TWI536991B - 黏著斑激酶之抑制劑 - Google Patents
黏著斑激酶之抑制劑 Download PDFInfo
- Publication number
- TWI536991B TWI536991B TW097109125A TW97109125A TWI536991B TW I536991 B TWI536991 B TW I536991B TW 097109125 A TW097109125 A TW 097109125A TW 97109125 A TW97109125 A TW 97109125A TW I536991 B TWI536991 B TW I536991B
- Authority
- TW
- Taiwan
- Prior art keywords
- group
- trifluoromethyl
- ylamino
- pyridin
- mmol
- Prior art date
Links
- 108010067715 Focal Adhesion Protein-Tyrosine Kinases Proteins 0.000 title claims description 41
- 102000016621 Focal Adhesion Protein-Tyrosine Kinases Human genes 0.000 title claims description 41
- 239000003112 inhibitor Substances 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 209
- -1 hydroxy, cyano, decyl Chemical group 0.000 claims description 164
- 125000000217 alkyl group Chemical group 0.000 claims description 41
- 125000003118 aryl group Chemical group 0.000 claims description 35
- 125000005842 heteroatom Chemical group 0.000 claims description 33
- 229910052799 carbon Inorganic materials 0.000 claims description 32
- 229910052739 hydrogen Inorganic materials 0.000 claims description 30
- 239000001257 hydrogen Substances 0.000 claims description 30
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 26
- 125000001072 heteroaryl group Chemical group 0.000 claims description 25
- 125000000623 heterocyclic group Chemical group 0.000 claims description 23
- 125000003545 alkoxy group Chemical group 0.000 claims description 22
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 claims description 17
- 229910052736 halogen Inorganic materials 0.000 claims description 17
- 229910052717 sulfur Inorganic materials 0.000 claims description 17
- 150000002367 halogens Chemical class 0.000 claims description 16
- 125000002950 monocyclic group Chemical group 0.000 claims description 16
- 125000001424 substituent group Chemical group 0.000 claims description 16
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 15
- 229910052757 nitrogen Inorganic materials 0.000 claims description 15
- 229910052760 oxygen Inorganic materials 0.000 claims description 15
- 206010028980 Neoplasm Diseases 0.000 claims description 14
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 13
- 201000011510 cancer Diseases 0.000 claims description 12
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 12
- 238000002360 preparation method Methods 0.000 claims description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 12
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 12
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 11
- 230000000694 effects Effects 0.000 claims description 11
- 239000000460 chlorine Substances 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 125000003342 alkenyl group Chemical group 0.000 claims description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 9
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 8
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 claims description 8
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 8
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- 241000124008 Mammalia Species 0.000 claims description 7
- 125000000304 alkynyl group Chemical group 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 7
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 7
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 6
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 claims description 6
- 230000002159 abnormal effect Effects 0.000 claims description 6
- 125000002618 bicyclic heterocycle group Chemical group 0.000 claims description 6
- 239000004202 carbamide Substances 0.000 claims description 6
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 claims description 5
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims description 5
- 125000000172 C5-C10 aryl group Chemical group 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 230000001404 mediated effect Effects 0.000 claims description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 5
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 claims description 4
- TZOYXRMEFDYWDQ-UHFFFAOYSA-N 3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC=C2NC(=O)CCC2=C1 TZOYXRMEFDYWDQ-UHFFFAOYSA-N 0.000 claims description 4
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 claims description 4
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 claims description 4
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 claims description 4
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 4
- 125000002619 bicyclic group Chemical group 0.000 claims description 4
- 239000003814 drug Substances 0.000 claims description 4
- PXZQEOJJUGGUIB-UHFFFAOYSA-N isoindolin-1-one Chemical compound C1=CC=C2C(=O)NCC2=C1 PXZQEOJJUGGUIB-UHFFFAOYSA-N 0.000 claims description 4
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 4
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 claims description 4
- 150000003852 triazoles Chemical class 0.000 claims description 4
- 125000006699 (C1-C3) hydroxyalkyl group Chemical group 0.000 claims description 3
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 claims description 3
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 claims description 3
- 239000008194 pharmaceutical composition Substances 0.000 claims 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims 1
- 239000011737 fluorine Substances 0.000 claims 1
- 238000000034 method Methods 0.000 description 172
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N DMSO Substances CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 124
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 113
- 239000000203 mixture Substances 0.000 description 113
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 99
- 238000005481 NMR spectroscopy Methods 0.000 description 97
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 86
- 239000007787 solid Substances 0.000 description 68
- 238000005160 1H NMR spectroscopy Methods 0.000 description 61
- 235000019439 ethyl acetate Nutrition 0.000 description 53
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 44
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 39
- 239000002904 solvent Substances 0.000 description 36
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 35
- 229910000024 caesium carbonate Inorganic materials 0.000 description 33
- 239000000243 solution Substances 0.000 description 33
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 30
- 239000012043 crude product Substances 0.000 description 28
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 26
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 26
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 24
- CXNIUSPIQKWYAI-UHFFFAOYSA-N 4,5-bis(diphenylphosphino)-9,9-dimethyl-xanthene Substances C=12OC3=C(P(C=4C=CC=CC=4)C=4C=CC=CC=4)C=CC=C3C(C)(C)C2=CC=CC=1P(C=1C=CC=CC=1)C1=CC=CC=C1 CXNIUSPIQKWYAI-UHFFFAOYSA-N 0.000 description 23
- 239000000047 product Substances 0.000 description 23
- 229910052786 argon Inorganic materials 0.000 description 22
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 21
- 125000004432 carbon atom Chemical group C* 0.000 description 20
- 238000010898 silica gel chromatography Methods 0.000 description 19
- 239000005909 Kieselgur Substances 0.000 description 18
- 150000003840 hydrochlorides Chemical class 0.000 description 16
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- GJCOSYZMQJWQCA-UHFFFAOYSA-N 9H-xanthene Chemical compound C1=CC=C2CC3=CC=CC=C3OC2=C1 GJCOSYZMQJWQCA-UHFFFAOYSA-N 0.000 description 14
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 14
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 14
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- QDLAGTHXVHQKRE-UHFFFAOYSA-N lichenxanthone Natural products COC1=CC(O)=C2C(=O)C3=C(C)C=C(OC)C=C3OC2=C1 QDLAGTHXVHQKRE-UHFFFAOYSA-N 0.000 description 14
- 229910052763 palladium Inorganic materials 0.000 description 14
- 238000002953 preparative HPLC Methods 0.000 description 13
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 12
- 229920006395 saturated elastomer Polymers 0.000 description 12
- XEEQBBXEZSNIQV-UHFFFAOYSA-N 2-chloro-4-iodo-5-(trifluoromethyl)pyridine Chemical compound FC(F)(F)C1=CN=C(Cl)C=C1I XEEQBBXEZSNIQV-UHFFFAOYSA-N 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 102000001253 Protein Kinase Human genes 0.000 description 11
- 210000004027 cell Anatomy 0.000 description 11
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 11
- 108060006633 protein kinase Proteins 0.000 description 11
- 239000003039 volatile agent Substances 0.000 description 11
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-Ethyl-3-(3-dimethylaminopropyl)carbodiimide Substances CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 10
- 150000001412 amines Chemical class 0.000 description 10
- 239000000945 filler Substances 0.000 description 10
- 238000009472 formulation Methods 0.000 description 10
- 125000005843 halogen group Chemical group 0.000 description 10
- 230000002401 inhibitory effect Effects 0.000 description 10
- 239000007924 injection Substances 0.000 description 10
- 238000002347 injection Methods 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- BLDAPDVJFOJWMZ-UHFFFAOYSA-N 2-[[2-chloro-5-(trifluoromethyl)pyridin-4-yl]amino]-n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(Cl)=NC=C1C(F)(F)F BLDAPDVJFOJWMZ-UHFFFAOYSA-N 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- 238000003556 assay Methods 0.000 description 9
- NQMRYBIKMRVZLB-UHFFFAOYSA-N methylamine hydrochloride Chemical compound [Cl-].[NH3+]C NQMRYBIKMRVZLB-UHFFFAOYSA-N 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 8
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 8
- 125000004429 atom Chemical group 0.000 description 8
- 239000000872 buffer Substances 0.000 description 8
- 239000003085 diluting agent Substances 0.000 description 8
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 8
- 230000005764 inhibitory process Effects 0.000 description 8
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 7
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 7
- 125000003277 amino group Chemical group 0.000 description 7
- 229910052794 bromium Inorganic materials 0.000 description 7
- 239000000194 fatty acid Substances 0.000 description 7
- 239000003999 initiator Substances 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- 235000019198 oils Nutrition 0.000 description 7
- 239000000651 prodrug Substances 0.000 description 7
- 229940002612 prodrug Drugs 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 239000003826 tablet Substances 0.000 description 7
- XXMFJKNOJSDQBM-UHFFFAOYSA-N 2,2,2-trifluoroacetic acid;hydrate Chemical compound [OH3+].[O-]C(=O)C(F)(F)F XXMFJKNOJSDQBM-UHFFFAOYSA-N 0.000 description 6
- BQTMHUUWYHEPNQ-UHFFFAOYSA-N 2-methoxy-4-morpholin-4-ylaniline Chemical compound C1=C(N)C(OC)=CC(N2CCOCC2)=C1 BQTMHUUWYHEPNQ-UHFFFAOYSA-N 0.000 description 6
- CUYKNJBYIJFRCU-UHFFFAOYSA-N 3-aminopyridine Chemical compound NC1=CC=CN=C1 CUYKNJBYIJFRCU-UHFFFAOYSA-N 0.000 description 6
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 6
- 108091000080 Phosphotransferase Proteins 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 6
- 150000001502 aryl halides Chemical class 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 125000000392 cycloalkenyl group Chemical group 0.000 description 6
- 235000014113 dietary fatty acids Nutrition 0.000 description 6
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 6
- 239000002552 dosage form Substances 0.000 description 6
- 230000002255 enzymatic effect Effects 0.000 description 6
- 229930195729 fatty acid Natural products 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- 102000020233 phosphotransferase Human genes 0.000 description 6
- 125000004076 pyridyl group Chemical group 0.000 description 6
- 125000000335 thiazolyl group Chemical group 0.000 description 6
- VZXTWGWHSMCWGA-UHFFFAOYSA-N 1,3,5-triazine-2,4-diamine Chemical compound NC1=NC=NC(N)=N1 VZXTWGWHSMCWGA-UHFFFAOYSA-N 0.000 description 5
- XLFJZKCYKPSSNZ-UHFFFAOYSA-N 5-fluoro-n-methyl-2-nitrobenzamide Chemical compound CNC(=O)C1=CC(F)=CC=C1[N+]([O-])=O XLFJZKCYKPSSNZ-UHFFFAOYSA-N 0.000 description 5
- 239000004305 biphenyl Substances 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- 125000002837 carbocyclic group Chemical group 0.000 description 5
- 239000013058 crude material Substances 0.000 description 5
- OJCSPXHYDFONPU-UHFFFAOYSA-N etoac etoac Chemical compound CCOC(C)=O.CCOC(C)=O OJCSPXHYDFONPU-UHFFFAOYSA-N 0.000 description 5
- 125000002541 furyl group Chemical group 0.000 description 5
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 5
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 5
- 238000001727 in vivo Methods 0.000 description 5
- 102000006495 integrins Human genes 0.000 description 5
- 108010044426 integrins Proteins 0.000 description 5
- 239000003446 ligand Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 208000024891 symptom Diseases 0.000 description 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- 125000003396 thiol group Chemical class [H]S* 0.000 description 5
- OEBXWWBYZJNKRK-UHFFFAOYSA-N 1-methyl-2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidine Chemical compound C1CCN=C2N(C)CCCN21 OEBXWWBYZJNKRK-UHFFFAOYSA-N 0.000 description 4
- FBBFBZJZXFGFCK-UHFFFAOYSA-N 2-[[2-chloro-5-(trifluoromethyl)pyridin-4-yl]amino]-n-methylbenzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC=CC=C1NC1=CC(Cl)=NC=C1C(F)(F)F FBBFBZJZXFGFCK-UHFFFAOYSA-N 0.000 description 4
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- 108010037362 Extracellular Matrix Proteins Proteins 0.000 description 4
- 102000010834 Extracellular Matrix Proteins Human genes 0.000 description 4
- 229940124783 FAK inhibitor Drugs 0.000 description 4
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- 235000010290 biphenyl Nutrition 0.000 description 4
- 150000001721 carbon Chemical class 0.000 description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 4
- 238000005859 coupling reaction Methods 0.000 description 4
- 125000004663 dialkyl amino group Chemical group 0.000 description 4
- 239000003937 drug carrier Substances 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 239000007937 lozenge Substances 0.000 description 4
- 239000011777 magnesium Substances 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 230000001394 metastastic effect Effects 0.000 description 4
- 206010061289 metastatic neoplasm Diseases 0.000 description 4
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 125000004430 oxygen atom Chemical group O* 0.000 description 4
- 230000002829 reductive effect Effects 0.000 description 4
- 125000003107 substituted aryl group Chemical group 0.000 description 4
- 125000001544 thienyl group Chemical group 0.000 description 4
- 125000006559 (C1-C3) alkylamino group Chemical group 0.000 description 3
- FHKXZOCKROENBY-UHFFFAOYSA-N 2-(dimethylamino)-1-(5-nitro-1H-indol-3-yl)ethanone Chemical compound C1=C([N+]([O-])=O)C=C2C(C(=O)CN(C)C)=CNC2=C1 FHKXZOCKROENBY-UHFFFAOYSA-N 0.000 description 3
- YNNUSGIPVFPVBX-UHFFFAOYSA-N 2-[2-[1-(4-chlorophenyl)-1-phenylethoxy]ethyl]-1-methylpyrrolidine Chemical compound CN1CCCC1CCOC(C)(C=1C=CC(Cl)=CC=1)C1=CC=CC=C1 YNNUSGIPVFPVBX-UHFFFAOYSA-N 0.000 description 3
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 3
- HMYXHQDSYJOVBG-UHFFFAOYSA-N 2-chloro-n-(2-pyrimidin-2-ylphenyl)-5-(trifluoromethyl)pyridin-4-amine Chemical compound FC(F)(F)C1=CN=C(Cl)C=C1NC1=CC=CC=C1C1=NC=CC=N1 HMYXHQDSYJOVBG-UHFFFAOYSA-N 0.000 description 3
- PMPFLCSHKNHZTF-UHFFFAOYSA-N 2-chloro-n-pyridin-2-yl-5-(trifluoromethyl)pyridin-4-amine Chemical compound FC(F)(F)C1=CN=C(Cl)C=C1NC1=CC=CC=N1 PMPFLCSHKNHZTF-UHFFFAOYSA-N 0.000 description 3
- CCZWSTFVHJPCEM-UHFFFAOYSA-N 2-iodopyridine Chemical compound IC1=CC=CC=N1 CCZWSTFVHJPCEM-UHFFFAOYSA-N 0.000 description 3
- FVGYSTMRKRNXSB-UHFFFAOYSA-N 4,5-difluoro-n-methyl-2-nitrobenzamide Chemical compound CNC(=O)C1=CC(F)=C(F)C=C1[N+]([O-])=O FVGYSTMRKRNXSB-UHFFFAOYSA-N 0.000 description 3
- YMXOMWAFFGHJFC-UHFFFAOYSA-N 4-(3-methoxy-4-nitrophenyl)morpholine Chemical compound C1=C([N+]([O-])=O)C(OC)=CC(N2CCOCC2)=C1 YMXOMWAFFGHJFC-UHFFFAOYSA-N 0.000 description 3
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- KIMWOULVHFLJIU-UHFFFAOYSA-N N-Methylanthranilamide Chemical compound CNC(=O)C1=CC=CC=C1N KIMWOULVHFLJIU-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 125000000477 aza group Chemical group 0.000 description 3
- 230000009286 beneficial effect Effects 0.000 description 3
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 3
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 3
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 3
- 230000004071 biological effect Effects 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 125000004122 cyclic group Chemical group 0.000 description 3
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- WJJMNDUMQPNECX-UHFFFAOYSA-N dipicolinic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=N1 WJJMNDUMQPNECX-UHFFFAOYSA-N 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 229920001971 elastomer Polymers 0.000 description 3
- 210000002744 extracellular matrix Anatomy 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000007903 gelatin capsule Substances 0.000 description 3
- 125000005241 heteroarylamino group Chemical group 0.000 description 3
- 125000004415 heterocyclylalkyl group Chemical group 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 238000000338 in vitro Methods 0.000 description 3
- 230000000977 initiatory effect Effects 0.000 description 3
- 125000000842 isoxazolyl group Chemical group 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 230000007246 mechanism Effects 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- PLOJLKHEIDCYRG-UHFFFAOYSA-N n-(3-cyanopyridin-2-yl)-n-methylmethanesulfonamide Chemical compound CS(=O)(=O)N(C)C1=NC=CC=C1C#N PLOJLKHEIDCYRG-UHFFFAOYSA-N 0.000 description 3
- OLNYAGCWUQTTSP-UHFFFAOYSA-N n-(6-nitropyridin-3-yl)acetamide Chemical compound CC(=O)NC1=CC=C([N+]([O-])=O)N=C1 OLNYAGCWUQTTSP-UHFFFAOYSA-N 0.000 description 3
- XKMQXUWCKCZDBT-UHFFFAOYSA-N n-[2-chloro-5-(trifluoromethyl)pyridin-4-yl]-5-pyrimidin-2-yl-1,3-thiazol-4-amine Chemical compound FC(F)(F)C1=CN=C(Cl)C=C1NC1=C(C=2N=CC=CN=2)SC=N1 XKMQXUWCKCZDBT-UHFFFAOYSA-N 0.000 description 3
- LJFPBRJGFQQUTO-UHFFFAOYSA-N n-methyl-5-morpholin-4-yl-2-nitrobenzamide Chemical compound C1=C([N+]([O-])=O)C(C(=O)NC)=CC(N2CCOCC2)=C1 LJFPBRJGFQQUTO-UHFFFAOYSA-N 0.000 description 3
- 125000001624 naphthyl group Chemical group 0.000 description 3
- 125000002971 oxazolyl group Chemical group 0.000 description 3
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 238000012545 processing Methods 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 3
- 125000005493 quinolyl group Chemical group 0.000 description 3
- 125000006413 ring segment Chemical group 0.000 description 3
- 239000012453 solvate Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 239000000375 suspending agent Substances 0.000 description 3
- 230000009466 transformation Effects 0.000 description 3
- 125000001425 triazolyl group Chemical group 0.000 description 3
- FTNJQNQLEGKTGD-UHFFFAOYSA-N 1,3-benzodioxole Chemical compound C1=CC=C2OCOC2=C1 FTNJQNQLEGKTGD-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 2
- IFFLKGMDBKQMAH-UHFFFAOYSA-N 2,4-diaminopyridine Chemical class NC1=CC=NC(N)=C1 IFFLKGMDBKQMAH-UHFFFAOYSA-N 0.000 description 2
- CLDNMNFJIAZONI-UHFFFAOYSA-N 2-(2-methoxy-4-morpholin-4-ylphenyl)-4-N-(pyridin-2-ylmethyl)-5-(trifluoromethyl)-1H-pyridine-2,4-diamine Chemical compound COC1=C(C=CC(=C1)N1CCOCC1)C1(NC=C(C(=C1)NCC1=NC=CC=C1)C(F)(F)F)N CLDNMNFJIAZONI-UHFFFAOYSA-N 0.000 description 2
- YXAMFZKFPVKRER-UHFFFAOYSA-N 2-(2-methoxy-4-morpholin-4-ylphenyl)-4-N-[2-(1,3-oxazol-2-yl)phenyl]-5-(trifluoromethyl)-1H-pyridine-2,4-diamine Chemical compound COC1=C(C=CC(=C1)N1CCOCC1)C1(NC=C(C(=C1)NC1=C(C=CC=C1)C=1OC=CN=1)C(F)(F)F)N YXAMFZKFPVKRER-UHFFFAOYSA-N 0.000 description 2
- OLACPKIMBMIPCA-UHFFFAOYSA-N 2-(2-methoxy-4-morpholin-4-ylphenyl)-4-N-pyridin-2-yl-5-(trifluoromethyl)-1H-pyridine-2,4-diamine Chemical compound COC1=C(C=CC(=C1)N1CCOCC1)C1(NC=C(C(=C1)NC1=NC=CC=C1)C(F)(F)F)N OLACPKIMBMIPCA-UHFFFAOYSA-N 0.000 description 2
- KOVNPJHHUQBCJG-UHFFFAOYSA-N 2-(2-methoxy-4-morpholin-4-ylphenyl)-4-N-pyridin-3-yl-5-(trifluoromethyl)-1H-pyridine-2,4-diamine Chemical compound COC1=C(C=CC(=C1)N1CCOCC1)C1(NC=C(C(=C1)NC=1C=NC=CC=1)C(F)(F)F)N KOVNPJHHUQBCJG-UHFFFAOYSA-N 0.000 description 2
- KBRRIEFTVXTTCR-UHFFFAOYSA-N 2-(nitromethyl)pyridine Chemical compound [O-][N+](=O)CC1=CC=CC=N1 KBRRIEFTVXTTCR-UHFFFAOYSA-N 0.000 description 2
- OTQVEDFVMOXIAC-UHFFFAOYSA-N 2-[(2,5-dibromopyridin-4-yl)amino]-n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(Br)=NC=C1Br OTQVEDFVMOXIAC-UHFFFAOYSA-N 0.000 description 2
- JLHHMCQHSNTVIM-UHFFFAOYSA-N 2-[(2-bromo-5-chloropyridin-4-yl)amino]-n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(Br)=NC=C1Cl JLHHMCQHSNTVIM-UHFFFAOYSA-N 0.000 description 2
- IGUBBWJDMLCRIK-UHFFFAOYSA-N 2-[[2-(2-methoxy-4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyridin-4-yl]amino]-n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2C(=CC(=CC=2)N2CCOCC2)OC)=NC=C1C(F)(F)F IGUBBWJDMLCRIK-UHFFFAOYSA-N 0.000 description 2
- URDRCGDNRKCDNN-UHFFFAOYSA-N 2-[[2-(2-methoxy-4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyridin-4-yl]amino]-n-methylbenzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC=CC=C1NC1=CC(NC=2C(=CC(=CC=2)N2CCOCC2)OC)=NC=C1C(F)(F)F URDRCGDNRKCDNN-UHFFFAOYSA-N 0.000 description 2
- VUTLRGODRLPLMK-UHFFFAOYSA-N 2-[[2-(2-methoxy-4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyridin-4-yl]amino]-n-propan-2-ylbenzenesulfonamide Chemical compound COC1=CC(N2CCOCC2)=CC=C1NC(N=CC=1C(F)(F)F)=CC=1NC1=CC=CC=C1S(=O)(=O)NC(C)C VUTLRGODRLPLMK-UHFFFAOYSA-N 0.000 description 2
- WQYDASORCSDVNY-UHFFFAOYSA-N 2-[[5-bromo-2-(2-methoxy-4-morpholin-4-ylanilino)pyridin-4-yl]amino]-n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2C(=CC(=CC=2)N2CCOCC2)OC)=NC=C1Br WQYDASORCSDVNY-UHFFFAOYSA-N 0.000 description 2
- SVIILPGBQTUQPJ-UHFFFAOYSA-N 2-[[5-chloro-2-(2-methoxy-4-morpholin-4-ylanilino)pyridin-4-yl]amino]-n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2C(=CC(=CC=2)N2CCOCC2)OC)=NC=C1Cl SVIILPGBQTUQPJ-UHFFFAOYSA-N 0.000 description 2
- JMHVADDHAXZSPT-UHFFFAOYSA-N 2-[[5-cyano-2-(2-methoxy-4-morpholin-4-ylanilino)pyridin-4-yl]amino]-n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2C(=CC(=CC=2)N2CCOCC2)OC)=NC=C1C#N JMHVADDHAXZSPT-UHFFFAOYSA-N 0.000 description 2
- UPOMRTKHZCWMBW-UHFFFAOYSA-N 2-[[5-fluoro-2-(2-methoxy-4-morpholin-4-ylanilino)pyridin-4-yl]amino]-n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2C(=CC(=CC=2)N2CCOCC2)OC)=NC=C1F UPOMRTKHZCWMBW-UHFFFAOYSA-N 0.000 description 2
- RCEJRYHSONGKJW-UHFFFAOYSA-N 2-amino-n-methyl-5-morpholin-4-ylbenzamide Chemical compound C1=C(N)C(C(=O)NC)=CC(N2CCOCC2)=C1 RCEJRYHSONGKJW-UHFFFAOYSA-N 0.000 description 2
- PFMDLZQSUMZMHZ-UHFFFAOYSA-N 2-amino-n-propan-2-ylbenzenesulfonamide Chemical compound CC(C)NS(=O)(=O)C1=CC=CC=C1N PFMDLZQSUMZMHZ-UHFFFAOYSA-N 0.000 description 2
- BVKYVDJDCQLPEC-UHFFFAOYSA-N 2-chloro-5-(trifluoromethyl)pyridin-4-amine Chemical compound NC1=CC(Cl)=NC=C1C(F)(F)F BVKYVDJDCQLPEC-UHFFFAOYSA-N 0.000 description 2
- JAWLWNKATJAODJ-UHFFFAOYSA-N 2-chloro-n-methyl-n-(4-nitrophenyl)acetamide Chemical compound ClCC(=O)N(C)C1=CC=C([N+]([O-])=O)C=C1 JAWLWNKATJAODJ-UHFFFAOYSA-N 0.000 description 2
- DKPLMTGQQPATKM-UHFFFAOYSA-N 2-chloro-n-pyridin-3-yl-5-(trifluoromethyl)pyridin-4-amine Chemical compound FC(F)(F)C1=CN=C(Cl)C=C1NC1=CC=CN=C1 DKPLMTGQQPATKM-UHFFFAOYSA-N 0.000 description 2
- IZHVBANLECCAGF-UHFFFAOYSA-N 2-hydroxy-3-(octadecanoyloxy)propyl octadecanoate Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)COC(=O)CCCCCCCCCCCCCCCCC IZHVBANLECCAGF-UHFFFAOYSA-N 0.000 description 2
- FEUJETNFYAFWJY-UHFFFAOYSA-N 2-methoxy-4-(5-methyl-1H-pyridazin-2-yl)aniline Chemical compound COC1=C(N)C=CC(=C1)N1NC=C(C=C1)C FEUJETNFYAFWJY-UHFFFAOYSA-N 0.000 description 2
- WGLBNSMEXOFRHQ-UHFFFAOYSA-N 2-methoxy-5-morpholin-4-ylaniline Chemical compound C1=C(N)C(OC)=CC=C1N1CCOCC1 WGLBNSMEXOFRHQ-UHFFFAOYSA-N 0.000 description 2
- AGNODYCWEZDMHI-UHFFFAOYSA-N 2-nitro-n-propan-2-ylbenzenesulfonamide Chemical compound CC(C)NS(=O)(=O)C1=CC=CC=C1[N+]([O-])=O AGNODYCWEZDMHI-UHFFFAOYSA-N 0.000 description 2
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 2
- SRMUNBIMVOVMSV-UHFFFAOYSA-N 3-N-[2-chloro-5-(trifluoromethyl)pyridin-4-yl]-1-N-methylpyridin-1-ium-1,3-diamine Chemical compound ClC1=NC=C(C(=C1)NC=1C=[N+](C=CC1)NC)C(F)(F)F SRMUNBIMVOVMSV-UHFFFAOYSA-N 0.000 description 2
- CRTMHMPDIZZKLS-UHFFFAOYSA-N 4-amino-n-methylpyrimidine-5-carboxamide Chemical compound CNC(=O)C1=CN=CN=C1N CRTMHMPDIZZKLS-UHFFFAOYSA-N 0.000 description 2
- BKNDHOZONDAKMR-UHFFFAOYSA-N 5-[[2-(2-methoxy-4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyridin-4-yl]amino]-n-methyl-1,3-thiazole-4-carboxamide Chemical compound N1=CSC(NC=2C(=CN=C(NC=3C(=CC(=CC=3)N3CCOCC3)OC)C=2)C(F)(F)F)=C1C(=O)NC BKNDHOZONDAKMR-UHFFFAOYSA-N 0.000 description 2
- MEGTXQFXYWPJPB-UHFFFAOYSA-O 5-[[4-[(1,1-dimethyl-2H-pyridin-1-ium-3-yl)amino]-5-(trifluoromethyl)pyridin-2-yl]amino]indol-2-one Chemical compound C[N+]1(CC(=CC=C1)NC1=CC(=NC=C1C(F)(F)F)NC1=CC2=CC(N=C2C=C1)=O)C MEGTXQFXYWPJPB-UHFFFAOYSA-O 0.000 description 2
- ABYXBJSZROTLFG-UHFFFAOYSA-O 5-[[4-[(1-methylpyridin-1-ium-3-yl)amino]-5-(trifluoromethyl)pyridin-2-yl]amino]indol-2-one Chemical compound C[N+]1=CC(=CC=C1)NC1=CC(=NC=C1C(F)(F)F)NC1=CC2=CC(N=C2C=C1)=O ABYXBJSZROTLFG-UHFFFAOYSA-O 0.000 description 2
- DZADIHSSWKMGIZ-UHFFFAOYSA-N 5-fluoro-2-[[2-(2-methoxy-4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyridin-4-yl]amino]-n-methylbenzamide Chemical compound CNC(=O)C1=CC(F)=CC=C1NC1=CC(NC=2C(=CC(=CC=2)N2CCOCC2)OC)=NC=C1C(F)(F)F DZADIHSSWKMGIZ-UHFFFAOYSA-N 0.000 description 2
- GHYZIXDKAPMFCS-UHFFFAOYSA-N 5-fluoro-2-nitrobenzoic acid Chemical compound OC(=O)C1=CC(F)=CC=C1[N+]([O-])=O GHYZIXDKAPMFCS-UHFFFAOYSA-N 0.000 description 2
- ZUUJWCKWJJGJOE-UHFFFAOYSA-N 59290-85-6 Chemical compound OC(=O)C1=NC=CC=C1[N+]([O-])=O ZUUJWCKWJJGJOE-UHFFFAOYSA-N 0.000 description 2
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 description 2
- LRFVTYWOQMYALW-UHFFFAOYSA-N 9H-xanthine Chemical compound O=C1NC(=O)NC2=C1NC=N2 LRFVTYWOQMYALW-UHFFFAOYSA-N 0.000 description 2
- GFFGJBXGBJISGV-UHFFFAOYSA-N Adenine Chemical compound NC1=NC=NC2=C1N=CN2 GFFGJBXGBJISGV-UHFFFAOYSA-N 0.000 description 2
- ZGEKZCVZEQNJCL-UHFFFAOYSA-N CC(C)(C)OC(NCC1=CC=CN=C1N(C)S(C)=O)=O Chemical compound CC(C)(C)OC(NCC1=CC=CN=C1N(C)S(C)=O)=O ZGEKZCVZEQNJCL-UHFFFAOYSA-N 0.000 description 2
- 229920000858 Cyclodextrin Polymers 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- MWBXYQNKDKTKBP-UHFFFAOYSA-N N-methyl-2-[[2-[(2-oxoindol-5-yl)amino]-5-(trifluoromethyl)pyridin-4-yl]amino]pyridine-3-carboxamide Chemical compound CNC(C1=C(N=CC=C1)NC1=CC(=NC=C1C(F)(F)F)NC1=CC2=CC(N=C2C=C1)=O)=O MWBXYQNKDKTKBP-UHFFFAOYSA-N 0.000 description 2
- YSBWLMAMXKEUPV-UHFFFAOYSA-N N-methyl-3-[[2-[(2-oxoindol-5-yl)amino]-5-(trifluoromethyl)pyridin-4-yl]amino]pyrazine-2-carboxamide Chemical compound CNC(=O)C1=NC=CN=C1NC1=CC(=NC=C1C(F)(F)F)NC1=CC2=CC(N=C2C=C1)=O YSBWLMAMXKEUPV-UHFFFAOYSA-N 0.000 description 2
- BJEXCNTZBQVJMH-UHFFFAOYSA-N N-methyl-4-[[2-[(2-oxoindol-5-yl)amino]-5-(trifluoromethyl)pyridin-4-yl]amino]pyridine-3-carboxamide Chemical compound CNC(C1=CN=CC=C1NC1=CC(=NC=C1C(F)(F)F)NC1=CC2=CC(N=C2C=C1)=O)=O BJEXCNTZBQVJMH-UHFFFAOYSA-N 0.000 description 2
- ZKAGCGGXYTYYHC-UHFFFAOYSA-N N-methyl-4-[[2-[(2-oxoindol-5-yl)amino]-5-(trifluoromethyl)pyridin-4-yl]amino]pyrimidine-5-carboxamide Chemical compound CNC(=O)C=1C(=NC=NC1)NC1=CC(=NC=C1C(F)(F)F)NC1=CC2=CC(N=C2C=C1)=O ZKAGCGGXYTYYHC-UHFFFAOYSA-N 0.000 description 2
- BFCFQCOMUORKPM-UHFFFAOYSA-N N-methyl-5-morpholin-4-yl-2-[[2-[(2-oxoindol-5-yl)amino]-5-(trifluoromethyl)pyridin-4-yl]amino]benzamide Chemical compound CNC(C1=C(C=CC(=C1)N1CCOCC1)NC1=CC(=NC=C1C(F)(F)F)NC1=CC2=CC(N=C2C=C1)=O)=O BFCFQCOMUORKPM-UHFFFAOYSA-N 0.000 description 2
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 2
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 2
- 229910004298 SiO 2 Inorganic materials 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical class [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 229940045988 antineoplastic drug protein kinase inhibitors Drugs 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 2
- 125000004104 aryloxy group Chemical group 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 125000005602 azabenzimidazolyl group Chemical group 0.000 description 2
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 229920002988 biodegradable polymer Polymers 0.000 description 2
- 239000004621 biodegradable polymer Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000006267 biphenyl group Chemical group 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 description 2
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 150000007942 carboxylates Chemical class 0.000 description 2
- 239000004359 castor oil Substances 0.000 description 2
- 235000019438 castor oil Nutrition 0.000 description 2
- 238000000423 cell based assay Methods 0.000 description 2
- 229920001429 chelating resin Polymers 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000003678 cyclohexadienyl group Chemical group C1(=CC=CCC1)* 0.000 description 2
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 2
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 2
- 125000003493 decenyl group Chemical group [H]C([*])=C([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000003111 delayed effect Effects 0.000 description 2
- 238000001514 detection method Methods 0.000 description 2
- GPAYUJZHTULNBE-UHFFFAOYSA-N diphenylphosphine Chemical compound C=1C=CC=CC=1PC1=CC=CC=C1 GPAYUJZHTULNBE-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000003818 flash chromatography Methods 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 125000005945 imidazopyridyl group Chemical group 0.000 description 2
- 150000002466 imines Chemical class 0.000 description 2
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 2
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 2
- 230000006698 induction Effects 0.000 description 2
- 239000007972 injectable composition Substances 0.000 description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 2
- 125000005956 isoquinolyl group Chemical group 0.000 description 2
- 229940043355 kinase inhibitor Drugs 0.000 description 2
- 239000006194 liquid suspension Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 239000011159 matrix material Substances 0.000 description 2
- 230000004060 metabolic process Effects 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- KTDWABGWPOFXBK-UHFFFAOYSA-N methyl 4-[[2-(2-methoxy-5-morpholin-4-ylanilino)-5-(trifluoromethyl)pyridin-4-yl]amino]-2-methylsulfanyl-1,3-thiazole-5-carboxylate Chemical compound S1C(SC)=NC(NC=2C(=CN=C(NC=3C(=CC=C(C=3)N3CCOCC3)OC)C=2)C(F)(F)F)=C1C(=O)OC KTDWABGWPOFXBK-UHFFFAOYSA-N 0.000 description 2
- OJXVCUNIMJIROK-UHFFFAOYSA-N methyl 4-[[2-chloro-5-(trifluoromethyl)pyridin-4-yl]amino]-2-methylsulfanyl-1,3-thiazole-5-carboxylate Chemical compound S1C(SC)=NC(NC=2C(=CN=C(Cl)C=2)C(F)(F)F)=C1C(=O)OC OJXVCUNIMJIROK-UHFFFAOYSA-N 0.000 description 2
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical compound COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 2
- 125000002757 morpholinyl group Chemical group 0.000 description 2
- NJBRJYSZFWGUMN-UHFFFAOYSA-N n,n-dimethyl-2-oxo-2-[5-[[4-(pyridin-2-ylamino)-5-(trifluoromethyl)pyridin-2-yl]amino]-1h-indol-3-yl]acetamide Chemical compound C1=C2C(C(=O)C(=O)N(C)C)=CNC2=CC=C1NC(N=CC=1C(F)(F)F)=CC=1NC1=CC=CC=N1 NJBRJYSZFWGUMN-UHFFFAOYSA-N 0.000 description 2
- LYSUPYRJFGDDOD-UHFFFAOYSA-N n-[2-[[2-(2-methoxy-4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyridin-4-yl]amino]phenyl]acetamide Chemical compound COC1=CC(N2CCOCC2)=CC=C1NC(N=CC=1C(F)(F)F)=CC=1NC1=CC=CC=C1NC(C)=O LYSUPYRJFGDDOD-UHFFFAOYSA-N 0.000 description 2
- OOTMQTFKRNSTMP-UHFFFAOYSA-N n-[2-[[2-[(2-oxo-1,3-dihydroindol-5-yl)amino]-5-(trifluoromethyl)pyridin-4-yl]amino]phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC=C1NC1=CC(NC=2C=C3CC(=O)NC3=CC=2)=NC=C1C(F)(F)F OOTMQTFKRNSTMP-UHFFFAOYSA-N 0.000 description 2
- CLGSLNDJLKDNEO-UHFFFAOYSA-N n-[2-[[2-chloro-5-(trifluoromethyl)pyridin-4-yl]amino]phenyl]acetamide Chemical compound CC(=O)NC1=CC=CC=C1NC1=CC(Cl)=NC=C1C(F)(F)F CLGSLNDJLKDNEO-UHFFFAOYSA-N 0.000 description 2
- JPOHQSSYLJWDAT-UHFFFAOYSA-N n-[3-(aminomethyl)pyridin-2-yl]-n-methylmethanesulfonamide Chemical compound CS(=O)(=O)N(C)C1=NC=CC=C1CN JPOHQSSYLJWDAT-UHFFFAOYSA-N 0.000 description 2
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 230000026731 phosphorylation Effects 0.000 description 2
- 238000006366 phosphorylation reaction Methods 0.000 description 2
- 239000003757 phosphotransferase inhibitor Substances 0.000 description 2
- 230000035790 physiological processes and functions Effects 0.000 description 2
- 125000003367 polycyclic group Chemical group 0.000 description 2
- 239000012256 powdered iron Substances 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000003909 protein kinase inhibitor Substances 0.000 description 2
- 230000002685 pulmonary effect Effects 0.000 description 2
- 125000003226 pyrazolyl group Chemical group 0.000 description 2
- 125000002098 pyridazinyl group Chemical group 0.000 description 2
- 150000003222 pyridines Chemical class 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 2
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- HFHDHCJBZVLPGP-UHFFFAOYSA-N schardinger α-dextrin Chemical compound O1C(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(O)C2O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC2C(O)C(O)C1OC2CO HFHDHCJBZVLPGP-UHFFFAOYSA-N 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- 125000000547 substituted alkyl group Chemical group 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 238000013268 sustained release Methods 0.000 description 2
- 239000012730 sustained-release form Substances 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- 229910052723 transition metal Inorganic materials 0.000 description 2
- 150000003624 transition metals Chemical class 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- DTGKSKDOIYIVQL-WEDXCCLWSA-N (+)-borneol Chemical compound C1C[C@@]2(C)[C@@H](O)C[C@@H]1C2(C)C DTGKSKDOIYIVQL-WEDXCCLWSA-N 0.000 description 1
- REPVLJRCJUVQFA-UHFFFAOYSA-N (-)-isopinocampheol Natural products C1C(O)C(C)C2C(C)(C)C1C2 REPVLJRCJUVQFA-UHFFFAOYSA-N 0.000 description 1
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- DOTAAODFKPTVCK-UHFFFAOYSA-N (1-diphenylphosphanyl-9h-xanthen-2-yl)-diphenylphosphane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)C1=C2CC3=CC=CC=C3OC2=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 DOTAAODFKPTVCK-UHFFFAOYSA-N 0.000 description 1
- FNQJDLTXOVEEFB-UHFFFAOYSA-N 1,2,3-benzothiadiazole Chemical compound C1=CC=C2SN=NC2=C1 FNQJDLTXOVEEFB-UHFFFAOYSA-N 0.000 description 1
- 125000001607 1,2,3-triazol-1-yl group Chemical group [*]N1N=NC([H])=C1[H] 0.000 description 1
- 125000001359 1,2,3-triazol-4-yl group Chemical group [H]N1N=NC([*])=C1[H] 0.000 description 1
- 125000001305 1,2,4-triazol-3-yl group Chemical group [H]N1N=C([*])N=C1[H] 0.000 description 1
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- IOMOVAPYJQVJDK-UHFFFAOYSA-N 1-(4-aminophenyl)pyrrolidin-2-one Chemical compound C1=CC(N)=CC=C1N1C(=O)CCC1 IOMOVAPYJQVJDK-UHFFFAOYSA-N 0.000 description 1
- CJNBVCUUVAJAFX-UHFFFAOYSA-N 1-[4-[[4-[(3-methylsulfonylphenyl)methylamino]-5-(trifluoromethyl)pyridin-2-yl]amino]phenyl]pyrrolidin-2-one Chemical compound CS(=O)(=O)C1=CC=CC(CNC=2C(=CN=C(NC=3C=CC(=CC=3)N3C(CCC3)=O)C=2)C(F)(F)F)=C1 CJNBVCUUVAJAFX-UHFFFAOYSA-N 0.000 description 1
- 125000004173 1-benzimidazolyl group Chemical group [H]C1=NC2=C([H])C([H])=C([H])C([H])=C2N1* 0.000 description 1
- YZPXYIOAOCJBRV-UHFFFAOYSA-N 1-methyl-3-nitropyridin-1-ium Chemical compound C[N+]1=CC=CC([N+]([O-])=O)=C1 YZPXYIOAOCJBRV-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- 238000004293 19F NMR spectroscopy Methods 0.000 description 1
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 description 1
- ZCBIFHNDZBSCEP-UHFFFAOYSA-N 1H-indol-5-amine Chemical compound NC1=CC=C2NC=CC2=C1 ZCBIFHNDZBSCEP-UHFFFAOYSA-N 0.000 description 1
- KCNISYPADDTFDO-UHFFFAOYSA-N 2,4-dinitrophenylacetic acid Chemical compound OC(=O)CC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O KCNISYPADDTFDO-UHFFFAOYSA-N 0.000 description 1
- NGUUVECDJLOZBN-UHFFFAOYSA-N 2-(2-methoxy-4-morpholin-4-ylphenyl)-4-N-(2-pyrimidin-2-ylphenyl)-5-(trifluoromethyl)-1H-pyridine-2,4-diamine Chemical compound COC1=C(C=CC(=C1)N1CCOCC1)C1(NC=C(C(=C1)NC1=C(C=CC=C1)C1=NC=CC=N1)C(F)(F)F)N NGUUVECDJLOZBN-UHFFFAOYSA-N 0.000 description 1
- LMICFDDESPTZRD-UHFFFAOYSA-N 2-(2-methoxy-4-morpholin-4-ylphenyl)-4-N-[(2-methylsulfonylphenyl)methyl]-5-(trifluoromethyl)-1H-pyridine-2,4-diamine Chemical compound COC1=C(C=CC(=C1)N1CCOCC1)C1(NC=C(C(=C1)NCC1=C(C=CC=C1)S(=O)(=O)C)C(F)(F)F)N LMICFDDESPTZRD-UHFFFAOYSA-N 0.000 description 1
- OSLYTJIAXAWFSO-UHFFFAOYSA-N 2-(2-methoxy-4-morpholin-4-ylphenyl)-4-N-[(3-methylsulfonylphenyl)methyl]-5-(trifluoromethyl)-1H-pyridine-2,4-diamine Chemical compound COC1=C(C=CC(=C1)N1CCOCC1)C1(NC=C(C(=C1)NCC1=CC(=CC=C1)S(=O)(=O)C)C(F)(F)F)N OSLYTJIAXAWFSO-UHFFFAOYSA-N 0.000 description 1
- SBFQAUMDVCSVSZ-UHFFFAOYSA-N 2-(2-methoxy-4-morpholin-4-ylphenyl)-5-(trifluoromethyl)-1H-pyridine-2,4-diamine Chemical compound COC1=C(C=CC(=C1)N1CCOCC1)C1(NC=C(C(=C1)N)C(F)(F)F)N SBFQAUMDVCSVSZ-UHFFFAOYSA-N 0.000 description 1
- KEKCZPRBPJFTMT-UHFFFAOYSA-N 2-(2-methoxy-5-morpholin-4-ylphenyl)-4-N-pyridin-2-yl-5-(trifluoromethyl)-1H-pyridine-2,4-diamine Chemical compound COC1=C(C=C(C=C1)N1CCOCC1)C1(NC=C(C(=C1)NC1=NC=CC=C1)C(F)(F)F)N KEKCZPRBPJFTMT-UHFFFAOYSA-N 0.000 description 1
- FIHKPYJIOKPQCM-UHFFFAOYSA-N 2-N-(1,3-benzodioxol-5-yl)-4-N-[2-(methylaminomethyl)phenyl]-5-(trifluoromethyl)pyridine-2,4-diamine Chemical compound O1COC2=C1C=CC(=C2)NC2=NC=C(C(=C2)NC2=C(CNC)C=CC=C2)C(F)(F)F FIHKPYJIOKPQCM-UHFFFAOYSA-N 0.000 description 1
- CSZOQILMVKXAPJ-UHFFFAOYSA-N 2-N-(1H-indazol-5-yl)-4-N-(1-methylpyridin-1-ium-3-yl)-5-(trifluoromethyl)pyridine-2,4-diamine Chemical compound N1N=CC2=CC(=CC=C12)NC1=NC=C(C(=C1)NC=1C=[N+](C=CC1)C)C(F)(F)F CSZOQILMVKXAPJ-UHFFFAOYSA-N 0.000 description 1
- QWIKOEWRZJWDTF-UHFFFAOYSA-N 2-N-(2-methoxy-4-morpholin-4-ylphenyl)-4-N-[1-(methylamino)pyridin-1-ium-3-yl]-5-(trifluoromethyl)pyridine-2,4-diamine Chemical compound COC1=C(C=CC(=C1)N1CCOCC1)NC1=NC=C(C(=C1)NC=1C=[N+](C=CC1)NC)C(F)(F)F QWIKOEWRZJWDTF-UHFFFAOYSA-N 0.000 description 1
- ZBYKYPHROVIJNW-UHFFFAOYSA-N 2-N-[4-[(dimethylamino)methyl]-2-methoxyphenyl]-4-N-[2-[2-(methylamino)ethyl]phenyl]-5-(trifluoromethyl)pyridine-2,4-diamine Chemical compound COC=1C=C(CN(C)C)C=CC1NC1=NC=C(C(=C1)NC1=C(C=CC=C1)CCNC)C(F)(F)F ZBYKYPHROVIJNW-UHFFFAOYSA-N 0.000 description 1
- BTYUDXQEYQNBKQ-UHFFFAOYSA-N 2-[(2,5-dichloropyridin-4-yl)amino]-n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(Cl)=NC=C1Cl BTYUDXQEYQNBKQ-UHFFFAOYSA-N 0.000 description 1
- JWIAJAVYTSEZMC-UHFFFAOYSA-N 2-[(2-bromo-5-cyanopyridin-4-yl)amino]-n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(Br)=NC=C1C#N JWIAJAVYTSEZMC-UHFFFAOYSA-N 0.000 description 1
- OAJNSHRCPBJUAC-UHFFFAOYSA-N 2-[(2-chloro-5-cyanopyridin-4-yl)amino]-n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(Cl)=NC=C1C#N OAJNSHRCPBJUAC-UHFFFAOYSA-N 0.000 description 1
- JKMHFZQWWAIEOD-UHFFFAOYSA-N 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid Chemical compound OCC[NH+]1CCN(CCS([O-])(=O)=O)CC1 JKMHFZQWWAIEOD-UHFFFAOYSA-N 0.000 description 1
- NUCHZGVVXZEKRI-UHFFFAOYSA-N 2-[[2-(2-methoxy-4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyridin-4-yl]amino]-n,n-dimethylbenzamide Chemical compound COC1=CC(N2CCOCC2)=CC=C1NC(N=CC=1C(F)(F)F)=CC=1NC1=CC=CC=C1C(=O)N(C)C NUCHZGVVXZEKRI-UHFFFAOYSA-N 0.000 description 1
- IHLGRHHOEJRMEJ-UHFFFAOYSA-N 2-[[2-(2-methoxy-4-pyrimidin-5-ylanilino)-5-(trifluoromethyl)pyridin-4-yl]amino]-n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2C(=CC(=CC=2)C=2C=NC=NC=2)OC)=NC=C1C(F)(F)F IHLGRHHOEJRMEJ-UHFFFAOYSA-N 0.000 description 1
- GUCZOPLDOPVFBO-UHFFFAOYSA-N 2-[[2-(4-fluoro-2-methoxyanilino)-5-(trifluoromethyl)pyridin-4-yl]amino]-n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2C(=CC(F)=CC=2)OC)=NC=C1C(F)(F)F GUCZOPLDOPVFBO-UHFFFAOYSA-N 0.000 description 1
- QUSXVVFWLZVSRJ-UHFFFAOYSA-N 2-[[2-[(6-fluoro-6-morpholin-4-ylcyclohexa-2,4-dien-1-yl)amino]-5-(trifluoromethyl)pyridin-4-yl]amino]-N-methylbenzamide Chemical compound FC1(C(C=CC=C1)NC1=NC=C(C(=C1)NC1=C(C(=O)NC)C=CC=C1)C(F)(F)F)N1CCOCC1 QUSXVVFWLZVSRJ-UHFFFAOYSA-N 0.000 description 1
- QIPBEHJUIADJNG-UHFFFAOYSA-N 2-[[2-[4-(ethylamino)anilino]-5-(trifluoromethyl)pyridin-4-yl]amino]-5-fluoro-N-methylbenzamide Chemical compound C(C)NC1=CC=C(C=C1)NC1=NC=C(C(=C1)NC1=C(C(=O)NC)C=C(C=C1)F)C(F)(F)F QIPBEHJUIADJNG-UHFFFAOYSA-N 0.000 description 1
- HLDLFTQYMYQYSD-UHFFFAOYSA-N 2-[[2-[4-(ethylamino)anilino]-5-(trifluoromethyl)pyridin-4-yl]amino]-N-methylbenzamide Chemical compound C(C)NC1=CC=C(C=C1)NC1=NC=C(C(=C1)NC1=C(C(=O)NC)C=CC=C1)C(F)(F)F HLDLFTQYMYQYSD-UHFFFAOYSA-N 0.000 description 1
- ONHSWMIDCJLKQC-INIZCTEOSA-N 2-[[2-[4-[(3s)-3-hydroxypyrrolidine-1-carbonyl]-2-methoxyanilino]-5-(trifluoromethyl)pyridin-4-yl]amino]-n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2C(=CC(=CC=2)C(=O)N2C[C@@H](O)CC2)OC)=NC=C1C(F)(F)F ONHSWMIDCJLKQC-INIZCTEOSA-N 0.000 description 1
- IQQBFOIOCMVMKO-UHFFFAOYSA-N 2-[[2-chloro-5-(trifluoromethyl)pyridin-4-yl]amino]-4,5-difluoro-n-methylbenzamide Chemical compound CNC(=O)C1=CC(F)=C(F)C=C1NC1=CC(Cl)=NC=C1C(F)(F)F IQQBFOIOCMVMKO-UHFFFAOYSA-N 0.000 description 1
- GUTKDNPZKATMAV-UHFFFAOYSA-N 2-[[2-chloro-5-(trifluoromethyl)pyridin-4-yl]amino]-5-fluoro-n-methylbenzamide Chemical compound CNC(=O)C1=CC(F)=CC=C1NC1=CC(Cl)=NC=C1C(F)(F)F GUTKDNPZKATMAV-UHFFFAOYSA-N 0.000 description 1
- UYZMFPLRZIUBQF-UHFFFAOYSA-N 2-[[2-chloro-5-(trifluoromethyl)pyridin-4-yl]amino]-n-methyl-5-morpholin-4-ylbenzamide Chemical compound CNC(=O)C1=CC(N2CCOCC2)=CC=C1NC1=CC(Cl)=NC=C1C(F)(F)F UYZMFPLRZIUBQF-UHFFFAOYSA-N 0.000 description 1
- QMTKVUUGVKUFGI-UHFFFAOYSA-N 2-[[2-chloro-5-(trifluoromethyl)pyridin-4-yl]amino]-n-propan-2-ylbenzenesulfonamide Chemical compound CC(C)NS(=O)(=O)C1=CC=CC=C1NC1=CC(Cl)=NC=C1C(F)(F)F QMTKVUUGVKUFGI-UHFFFAOYSA-N 0.000 description 1
- CMSFXGFBVZDVNX-UHFFFAOYSA-N 2-[[5-cyano-2-(2-methoxy-4-thiomorpholin-4-ylanilino)pyridin-4-yl]amino]-n-methylbenzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2C(=CC(=CC=2)N2CCSCC2)OC)=NC=C1C#N CMSFXGFBVZDVNX-UHFFFAOYSA-N 0.000 description 1
- KQTGLOITUZJIRX-UHFFFAOYSA-N 2-amino-4,5-difluoro-n-methylbenzamide Chemical compound CNC(=O)C1=CC(F)=C(F)C=C1N KQTGLOITUZJIRX-UHFFFAOYSA-N 0.000 description 1
- WIWCLLBGLNIHMG-UHFFFAOYSA-N 2-amino-5-fluoro-n-methylbenzamide Chemical compound CNC(=O)C1=CC(F)=CC=C1N WIWCLLBGLNIHMG-UHFFFAOYSA-N 0.000 description 1
- SSEZSHJJNNLTQI-UHFFFAOYSA-N 2-amino-n-methylbenzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC=CC=C1N SSEZSHJJNNLTQI-UHFFFAOYSA-N 0.000 description 1
- KPIVDNYJNOPGBE-UHFFFAOYSA-N 2-aminonicotinic acid Chemical compound NC1=NC=CC=C1C(O)=O KPIVDNYJNOPGBE-UHFFFAOYSA-N 0.000 description 1
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- UUOLETYDNTVQDY-UHFFFAOYSA-N 2-chloro-3-nitropyridine Chemical compound [O-][N+](=O)C1=CC=CN=C1Cl UUOLETYDNTVQDY-UHFFFAOYSA-N 0.000 description 1
- LQCUYHYVQRABGZ-UHFFFAOYSA-N 2-chloro-n-(2-pyrazol-1-ylphenyl)-5-(trifluoromethyl)pyridin-4-amine Chemical compound FC(F)(F)C1=CN=C(Cl)C=C1NC1=CC=CC=C1N1N=CC=C1 LQCUYHYVQRABGZ-UHFFFAOYSA-N 0.000 description 1
- JJISFHBFVCKGBI-UHFFFAOYSA-N 2-chloro-n-(pyridin-2-ylmethyl)-5-(trifluoromethyl)pyridin-4-amine Chemical compound FC(F)(F)C1=CN=C(Cl)C=C1NCC1=CC=CC=N1 JJISFHBFVCKGBI-UHFFFAOYSA-N 0.000 description 1
- MNWCVSGFUYWDDB-UHFFFAOYSA-N 2-chloro-n-[(2-methylsulfonylphenyl)methyl]-5-(trifluoromethyl)pyridin-4-amine Chemical compound CS(=O)(=O)C1=CC=CC=C1CNC1=CC(Cl)=NC=C1C(F)(F)F MNWCVSGFUYWDDB-UHFFFAOYSA-N 0.000 description 1
- SWBWGMDCPNYARS-UHFFFAOYSA-N 2-chloro-n-[(3-methylsulfonylphenyl)methyl]-5-(trifluoromethyl)pyridin-4-amine Chemical compound CS(=O)(=O)C1=CC=CC(CNC=2C(=CN=C(Cl)C=2)C(F)(F)F)=C1 SWBWGMDCPNYARS-UHFFFAOYSA-N 0.000 description 1
- VSVLFZWIGLWDKW-UHFFFAOYSA-N 2-chloro-n-[2-(1,3-oxazol-2-yl)phenyl]-5-(trifluoromethyl)pyridin-4-amine Chemical compound FC(F)(F)C1=CN=C(Cl)C=C1NC1=CC=CC=C1C1=NC=CO1 VSVLFZWIGLWDKW-UHFFFAOYSA-N 0.000 description 1
- MPNXSZJPSVBLHP-UHFFFAOYSA-N 2-chloro-n-phenylpyridine-3-carboxamide Chemical compound ClC1=NC=CC=C1C(=O)NC1=CC=CC=C1 MPNXSZJPSVBLHP-UHFFFAOYSA-N 0.000 description 1
- JAUPUQRPBNDMDT-UHFFFAOYSA-N 2-chloropyridine-3-carbonitrile Chemical compound ClC1=NC=CC=C1C#N JAUPUQRPBNDMDT-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- XDIAZKGLEWYQGI-UHFFFAOYSA-N 2-methoxy-4-pyrimidin-5-ylaniline Chemical compound C1=C(N)C(OC)=CC(C=2C=NC=NC=2)=C1 XDIAZKGLEWYQGI-UHFFFAOYSA-N 0.000 description 1
- KYFHFHMEDGLVCC-UHFFFAOYSA-N 2-methoxy-N-phenylmorpholine-4-carboxamide Chemical compound COC1CN(CCO1)C(=O)NC1=CC=CC=C1 KYFHFHMEDGLVCC-UHFFFAOYSA-N 0.000 description 1
- CCFGTKQIRWHYTB-UHFFFAOYSA-N 2-methyl-3-nitropyridine Chemical compound CC1=NC=CC=C1[N+]([O-])=O CCFGTKQIRWHYTB-UHFFFAOYSA-N 0.000 description 1
- QMIRBGUWJFYHOG-UHFFFAOYSA-N 2-methyl-7-[[2-[(2-methyl-3-oxo-1h-isoindol-4-yl)amino]-5-(trifluoromethyl)pyridin-4-yl]amino]-3h-isoindol-1-one Chemical compound C=12C(=O)N(C)CC2=CC=CC=1NC(N=CC=1C(F)(F)F)=CC=1NC1=CC=CC2=C1C(=O)N(C)C2 QMIRBGUWJFYHOG-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- LLINQVYQJAQYON-UHFFFAOYSA-N 2-pyrimidin-2-ylaniline Chemical compound NC1=CC=CC=C1C1=NC=CC=N1 LLINQVYQJAQYON-UHFFFAOYSA-N 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- WMKYKQWKLILFBM-UHFFFAOYSA-N 2h-pyridine-1-carboxylic acid Chemical compound OC(=O)N1CC=CC=C1 WMKYKQWKLILFBM-UHFFFAOYSA-N 0.000 description 1
- ZRLITKUOEMAXMK-UHFFFAOYSA-N 3-N-[2-chloro-5-(trifluoromethyl)pyridin-4-yl]-1-N,1-N-dimethylpyridin-1-ium-1,3-diamine Chemical compound ClC1=NC=C(C(=C1)NC=1C=[N+](C=CC1)N(C)C)C(F)(F)F ZRLITKUOEMAXMK-UHFFFAOYSA-N 0.000 description 1
- CEJDJPPGABACHI-UHFFFAOYSA-N 3-[[2-chloro-5-(trifluoromethyl)pyridin-4-yl]amino]-n-methylpyrazine-2-carboxamide Chemical compound CNC(=O)C1=NC=CN=C1NC1=CC(Cl)=NC=C1C(F)(F)F CEJDJPPGABACHI-UHFFFAOYSA-N 0.000 description 1
- BOOMHTFCWOJWFO-UHFFFAOYSA-N 3-aminopyridine-2-carboxylic acid Chemical compound NC1=CC=CN=C1C(O)=O BOOMHTFCWOJWFO-UHFFFAOYSA-N 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- HGGRAOYTQNFGGN-UHFFFAOYSA-N 4,5-difluoro-2-nitrobenzoic acid Chemical compound OC(=O)C1=CC(F)=C(F)C=C1[N+]([O-])=O HGGRAOYTQNFGGN-UHFFFAOYSA-N 0.000 description 1
- UCWIUIKESGBOAZ-UHFFFAOYSA-N 4,5-difluoro-n-methyl-2-[[2-[(2-oxo-1,3-dihydroindol-5-yl)amino]-5-(trifluoromethyl)pyridin-4-yl]amino]benzamide Chemical compound CNC(=O)C1=CC(F)=C(F)C=C1NC1=CC(NC=2C=C3CC(=O)NC3=CC=2)=NC=C1C(F)(F)F UCWIUIKESGBOAZ-UHFFFAOYSA-N 0.000 description 1
- JCYMFYTVFVYHLZ-UHFFFAOYSA-N 4-N-(4-fluorophenyl)-4-N-methyl-2-N-[4-(1,2-oxazolidin-2-yl)phenyl]-5-(trifluoromethyl)pyridine-2,4-diamine Chemical compound FC=1C=CC(=CC1)N(C)C1=CC(=NC=C1C(F)(F)F)NC1=CC=C(C=C1)N1OCCC1 JCYMFYTVFVYHLZ-UHFFFAOYSA-N 0.000 description 1
- GXOCMIXHFWKVNS-UHFFFAOYSA-N 4-[(3-methylsulfonylphenyl)methyl]-5-(trifluoromethyl)-3H-pyridine-2,4-diamine Chemical compound CS(=O)(=O)C=1C=C(CC2(CC(=NC=C2C(F)(F)F)N)N)C=CC1 GXOCMIXHFWKVNS-UHFFFAOYSA-N 0.000 description 1
- XDQIAPFADFGQEF-UHFFFAOYSA-N 4-[[2-chloro-5-(trifluoromethyl)pyridin-4-yl]amino]-n-methylpyrimidine-5-carboxamide Chemical compound CNC(=O)C1=CN=CN=C1NC1=CC(Cl)=NC=C1C(F)(F)F XDQIAPFADFGQEF-UHFFFAOYSA-N 0.000 description 1
- IASBMUIXBJNMDW-UHFFFAOYSA-N 4-aminonicotinic acid Chemical compound NC1=CC=NC=C1C(O)=O IASBMUIXBJNMDW-UHFFFAOYSA-N 0.000 description 1
- ZUBDZQFROMAIPT-UHFFFAOYSA-N 4-aminopyrimidine-5-carboxylic acid Chemical compound NC1=NC=NC=C1C(O)=O ZUBDZQFROMAIPT-UHFFFAOYSA-N 0.000 description 1
- DPPDGUAWAYEQEX-UHFFFAOYSA-N 4-benzyl-2-N-(2-methoxy-4-morpholin-4-ylphenyl)-5-(trifluoromethyl)-3H-pyridine-2,4-diamine Chemical compound C(C1=CC=CC=C1)C1(CC(=NC=C1C(F)(F)F)NC1=C(C=C(C=C1)N1CCOCC1)OC)N DPPDGUAWAYEQEX-UHFFFAOYSA-N 0.000 description 1
- WLKUSVNHZXUEFO-UHFFFAOYSA-N 4-fluoro-2-methoxy-1-nitrobenzene Chemical compound COC1=CC(F)=CC=C1[N+]([O-])=O WLKUSVNHZXUEFO-UHFFFAOYSA-N 0.000 description 1
- RTLUPHDWSUGAOS-UHFFFAOYSA-N 4-iodopyridine Chemical compound IC1=CC=NC=C1 RTLUPHDWSUGAOS-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- JPUUZHZRCVFNOF-UHFFFAOYSA-N 5-[[2-chloro-5-(trifluoromethyl)pyridin-4-yl]amino]-n-methyl-1,3-thiazole-4-carboxamide Chemical compound N1=CSC(NC=2C(=CN=C(Cl)C=2)C(F)(F)F)=C1C(=O)NC JPUUZHZRCVFNOF-UHFFFAOYSA-N 0.000 description 1
- VMXPYPSHIZRRTQ-UHFFFAOYSA-N 5-[[4-(2-pyrimidin-2-ylanilino)-5-(trifluoromethyl)pyridin-2-yl]amino]indol-2-one Chemical compound N1=C(N=CC=C1)C1=C(C=CC=C1)NC1=CC(=NC=C1C(F)(F)F)NC1=CC2=CC(N=C2C=C1)=O VMXPYPSHIZRRTQ-UHFFFAOYSA-N 0.000 description 1
- CAQJLUZNNGMDRI-UHFFFAOYSA-N 5-[[4-(pyridin-2-ylamino)-5-(trifluoromethyl)pyridin-2-yl]amino]indol-2-one Chemical compound N1=C(C=CC=C1)NC1=CC(=NC=C1C(F)(F)F)NC1=CC2=CC(N=C2C=C1)=O CAQJLUZNNGMDRI-UHFFFAOYSA-N 0.000 description 1
- ZGLUKQQSWABKDH-UHFFFAOYSA-N 5-amino-1-methyl-3h-indol-2-one Chemical compound NC1=CC=C2N(C)C(=O)CC2=C1 ZGLUKQQSWABKDH-UHFFFAOYSA-N 0.000 description 1
- 125000004539 5-benzimidazolyl group Chemical group N1=CNC2=C1C=CC(=C2)* 0.000 description 1
- PYAJPJWSNVTPKH-UHFFFAOYSA-N 5-bromo-n-methyl-1,3-thiazole-4-carboxamide Chemical compound CNC(=O)C=1N=CSC=1Br PYAJPJWSNVTPKH-UHFFFAOYSA-N 0.000 description 1
- XDLWNEUYUGKDTC-UHFFFAOYSA-N 5-ethylsulfonyl-2-methoxyaniline Chemical compound CCS(=O)(=O)C1=CC=C(OC)C(N)=C1 XDLWNEUYUGKDTC-UHFFFAOYSA-N 0.000 description 1
- SSBLNEQRGILPEC-UHFFFAOYSA-N 5-fluoro-2-[[2-(1h-indazol-5-ylamino)-5-(trifluoromethyl)pyridin-4-yl]amino]-n-methylbenzamide Chemical compound CNC(=O)C1=CC(F)=CC=C1NC1=CC(NC=2C=C3C=NNC3=CC=2)=NC=C1C(F)(F)F SSBLNEQRGILPEC-UHFFFAOYSA-N 0.000 description 1
- GFWKWOIMKVQXHO-UHFFFAOYSA-N 5-fluoro-2-[[2-(3-methoxyanilino)-5-(trifluoromethyl)pyridin-4-yl]amino]-n-methylbenzamide Chemical compound CNC(=O)C1=CC(F)=CC=C1NC1=CC(NC=2C=C(OC)C=CC=2)=NC=C1C(F)(F)F GFWKWOIMKVQXHO-UHFFFAOYSA-N 0.000 description 1
- AFWGXASQQPEWFZ-UHFFFAOYSA-N 5-fluoro-N-methyl-2-[[2-[(2-oxoindol-5-yl)amino]-5-(trifluoromethyl)pyridin-4-yl]amino]benzamide Chemical compound FC=1C=CC(=C(C(=O)NC)C1)NC1=CC(=NC=C1C(F)(F)F)NC1=CC2=CC(N=C2C=C1)=O AFWGXASQQPEWFZ-UHFFFAOYSA-N 0.000 description 1
- OZFPSOBLQZPIAV-UHFFFAOYSA-N 5-nitro-1h-indole Chemical compound [O-][N+](=O)C1=CC=C2NC=CC2=C1 OZFPSOBLQZPIAV-UHFFFAOYSA-N 0.000 description 1
- BASHMPGSQMGBDZ-UHFFFAOYSA-N 5-pyrimidin-2-yl-1,3-thiazol-4-amine Chemical compound N1=CSC(C=2N=CC=CN=2)=C1N BASHMPGSQMGBDZ-UHFFFAOYSA-N 0.000 description 1
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 description 1
- ZWCDESVTDYBGII-UHFFFAOYSA-N 6-[[4-[(1-methyl-2H-pyridin-3-yl)amino]-5-(trifluoromethyl)pyridin-2-yl]amino]-3,4-dihydro-1H-quinolin-2-one Chemical compound CN1CC(=CC=C1)NC1=CC(=NC=C1C(F)(F)F)NC=1C=C2CCC(NC2=CC1)=O ZWCDESVTDYBGII-UHFFFAOYSA-N 0.000 description 1
- LUIYFWVGULLIAV-UHFFFAOYSA-N 6-[[4-[2-(methylaminomethyl)anilino]-5-(trifluoromethyl)pyridin-2-yl]amino]-3H-1,3-benzoxazol-2-one Chemical compound CNCC1=C(C=CC=C1)NC1=CC(=NC=C1C(F)(F)F)NC1=CC2=C(NC(O2)=O)C=C1 LUIYFWVGULLIAV-UHFFFAOYSA-N 0.000 description 1
- ULWJTPAOSJSHFG-UHFFFAOYSA-N 6-amino-1-methyl-3,4-dihydroquinolin-2-one Chemical compound NC1=CC=C2N(C)C(=O)CCC2=C1 ULWJTPAOSJSHFG-UHFFFAOYSA-N 0.000 description 1
- NFWVCYWFUIFIKU-UHFFFAOYSA-N 6-amino-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=CC(N)=CC=C21 NFWVCYWFUIFIKU-UHFFFAOYSA-N 0.000 description 1
- HJVIDUDMCNQPDX-UHFFFAOYSA-N 6-amino-n-[2-(diethylamino)ethyl]pyridine-3-carboxamide Chemical compound CCN(CC)CCNC(=O)C1=CC=C(N)N=C1 HJVIDUDMCNQPDX-UHFFFAOYSA-N 0.000 description 1
- SSAYHQQUDKQNAC-UHFFFAOYSA-N 6-chloro-2-methylpyrimidin-4-amine Chemical compound CC1=NC(N)=CC(Cl)=N1 SSAYHQQUDKQNAC-UHFFFAOYSA-N 0.000 description 1
- VQUKRPRYOARROK-UHFFFAOYSA-N 7-[[2-(2-methoxy-4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyridin-4-yl]amino]-2-methyl-3h-isoindol-1-one Chemical compound C=1C=C(NC=2N=CC(=C(NC=3C=4C(=O)N(C)CC=4C=CC=3)C=2)C(F)(F)F)C(OC)=CC=1N1CCOCC1 VQUKRPRYOARROK-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- 239000005964 Acibenzolar-S-methyl Substances 0.000 description 1
- 229930024421 Adenine Natural products 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 229920000856 Amylose Polymers 0.000 description 1
- CWMRDFOHHUAAHC-UHFFFAOYSA-N C(C)(C)(C)C1N(CCC(=C1)C1=CCC2=NC3=CC=CC(=C3C2=C1)N)C(=O)O Chemical compound C(C)(C)(C)C1N(CCC(=C1)C1=CCC2=NC3=CC=CC(=C3C2=C1)N)C(=O)O CWMRDFOHHUAAHC-UHFFFAOYSA-N 0.000 description 1
- FVCDYBYGHGPUCM-UHFFFAOYSA-N C1=CC(C(C=C1)([N+](=O)[O-])[N+](=O)[O-])S(=O)(=O)N Chemical compound C1=CC(C(C=C1)([N+](=O)[O-])[N+](=O)[O-])S(=O)(=O)N FVCDYBYGHGPUCM-UHFFFAOYSA-N 0.000 description 1
- YFDVIVUMXYWBQG-UHFFFAOYSA-N CC12C(C=C(N1)C(=C1C=CC(=N1)C=C1C=CC(N1)=CC=1C=CC(N1)=C2)[N+](=O)[O-])=O Chemical compound CC12C(C=C(N1)C(=C1C=CC(=N1)C=C1C=CC(N1)=CC=1C=CC(N1)=C2)[N+](=O)[O-])=O YFDVIVUMXYWBQG-UHFFFAOYSA-N 0.000 description 1
- XAFUBEBQZCKJIJ-UHFFFAOYSA-N CCNC1=CN=C(C=C1)NC2=NC=C(C(=C2)NC3=C(C=C(C=C3)F)C(=O)NC)C(F)(F)F Chemical compound CCNC1=CN=C(C=C1)NC2=NC=C(C(=C2)NC3=C(C=C(C=C3)F)C(=O)NC)C(F)(F)F XAFUBEBQZCKJIJ-UHFFFAOYSA-N 0.000 description 1
- VFUNREYPACCJPU-UHFFFAOYSA-N CN[N+]1=CC(=CC=C1)[N+](=O)[O-] Chemical compound CN[N+]1=CC(=CC=C1)[N+](=O)[O-] VFUNREYPACCJPU-UHFFFAOYSA-N 0.000 description 1
- DQERPLFVOZXCQO-UHFFFAOYSA-N CO.NC1=CC=C2CC(NC2=C1)=O Chemical compound CO.NC1=CC=C2CC(NC2=C1)=O DQERPLFVOZXCQO-UHFFFAOYSA-N 0.000 description 1
- PZTKNKUQLOYGNW-UHFFFAOYSA-N C[N+]1(CC(=CC=C1)N)C Chemical compound C[N+]1(CC(=CC=C1)N)C PZTKNKUQLOYGNW-UHFFFAOYSA-N 0.000 description 1
- 108010001857 Cell Surface Receptors Proteins 0.000 description 1
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 1
- 102000004266 Collagen Type IV Human genes 0.000 description 1
- 108010042086 Collagen Type IV Proteins 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 241000195493 Cryptophyta Species 0.000 description 1
- 102000010831 Cytoskeletal Proteins Human genes 0.000 description 1
- 108010037414 Cytoskeletal Proteins Proteins 0.000 description 1
- IGXWBGJHJZYPQS-SSDOTTSWSA-N D-Luciferin Chemical compound OC(=O)[C@H]1CSC(C=2SC3=CC=C(O)C=C3N=2)=N1 IGXWBGJHJZYPQS-SSDOTTSWSA-N 0.000 description 1
- MHZGKXUYDGKKIU-UHFFFAOYSA-N Decylamine Chemical compound CCCCCCCCCCN MHZGKXUYDGKKIU-UHFFFAOYSA-N 0.000 description 1
- CYCGRDQQIOGCKX-UHFFFAOYSA-N Dehydro-luciferin Natural products OC(=O)C1=CSC(C=2SC3=CC(O)=CC=C3N=2)=N1 CYCGRDQQIOGCKX-UHFFFAOYSA-N 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- 239000006144 Dulbecco’s modified Eagle's medium Substances 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 238000012286 ELISA Assay Methods 0.000 description 1
- 238000008157 ELISA kit Methods 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 102000016359 Fibronectins Human genes 0.000 description 1
- 108010067306 Fibronectins Proteins 0.000 description 1
- BJGNCJDXODQBOB-UHFFFAOYSA-N Fivefly Luciferin Natural products OC(=O)C1CSC(C=2SC3=CC(O)=CC=C3N=2)=N1 BJGNCJDXODQBOB-UHFFFAOYSA-N 0.000 description 1
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical compound NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Polymers OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 1
- 101000878540 Homo sapiens Protein-tyrosine kinase 2-beta Proteins 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- DDWFXDSYGUXRAY-UHFFFAOYSA-N Luciferin Natural products CCc1c(C)c(CC2NC(=O)C(=C2C=C)C)[nH]c1Cc3[nH]c4C(=C5/NC(CC(=O)O)C(C)C5CC(=O)O)CC(=O)c4c3C DDWFXDSYGUXRAY-UHFFFAOYSA-N 0.000 description 1
- 206010027476 Metastases Diseases 0.000 description 1
- MRVMSEMMHDGONK-UHFFFAOYSA-N N,N,3-trimethyl-4-[[4-[2-(methylaminomethyl)anilino]-5-(trifluoromethyl)pyridin-2-yl]amino]benzamide Chemical compound CN(C(C1=CC(=C(C=C1)NC1=NC=C(C(=C1)NC1=C(C=CC=C1)CNC)C(F)(F)F)C)=O)C MRVMSEMMHDGONK-UHFFFAOYSA-N 0.000 description 1
- OKIZCWYLBDKLSU-UHFFFAOYSA-M N,N,N-Trimethylmethanaminium chloride Chemical compound [Cl-].C[N+](C)(C)C OKIZCWYLBDKLSU-UHFFFAOYSA-M 0.000 description 1
- MLQUXABKWAYDGC-UHFFFAOYSA-N N,N-dimethyl-4-[[4-[2-(methylaminomethyl)anilino]-5-(trifluoromethyl)pyridin-2-yl]amino]benzamide Chemical compound CN(C(C1=CC=C(C=C1)NC1=NC=C(C(=C1)NC1=C(C=CC=C1)CNC)C(F)(F)F)=O)C MLQUXABKWAYDGC-UHFFFAOYSA-N 0.000 description 1
- IHMPGBCBQHANIC-UHFFFAOYSA-O N,N-dimethyl-6-[[4-[(1-methylpyridin-1-ium-3-yl)amino]-5-(trifluoromethyl)pyridin-2-yl]amino]pyridine-3-carboxamide Chemical compound CN(C(=O)C=1C=CC(=NC1)NC1=NC=C(C(=C1)NC=1C=[N+](C=CC1)C)C(F)(F)F)C IHMPGBCBQHANIC-UHFFFAOYSA-O 0.000 description 1
- IZLPUYNGGDLDRD-UHFFFAOYSA-N N,N-dimethyl-6-[[4-[2-[2-(methylamino)ethyl]anilino]-5-(trifluoromethyl)pyridin-2-yl]amino]pyridine-3-carboxamide Chemical compound CN(C(C1=CN=C(C=C1)NC1=NC=C(C(=C1)NC1=C(C=CC=C1)CCNC)C(F)(F)F)=O)C IZLPUYNGGDLDRD-UHFFFAOYSA-N 0.000 description 1
- UIYYPJYZRQCWGY-UHFFFAOYSA-N N-[2-(diethylamino)ethyl]-3-methoxy-4-[[4-[2-[2-(methylamino)ethyl]anilino]-5-(trifluoromethyl)pyridin-2-yl]amino]benzamide Chemical compound C(C)N(CCNC(C1=CC(=C(C=C1)NC1=NC=C(C(=C1)NC1=C(C=CC=C1)CCNC)C(F)(F)F)OC)=O)CC UIYYPJYZRQCWGY-UHFFFAOYSA-N 0.000 description 1
- BEHDEHVSMMQNAO-UHFFFAOYSA-N N-[2-(diethylamino)ethyl]-3-methyl-4-[[4-[2-[2-(methylamino)ethyl]anilino]-5-(trifluoromethyl)pyridin-2-yl]amino]benzamide Chemical compound C(C)N(CCNC(C1=CC(=C(C=C1)NC1=NC=C(C(=C1)NC1=C(C=CC=C1)CCNC)C(F)(F)F)C)=O)CC BEHDEHVSMMQNAO-UHFFFAOYSA-N 0.000 description 1
- TVLLVIWFUYKATL-UHFFFAOYSA-N N-methyl-2-[[2-[(2-oxoindol-5-yl)amino]-5-(trifluoromethyl)pyridin-4-yl]amino]benzamide Chemical compound CNC(C1=C(C=CC=C1)NC1=CC(=NC=C1C(F)(F)F)NC1=CC2=CC(N=C2C=C1)=O)=O TVLLVIWFUYKATL-UHFFFAOYSA-N 0.000 description 1
- KDXRQNYMELFKFW-UHFFFAOYSA-N N-methyl-3-[[2-[(2-oxoindol-5-yl)amino]-5-(trifluoromethyl)pyridin-4-yl]amino]pyridine-4-carboxamide Chemical compound CNC(C1=C(C=NC=C1)NC1=CC(=NC=C1C(F)(F)F)NC1=CC2=CC(N=C2C=C1)=O)=O KDXRQNYMELFKFW-UHFFFAOYSA-N 0.000 description 1
- ITUOJPWSSSFVRZ-UHFFFAOYSA-N N-methyl-6-[[4-[2-[2-(methylaminomethyl)hydrazinyl]anilino]-5-(trifluoromethyl)pyridin-2-yl]amino]pyridine-3-carboxamide Chemical compound CNC(C1=CN=C(C=C1)NC1=NC=C(C(=C1)NC1=C(C=CC=C1)NNCNC)C(F)(F)F)=O ITUOJPWSSSFVRZ-UHFFFAOYSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- ZCVPVCIRZIMSKJ-UHFFFAOYSA-N NC=1C=[N+](C=CC1)NC Chemical compound NC=1C=[N+](C=CC1)NC ZCVPVCIRZIMSKJ-UHFFFAOYSA-N 0.000 description 1
- 101150003085 Pdcl gene Proteins 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229920002732 Polyanhydride Polymers 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 229920000954 Polyglycolide Polymers 0.000 description 1
- 229920001710 Polyorthoester Polymers 0.000 description 1
- 229920001213 Polysorbate 20 Polymers 0.000 description 1
- 102100037787 Protein-tyrosine kinase 2-beta Human genes 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- ZGHCLQQCJGCIAH-UHFFFAOYSA-N [3-methoxy-4-[[4-[(3-methylsulfonylphenyl)methylamino]-5-(trifluoromethyl)pyridin-2-yl]amino]phenyl]-morpholin-4-ylmethanone Chemical compound COC1=CC(C(=O)N2CCOCC2)=CC=C1NC(N=CC=1C(F)(F)F)=CC=1NCC1=CC=CC(S(C)(=O)=O)=C1 ZGHCLQQCJGCIAH-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 229960000643 adenine Drugs 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 235000010419 agar Nutrition 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 150000005215 alkyl ethers Chemical class 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- RJGDLRCDCYRQOQ-UHFFFAOYSA-N anthrone Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3CC2=C1 RJGDLRCDCYRQOQ-UHFFFAOYSA-N 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 230000006907 apoptotic process Effects 0.000 description 1
- 239000008365 aqueous carrier Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 125000001691 aryl alkyl amino group Chemical group 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 239000012131 assay buffer Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- OGBUMNBNEWYMNJ-UHFFFAOYSA-N batilol Chemical class CCCCCCCCCCCCCCCCCCOCC(O)CO OGBUMNBNEWYMNJ-UHFFFAOYSA-N 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000010256 biochemical assay Methods 0.000 description 1
- 230000031018 biological processes and functions Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 229940116229 borneol Drugs 0.000 description 1
- CKDOCTFBFTVPSN-UHFFFAOYSA-N borneol Natural products C1CC2(C)C(C)CC1C2(C)C CKDOCTFBFTVPSN-UHFFFAOYSA-N 0.000 description 1
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 1
- 230000004712 cancer cell adhesion Effects 0.000 description 1
- 230000009400 cancer invasion Effects 0.000 description 1
- AIXAANGOTKPUOY-UHFFFAOYSA-N carbachol Chemical compound [Cl-].C[N+](C)(C)CCOC(N)=O AIXAANGOTKPUOY-UHFFFAOYSA-N 0.000 description 1
- 229960004484 carbachol Drugs 0.000 description 1
- 235000014633 carbohydrates Nutrition 0.000 description 1
- 150000001720 carbohydrates Chemical class 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 230000004709 cell invasion Effects 0.000 description 1
- 230000012292 cell migration Effects 0.000 description 1
- 230000009087 cell motility Effects 0.000 description 1
- 230000004663 cell proliferation Effects 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 235000010980 cellulose Nutrition 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000002676 chrysenyl group Chemical group C1(=CC=CC=2C3=CC=C4C=CC=CC4=C3C=CC12)* 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 238000002648 combination therapy Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000013270 controlled release Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 description 1
- 125000004367 cycloalkylaryl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004855 decalinyl group Chemical group C1(CCCC2CCCCC12)* 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 125000004986 diarylamino group Chemical group 0.000 description 1
- RAABOESOVLLHRU-UHFFFAOYSA-N diazene Chemical compound N=N RAABOESOVLLHRU-UHFFFAOYSA-N 0.000 description 1
- 229910000071 diazene Inorganic materials 0.000 description 1
- WMKGGPCROCCUDY-PHEQNACWSA-N dibenzylideneacetone Chemical compound C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 WMKGGPCROCCUDY-PHEQNACWSA-N 0.000 description 1
- 229940105990 diglycerin Drugs 0.000 description 1
- 125000000723 dihydrobenzofuranyl group Chemical group O1C(CC2=C1C=CC=C2)* 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- 150000002013 dioxins Chemical class 0.000 description 1
- 125000005879 dioxolanyl group Chemical group 0.000 description 1
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 1
- NYERCBJKHBDQGO-UHFFFAOYSA-N diphenyl(9h-xanthen-1-yl)phosphane Chemical compound C=12CC3=CC=CC=C3OC2=CC=CC=1P(C=1C=CC=CC=1)C1=CC=CC=C1 NYERCBJKHBDQGO-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- CNXMDTWQWLGCPE-UHFFFAOYSA-N ditert-butyl-(2-phenylphenyl)phosphane Chemical group CC(C)(C)P(C(C)(C)C)C1=CC=CC=C1C1=CC=CC=C1 CNXMDTWQWLGCPE-UHFFFAOYSA-N 0.000 description 1
- DTGKSKDOIYIVQL-UHFFFAOYSA-N dl-isoborneol Natural products C1CC2(C)C(O)CC1C2(C)C DTGKSKDOIYIVQL-UHFFFAOYSA-N 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- DEFVIWRASFVYLL-UHFFFAOYSA-N ethylene glycol bis(2-aminoethyl)tetraacetic acid Chemical compound OC(=O)CN(CC(O)=O)CCOCCOCCN(CC(O)=O)CC(O)=O DEFVIWRASFVYLL-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000003885 eye ointment Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 125000005567 fluorenylene group Chemical group 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 210000001650 focal adhesion Anatomy 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 238000005227 gel permeation chromatography Methods 0.000 description 1
- 238000007429 general method Methods 0.000 description 1
- 229940074045 glyceryl distearate Drugs 0.000 description 1
- 229940075507 glyceryl monostearate Drugs 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000002795 guanidino group Chemical group C(N)(=N)N* 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004475 heteroaralkyl group Chemical group 0.000 description 1
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 1
- 238000002868 homogeneous time resolved fluorescence Methods 0.000 description 1
- 150000002429 hydrazines Chemical group 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- 229940031574 hydroxymethyl cellulose Drugs 0.000 description 1
- 239000007943 implant Substances 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 125000003427 indacenyl group Chemical group 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007915 intraurethral administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 125000002346 iodo group Chemical group I* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- VFQXVTODMYMSMJ-UHFFFAOYSA-N isonicotinamide Chemical compound NC(=O)C1=CC=NC=C1 VFQXVTODMYMSMJ-UHFFFAOYSA-N 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 125000000654 isopropylidene group Chemical group C(C)(C)=* 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 239000002502 liposome Substances 0.000 description 1
- 239000011344 liquid material Substances 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 230000001926 lymphatic effect Effects 0.000 description 1
- 239000006166 lysate Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- 235000014380 magnesium carbonate Nutrition 0.000 description 1
- 230000003211 malignant effect Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 102000006240 membrane receptors Human genes 0.000 description 1
- 230000009401 metastasis Effects 0.000 description 1
- 208000037819 metastatic cancer Diseases 0.000 description 1
- 208000011575 metastatic malignant neoplasm Diseases 0.000 description 1
- GVNAJKLESILZHU-UHFFFAOYSA-N methyl 4-amino-2-methylsulfanyl-1,3-thiazole-5-carboxylate Chemical compound COC(=O)C=1SC(SC)=NC=1N GVNAJKLESILZHU-UHFFFAOYSA-N 0.000 description 1
- 239000000693 micelle Substances 0.000 description 1
- 239000011859 microparticle Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 230000004899 motility Effects 0.000 description 1
- IQEKCKQBCMCLQF-UHFFFAOYSA-N n,n-dimethyl-2-(5-nitro-1h-indol-3-yl)-2-oxoacetamide Chemical compound C1=C([N+]([O-])=O)C=C2C(C(=O)C(=O)N(C)C)=CNC2=C1 IQEKCKQBCMCLQF-UHFFFAOYSA-N 0.000 description 1
- QDGZSSQFFUKGMR-UHFFFAOYSA-N n,n-dimethyl-2-[[2-[(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)amino]-5-(trifluoromethyl)pyridin-4-yl]amino]benzamide Chemical compound CN(C)C(=O)C1=CC=CC=C1NC1=CC(NC=2C=C3CCC(=O)N(C)C3=CC=2)=NC=C1C(F)(F)F QDGZSSQFFUKGMR-UHFFFAOYSA-N 0.000 description 1
- MZRVEZGGRBJDDB-UHFFFAOYSA-N n-Butyllithium Substances [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 1
- MKCKLFZNSDBNFP-UHFFFAOYSA-N n-[3-[[[2-chloro-5-(trifluoromethyl)pyridin-4-yl]amino]methyl]pyridin-2-yl]-n-methylmethanesulfonamide Chemical compound CS(=O)(=O)N(C)C1=NC=CC=C1CNC1=CC(Cl)=NC=C1C(F)(F)F MKCKLFZNSDBNFP-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- UBPGPRYDVRLDEQ-UHFFFAOYSA-N n-methyl-2-[[2-(2-methyl-4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyridin-4-yl]amino]benzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2C(=CC(=CC=2)N2CCOCC2)C)=NC=C1C(F)(F)F UBPGPRYDVRLDEQ-UHFFFAOYSA-N 0.000 description 1
- VELUXFAMSJIQFI-UHFFFAOYSA-N n-methyl-2-[[2-(4-morpholin-4-ylanilino)-5-(trifluoromethyl)pyridin-4-yl]amino]benzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2C=CC(=CC=2)N2CCOCC2)=NC=C1C(F)(F)F VELUXFAMSJIQFI-UHFFFAOYSA-N 0.000 description 1
- IRQALLNJXFCIHM-UHFFFAOYSA-N n-methyl-2-[[2-(4-pyrimidin-5-ylanilino)-5-(trifluoromethyl)pyridin-4-yl]amino]benzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2C=CC(=CC=2)C=2C=NC=NC=2)=NC=C1C(F)(F)F IRQALLNJXFCIHM-UHFFFAOYSA-N 0.000 description 1
- OGDDTMYHKPXPJH-UHFFFAOYSA-N n-methyl-2-[[2-(pyridin-2-ylamino)-5-(trifluoromethyl)pyridin-4-yl]amino]benzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2N=CC=CC=2)=NC=C1C(F)(F)F OGDDTMYHKPXPJH-UHFFFAOYSA-N 0.000 description 1
- QJAWTHFHFZFMBT-UHFFFAOYSA-N n-methyl-2-[[2-(pyrimidin-2-ylamino)-5-(trifluoromethyl)pyridin-4-yl]amino]benzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2N=CC=CN=2)=NC=C1C(F)(F)F QJAWTHFHFZFMBT-UHFFFAOYSA-N 0.000 description 1
- IBCBPGYZAPWEKM-UHFFFAOYSA-N n-methyl-2-[[2-[(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)amino]-5-(trifluoromethyl)pyridin-4-yl]amino]benzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2C=C3CCC(=O)N(C)C3=CC=2)=NC=C1C(F)(F)F IBCBPGYZAPWEKM-UHFFFAOYSA-N 0.000 description 1
- LIGRMYLGRYLXFT-UHFFFAOYSA-N n-methyl-2-[[2-[(1-methyl-2-oxo-3h-indol-5-yl)amino]-5-(trifluoromethyl)pyridin-4-yl]amino]benzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2C=C3CC(=O)N(C)C3=CC=2)=NC=C1C(F)(F)F LIGRMYLGRYLXFT-UHFFFAOYSA-N 0.000 description 1
- MVAGVFJMGYSCGX-UHFFFAOYSA-N n-methyl-2-[[2-[(2-oxo-3,4-dihydro-1h-quinolin-6-yl)amino]-5-(trifluoromethyl)pyridin-4-yl]amino]benzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC=CC=C1NC1=CC(NC=2C=C3CCC(=O)NC3=CC=2)=NC=C1C(F)(F)F MVAGVFJMGYSCGX-UHFFFAOYSA-N 0.000 description 1
- KFKXNGWTXHAUFQ-UHFFFAOYSA-N n-methyl-2-[[2-[(3-methyl-2-oxo-1,3-benzoxazol-6-yl)amino]-5-(trifluoromethyl)pyridin-4-yl]amino]benzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2C=C3OC(=O)N(C)C3=CC=2)=NC=C1C(F)(F)F KFKXNGWTXHAUFQ-UHFFFAOYSA-N 0.000 description 1
- YXCIAQICOKCQGD-UHFFFAOYSA-N n-methyl-2-[[2-[(3-methylpyridin-2-yl)amino]-5-(trifluoromethyl)pyridin-4-yl]amino]benzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2C(=CC=CN=2)C)=NC=C1C(F)(F)F YXCIAQICOKCQGD-UHFFFAOYSA-N 0.000 description 1
- WEHMEAGFBBXUIZ-UHFFFAOYSA-N n-methyl-2-[[2-[(6-methylpyridin-2-yl)amino]-5-(trifluoromethyl)pyridin-4-yl]amino]benzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2N=C(C)C=CC=2)=NC=C1C(F)(F)F WEHMEAGFBBXUIZ-UHFFFAOYSA-N 0.000 description 1
- LTJYJOGZMKRPKF-UHFFFAOYSA-N n-methyl-2-[[2-[[3-(1,2,3,6-tetrahydropyridin-4-yl)-1h-indazol-5-yl]amino]-5-(trifluoromethyl)pyridin-4-yl]amino]benzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2C=C3C(C=4CCNCC=4)=NNC3=CC=2)=NC=C1C(F)(F)F LTJYJOGZMKRPKF-UHFFFAOYSA-N 0.000 description 1
- YCCQYRDZIRFLJG-UHFFFAOYSA-N n-methyl-2-[[2-[[3-(1,2,3,6-tetrahydropyridin-4-yl)-1h-indol-5-yl]amino]-5-(trifluoromethyl)pyridin-4-yl]amino]benzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2C=C3C(C=4CCNCC=4)=CNC3=CC=2)=NC=C1C(F)(F)F YCCQYRDZIRFLJG-UHFFFAOYSA-N 0.000 description 1
- WVDDMHLEWVESGD-UHFFFAOYSA-N n-methyl-2-[[2-[[5-(morpholine-4-carbonyl)pyridin-2-yl]amino]-5-(trifluoromethyl)pyridin-4-yl]amino]benzamide Chemical compound CNC(=O)C1=CC=CC=C1NC1=CC(NC=2N=CC(=CC=2)C(=O)N2CCOCC2)=NC=C1C(F)(F)F WVDDMHLEWVESGD-UHFFFAOYSA-N 0.000 description 1
- XIFJZJPMHNUGRA-UHFFFAOYSA-N n-methyl-4-nitroaniline Chemical compound CNC1=CC=C([N+]([O-])=O)C=C1 XIFJZJPMHNUGRA-UHFFFAOYSA-N 0.000 description 1
- VCNRFYBUVVKGEU-UHFFFAOYSA-N n-methyl-n-[3-[[[2-[(2-oxo-3h-1,3-benzoxazol-6-yl)amino]-5-(trifluoromethyl)pyridin-4-yl]amino]methyl]pyridin-2-yl]methanesulfonamide Chemical compound CS(=O)(=O)N(C)C1=NC=CC=C1CNC1=CC(NC=2C=C3OC(=O)NC3=CC=2)=NC=C1C(F)(F)F VCNRFYBUVVKGEU-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 150000004767 nitrides Chemical class 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 239000012053 oil suspension Substances 0.000 description 1
- 239000004006 olive oil Substances 0.000 description 1
- 235000008390 olive oil Nutrition 0.000 description 1
- 239000002997 ophthalmic solution Substances 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 125000000962 organic group Chemical group 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 229940127084 other anti-cancer agent Drugs 0.000 description 1
- 125000001715 oxadiazolyl group Chemical group 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 239000003002 pH adjusting agent Substances 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000005561 phenanthryl group Chemical group 0.000 description 1
- FVZVCSNXTFCBQU-UHFFFAOYSA-N phosphanyl Chemical group [PH2] FVZVCSNXTFCBQU-UHFFFAOYSA-N 0.000 description 1
- YHHSONZFOIEMCP-UHFFFAOYSA-O phosphocholine Chemical compound C[N+](C)(C)CCOP(O)(O)=O YHHSONZFOIEMCP-UHFFFAOYSA-O 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229950004354 phosphorylcholine Drugs 0.000 description 1
- 239000002504 physiological saline solution Substances 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 150000003864 primary ammonium salts Chemical class 0.000 description 1
- 125000003373 pyrazinyl group Chemical group 0.000 description 1
- 125000002206 pyridazin-3-yl group Chemical group [H]C1=C([H])C([H])=C(*)N=N1 0.000 description 1
- 125000004940 pyridazin-4-yl group Chemical group N1=NC=C(C=C1)* 0.000 description 1
- 125000004941 pyridazin-5-yl group Chemical group N1=NC=CC(=C1)* 0.000 description 1
- 125000006514 pyridin-2-ylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- LJXQPZWIHJMPQQ-UHFFFAOYSA-N pyrimidin-2-amine Chemical compound NC1=NC=CC=N1 LJXQPZWIHJMPQQ-UHFFFAOYSA-N 0.000 description 1
- 125000000246 pyrimidin-2-yl group Chemical group [H]C1=NC(*)=NC([H])=C1[H] 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 125000004528 pyrimidin-5-yl group Chemical group N1=CN=CC(=C1)* 0.000 description 1
- 125000004943 pyrimidin-6-yl group Chemical group N1=CN=CC=C1* 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003865 secondary ammonium salts Chemical class 0.000 description 1
- 239000012056 semi-solid material Substances 0.000 description 1
- 230000019491 signal transduction Effects 0.000 description 1
- 230000011664 signaling Effects 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 125000001010 sulfinic acid amide group Chemical group 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 125000006296 sulfonyl amino group Chemical group [H]N(*)S(*)(=O)=O 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- FQSYPZJBFOLHQZ-UHFFFAOYSA-N tert-butyl 4-(5-amino-1h-indazol-3-yl)-3,6-dihydro-2h-pyridine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC(C=2C3=CC(N)=CC=C3NN=2)=C1 FQSYPZJBFOLHQZ-UHFFFAOYSA-N 0.000 description 1
- SVFQWDXQGMOVNW-UHFFFAOYSA-N tert-butyl 4-(5-amino-1h-indol-3-yl)-3,6-dihydro-2h-pyridine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC(C=2C3=CC(N)=CC=C3NC=2)=C1 SVFQWDXQGMOVNW-UHFFFAOYSA-N 0.000 description 1
- FZSVVFOVVIFLQV-UHFFFAOYSA-N tert-butyl 4-(5-nitro-1h-indazol-3-yl)-3,6-dihydro-2h-pyridine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC(C=2C3=CC(=CC=C3NN=2)[N+]([O-])=O)=C1 FZSVVFOVVIFLQV-UHFFFAOYSA-N 0.000 description 1
- RERYBXVNHMAABS-UHFFFAOYSA-N tert-butyl 4-(5-nitro-1h-indol-3-yl)-3,6-dihydro-2h-pyridine-1-carboxylate Chemical compound C1N(C(=O)OC(C)(C)C)CCC(C=2C3=CC(=CC=C3NC=2)[N+]([O-])=O)=C1 RERYBXVNHMAABS-UHFFFAOYSA-N 0.000 description 1
- 150000003866 tertiary ammonium salts Chemical class 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000001113 thiadiazolyl group Chemical group 0.000 description 1
- 125000004927 thianaphthalenyl group Chemical group S1C(C=CC2=CC=CC=C12)* 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 150000003626 triacylglycerols Chemical class 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical group CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 210000004881 tumor cell Anatomy 0.000 description 1
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 1
- 239000003981 vehicle Substances 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 229940075420 xanthine Drugs 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/10—Spiro-condensed systems
- C07D491/113—Spiro-condensed systems with two or more oxygen atoms as ring hetero atoms in the oxygen-containing ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
- A61P35/04—Antineoplastic agents specific for metastasis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/74—Amino or imino radicals substituted by hydrocarbon or substituted hydrocarbon radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/81—Amides; Imides
- C07D213/82—Amides; Imides in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/84—Nitriles
- C07D213/85—Nitriles in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Medicinal Chemistry (AREA)
- Oncology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Pyridine Compounds (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US89537907P | 2007-03-16 | 2007-03-16 | |
| US94663707P | 2007-06-27 | 2007-06-27 | |
| US3002508P | 2008-02-20 | 2008-02-20 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| TW200901996A TW200901996A (en) | 2009-01-16 |
| TWI536991B true TWI536991B (zh) | 2016-06-11 |
Family
ID=39628767
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| TW097109125A TWI536991B (zh) | 2007-03-16 | 2008-03-14 | 黏著斑激酶之抑制劑 |
| TW105104283A TW201618780A (zh) | 2007-03-16 | 2008-03-14 | 黏著斑激酶之抑制劑 |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| TW105104283A TW201618780A (zh) | 2007-03-16 | 2008-03-14 | 黏著斑激酶之抑制劑 |
Country Status (10)
| Country | Link |
|---|---|
| US (2) | US8501763B2 (enExample) |
| EP (2) | EP2134689B1 (enExample) |
| JP (2) | JP5569956B2 (enExample) |
| CN (2) | CN101679264A (enExample) |
| CA (1) | CA2681015C (enExample) |
| DK (1) | DK2134689T3 (enExample) |
| ES (1) | ES2485040T3 (enExample) |
| PL (1) | PL2134689T3 (enExample) |
| TW (2) | TWI536991B (enExample) |
| WO (1) | WO2008115369A2 (enExample) |
Families Citing this family (44)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP5569956B2 (ja) | 2007-03-16 | 2014-08-13 | ザ スクリプス リサーチ インスティテュート | 接着斑キナーゼのインヒビター |
| GB0719644D0 (en) * | 2007-10-05 | 2007-11-14 | Cancer Rec Tech Ltd | Therapeutic compounds and their use |
| US20100317663A1 (en) * | 2008-02-19 | 2010-12-16 | Jerry Leroy Adams | Anilinopyridines as inhibitors of fak |
| GB0803018D0 (en) | 2008-02-19 | 2008-03-26 | Cancer Rec Tech Ltd | Therapeutic compounds and their use |
| CN102124000B (zh) | 2008-06-17 | 2014-09-17 | 阿斯利康(瑞典)有限公司 | 吡啶化合物 |
| JO3067B1 (ar) * | 2008-10-27 | 2017-03-15 | Glaxosmithkline Llc | بيرميدينات بيرازولو امينو كمثبطات ل fak |
| EP2394993A4 (en) * | 2008-12-10 | 2012-05-30 | Dong Wha Pharm Co Ltd | A NEW 2,6-SUBSTITUTED 3-NITROPYRIDINE DERIVATIVE, METHOD FOR ITS PREPARATION AND PHARMACEUTICAL COMPOSITION CONTAINING THEREOF |
| US20120196858A1 (en) * | 2009-08-12 | 2012-08-02 | Poniard Pharmaceuticals ,Inc. | Method of promoting apoptosis and inhibiting metastasis |
| CN103003264B (zh) | 2010-05-21 | 2014-08-06 | 切米利亚股份公司 | 嘧啶衍生物 |
| JP5936609B2 (ja) * | 2010-06-29 | 2016-06-22 | ベラステム インコーポレイテッド | キナーゼインヒビターの経口製剤 |
| JP5923499B2 (ja) | 2010-06-30 | 2016-05-24 | ベラステム インコーポレイテッド | キナーゼインヒビターの合成および使用 |
| DE102010034699A1 (de) | 2010-08-18 | 2012-02-23 | Merck Patent Gmbh | Pyrimidinderivate |
| US20120244141A1 (en) | 2010-09-28 | 2012-09-27 | Boehringer Ingelheim International Gmbh | Stratification of cancer patients for susceptibility to therapy with PTK2 inhibitors |
| EA201391076A1 (ru) * | 2011-01-26 | 2014-07-30 | Глэксосмитклайн Интеллекчуал Проперти Лимитед | Комбинации |
| EP2675794B1 (en) | 2011-02-17 | 2019-02-13 | Cancer Therapeutics Crc Pty Limited | Selective fak inhibitors |
| DK2675793T3 (en) | 2011-02-17 | 2018-11-12 | Cancer Therapeutics Crc Pty Ltd | FAK INHIBITORS |
| CA2830129C (en) | 2011-03-24 | 2016-07-19 | Chemilia Ab | Novel pyrimidine derivatives |
| DE102011111400A1 (de) | 2011-08-23 | 2013-02-28 | Merck Patent Gmbh | Bicyclische heteroaromatische Verbindungen |
| US9040540B2 (en) | 2011-11-09 | 2015-05-26 | Cancer Research Technology Limited | 5-(pyridin-2-yl-amino)-pyrazine-2-carbonitrile compounds and their therapeutic use |
| KR20210156333A (ko) * | 2012-05-15 | 2021-12-24 | 캔써 리서치 테크놀로지 리미티드 | 5-[[4-[[모르폴린-2-일]메틸아미노]-5-(트리플루오로메틸)-2-피리딜]아미노]피라진-2-카보니트릴 및 그의 치료적 용도 |
| KR20150087400A (ko) | 2012-11-20 | 2015-07-29 | 버텍스 파마슈티칼스 인코포레이티드 | 인돌아민 2,3-디옥시게나제의 억제제로서 유용한 화합물 |
| BR112015027381A8 (pt) * | 2013-05-01 | 2018-01-30 | Hoffmann La Roche | pirimidinas substituídas por heterocicloalquila ligadas ao c e seus usos |
| WO2015035199A1 (en) * | 2013-09-06 | 2015-03-12 | Mayo Foundation For Medical Education And Research | Neem compositions used for the treatment of cancer |
| WO2015054477A1 (en) | 2013-10-09 | 2015-04-16 | The General Hospital Corporation | Methods of diagnosing and treating b cell acute lymphoblastic leukemia |
| TWI713455B (zh) | 2014-06-25 | 2020-12-21 | 美商伊凡克特治療公司 | MnK抑制劑及其相關方法 |
| CN108289892B (zh) | 2015-06-29 | 2021-11-23 | 维瑞斯特姆股份有限公司 | 治疗组合物、组合和使用方法 |
| KR20180070696A (ko) | 2015-10-29 | 2018-06-26 | 이펙터 테라퓨틱스, 인크. | Mnk1 및 mnk2를 억제하는 피롤로-, 피라졸로-, 이미다조-피리미딘 및 피리딘 화합물 |
| SG11201803242TA (en) | 2015-10-29 | 2018-05-30 | Effector Therapeutics Inc | Isoindoline, azaisoindoline, dihydroindenone and dihydroazaindenone inhibitors of mnk1 and mnk2 |
| WO2017087808A1 (en) | 2015-11-20 | 2017-05-26 | Effector Therapeutics, Inc. | Heterocyclic compounds that inhibit the kinase activity of mnk useful for treating various cancers |
| DK3380465T3 (da) * | 2015-11-26 | 2020-10-26 | Novartis Ag | Diaminopyridinderivativer |
| JOP20190024A1 (ar) | 2016-08-26 | 2019-02-19 | Gilead Sciences Inc | مركبات بيروليزين بها استبدال واستخداماتها |
| WO2018152117A1 (en) | 2017-02-14 | 2018-08-23 | Effector Therapeutics, Inc. | Piperidine-substituted mnk inhibitors and methods related thereto |
| KR102526964B1 (ko) | 2018-02-26 | 2023-04-28 | 길리애드 사이언시즈, 인코포레이티드 | Hbv 복제 억제제로서의 치환된 피롤리진 화합물 |
| EP3765085A1 (en) | 2018-03-12 | 2021-01-20 | Université de Paris | Use of caloric restriction mimetics for potentiating chemo-immunotherapy for the treatment of cancers |
| WO2020069117A1 (en) * | 2018-09-27 | 2020-04-02 | Dana-Farber Cancer Institute, Inc. | Degradation of fak or fak and alk by conjugation of fak and alk inhibitors with e3 ligase ligands and methods of use |
| US11130757B2 (en) | 2018-10-24 | 2021-09-28 | Effector Therapeutics Inc. | Crystalline forms of MNK inhibitors |
| CN110724137B (zh) * | 2019-11-13 | 2021-03-30 | 广东工业大学 | 一种噻吩类衍生物及其制备方法与应用 |
| CN111233834B (zh) * | 2020-03-09 | 2021-08-31 | 北京师范大学 | 一类靶向fak的化合物和其标记物、及它们的制备方法和应用 |
| WO2021237121A1 (en) * | 2020-05-21 | 2021-11-25 | Gossamer Bio Services, Inc. | Substituted pyridines |
| CN114181257B (zh) * | 2020-09-14 | 2025-02-14 | 四川科伦博泰生物医药股份有限公司 | 吡啶类化合物,包含其的药物组合物,其制备方法及其用途 |
| WO2022133046A2 (en) * | 2020-12-16 | 2022-06-23 | Ifm Due, Inc. | Compounds and compositions for treating conditions associated with sting activity |
| GB202113079D0 (en) * | 2021-09-14 | 2021-10-27 | Ucl Business Ltd | New therapy |
| WO2023218245A1 (en) * | 2022-05-13 | 2023-11-16 | Voronoi Inc. | Heteroaryl derivative compounds, and pharmaceutical composition comprising thereof |
| CN121335887A (zh) * | 2023-06-08 | 2026-01-13 | 希格生科(深圳)有限公司 | 含氮芳环化合物及其医药用途 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| KR100521735B1 (ko) * | 2000-02-25 | 2005-10-17 | 에프. 호프만-라 로슈 아게 | 아데노신 수용체 조절인자 |
| GB0004887D0 (en) * | 2000-03-01 | 2000-04-19 | Astrazeneca Uk Ltd | Chemical compounds |
| GB0004888D0 (en) | 2000-03-01 | 2000-04-19 | Astrazeneca Uk Ltd | Chemical compounds |
| GB0206215D0 (en) | 2002-03-15 | 2002-05-01 | Novartis Ag | Organic compounds |
| TW200409629A (en) * | 2002-06-27 | 2004-06-16 | Bristol Myers Squibb Co | 2,4-disubstituted-pyridine N-oxides useful as HIV reverse transcriptase inhibitors |
| EP1542989B1 (en) * | 2002-07-31 | 2007-04-18 | Critical Outcome Technologies, Inc. | Protein tyrosine kinase inhibitors |
| EP2222647B1 (en) | 2006-10-23 | 2015-08-05 | Cephalon, Inc. | Fused bicyclic derivatives of 2,4-diaminopyrimidine as alk and c-met inhibitors |
| ME00811B (me) | 2006-12-08 | 2012-03-20 | Novartis Ag | JEDINJENJA l KOMPOZICIJE KAO INHIBITORI PROTEIN KINAZE |
| KR101364277B1 (ko) * | 2006-12-08 | 2014-02-21 | 아이알엠 엘엘씨 | 단백질 키나제 억제제로서의 화합물 |
| JP5569956B2 (ja) | 2007-03-16 | 2014-08-13 | ザ スクリプス リサーチ インスティテュート | 接着斑キナーゼのインヒビター |
| US20100317663A1 (en) | 2008-02-19 | 2010-12-16 | Jerry Leroy Adams | Anilinopyridines as inhibitors of fak |
-
2008
- 2008-03-10 JP JP2009553600A patent/JP5569956B2/ja not_active Expired - Fee Related
- 2008-03-10 US US12/531,010 patent/US8501763B2/en not_active Expired - Fee Related
- 2008-03-10 CN CN200880015910A patent/CN101679264A/zh active Pending
- 2008-03-10 EP EP08726698.7A patent/EP2134689B1/en not_active Not-in-force
- 2008-03-10 PL PL08726698T patent/PL2134689T3/pl unknown
- 2008-03-10 EP EP13189112.9A patent/EP2727909A1/en not_active Withdrawn
- 2008-03-10 WO PCT/US2008/003205 patent/WO2008115369A2/en not_active Ceased
- 2008-03-10 CA CA2681015A patent/CA2681015C/en not_active Expired - Fee Related
- 2008-03-10 ES ES08726698.7T patent/ES2485040T3/es active Active
- 2008-03-10 DK DK08726698.7T patent/DK2134689T3/da active
- 2008-03-10 CN CN201310403215.3A patent/CN103588704B/zh not_active Expired - Fee Related
- 2008-03-14 TW TW097109125A patent/TWI536991B/zh not_active IP Right Cessation
- 2008-03-14 TW TW105104283A patent/TW201618780A/zh unknown
-
2013
- 2013-06-19 US US13/921,663 patent/US9580439B2/en not_active Expired - Fee Related
-
2014
- 2014-05-20 JP JP2014104005A patent/JP2014148542A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| ES2485040T3 (es) | 2014-08-12 |
| DK2134689T3 (da) | 2014-06-30 |
| EP2134689A2 (en) | 2009-12-23 |
| CA2681015A1 (en) | 2008-09-25 |
| WO2008115369A3 (en) | 2008-11-13 |
| US8501763B2 (en) | 2013-08-06 |
| US20110046121A1 (en) | 2011-02-24 |
| JP5569956B2 (ja) | 2014-08-13 |
| WO2008115369A2 (en) | 2008-09-25 |
| PL2134689T3 (pl) | 2014-10-31 |
| TW200901996A (en) | 2009-01-16 |
| CN103588704B (zh) | 2016-09-14 |
| JP2014148542A (ja) | 2014-08-21 |
| CN101679264A (zh) | 2010-03-24 |
| JP2010521458A (ja) | 2010-06-24 |
| EP2727909A1 (en) | 2014-05-07 |
| CN103588704A (zh) | 2014-02-19 |
| US9580439B2 (en) | 2017-02-28 |
| TW201618780A (zh) | 2016-06-01 |
| EP2134689B1 (en) | 2014-04-23 |
| CA2681015C (en) | 2016-06-21 |
| US20130281443A1 (en) | 2013-10-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| TWI536991B (zh) | 黏著斑激酶之抑制劑 | |
| JP2010521458A5 (enExample) | ||
| US20230265054A1 (en) | Pyridyl inhibitors of hedgehog signalling | |
| JP7175888B2 (ja) | 選択的hdac1、2阻害剤としてのピペラジン誘導体 | |
| AU2014367283B2 (en) | Maleimide derivatives as modulators of WNT pathway | |
| CN101072755A (zh) | Hedgehog信号转导的吡啶基抑制剂 | |
| KR20160132470A (ko) | 피페리딘-다이온 유도체 | |
| JP2021519263A (ja) | 化合物及びその使用 | |
| TW202332437A (zh) | 新穎hdac抑制劑及其治療用途 | |
| WO2015187094A1 (en) | Phthalimide derivatives as modulators of wnt pathway | |
| TW202412773A (zh) | 雜芳基衍生化合物及其用途 | |
| HK1194380B (en) | Inhibitors of focal adhesion kinase | |
| HK1194380A (en) | Inhibitors of focal adhesion kinase | |
| HK1141521A (en) | Inhibitors of focal adhesion kinase | |
| AU2019226273A1 (en) | Pyridyl inhibitors of hedgehog signalling | |
| HK1183019A (en) | Pyridyl inhibitors of hedgehog signalling |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Annulment or lapse of patent due to non-payment of fees |