US2976892A - Loom - Google Patents
Loom Download PDFInfo
- Publication number
- US2976892A US2976892A US676344A US67634457A US2976892A US 2976892 A US2976892 A US 2976892A US 676344 A US676344 A US 676344A US 67634457 A US67634457 A US 67634457A US 2976892 A US2976892 A US 2976892A
- Authority
- US
- United States
- Prior art keywords
- loom
- march
- sheets
- morin
- sheet
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- YXOLAZRVSSWPPT-UHFFFAOYSA-N Morin Chemical compound OC1=CC(O)=CC=C1C1=C(O)C(=O)C2=C(O)C=C(O)C=C2O1 YXOLAZRVSSWPPT-UHFFFAOYSA-N 0.000 description 11
- UXOUKMQIEVGVLY-UHFFFAOYSA-N morin Natural products OC1=CC(O)=CC(C2=C(C(=O)C3=C(O)C=C(O)C=C3O2)O)=C1 UXOUKMQIEVGVLY-UHFFFAOYSA-N 0.000 description 11
- 235000007708 morin Nutrition 0.000 description 11
- HRNLTDFVEVHLFF-UHFFFAOYSA-N 5-hydroxy-8-(8-hydroxy-2,2-dimethylchromen-6-yl)-2,2-dimethyl-10-(3-methylbut-2-enyl)-7,8-dihydropyrano[3,2-g]chromen-6-one Chemical compound O1C(C)(C)C=CC2=CC(C3OC4=C(C=5OC(C)(C)C=CC=5C(O)=C4C(=O)C3)CC=C(C)C)=CC(O)=C21 HRNLTDFVEVHLFF-UHFFFAOYSA-N 0.000 description 2
Images
Classifications
-
- D—TEXTILES; PAPER
- D03—WEAVING
- D03D—WOVEN FABRICS; METHODS OF WEAVING; LOOMS
- D03D47/00—Looms in which bulk supply of weft does not pass through shed, e.g. shuttleless looms, gripper shuttle looms, dummy shuttle looms
- D03D47/12—Looms in which bulk supply of weft does not pass through shed, e.g. shuttleless looms, gripper shuttle looms, dummy shuttle looms wherein single picks of weft thread are inserted, i.e. with shedding between each pick
- D03D47/24—Looms in which bulk supply of weft does not pass through shed, e.g. shuttleless looms, gripper shuttle looms, dummy shuttle looms wherein single picks of weft thread are inserted, i.e. with shedding between each pick by gripper or dummy shuttle
-
- D—TEXTILES; PAPER
- D03—WEAVING
- D03D—WOVEN FABRICS; METHODS OF WEAVING; LOOMS
- D03D47/00—Looms in which bulk supply of weft does not pass through shed, e.g. shuttleless looms, gripper shuttle looms, dummy shuttle looms
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Looms (AREA)
- Paper (AREA)
- Folding Of Thin Sheet-Like Materials, Special Discharging Devices, And Others (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US676344A US2976892A (en) | 1957-08-05 | 1957-08-05 | Loom |
| DET15420A DE1233790B (de) | 1957-08-05 | 1958-07-23 | Webmaschine |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US676344A US2976892A (en) | 1957-08-05 | 1957-08-05 | Loom |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| US2976892A true US2976892A (en) | 1961-03-28 |
Family
ID=24714152
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| US676344A Expired - Lifetime US2976892A (en) | 1957-08-05 | 1957-08-05 | Loom |
Country Status (2)
| Country | Link |
|---|---|
| US (1) | US2976892A (Direct) |
| DE (1) | DE1233790B (Direct) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3213892A (en) * | 1962-10-17 | 1965-10-26 | Zangs Ag Maschf | Weaving method and gripper shuttle weaving machine for carrying out said method |
| US3307593A (en) * | 1962-06-26 | 1967-03-07 | Dewas Raymond | Loom having means for the formation of selvedges |
| US3457967A (en) * | 1965-06-25 | 1969-07-29 | Marcel Claeys | Control element for shuttleless looms |
| US4241765A (en) * | 1978-02-08 | 1980-12-30 | Franzen Gert E A | Shuttle drive arrangement |
Citations (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1762377A (en) * | 1927-12-24 | 1930-06-10 | Aberfoyle Mfg Company | Weft-inserting mechanism |
| US1802311A (en) * | 1927-02-04 | 1931-04-21 | Gledhill Walter | Loom for weaving having stationary weft supplies |
| US1862178A (en) * | 1928-12-04 | 1932-06-07 | Celanese Corp | Loom having stationary weft supplies |
| US2152255A (en) * | 1936-10-08 | 1939-03-28 | Sulzer Ag | Method and loom for weaving |
| US2168420A (en) * | 1937-08-21 | 1939-08-08 | Magic Automatic Loom Co | Loom |
| US2265190A (en) * | 1939-12-07 | 1941-12-09 | Botany Worsted Mills | Loom |
| US2267287A (en) * | 1939-08-26 | 1941-12-23 | Sulzer Ag | Selvage forming device for looms |
| US2413155A (en) * | 1944-10-18 | 1946-12-24 | Victor Mosca | Loom |
| GB657694A (en) * | 1947-07-12 | 1951-09-26 | Robert Rene Ferdinand Colibert | Improvements in or relating to weaving and looms therefor |
| US2652860A (en) * | 1949-03-29 | 1953-09-22 | Barzaghi Angelo | Loom |
| US2774388A (en) * | 1953-09-03 | 1956-12-18 | Herman C Frentzel | Shuttle control |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE94432C (Direct) * | ||||
| DE203170C (Direct) * | ||||
| FR581365A (Direct) * | 1924-11-27 | |||
| FR767137A (Direct) * | 1934-07-09 | |||
| DE491281C (de) * | 1930-02-07 | Wilhelm Balluff | Webstuhl mit feststehenden Schussspulen | |
| CH102249A (de) * | 1922-07-18 | 1923-12-01 | Hedrich Gustav | Webstuhl mit durch ein Schiffchen von feststehenden Spulen vermittelst ausschwingender Röhrchen entnommenen Schüssen. |
| US1564603A (en) * | 1924-01-05 | 1925-12-08 | Kumfy Kab Company | Loom |
| FR583104A (fr) * | 1924-06-25 | 1925-01-07 | Vosges Atel Des | Dispositif de lisière pour tissus à duites simples coupées |
| DE488982C (de) * | 1927-03-07 | 1930-01-14 | Ramon Garcia Moya | Vorrichtung fuer Webstuehle mit feststehenden Schussspulen zur Spannung des Schussfadens |
| DE492038C (de) * | 1928-07-10 | 1930-02-20 | Gabler & Co G M B H J | Schussfadenhaltevorrichtung fuer Greiferwebstuehle |
| DE549617C (de) * | 1929-09-24 | 1932-04-29 | Tefag Textil Finanz A G | Verfahren und Vorrichtung zur Herstellung von Geweben, bei welcher die Schussfaeden durch Greiferschuetzen von feststehenden Spulen abgezogen werden |
| CH172564A (de) * | 1932-05-23 | 1934-10-15 | Tefag Textil Finanz Ag | Webverfahren und Maschine zur Durchführung desselben. |
| DE660007C (de) * | 1932-06-23 | 1938-05-16 | Dewas Raymond | Greiferschuetzen |
| US1900545A (en) * | 1932-08-03 | 1933-03-07 | Bigelow Sanford Carpet Co Inc | Filling stop motion for looms |
| DE679464C (de) * | 1936-10-08 | 1939-08-05 | Sulzer Akt Ges Geb | Vorrichtung zum Weben mit Greiferwebschuetzen |
| US2203190A (en) * | 1938-11-18 | 1940-06-04 | Sr Arthur M De Gezelle | Bobbinless loom |
| DE725262C (de) * | 1939-09-02 | 1942-09-18 | Sulzer Ag | Vorrichtung zum Herstellen fester Kanten bei Geweben |
| DE869476C (de) * | 1950-10-16 | 1953-03-05 | Giuseppe Barberi | Webstuhl mit Entnahme des Schussfadens von feststehenden Spulen |
| GB748616A (en) * | 1953-08-14 | 1956-05-09 | Weaving Res & Textile Commissi | Improvements relating to looms for weaving |
| FR1096428A (fr) * | 1953-12-12 | 1955-06-21 | Perfectionnements aux métiers à tisser sans navette | |
| GB760047A (en) * | 1954-03-04 | 1956-10-31 | Fras Hinde & Sons Ltd | Improvements in automatic weft breakage stop motions for shuttleless weaving looms |
-
1957
- 1957-08-05 US US676344A patent/US2976892A/en not_active Expired - Lifetime
-
1958
- 1958-07-23 DE DET15420A patent/DE1233790B/de active Granted
Patent Citations (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1802311A (en) * | 1927-02-04 | 1931-04-21 | Gledhill Walter | Loom for weaving having stationary weft supplies |
| US1762377A (en) * | 1927-12-24 | 1930-06-10 | Aberfoyle Mfg Company | Weft-inserting mechanism |
| US1862178A (en) * | 1928-12-04 | 1932-06-07 | Celanese Corp | Loom having stationary weft supplies |
| US2152255A (en) * | 1936-10-08 | 1939-03-28 | Sulzer Ag | Method and loom for weaving |
| US2168420A (en) * | 1937-08-21 | 1939-08-08 | Magic Automatic Loom Co | Loom |
| US2267287A (en) * | 1939-08-26 | 1941-12-23 | Sulzer Ag | Selvage forming device for looms |
| US2265190A (en) * | 1939-12-07 | 1941-12-09 | Botany Worsted Mills | Loom |
| US2413155A (en) * | 1944-10-18 | 1946-12-24 | Victor Mosca | Loom |
| GB657694A (en) * | 1947-07-12 | 1951-09-26 | Robert Rene Ferdinand Colibert | Improvements in or relating to weaving and looms therefor |
| US2652860A (en) * | 1949-03-29 | 1953-09-22 | Barzaghi Angelo | Loom |
| US2774388A (en) * | 1953-09-03 | 1956-12-18 | Herman C Frentzel | Shuttle control |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3307593A (en) * | 1962-06-26 | 1967-03-07 | Dewas Raymond | Loom having means for the formation of selvedges |
| US3213892A (en) * | 1962-10-17 | 1965-10-26 | Zangs Ag Maschf | Weaving method and gripper shuttle weaving machine for carrying out said method |
| US3457967A (en) * | 1965-06-25 | 1969-07-29 | Marcel Claeys | Control element for shuttleless looms |
| US4241765A (en) * | 1978-02-08 | 1980-12-30 | Franzen Gert E A | Shuttle drive arrangement |
Also Published As
| Publication number | Publication date |
|---|---|
| DE1233790C2 (Direct) | 1967-08-03 |
| DE1233790B (de) | 1967-02-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3472287A (en) | Control device for textile machines | |
| US2976892A (en) | Loom | |
| US2944734A (en) | Test scoring machine | |
| US2528740A (en) | Tagging and listing machine | |
| Pettersson | Handslaget: svensk industriell forskningspolitik 1940-1980 | |
| Amano | Intermediate goods and the theory of comparative advantage: A two-country, three-commodity case | |
| US2846071A (en) | Washing jig | |
| GB1048212A (en) | Motion picture film | |
| GB1136488A (en) | Textile twisting-in frames | |
| GB1536704A (en) | Leno device for a weaving loom | |
| DK133028C (da) | Anleg til gruppering af plane emner, sasom akkumulatorplader, i en forudbestemt rekkefolge | |
| GB867925A (en) | Lug inserter | |
| ES338257A1 (es) | Dispositivo de accionamiento de multiples elementos inser- tadores de hilos de trama. | |
| JPS5366A (en) | Counter | |
| EP0133966A3 (en) | Heald frames control linkage in weave machines | |
| FI49291C (fi) | Menetelmä lääkeaineena aktiivisen halogeenisubstituoidun 2,6-ksylididi n valmistamiseksi. | |
| US2704024A (en) | Data comparing and record posting machine | |
| FR2174675A1 (en) | Loom for weaving gauze - having one heald frame movable laterally | |
| GB877569A (en) | Hinge connection between two bars, more especially between bars or pallet frames | |
| GB906737A (en) | Improvements relating to the threading of warp threads | |
| FR2385829A1 (fr) | Dispositif mecanique pour mouvoir les crochets dans les machines d'armoire des metiers | |
| JPS5353230A (en) | Memory reading system for computer | |
| FR2259207A1 (en) | Key-bolt for two horiz shuttering sections - has interlocking pawls along shuttering edges pivoting on vert axes | |
| GB865585A (en) | Improvements in show cards | |
| IT1213962B (it) | Meccanismo per porre in oscillazione,su un piano verticale,gli organi estirpatori impiegati nellemacchine cavabietole |