D311/82—Xanthenes
- C07D311/84—Xanthenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 9
- C07D311/86—Oxygen atoms, e.g. xanthones
Definitions
- X represents a carboxyl or 5-[lH1-tetrazolyl group; and R and R which may be the same or different each represent a hydrogen atom, an alkyl group containing from 1 to 4 carbon atoms, a nitro group, a halogen atom or a group of the formula -NR R or 0R or NR SO R (in which the groups R and R; which may be the same or different each represent a hydrogen atom, a phenyl group, a benzyl group or an alkyl group'which may optionally be substituted by an alkoxy group containing from 1 to 6 carbon atoms, a phenoxy group, phenyl group, an amino, alkylamino or dialkylamino group or by one or more hydroxy groups; and in which R, is a hydrogen atom or an alkyl group containing from 1 to 6 carbon atoms and R is an alkyl group containing from 1 to 6 carbon atoms); with the proviso that when X represents
- R and R which may be the same or different each represent a hydrogen atom, an alkyl group containing from 1 to 4 carbon atoms, a nitro group, a halogen atom or a group of the formula NR R or 0R or NR SO R (in which the groups R and R, which may be the same or different each represent a hydrogen atom, a phenyl group, a benzyl group or an alkyl group which may optionally be substituted by an alkoxy group containing from 1 to 6 carbon atoms, a phenoxy group, phenyl group, an amino alkylamino or dialkylamino group or by one of more hydroxy groups; and in which R is a hydrogen atom or an alkyl group containing from 1 to 6 carbon atoms and R is an alkyl group containing from 1 to 6 carbon atoms
- non-toxic salts according to the invention may for example be salts of the group X with alkali metals, e.g. sodium, or with organic bases, for example dimethylaminoethanol and morpholine. Where R or R contain basic substituents the invention also provides non-toxic salts with acids, e.g. hydrochlorides.
- esters of the carboxylic acid function for example those with lower alkanols and glycerol.
- R, or R represent alkyl are preferably those in which the alkyl groups contain from 1 to 4 carbon atoms.
- R, or R represent NR R OR or NR SO R and R R R and R represent alkyl groups these are preferably ones which contain from 1 to 4 carbon atoms.
- 6-phenoxy-9-oxo-xanthene-2-carboxylic acid 6-benzyloxy-9-oxo-xanthene-2-carboxylic acid. 6-methoxy-7-nitro-9-oXo-xanthene-2-carboxylic acid. 5-methoXy-9-oXo-xanthene-Z-carboxylic acid. 7-methyl-9-oxo-xanthene-2-carboxylic acid. 6,7-dimethoxy-9-oxo-xanthene-2-carboxylic acid. 7-methoXy-9-oxo-xanthene-2-carboxylic acid and sodium salt.
- the xanthone derivatives according to the invention have been shown to inhibit release of spasmogens from antigen-antibody reactions such as occur in the rat during the PCA (passive cutaneous anaphylaxis) test described by Ogilvie (J. Immunol., 1967, 12, (2), 113).
- PCA passive cutaneous anaphylaxis
- Ogilvie J. Immunol., 1967, 12, (2), 113.
- the compound of Example 24 when given intravenously was about 5-7 times more potent than sodium cromoglycate in inhibiting the PCA reaction in sensitised rats challenged with Nippostrongylis brasiliensis as antigen.
- extrinsic antigen combination with a reaginic antibody is primarily responsible, for example extrinsic asthma, hay fever, urticaria, eczema or atopic dermatitis.
- compositions which contain a xanthone derivative of general Formula I or a salt or ester thereof together with a pharmaceutically acceptable carrier, excipient or other formulatory agent.
- the compositions may also contain supplementary medicinal agents, e.g. a bronchodilator, antihistamine, tranquilliser or anxio lytic.
- supplementary medicinal agents e.g. a bronchodilator, antihistamine, tranquilliser or anxio lytic.
- forms for oral administration include tablets, capsules, syrups or emulsions.
- compositions according to the invention may be in the form of a powder or snuff or as an aerosol spray presentation.
- the last may conveniently be a pressurised pack with a metering valve to deliver a fixed dosage unit or may be an aqueous solution that may be delivered via a nebuliser device.
- the dosage at which the active ingredient is administered may vary within a wide range.
- a suitable oral dosage range is generally from 20-1500 mg. and for inhalation is from 1-20 mg.
- the invention also provides a process for the preparation of compounds of Formula I in which acids of general Formula II are cyclised to xanthones of general Formula 111 where R R and Z may be the groups R7 CO H R7 R R and X of Formula I as herein defined or are groups that can be subsequently converted thereto by standard methods of chemistry well known to those skilled in the art, e.g. Z may be a methyl group which can then be oxidised to the carboxylic acid, or may be a nitrile which can be hydrolysed to the acid or can be converted into the -[lH]-tetrazolyl function.
- the cyclisation may be effected by heating with condensing agents such as sulphuric acid, phosphorus oxychloride, or polyphosphoric acid PPA), for example at temperatures between 60 and 100".
- condensing agents such as sulphuric acid, phosphorus oxychloride, or polyphosphoric acid PPA
- Z represents a nitrile group this is converted by -PPA under the cyclisation conditions into an amide and by sulphuric acid into a mixture of the amide and the acid.
- the amide can then be hydrolysed to the carboxylic acid with mineral acids or with alkali or it may be reconverted into the nitrile with dehydrating agents, e.g. by warming with tosyl chloride and pyridine in dimethylformamide.
- Conversion of compounds where Z represents a nitrile function into those where Z represents a 5-[1H]-tetrazolyl group can be effected by treatment with hydrazoic acid or its salts.
- the reaction can conveniently be carried out with sodium or ammonium azide in an inert solvent, e.g. dimethylforrnamide, which may be warmed to about 100 C.
- the intermediates of general Formula II may be prepared by an Ullman reaction of the halo acid (IV) and a phenol (V).
- COzH -Z Hal HO Hal represents a halogen atom, e.g. chlorine or bromine.
- the reaction can conveniently be carried out in the presence of an alkali metal carbonate such as potassium carbonate, cuprous iodide, and copper bronze at elevated temperatures, e.g. between and 180 C.
- alkali metal carbonate such as potassium carbonate, cuprous iodide, and copper bronze
- Inert highboiling solvents such as xylene or nitrobenzene may also be present.
- Compounds of general Formula I wherein R and/or R represent amino groups may be prepared by reduction of the corresponding nitro compounds with, for example stannous chloride.
- X is a protected carboxyl group, for example the group CO CH
- the compounds of general Formula I in which R represents the group NHSO R may be prepared by reaction of the appropriate amine with a suitable sulphonyl chloride, for example methane sulphonyl chloride. Further alkylation may be effected with a suitable alkylating agent, for example dimethylsulphate.
- R, and/or R represent a group 0R
- R in the group OR represents an alkyl radical substituted with hydroxyl such radical may be provided by reaction of the corresponding compound in which R, and/or R represent OH with an alkylene oxide in particular ethylene oxide.
- the compound in which R and/or R represent OH may be prepared from its corresponding compound in which R and/or R represent OCH by heating with hydrogen bromide in acetic acid or aluminum chloride in xylene.
- EXAMPLE 1 7-nitro-9-oxo-xanthene-2-carboxylic acid 2-chloro-5-nitro-benzoic acid (20 g.), p-cresol (20 g.), anhydrous potassium carbonate (1.4 g.), copper bronze (0.2 g.), and cuprous iodide (0.2 g.) were ground together and heated for 1 hour at -175". The mixture was cooled, triturated with water, and filtered. The filtrate was acidified with dilute hydrchloric acid and the precipitate was recrystallised from aqueous methanol (1:1) to give 5-nitro-2-(p-tolyloxy)-benzoic acid (5 g.), M.P. 166-167".
- EXAMPLE 4 6-methoxy-9-oxo-xanthene-2-carboxylic acid 6-nitro-9-oXo-xanthene-2-carboxylic acid (1 g.) from Example 3 in dimethylformamide ml.) was heated at 8090 for 1.75 hours with sodium methoxide [from sodium (0.25 g.) and methanol (10.5 ml.)] and then poured onto ice (300 g.) and extracted with ethyl acetate (350 ml.). The aqueous phase was acidified with concentrated hydrochloric acid and chilled. The bufl precipitate was filtered ofl" and recrystallised from glacial acetic acid to give 6-methoxy-9-oxo-xanthene-Z-carboxylic acid (0.45 g.), M.P. 331334.
- 6-substituted-9-oxo-xanthene-2-carboxylic acids were prepared from the 6-nitro compound as described above by displacement with the appropriate alkoxide M.P. C. 6-propoxy- 285 6-(2-hydroxyethoxy)- 280 6- 2-hydroxypropoxy 240 6-(2-methoxyethoxy)- 260 6-(2-dimethylaminoethoxy)- 1 286 6-(isopropoxy)- 273 6- [2 (2-hydroxyethoxy)ethoxy1- 235 6-(2-phenoxyethoxy)- 287 6-(2-phenylethoxy)- 230 6-phenoxy- 198-201 6-benzyloxy- 291-293 1 Hydrochloride.
- 6-methoxy-7-nitro 9 oxo-xanthene 2 carbonitrile (2.093 g.) was suspended in a solution of glacial acetic acid (20 ml.), water (220 ml.) and concentrated sulphuric acid (20 ml.) and the mixture was boiled under reflux for 6 hours. During this period the product separated as a white solid. Water (100 ml.) was added and the precipitated solid was collected, washed well with water and dried, M.P. 345.6-346 C. (dec.) (2.012 g.). Recrystallisation from dimethylformamide aflorded fine needles, M.P. 341343 (dec.) (1.863 g.).
- EXAMPLE 6 5-methoxy-9-oxo-xanthene-2-carboxylic acid 2-chloro-S-methyl-benzoic acid (9.2 g.), 2-methoxyphenol (7.57 g.), copper bronze (l g.) were added to methanolic sodium methoxide [from sodium (2.78 g.) and methanol (50 ml.)]. The solvent was removed and the residue was placed in an oil bath at 140. The temperature was then raised to 185, nitrobenzene (25 ml.) added, and heating continued for 1.5 hours. The cooled mixture was treated with an excess of aqueous potassium carbonate and extracted with ether.
- EXAMPLE 7 7-methyl-9-oxo-xanthene-2-carboxylic acid 2-(4-cyano-phenoxy)-5-methylbenzoic acid, M.P. 172, was obtained from 2-chloro-S-methyl-benzoic acid and 4- hydroxybenzonitrile using the method described in Example 6 for the preparation of 2-(2-methoxy-phenoxy)- S-methylbenzoic acid.
- the cyano acid (4.7 g.) was refluxed for 1.5 hours with sulphuric acid (47 ml.), acetic acid (47 ml.), and water (47 ml.). The mixture was poured into water to give a precipitate of 5-methyl-2,4'-oxydibenzoic acid (4.5 g.), M.P. 263.
- This di-acid (4.3 g.) was stirred at 90-100 for 2.5 hours with polyphosphoric acid (57.3 g.) and then treated with water (50 ml.). The precipitate was washed with water and recrystallised from ethanol and then from acetone to give 7-methyl-9-oxo-xanthene-Z-carboxylic acid (0.9 g.), M.P. 298 C.
- EXAMPLE 8 6,7-dimethoxy-9-oxo-xanthene-Z-carboxylic acid 2-(4-cyanophenoxy)-4,5-dimethoxy-benzoic acid, M.P. 254-5 C., was prepared from the Ullman reaction between 2-bromo-4,S-dimethoxybenzoic acid and 4-hydroxy benzonitrile using the conditions described in Example 6 for the synthesis of 2-(2-methoxyphenoxy)-5-methyl-benzoic acid.
- the cyano-acid (1 g.) was heated at 90-100 for 25.5 hours with polyphosphoric acid (6 g.) and then poured onto ice. The precipitate was recrystallised from acetic acid to give 6,7-dimethoxy-9-oxo-xanthene-Z-carboxamide (0.95 g.), M.P. 2l9-222 C.
- EXAMPLE 9 7-methoxy-9-oxo-xanthene-Z-carboxylic acid
- 2-chloro-5-nitro-benzoic acid (156 g.) in n-pentanol (600 ml.) and p-methoxyphenol (110 g.) were refluxed with stirring for 4 hours with anhydrous potassium carbonate (240 g.), copper bronze (0.8 g.) and cuprous iodide (0.8 g.).
- the cooled mixture was treated with ether and water and the aqueous phase was further extracted with ether and then acidified with dilute hydrochloric acid.
- This acid (75 g.) was cyclised with sulphuric acid by the method described in Example 1 for 5-nitro-2-(p-tolyloxy)-benzoic acid, to give 7-methoxy-2-nitro-xanthone (37.2 g.), M.P. 211-2l2.5 C. after crystallisation from ethyl acetate/ methanol.
- This amine (1.8 g.), suspended in concentrated hydrochloric acid (5 ml.) and water (10 ml.), was treated dropwise at below 5 C. with 10% sodium nitrite (5 ml.). After ten minutes the mixture was added to a vigorously boiling solution of nickel chloride hexahydrate (3 g.) and sodium cyanide (3 g.) in water (30 ml.). After 0.5 hour reflux, the mixture was cooled and filtered. The filter cake was washed well with water and then refluxed for 5 hours with sulphuric acid (25 ml.), acetic acid (25 ml.) and water (25 ml.). The mixture was poured into water and filtered.
- Method B 2-bromo-5-methoxybenzoic acid (924 g.), potassium carbonate (818 g.), copper bronze (16 g.), cuprous iodide (16 g.), and xylene (4 l.) were stirred at and 4-hydroxybenzonitrile (476 g.) was added over 10 minutes. The temperature was raised to C. for 3 hours during which time an azeotrope of water (200 ml.) and xylene was collected. The mixture was cooled to 100 C. and water (3 l.) was added. After filtration through Hyflo the xylene layer was washed with water (2 l.). The combined aqueous phases were slowly added to vigorously stirred concentrated hydrochloric acid 1200 ml.).
- Method C 2 (4 cyanophenoxy)-5-methoxy-benzoic acid (400 g.) (Method B above) and polyphosphoric acid g.) was heated for 2 hours at 90-100 C. Acetic acid (150 ml.) was added and the mixture poured into water (4 1.), keeping the temperatures below 45 C. The solid was washed well with water and then with ethanol and dried at 60 to give 7-methoxy-9-oxo-xanthene-2-car boxamide (358 g.), M.P. 280-290 C. crystallisation from aqueous acetic acid gave material M.P. 301-3 C.
- This nitrile (0.42 g.) was hydrolysed with watersulphuric acid-acetic acid, as described in Example 3 for 6-nitro-9-oxo-xanthene-Z-carboxylic acid, to give 7-dimethylamino-9-oxo-xanthene-2-carboxylic acid (0.37 g.), M.P. 280-281.5 C., after crystallisation from ethanol.
- EXAMPLE 12 7-hydroxy-9-oxo-xanthene-2-carboxylic acid 7-methoxy-9-oxo-xanthene-2-carboxylic acid (0.6 g.), aluminum chloride (2.4 g.) and xylene (20 ml.) were heated at 65-75 C. for 5 hours and poured onto crushed ice (50 g.) and concentrated hydrochloric acid (15 ml.). The precipitate was filtered off, taken up in 8% sodium bicarbonate, refiltered and recovered by acidification with hydrochloric acid. The product was extracted into ethyl acetate and the extracts were washed and evaporated. Crystallisation of the residue from ethyl acetate gave 7- hydroxy-9-oxo-xanthene-Z-carboxylic acid (0.2 g.), M.P. 349 C. (d).
- EXAMPLE 13 7-amino-9-oxo-xanthene-2-carboxylic acid methyl ester 7-amino-9-oxo-xanthene-2 carboxylic acid, hydrochloride (12.2 g.), from Example 2, was refluxed for 16 hours in methanol (1600 ml.) and sulphuric acid (61 m1.) and then poured onto crushed ice. The precipitate was filtered 01f, triturated with 2 N sodium hydroxide, refiltered, and dried to give the methyl ester (9.4 g.),
- EXAMPLE 14 7-methanesulphonamido-9-oxo-xanthene-2-carboxylic acid 7-amino-9-oxo-xanthene-2 carboxylic acid, methyl ester (4 g.), from Example 13, pyridine (150 ml.), and methanesulphonyl chloride (1.28 ml.) were stirred for 6 days at room temperature and then for 24 hours at 40 C. A further portion (1.05 ml.) of methanesulphonyl chloride was added and heating continued for 5.5 hours.
- EXAMPLE 15 7-dimethylamino-6-methoxy-9-oxo-xanthene-2- carboxylic acid 2 chloro 4 rnethoxy 5 nitro-benzoic acid (10 g.) and 4-hydroxybenzonitrile (11.6 g.) were condensed, using the method described in Example 1 for 5-nitro-2- (p-tolyloxy)benzoic acid, to give 2-(4-cyanophenoxy)-4- methoxy-S-nitrobenzoic acid (7.25 g.), M.P. 216-219", after crystallisation from aqueous ethanol.
- This acid (2 g.) was cyclised with phosphorus oxychloride as described in Example 3 for 6-nitro-9-oxoxanthene 2 carbonitrile, to give 6-methoxy-7-nitro-9- oxo-xanthene 2 carbonitrile (1.7 g.), M.P. 339-340 C. (d), after crystallisation from dimethylformamide.
- This amine (2 g.) was treated with formic acid and Formalin as described in Example 10 for 7-dimeth'ylamino-9-oxo-xanthene-Z-carbonitrile.
- the reaction solution was concentrated and the precipitate was purified by elution from a column of alumina with 5-10% ethyl acetate/benzene to give 7-dimethylamino-6-methoxy-9- oxo-xanthene-Z-carbonitrile (0.94 g.), M.P. 224-7 C., after crystallisation from methylene chloride ethanol.
- EXAMPLE 16 7-isopropoxy-9-oxo-xanthene-2-carboxylic acid 7 hydroxy 9 oxo-xanthene-2-carboxylic acid (7 g.) from Example 12 in dry ethanol (700 ml.) was refiuxed for 5 hours with dry hydrogen chloride, then cooled, and diluted with water (110 ml.). The precipitate was crystallised from ethanol to give the ethyl ester (4 g.), M.P. 230 C.
- This ester (0.5 g.) and sodium hydride (50% dispersion in oil) (0.3 g.) were stirred in dimethylforrnamide for ten minutes and isopropyl iodide (3 ml.) was added. After a further ten minutes the excess of hydride was decomposed with water and the solution was allowed to stand for 1 hour. The mixture was acidified and the precipitate was crystallised from ethanol to give 7-isopr0p0xy-9-oxoxanthene 2 carboxylic acid (0.22 g.), M.P. 269-270 C.
- EXAMPLE 17 7-(2-hydroxyethoxy)-9-oxo-xanthene-2-carboxylic acid 7 hydroxy 9 oxo-xanthene 2 carboxylic acid, ethyl ester (1 g.), from Example 16, dimethylformamide (10 ml.), ethylene oxide (5 ml.), and pyridine (one drop) were heated in a sealed tube at for 116 hours and then poured into water. The precipitate was refluxed for 2 hours with sodium hydroxide (l g.) ethanol (250 ml.), and water (10 ml.) and the solution was cooled and acidified. The solid was crystallised from ethanol to give 7 (2 hydroxyethoxy) 9 oxo-xanthene-Z-carboxylic acid (0.19 g.), M.P. 263-265 C.
- EXAMPLE 1'8 7-chloro-9-oxo-xanthene-2-carboxylic acid 2,5-dichlorobenzoic acid (23.5 g.), potassium carbonate (23 g.), cuprous iodide (0.1 g.), copper bronze (0.1 g.), 4 hydroxybenzonitrile (21.6 g.), and nitrobenzene (105 ml.) were heated at 160 for 12 hours.
- the mixture was diluted with water and ether and the organic phase was extracted with 2N sodium hydroxide.
- the alkaline extracts were acidified with hydrochloric acid and the oil that separated was allowed to stand until the unchanged 4 hydroxybenzonitrile crystallised, leaving the crude 5-chloro-2-(4-cyanophenoxy)-benzoic acid.
- the crude acid was cyclised with polyphosph-oric acid, as described in Example 9, Method C, for 7-mcthoxy- 9-oxo-xanthene-2-carboxamide, to give crude 7-chloro- 9 oxo-xanthene 2 carboxamide which was used in the next stage.
- the 6-chl0ro compound may be prepared in a similar manner M.P. 164.8 C.
- EXAMPLE 22 7-dimethylamino-2-( lH-tetrazol-S-yl -xanthone 7 dimethylamino-9-oxo-xanthene-2-carbonitrile (0.24 g.) (Example 10), sodium azide (0.06 g.), ammonium chloride (0.05 g.) and dimethylformamide (4 ml.) were heated at 100 for 40 hours and then evaporated to dryness. The residue was taken up in warm dilute sodium bicarbonate and filtered. The filtrate was acidified with concentrated hydrochloric acid and cooled to 0 C.
- nitrile 0.5 g. was treated with sodium azide, as described in Example 22 for 7-dimethylamino-2-(IH-tetrazol-5-yl)-xanthone, to give 6,7-dimethoxy2-(lH-tetrazol-5-yl) xanthone (0.38 g.), M.P. 300, after crystallisation from aqueous dimethylformamide.
- EXAMPLE 24 7-methoxy-2-( 1H-tetrazol-5 -yl) -xanthone 7-methoxy-9-oxo-xanthene-2-carboxamide (285 g.) (Example 9, Method C), tosyl chloride (304 g.), pyridine (1150 ml.), and dimethylformamide (1150 ml.) were heated at 100 for hours and then poured onto crushed ice (3 kg.). The slurry was acidified with concentrated hydrochloric acid. The precipitate was washed with water (2X 1 l.) and dried at 50 C. Crystallisation from dimethylformamide gave 7-methoxy-9-oxo-xanthene-2-carbonitrile (202 g.), M.P. 255-8 C.
- the tetrazole (127.5 g.) was dissolved in water (450 ml.) containing morpholine (39.5 g.) by warming on the steam bath. Acetone (500 ml.) was added and the solid that crystallised was washed with acetone and dried to give the tetrazole, morpholine salt (99 g.), M.P. 285-8 C.
- EXAMPLE 25 Mg. Active ingredient sodium salt, monohydrate 2.25 Emulsifier YN 0.075 Propellant 11 23.10 Propellant 12 59.30
- the active ingredient sodium salt is micronised and mixed with the propellant 11 together with the Emulsifier YN.
- the required quantity of this suspension is filled into an aerosol can and a suitable metering valve crimped in place.
- the propellant 12 is filled into the can through the valve.
- Example 26 Capsules: To prepare 5,000 capsules each containing mg. of the compound of Example 9 (active ingredient).
- Aerosols An inhalation aerosol may be prepared containing in each metered dose 2 mg. of active ingredient made to the following formula:
- the active ingredient sodium salt is micronised and mixed with the propellant 11 together with the Emulsifier YN.
- the required quantity of this suspension is filled into an aerosol can and a suitable metering valve crimped in place.
- the propellant 12 is filled into the can through the valve.
- R and R are each H; alkyl of 1 to 4 C atoms; nitro; halo; hydroxy; phenoxy; alkoxy of 1 to 4 C atoms; alkoxy of l to 4 C atoms substituted by hydroxy, alkoxy of 1 to 6 C atoms, Z-hydroxyethoxy, phenoxy, phenyl or dialkylamino in which each alkyl radical is of 1 to 4 C atoms; monoalkylamino of 1 to 4 C atoms; dialkylamino in which each alkyl radical is of 1 to 4 C atoms; alkanesulphonoamido of 1 to 6 C atoms or N-alkyl-substituted alkanesulphonamido in which the N-alkyl substituent and alkane moiety are of 1 to 6 C atoms, at least one of R and R being other than H or a pharmaceutically acceptable non-toxic
- a compound as claimed in claim 1 which is 7-nitro- 9-oxo-xanthene-Z-carboxylic acid.
- a compound as claimed in claim 1 which is 6-nitro- 9-oxo-xanthene-Z-carboxylic acid.
- a compound as claimed in claim 1 which is 6-methoxy-9-oxo-xanthene-2-carboxylic acid.
- a compound as claimed in claim 1 which is 6-propoxy-9-oxo-xanthene-2-carboxylic acid.
- a compound as claimed in claim 1 which is 6-(2- hydroxyethoxy)-9-oxo-xanthene-2-carboxylic acid.
- a compound as claimed in claim 1 which is 6-(2- hydroxypropoxy)-9-oxo-xanthene-2-carboxylic acid.
- a compound as claimed in claim 1 which is 6-(2- methoxyethoxy)-9-oxo-xanthene-Z-carboxylic acid.
- a compound as claimed in claim 1 which is 6-(2-dimethylaminoethoxy)-9-oxo-xanthene 2 carboxylic acid, hydrochloride.
- a compound as claimed in claim 1 which is 6-(isopropoxy)-9-oxo-xanthene-2-carboxylic acid.
- a compound as claimed in claim 1 which is 6-[2 (2 hydroxyethoxy)ethoxy]-9-oxo-xanthene-2-carboxylic acid.
- a compound as claimed in claim 1 which is 6-(2- phenoxyethoxy)-9-oxo-xanthene-2-carboxylic acid.
- a compound as claimed in claim 1 which is 6-(2- phenylethoxy)-9-oxo-xanthene-2-carboxylic acid.
- a compound as claimed in claim 1 which is 6- phenoxy-9-oxo-xanthene-Z-carboxylic acid.
- a compound as claimed in claim 1 which is 6-benzyloxy-9-oxo-xanthene-2-carboxylic acid.
- a compound as claimed in claim 1 which is 6-methoxy-7-nitro-9-oxo-xanthene-2-carboxylic acid.
- a compound as claimed in claim 1 which is S-methoxy-9-oxo-xanthene-2-carboxylic acid.
- a compound as claimed in claim 1 which is 7-methyl-9-oxo-xanthene-2-carboxylic acid.
- a compound as claimed in claim 1 which is 6,7- dimethoxy-9-oxo-xanthene-Z-carboxylic acid.
- a compound as claimed in claim 1 which is 7-methoxy-9-oxo-xanthene-2-carboxylic acid or its sodium salt.
- a compound as claimed in claim 1 which is 7-dimethylamino-9-oxo-xanthene-Z-carboxylic acid.
- a compound as claimed in claim 1 which is 7-(N- methylamino)-9-oxo-xanthene-2-carboxylic acid.
- a compound as claimed in claim 1 which is 7-hydroxy-9-oxo-xanthene-2-carboxylic acid or its ethyl ester.
- a compound as claimed in claim 1 which is 7- methanesulphonamido 9 oxo xanthene 2 carboxylic acid or its methyl ester.
- a compound as claimed in claim 1 which is 7-dimethylamino-G-methoxy 9 oxo xanthene-Z-carboxylic acid.
- a compound as claimed in claim 1 which is 7-isopropoxy-9-oxo-xanthene-Z-carboxylic acid.
- a compound as claimed in claim 1 which is 7-(2- References Cited hydroxyethoxy)-9-oxo-xanthene-Z-carboxylic acid.
- a compound as claimed in claim 1 which is 6-ch10- 5 Chemlcal Abstracts 33 (1939), P- 8025' ro-9-oxo-xanthene-Z-carboxylic acid.
- a compound as claimed in claim 1 which is 7-(N- NORMA MILESTONE Pnmary Exammer ggaglyglc-gigianesulphonamido)-9-oxo-xanthene 2 car- Us. cl XR' 31.
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5812169 | 1969-11-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US3706768A true US3706768A (en) | 1972-12-19 |
Family
ID=10480814
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US90444A Expired - Lifetime US3706768A (en) | 1969-11-27 | 1970-11-17 | Xanthone derivatives |
| US00232954A Expired - Lifetime US3755319A (en) | 1969-11-27 | 1972-03-08 | Xanthone derivatives |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US00232954A Expired - Lifetime US3755319A (en) | 1969-11-27 | 1972-03-08 | Xanthone derivatives |
Country Status (21)
| Country | Link |
|---|---|
| US (2) | US3706768A (th) |
| AT (1) | AT304547B (th) |
| BE (1) | BE759292A (th) |
| CA (1) | CA930743A (th) |
| CH (1) | CH557347A (th) |
| CS (1) | CS172918B4 (th) |
| DE (1) | DE2058295C3 (th) |
| DK (1) | DK130740B (th) |
| ES (1) | ES385927A1 (th) |
| FI (1) | FI56005C (th) |
| FR (1) | FR2073425B1 (th) |
| GB (1) | GB1312620A (th) |
| HU (1) | HU162579B (th) |
| IE (1) | IE34720B1 (th) |
| IL (1) | IL35668A (th) |
| NL (1) | NL7017336A (th) |
| NO (1) | NO133367C (th) |
| PH (1) | PH11097A (th) |
| PL (1) | PL81223B1 (th) |
| SE (1) | SE382459B (th) |
| ZA (1) | ZA707727B (th) |
Cited By (53)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3818040A (en) * | 1972-09-25 | 1974-06-18 | Syntex Corp | Alkenyl and alkynyl substituted xanthone carboxylic acid compounds |
| US3818042A (en) * | 1972-01-12 | 1974-06-18 | Syntex Inc | Xanthone carboxylic acids and derivatives |
| US3835157A (en) * | 1972-05-17 | 1974-09-10 | Syntex Inc | Heterocyclic substituted xanthone carboxylic acid compounds |
| US3859442A (en) * | 1971-08-23 | 1975-01-07 | Syntex Inc | A method of inhibiting symptoms of asthma |
| US3867407A (en) * | 1971-08-23 | 1975-02-18 | Jurg R Pfister | Substituted xanthone carboxylic acid compounds |
| US3873714A (en) * | 1971-07-14 | 1975-03-25 | Syntex Inc | Xanthone carboxylic acids and derivatives |
| US3879411A (en) * | 1971-07-23 | 1975-04-22 | Fisons Ltd | Ditetrazolyl-benzodipyrans |
| US3885038A (en) * | 1971-08-23 | 1975-05-20 | Syntex Inc | Method of using substituted xanthone carboxylic acid |
| US3886181A (en) * | 1972-01-12 | 1975-05-27 | Syntex Inc | Disubstituted xanthone carboxylic acid compounds |
| US3887574A (en) * | 1971-10-08 | 1975-06-03 | Allen & Hanburys Ltd | Carboxamido tetrazolo chromones |
| US3891766A (en) * | 1971-08-23 | 1975-06-24 | Syntex Inc | Methods of using substituted xanthone carboxylic acid compounds |
| US3894049A (en) * | 1972-06-05 | 1975-07-08 | Syntex Inc | Disubstituted xanthone carboxylic acid compounds |
| US3904647A (en) * | 1972-07-19 | 1975-09-09 | Syntex Inc | Thioxanthone carboxylic acids and derivatives |
| US3905989A (en) * | 1972-05-19 | 1975-09-16 | Burroughs Wellcome Co | (Tetrazolyl)thioxanthone-10,10-dioxides |
| US3910957A (en) * | 1972-06-05 | 1975-10-07 | Syntex Inc | Xanthone carboxylic acids and derivatives |
| US3920826A (en) * | 1974-07-01 | 1975-11-18 | American Home Prod | Method of treating antiarrhythmic activity with bis(2-(dialkylamino)ethoxy)xanthen-9-one antiarrhythmic agents |
| US3928379A (en) * | 1972-03-03 | 1975-12-23 | Mead Johnson & Co | N-phenyl amidines |
| US3933845A (en) * | 1970-08-26 | 1976-01-20 | Fisons Limited | Benzopyranyltetrazoles |
| US3939276A (en) * | 1972-09-07 | 1976-02-17 | Burroughs Wellcome Co. | Cyclic carbonyl compounds |
| US3949084A (en) * | 1972-03-03 | 1976-04-06 | Syntex (U.S.A.) Inc. | Novel substituted xanthone carboxylic acid compounds |
| US3950342A (en) * | 1971-09-08 | 1976-04-13 | Burroughs Wellcome Co. | Acridone-dicarboxylic acids |
| US3951618A (en) * | 1974-03-12 | 1976-04-20 | Syntex (U.S.A.) Inc. | Method of use of, and compositions containing, disubstituted xanthone carboxylic acid compounds |
| US3959482A (en) * | 1971-09-08 | 1976-05-25 | Burroughs Wellcome Co. | Fluorenone carboxylic acids for the prevention of the symptoms of asthma and allergin rhinitis |
| US3963752A (en) * | 1974-01-08 | 1976-06-15 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3963753A (en) * | 1974-01-08 | 1976-06-15 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3965115A (en) * | 1974-01-08 | 1976-06-22 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3979414A (en) * | 1975-03-13 | 1976-09-07 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3988352A (en) * | 1975-03-13 | 1976-10-26 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3989720A (en) * | 1975-03-13 | 1976-11-02 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3989721A (en) * | 1975-03-13 | 1976-11-02 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US4007205A (en) * | 1976-03-16 | 1977-02-08 | Warner-Lambert Company | 7-Substituted-9-oxoxanthene-2-carboxaldehydes |
| US4012499A (en) * | 1972-05-19 | 1977-03-15 | Burroughs Wellcome Co. | Cyclic sulphur compounds |
| US4025635A (en) * | 1972-09-06 | 1977-05-24 | Burroughs Wellcome Co. | Cyclic sulphur compounds |
| US4035368A (en) * | 1975-04-02 | 1977-07-12 | Riker Laboratories, Inc. | Substituted 3-(1H-tetrazol-5-yl)-quinoline compounds |
| US4039556A (en) * | 1972-09-06 | 1977-08-02 | Burroughs Wellcome Co. | Substituted carbonyl compounds |
| US4061768A (en) * | 1971-09-08 | 1977-12-06 | Burroughs Wellcome Co. | Certain cyclic carbonyl compounds used in the prophylaxis of allergic conditions |
| US4064256A (en) * | 1970-08-26 | 1977-12-20 | Fisons Limited | Benzopyranyltetrazoles as antiasthma agents |
| US4094968A (en) * | 1972-09-06 | 1978-06-13 | Burroughs Wellcome Co. | Treatment for allergy and method of composition thereof |
| US4103015A (en) * | 1975-06-12 | 1978-07-25 | Burroughs Wellcome Co. | Antiallergic cyclic sulphur compounds |
| US4107172A (en) * | 1974-03-01 | 1978-08-15 | Abbott Laboratories | Uricosuric diuretic composition |
| US4127573A (en) * | 1972-09-06 | 1978-11-28 | Burroughs Wellcome Co. | Ditetrazole substituted acridone compounds |
| US4217361A (en) * | 1978-05-22 | 1980-08-12 | Syntex (U.S.A.) Inc. | Disubstituted xanthone-2-carboxylic acid antiallergy agents |
| US4232040A (en) * | 1978-03-08 | 1980-11-04 | Syntex (U.S.A.) Inc. | Compositions for and a method of preventing diabetic complications |
| US4250182A (en) * | 1972-02-24 | 1981-02-10 | Burroughs Wellcome Co. | Pharmaceutical composition containing acridone compounds and method of using same |
| US4282365A (en) * | 1978-11-24 | 1981-08-04 | Merck & Co., Inc. | Dibenz[b,e]oxepin compounds |
| US4333934A (en) * | 1979-02-09 | 1982-06-08 | Roussel Uclaf | Imidazoquinoxalines and pyrroloquinoxalines |
| US4363812A (en) * | 1978-11-30 | 1982-12-14 | Kakenyaku Kako Co., Ltd. | 3-(Tetrazol-5-yl), 4-methyl-8-alkoxy coumarins and anti-allergic compositions thereof |
| US4544557A (en) * | 1982-07-29 | 1985-10-01 | Merck & Co., Inc. | 6-(1-Hydroxyethyl)-2-(2-aminoethylthio)-3-tetrazoly-1-carbadethiapen-2-em |
| US4626431A (en) * | 1983-10-25 | 1986-12-02 | Burroughs Wellcome Co. | Storage of red blood cells |
| US4826996A (en) * | 1980-10-21 | 1989-05-02 | Groupement D'interet Economique Dit Centre International De Recherches Dermatologioues C.I.R.D. | 1,8,-dihydroxy-9-anthrones substituted in the 10-position |
| US4902701A (en) * | 1982-04-27 | 1990-02-20 | Burroughs Welcome Co. | Tetrazolyl substituted tricyclic compounds and pharmacological compositions thereof |
| US5310909A (en) * | 1989-11-29 | 1994-05-10 | Ciba-Geigy Corporation | Photochromic compounds, a process for their preparation, and their use |
| CN102180858A (zh) * | 2011-04-08 | 2011-09-14 | 华东师范大学 | 一取代或二取代呫吨酮化合物及合成方法 |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1389827A (en) * | 1971-07-23 | 1975-04-09 | Fisons Ltd | Tetrazolyl benzopyrans |
| CA967581A (en) * | 1972-01-12 | 1975-05-13 | Syntex Corporation | Preparation of xanthone-2-carboxylic acid compounds |
| BE793751A (fr) * | 1972-01-12 | 1973-07-09 | Syntex Corp | Nouveaux composes d'acides xanthone-carboxyliques disubstitues |
| BE793749A (fr) * | 1972-01-12 | 1973-07-09 | Syntex Corp | Nouveaux composes d'acides xanthone-carboxyliques disubstitues |
| US3835158A (en) * | 1972-05-17 | 1974-09-10 | Syntex Inc | Heterocyclic substituted xanthone carboxylic acid compounds |
| US3835139A (en) * | 1972-07-19 | 1974-09-10 | Syntex Inc | N-substituted acridone carboxylic acids and derivatives |
| GB1452891A (en) * | 1972-09-06 | 1976-10-20 | Wellcome Found | Tricyclic tetrazole derivatives their synthesis and compositions containing them |
| BE793864A (fr) * | 1972-09-25 | 1973-07-10 | Syntex Corp | Derives d'acide xanthone-carboxylique substitues par un groupement ether non sature |
| US3919211A (en) * | 1973-02-12 | 1975-11-11 | American Home Prod | 9-Oxoxanthene-N,N{40 -bis(substituted)-2,7-disulfonamides |
| NL7403583A (th) * | 1973-03-19 | 1974-09-23 | ||
| JPS5516432B2 (th) * | 1974-05-28 | 1980-05-01 | ||
| US4221800A (en) * | 1977-12-23 | 1980-09-09 | Miles Laboratories, Inc. | Cycloalkenochromone |
| JP7096817B2 (ja) | 2016-11-04 | 2022-07-06 | オークランド ユニサービシーズ リミティド | 三環式複素環式誘導体及びその使用 |
| US11970505B1 (en) | 2023-11-07 | 2024-04-30 | King Faisal University | Pyridino-2,16-dioxapentacyclo[7.7.5.01,21.03,8.010,15]henicosa3(8),10,12,14-tetraene-7,20-dione as an antimicrobial compound |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB708917A (en) * | 1951-01-29 | 1954-05-12 | Ward Blenkinsop & Co Ltd | Xanthones and process for the production thereof |
| FR1417961A (fr) * | 1961-01-19 | 1965-11-19 | Cassella Farbwerke Mainkur Ag | Procédé de préparation de dérivés d'hydroxy-xanthones |
-
0
- BE BE759292D patent/BE759292A/xx unknown
-
1969
- 1969-11-27 GB GB5812169A patent/GB1312620A/en not_active Expired
-
1970
- 1970-11-12 IE IE1448/70A patent/IE34720B1/xx unknown
- 1970-11-16 ZA ZA707727A patent/ZA707727B/xx unknown
- 1970-11-16 AT AT1028170A patent/AT304547B/de not_active IP Right Cessation
- 1970-11-16 IL IL35668A patent/IL35668A/xx unknown
- 1970-11-17 US US90444A patent/US3706768A/en not_active Expired - Lifetime
- 1970-11-18 FI FI3099/70A patent/FI56005C/fi active
- 1970-11-19 CA CA098544A patent/CA930743A/en not_active Expired
- 1970-11-23 PL PL1970144588A patent/PL81223B1/pl unknown
- 1970-11-25 CS CS7950A patent/CS172918B4/cs unknown
- 1970-11-26 NL NL7017336A patent/NL7017336A/xx not_active Application Discontinuation
- 1970-11-26 SE SE7016049A patent/SE382459B/xx unknown
- 1970-11-26 PH PH11987A patent/PH11097A/en unknown
- 1970-11-26 ES ES385927A patent/ES385927A1/es not_active Expired
- 1970-11-26 DE DE2058295A patent/DE2058295C3/de not_active Expired
- 1970-11-26 NO NO4538/70A patent/NO133367C/no unknown
- 1970-11-27 DK DK607370AA patent/DK130740B/da unknown
- 1970-11-27 HU HUHA902A patent/HU162579B/hu unknown
- 1970-11-27 CH CH1760070A patent/CH557347A/xx not_active IP Right Cessation
- 1970-11-27 FR FR707042706A patent/FR2073425B1/fr not_active Expired
-
1972
- 1972-03-08 US US00232954A patent/US3755319A/en not_active Expired - Lifetime
Cited By (58)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3933845A (en) * | 1970-08-26 | 1976-01-20 | Fisons Limited | Benzopyranyltetrazoles |
| US4064256A (en) * | 1970-08-26 | 1977-12-20 | Fisons Limited | Benzopyranyltetrazoles as antiasthma agents |
| US3933844A (en) * | 1970-08-26 | 1976-01-20 | Fisons Limited | Benzopyranyltetrazoles |
| US3873714A (en) * | 1971-07-14 | 1975-03-25 | Syntex Inc | Xanthone carboxylic acids and derivatives |
| US3879411A (en) * | 1971-07-23 | 1975-04-22 | Fisons Ltd | Ditetrazolyl-benzodipyrans |
| US3859442A (en) * | 1971-08-23 | 1975-01-07 | Syntex Inc | A method of inhibiting symptoms of asthma |
| US3867407A (en) * | 1971-08-23 | 1975-02-18 | Jurg R Pfister | Substituted xanthone carboxylic acid compounds |
| US3885038A (en) * | 1971-08-23 | 1975-05-20 | Syntex Inc | Method of using substituted xanthone carboxylic acid |
| US3891766A (en) * | 1971-08-23 | 1975-06-24 | Syntex Inc | Methods of using substituted xanthone carboxylic acid compounds |
| US3959482A (en) * | 1971-09-08 | 1976-05-25 | Burroughs Wellcome Co. | Fluorenone carboxylic acids for the prevention of the symptoms of asthma and allergin rhinitis |
| US3950342A (en) * | 1971-09-08 | 1976-04-13 | Burroughs Wellcome Co. | Acridone-dicarboxylic acids |
| US4061768A (en) * | 1971-09-08 | 1977-12-06 | Burroughs Wellcome Co. | Certain cyclic carbonyl compounds used in the prophylaxis of allergic conditions |
| US3887574A (en) * | 1971-10-08 | 1975-06-03 | Allen & Hanburys Ltd | Carboxamido tetrazolo chromones |
| US3886181A (en) * | 1972-01-12 | 1975-05-27 | Syntex Inc | Disubstituted xanthone carboxylic acid compounds |
| US3818042A (en) * | 1972-01-12 | 1974-06-18 | Syntex Inc | Xanthone carboxylic acids and derivatives |
| US4250182A (en) * | 1972-02-24 | 1981-02-10 | Burroughs Wellcome Co. | Pharmaceutical composition containing acridone compounds and method of using same |
| US3928379A (en) * | 1972-03-03 | 1975-12-23 | Mead Johnson & Co | N-phenyl amidines |
| US3949084A (en) * | 1972-03-03 | 1976-04-06 | Syntex (U.S.A.) Inc. | Novel substituted xanthone carboxylic acid compounds |
| US3835157A (en) * | 1972-05-17 | 1974-09-10 | Syntex Inc | Heterocyclic substituted xanthone carboxylic acid compounds |
| US4012499A (en) * | 1972-05-19 | 1977-03-15 | Burroughs Wellcome Co. | Cyclic sulphur compounds |
| US3905989A (en) * | 1972-05-19 | 1975-09-16 | Burroughs Wellcome Co | (Tetrazolyl)thioxanthone-10,10-dioxides |
| US3894049A (en) * | 1972-06-05 | 1975-07-08 | Syntex Inc | Disubstituted xanthone carboxylic acid compounds |
| US3910957A (en) * | 1972-06-05 | 1975-10-07 | Syntex Inc | Xanthone carboxylic acids and derivatives |
| US3904647A (en) * | 1972-07-19 | 1975-09-09 | Syntex Inc | Thioxanthone carboxylic acids and derivatives |
| US4127573A (en) * | 1972-09-06 | 1978-11-28 | Burroughs Wellcome Co. | Ditetrazole substituted acridone compounds |
| US4039556A (en) * | 1972-09-06 | 1977-08-02 | Burroughs Wellcome Co. | Substituted carbonyl compounds |
| US4025635A (en) * | 1972-09-06 | 1977-05-24 | Burroughs Wellcome Co. | Cyclic sulphur compounds |
| US4094968A (en) * | 1972-09-06 | 1978-06-13 | Burroughs Wellcome Co. | Treatment for allergy and method of composition thereof |
| US3939276A (en) * | 1972-09-07 | 1976-02-17 | Burroughs Wellcome Co. | Cyclic carbonyl compounds |
| US3818040A (en) * | 1972-09-25 | 1974-06-18 | Syntex Corp | Alkenyl and alkynyl substituted xanthone carboxylic acid compounds |
| US3965115A (en) * | 1974-01-08 | 1976-06-22 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3963753A (en) * | 1974-01-08 | 1976-06-15 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3963752A (en) * | 1974-01-08 | 1976-06-15 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US4107172A (en) * | 1974-03-01 | 1978-08-15 | Abbott Laboratories | Uricosuric diuretic composition |
| US3951618A (en) * | 1974-03-12 | 1976-04-20 | Syntex (U.S.A.) Inc. | Method of use of, and compositions containing, disubstituted xanthone carboxylic acid compounds |
| US3920826A (en) * | 1974-07-01 | 1975-11-18 | American Home Prod | Method of treating antiarrhythmic activity with bis(2-(dialkylamino)ethoxy)xanthen-9-one antiarrhythmic agents |
| US3988352A (en) * | 1975-03-13 | 1976-10-26 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3989721A (en) * | 1975-03-13 | 1976-11-02 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3989720A (en) * | 1975-03-13 | 1976-11-02 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3979414A (en) * | 1975-03-13 | 1976-09-07 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US4035368A (en) * | 1975-04-02 | 1977-07-12 | Riker Laboratories, Inc. | Substituted 3-(1H-tetrazol-5-yl)-quinoline compounds |
| US4103015A (en) * | 1975-06-12 | 1978-07-25 | Burroughs Wellcome Co. | Antiallergic cyclic sulphur compounds |
| US4007205A (en) * | 1976-03-16 | 1977-02-08 | Warner-Lambert Company | 7-Substituted-9-oxoxanthene-2-carboxaldehydes |
| US4232040A (en) * | 1978-03-08 | 1980-11-04 | Syntex (U.S.A.) Inc. | Compositions for and a method of preventing diabetic complications |
| US4217361A (en) * | 1978-05-22 | 1980-08-12 | Syntex (U.S.A.) Inc. | Disubstituted xanthone-2-carboxylic acid antiallergy agents |
| US4282365A (en) * | 1978-11-24 | 1981-08-04 | Merck & Co., Inc. | Dibenz[b,e]oxepin compounds |
| US4363812A (en) * | 1978-11-30 | 1982-12-14 | Kakenyaku Kako Co., Ltd. | 3-(Tetrazol-5-yl), 4-methyl-8-alkoxy coumarins and anti-allergic compositions thereof |
| US4333934A (en) * | 1979-02-09 | 1982-06-08 | Roussel Uclaf | Imidazoquinoxalines and pyrroloquinoxalines |
| US4474784A (en) * | 1979-02-09 | 1984-10-02 | Roussel Uclaf | Substituted imidazo 1,2-a-quinoxaline-4-(5H)ones, their compositions and method of use |
| US4826996A (en) * | 1980-10-21 | 1989-05-02 | Groupement D'interet Economique Dit Centre International De Recherches Dermatologioues C.I.R.D. | 1,8,-dihydroxy-9-anthrones substituted in the 10-position |
| US4902701A (en) * | 1982-04-27 | 1990-02-20 | Burroughs Welcome Co. | Tetrazolyl substituted tricyclic compounds and pharmacological compositions thereof |
| US4544557A (en) * | 1982-07-29 | 1985-10-01 | Merck & Co., Inc. | 6-(1-Hydroxyethyl)-2-(2-aminoethylthio)-3-tetrazoly-1-carbadethiapen-2-em |
| US4626431A (en) * | 1983-10-25 | 1986-12-02 | Burroughs Wellcome Co. | Storage of red blood cells |
| US4626432A (en) * | 1983-10-25 | 1986-12-02 | Burroughs Wellcome Co. | Storage of red blood cells |
| US4791136A (en) * | 1983-10-25 | 1988-12-13 | Burroughs Wellcome Co. | Pharmacologically active ketones and use |
| US5310909A (en) * | 1989-11-29 | 1994-05-10 | Ciba-Geigy Corporation | Photochromic compounds, a process for their preparation, and their use |
| US5432049A (en) * | 1989-11-29 | 1995-07-11 | Ciba-Geigy Corporation | Photochromic composition |
| CN102180858A (zh) * | 2011-04-08 | 2011-09-14 | 华东师范大学 | 一取代或二取代呫吨酮化合物及合成方法 |
Also Published As
| Publication number | Publication date |
|---|---|
| HU162579B (th) | 1973-03-28 |
| FR2073425B1 (th) | 1974-06-21 |
| NO133367C (th) | 1976-04-21 |
| IL35668A0 (en) | 1971-01-28 |
| PH11097A (en) | 1977-10-25 |
| FR2073425A1 (th) | 1971-10-01 |
| CS172918B4 (th) | 1977-01-28 |
| NO133367B (th) | 1976-01-12 |
| GB1312620A (en) | 1973-04-04 |
| DK130740C (th) | 1975-09-08 |
| AT304547B (de) | 1973-01-10 |
| IE34720L (en) | 1971-05-27 |
| CH557347A (de) | 1974-12-31 |
| IL35668A (en) | 1973-08-29 |
| CA930743A (en) | 1973-07-24 |
| US3755319A (en) | 1973-08-28 |
| ES385927A1 (es) | 1973-12-01 |
| IE34720B1 (en) | 1975-07-23 |
| FI56005B (fi) | 1979-07-31 |
| BE759292A (fr) | 1971-05-24 |
| PL81223B1 (th) | 1975-08-30 |
| ZA707727B (en) | 1971-08-25 |
| DE2058295B2 (de) | 1979-10-04 |
| DK130740B (da) | 1975-04-07 |
| FI56005C (fi) | 1979-11-12 |
| DE2058295A1 (de) | 1971-06-03 |
| SE382459B (sv) | 1976-02-02 |
| NL7017336A (th) | 1971-06-01 |
| DE2058295C3 (de) | 1980-06-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3706768A (en) | Xanthone derivatives | |
| US5171748A (en) | Benz[4,5]imidazole-containing angiotensin antagonists | |
| FI84719C (fi) | Foerfarande foer framstaellning av sura indolderivat med antiallergiskt aktivitet. | |
| JP3120873B2 (ja) | ピリジン誘導体 | |
| US5444071A (en) | Quinoline derivatives and use thereof as angiotensin II antagonists | |
| EP0516392B1 (en) | Naphthyridine derivatives as angiotensin II inhibitors | |
| PT95655B (pt) | Processo para a preparacao de derivados de benzimidazol | |
| EP0092786A2 (en) | 1,8-Naphthyridine and 1,5,8-azanaphthyridine derivatives | |
| CA2032831A1 (en) | Fused imidazole derivatives, their production and use | |
| CS241391A3 (en) | Process for preparing biphenylcarbonitriles | |
| EP0279466B1 (en) | Novel naphthalene derivatives and antiallergy and anti-inflammatory pharmaceuticals | |
| EP0799826A1 (en) | Heteroaryl substituted phenylene derivatives, their preparation and their use as leukotriene receptor antagonists | |
| KR100903713B1 (ko) | 바닐로이드 길항제로서 유용한 크로몬 유도체 | |
| JPH07149763A (ja) | 新規なベンゾチオフェンおよびベンゾフラン誘導体 | |
| JP2529798B2 (ja) | 4−ピリミジノン誘導体、その製造方法および治療への適用 | |
| JPS6156169A (ja) | ベンゾ〔h〕シンノリン誘導体 | |
| EP0053789A1 (en) | 2-Pyridinecarboxamide derivative, process for preparing same and pharmaceutical composition, useful as an anti-allergic agent | |
| US4061768A (en) | Certain cyclic carbonyl compounds used in the prophylaxis of allergic conditions | |
| CA1061353A (en) | 5:6-BENZO-.gamma.-PYRONE DERIVATIVES AND PROCESS FOR THEIR PREPARATION | |
| KR100497896B1 (ko) | 플라본유도체및이를함유하는의약 | |
| PL123811B1 (en) | Process for preparing novel derivatives of pyran-4-one | |
| CA1254204A (en) | 3-(1h-tetrazol-5-yl)-4(3h)-quinazolinones | |
| US3842087A (en) | 1,8-naphthyridine compounds | |
| US3974161A (en) | Fused pyrimidin-4(3H)-ones as antiallergy agents | |
| US4302458A (en) | Phthalidyl-isoquinoline derivatives |