TWI494325B - 溴化阻燃劑及其前驅物 - Google Patents
溴化阻燃劑及其前驅物 Download PDFInfo
- Publication number
- TWI494325B TWI494325B TW098140799A TW98140799A TWI494325B TW I494325 B TWI494325 B TW I494325B TW 098140799 A TW098140799 A TW 098140799A TW 98140799 A TW98140799 A TW 98140799A TW I494325 B TWI494325 B TW I494325B
- Authority
- TW
- Taiwan
- Prior art keywords
- range
- toluene
- styrene
- reaction mixture
- distribution
- Prior art date
Links
- 239000003063 flame retardant Substances 0.000 title claims description 81
- 239000002243 precursor Substances 0.000 title description 2
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 972
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 364
- 238000009826 distribution Methods 0.000 claims description 271
- 229920000642 polymer Polymers 0.000 claims description 246
- 239000000203 mixture Substances 0.000 claims description 240
- 239000011541 reaction mixture Substances 0.000 claims description 234
- 239000000243 solution Substances 0.000 claims description 191
- 238000000034 method Methods 0.000 claims description 174
- 229910052794 bromium Inorganic materials 0.000 claims description 157
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 claims description 148
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 146
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 146
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 125
- 229910001868 water Inorganic materials 0.000 claims description 124
- 238000005893 bromination reaction Methods 0.000 claims description 117
- 230000031709 bromination Effects 0.000 claims description 104
- QFGALIZFMJDZQJ-UHFFFAOYSA-N styrene;toluene Chemical compound CC1=CC=CC=C1.C=CC1=CC=CC=C1 QFGALIZFMJDZQJ-UHFFFAOYSA-N 0.000 claims description 98
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 claims description 85
- 238000010791 quenching Methods 0.000 claims description 80
- 239000000463 material Substances 0.000 claims description 74
- 238000006243 chemical reaction Methods 0.000 claims description 71
- VEAFKIYNHVBNIP-UHFFFAOYSA-N 1,3-Diphenylpropane Chemical compound C=1C=CC=CC=1CCCC1=CC=CC=C1 VEAFKIYNHVBNIP-UHFFFAOYSA-N 0.000 claims description 68
- 230000000171 quenching effect Effects 0.000 claims description 66
- 238000012546 transfer Methods 0.000 claims description 58
- 239000002904 solvent Substances 0.000 claims description 56
- 229920005989 resin Polymers 0.000 claims description 55
- 239000011347 resin Substances 0.000 claims description 55
- 238000005191 phase separation Methods 0.000 claims description 54
- 238000005406 washing Methods 0.000 claims description 51
- 239000003054 catalyst Substances 0.000 claims description 47
- -1 alkyl lithium Chemical compound 0.000 claims description 45
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims description 39
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 33
- 238000009472 formulation Methods 0.000 claims description 31
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 claims description 30
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 claims description 30
- 238000011282 treatment Methods 0.000 claims description 29
- 239000012074 organic phase Substances 0.000 claims description 28
- 238000012360 testing method Methods 0.000 claims description 27
- 229910052744 lithium Inorganic materials 0.000 claims description 25
- 229920005669 high impact polystyrene Polymers 0.000 claims description 24
- 239000004797 high-impact polystyrene Substances 0.000 claims description 24
- 239000008346 aqueous phase Substances 0.000 claims description 23
- 239000003795 chemical substances by application Substances 0.000 claims description 22
- 239000011521 glass Substances 0.000 claims description 22
- 238000002156 mixing Methods 0.000 claims description 20
- 150000003440 styrenes Chemical class 0.000 claims description 20
- 229910052751 metal Inorganic materials 0.000 claims description 18
- 239000002184 metal Substances 0.000 claims description 18
- 125000003118 aryl group Chemical group 0.000 claims description 17
- 230000009477 glass transition Effects 0.000 claims description 13
- 229920001169 thermoplastic Polymers 0.000 claims description 13
- 238000013019 agitation Methods 0.000 claims description 12
- JPOXNPPZZKNXOV-UHFFFAOYSA-N bromochloromethane Chemical compound ClCBr JPOXNPPZZKNXOV-UHFFFAOYSA-N 0.000 claims description 12
- 238000000926 separation method Methods 0.000 claims description 12
- 239000004416 thermosoftening plastic Substances 0.000 claims description 11
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 claims description 10
- 101150065749 Churc1 gene Proteins 0.000 claims description 10
- 102100038239 Protein Churchill Human genes 0.000 claims description 10
- 150000001875 compounds Chemical class 0.000 claims description 10
- 229920001187 thermosetting polymer Polymers 0.000 claims description 10
- 230000000670 limiting effect Effects 0.000 claims description 9
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 claims description 8
- 229910052782 aluminium Inorganic materials 0.000 claims description 8
- FNXLCIKXHOPCKH-UHFFFAOYSA-N bromamine Chemical compound BrN FNXLCIKXHOPCKH-UHFFFAOYSA-N 0.000 claims description 8
- 229920003247 engineering thermoplastic Polymers 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 7
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 229920003986 novolac Polymers 0.000 claims description 6
- 238000000149 argon plasma sintering Methods 0.000 claims description 5
- 229920000728 polyester Polymers 0.000 claims description 5
- 239000011342 resin composition Substances 0.000 claims description 5
- 230000004580 weight loss Effects 0.000 claims description 5
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 4
- 238000001514 detection method Methods 0.000 claims description 4
- 239000012299 nitrogen atmosphere Substances 0.000 claims description 4
- ODLMAHJVESYWTB-UHFFFAOYSA-N propylbenzene Chemical compound CCCC1=CC=CC=C1 ODLMAHJVESYWTB-UHFFFAOYSA-N 0.000 claims description 4
- 239000003586 protic polar solvent Substances 0.000 claims description 4
- 125000001246 bromo group Chemical group Br* 0.000 claims description 3
- 239000007864 aqueous solution Substances 0.000 claims description 2
- 229920006345 thermoplastic polyamide Polymers 0.000 claims description 2
- PQLAYKMGZDUDLQ-UHFFFAOYSA-K aluminium bromide Chemical group Br[Al](Br)Br PQLAYKMGZDUDLQ-UHFFFAOYSA-K 0.000 claims 2
- 239000007791 liquid phase Substances 0.000 claims 2
- 229920005672 polyolefin resin Polymers 0.000 claims 1
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 136
- 239000000047 product Substances 0.000 description 97
- 238000004458 analytical method Methods 0.000 description 90
- 238000005227 gel permeation chromatography Methods 0.000 description 88
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 84
- 229910052757 nitrogen Inorganic materials 0.000 description 84
- 230000015572 biosynthetic process Effects 0.000 description 62
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 60
- 238000011068 loading method Methods 0.000 description 55
- 239000000306 component Substances 0.000 description 53
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 48
- 230000008569 process Effects 0.000 description 41
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- 239000012279 sodium borohydride Substances 0.000 description 30
- 229910000033 sodium borohydride Inorganic materials 0.000 description 30
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 26
- 239000000839 emulsion Substances 0.000 description 25
- 239000010408 film Substances 0.000 description 25
- 239000007788 liquid Substances 0.000 description 25
- 238000010438 heat treatment Methods 0.000 description 24
- 230000006870 function Effects 0.000 description 23
- 230000002829 reductive effect Effects 0.000 description 23
- YYLMGEBQHHVBAN-UHFFFAOYSA-N 1,5-diphenylpentan-3-ylbenzene Chemical compound C=1C=CC=CC=1CCC(C=1C=CC=CC=1)CCC1=CC=CC=C1 YYLMGEBQHHVBAN-UHFFFAOYSA-N 0.000 description 22
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 22
- 239000004793 Polystyrene Substances 0.000 description 22
- 125000000129 anionic group Chemical group 0.000 description 22
- 239000012986 chain transfer agent Substances 0.000 description 22
- 238000011049 filling Methods 0.000 description 22
- 229920002223 polystyrene Polymers 0.000 description 22
- 239000000126 substance Substances 0.000 description 22
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 20
- FKLHPAQZDKDOPI-UHFFFAOYSA-N 1,5,7-triphenylheptan-3-ylbenzene Chemical compound C=1C=CC=CC=1CCC(C=1C=CC=CC=1)CC(C=1C=CC=CC=1)CCC1=CC=CC=C1 FKLHPAQZDKDOPI-UHFFFAOYSA-N 0.000 description 18
- 238000001577 simple distillation Methods 0.000 description 18
- 238000003756 stirring Methods 0.000 description 18
- 230000000052 comparative effect Effects 0.000 description 17
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 17
- 229920001577 copolymer Polymers 0.000 description 16
- 239000012071 phase Substances 0.000 description 16
- CUQOHAYJWVTKDE-UHFFFAOYSA-N potassium;butan-1-olate Chemical compound [K+].CCCC[O-] CUQOHAYJWVTKDE-UHFFFAOYSA-N 0.000 description 16
- 239000003426 co-catalyst Substances 0.000 description 15
- 230000036961 partial effect Effects 0.000 description 15
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 15
- 238000010926 purge Methods 0.000 description 14
- 239000003153 chemical reaction reagent Substances 0.000 description 13
- 238000001816 cooling Methods 0.000 description 13
- 238000006116 polymerization reaction Methods 0.000 description 13
- 230000002378 acidificating effect Effects 0.000 description 12
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 12
- 238000012545 processing Methods 0.000 description 12
- 229910001220 stainless steel Inorganic materials 0.000 description 12
- 239000010935 stainless steel Substances 0.000 description 12
- 239000003085 diluting agent Substances 0.000 description 11
- 239000000178 monomer Substances 0.000 description 11
- 239000007787 solid Substances 0.000 description 11
- 238000002411 thermogravimetry Methods 0.000 description 11
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 10
- MKXBTQGKFHSGOG-UHFFFAOYSA-N [K+].[K+].CCCC[O-].CCCC[O-] Chemical compound [K+].[K+].CCCC[O-].CCCC[O-] MKXBTQGKFHSGOG-UHFFFAOYSA-N 0.000 description 10
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 230000032683 aging Effects 0.000 description 9
- 239000010410 layer Substances 0.000 description 9
- 239000011159 matrix material Substances 0.000 description 9
- 238000002360 preparation method Methods 0.000 description 9
- 230000008901 benefit Effects 0.000 description 8
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 8
- 239000003638 chemical reducing agent Substances 0.000 description 8
- 238000001035 drying Methods 0.000 description 8
- 239000007789 gas Substances 0.000 description 8
- 229910000619 316 stainless steel Inorganic materials 0.000 description 7
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 7
- 239000007795 chemical reaction product Substances 0.000 description 7
- 239000013505 freshwater Substances 0.000 description 7
- 239000012535 impurity Substances 0.000 description 7
- 230000000977 initiatory effect Effects 0.000 description 7
- 238000001556 precipitation Methods 0.000 description 7
- 241000894007 species Species 0.000 description 7
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 6
- 239000004743 Polypropylene Substances 0.000 description 6
- 239000012298 atmosphere Substances 0.000 description 6
- 239000002131 composite material Substances 0.000 description 6
- 238000004090 dissolution Methods 0.000 description 6
- 238000005516 engineering process Methods 0.000 description 6
- 238000011067 equilibration Methods 0.000 description 6
- 239000004744 fabric Substances 0.000 description 6
- 238000012432 intermediate storage Methods 0.000 description 6
- 229920002959 polymer blend Polymers 0.000 description 6
- 229920001155 polypropylene Polymers 0.000 description 6
- 238000010998 test method Methods 0.000 description 6
- 230000007704 transition Effects 0.000 description 6
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 5
- 239000005977 Ethylene Substances 0.000 description 5
- 150000001412 amines Chemical class 0.000 description 5
- 239000006227 byproduct Substances 0.000 description 5
- 238000004440 column chromatography Methods 0.000 description 5
- 238000009833 condensation Methods 0.000 description 5
- 230000005494 condensation Effects 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 238000004128 high performance liquid chromatography Methods 0.000 description 5
- 125000001979 organolithium group Chemical group 0.000 description 5
- 229920000098 polyolefin Polymers 0.000 description 5
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 5
- 239000004810 polytetrafluoroethylene Substances 0.000 description 5
- 239000000376 reactant Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- FYGHSUNMUKGBRK-UHFFFAOYSA-N 1,2,3-trimethylbenzene Chemical compound CC1=CC=CC(C)=C1C FYGHSUNMUKGBRK-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- 101150028119 SPD1 gene Proteins 0.000 description 4
- 239000004809 Teflon Substances 0.000 description 4
- 229920006362 Teflon® Polymers 0.000 description 4
- 239000002250 absorbent Substances 0.000 description 4
- 230000002745 absorbent Effects 0.000 description 4
- 150000004703 alkoxides Chemical class 0.000 description 4
- 238000010533 azeotropic distillation Methods 0.000 description 4
- 230000009286 beneficial effect Effects 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 238000004364 calculation method Methods 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 239000012065 filter cake Substances 0.000 description 4
- 238000011010 flushing procedure Methods 0.000 description 4
- 239000003999 initiator Substances 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- 230000002572 peristaltic effect Effects 0.000 description 4
- UOHMMEJUHBCKEE-UHFFFAOYSA-N prehnitene Chemical compound CC1=CC=C(C)C(C)=C1C UOHMMEJUHBCKEE-UHFFFAOYSA-N 0.000 description 4
- 230000003134 recirculating effect Effects 0.000 description 4
- 230000008929 regeneration Effects 0.000 description 4
- 238000011069 regeneration method Methods 0.000 description 4
- 230000004044 response Effects 0.000 description 4
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 4
- 238000010561 standard procedure Methods 0.000 description 4
- 238000003860 storage Methods 0.000 description 4
- 230000008719 thickening Effects 0.000 description 4
- 239000003643 water by type Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 101710134784 Agnoprotein Proteins 0.000 description 3
- 150000001450 anions Chemical class 0.000 description 3
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 3
- 238000011088 calibration curve Methods 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 238000013480 data collection Methods 0.000 description 3
- FJBFPHVGVWTDIP-UHFFFAOYSA-N dibromomethane Chemical compound BrCBr FJBFPHVGVWTDIP-UHFFFAOYSA-N 0.000 description 3
- 229920001971 elastomer Polymers 0.000 description 3
- 239000000806 elastomer Substances 0.000 description 3
- 239000003822 epoxy resin Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 229920001519 homopolymer Polymers 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- YNXURHRFIMQACJ-UHFFFAOYSA-N lithium;methanidylbenzene Chemical compound [Li+].[CH2-]C1=CC=CC=C1 YNXURHRFIMQACJ-UHFFFAOYSA-N 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000005259 measurement Methods 0.000 description 3
- 230000007246 mechanism Effects 0.000 description 3
- ZIYPMFCOIRUJCZ-UHFFFAOYSA-N n,n,n',n'-tetramethylethane-1,2-diamine;toluene Chemical compound CC1=CC=CC=C1.CN(C)CCN(C)C ZIYPMFCOIRUJCZ-UHFFFAOYSA-N 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 229920001707 polybutylene terephthalate Polymers 0.000 description 3
- 229920000647 polyepoxide Polymers 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000012716 precipitator Substances 0.000 description 3
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 3
- 238000012216 screening Methods 0.000 description 3
- 239000012265 solid product Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 230000009466 transformation Effects 0.000 description 3
- 238000003828 vacuum filtration Methods 0.000 description 3
- APQIUTYORBAGEZ-UHFFFAOYSA-N 1,1-dibromoethane Chemical compound CC(Br)Br APQIUTYORBAGEZ-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical class ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- BDNXSMXBSABNSH-UHFFFAOYSA-N 1,3,7,9-tetraphenylnonan-5-ylbenzene Chemical compound C=1C=CC=CC=1CCC(C=1C=CC=CC=1)CC(C=1C=CC=CC=1)CC(C=1C=CC=CC=1)CCC1=CC=CC=C1 BDNXSMXBSABNSH-UHFFFAOYSA-N 0.000 description 2
- IBYHHJPAARCAIE-UHFFFAOYSA-N 1-bromo-2-chloroethane Chemical class ClCCBr IBYHHJPAARCAIE-UHFFFAOYSA-N 0.000 description 2
- ALLIZEAXNXSFGD-UHFFFAOYSA-N 1-methyl-2-phenylbenzene Chemical group CC1=CC=CC=C1C1=CC=CC=C1 ALLIZEAXNXSFGD-UHFFFAOYSA-N 0.000 description 2
- RZTDESRVPFKCBH-UHFFFAOYSA-N 1-methyl-4-(4-methylphenyl)benzene Chemical class C1=CC(C)=CC=C1C1=CC=C(C)C=C1 RZTDESRVPFKCBH-UHFFFAOYSA-N 0.000 description 2
- QPUYECUOLPXSFR-UHFFFAOYSA-N 1-methylnaphthalene Chemical compound C1=CC=C2C(C)=CC=CC2=C1 QPUYECUOLPXSFR-UHFFFAOYSA-N 0.000 description 2
- QIMMUPPBPVKWKM-UHFFFAOYSA-N 2-methylnaphthalene Chemical compound C1=CC=CC2=CC(C)=CC=C21 QIMMUPPBPVKWKM-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 2
- 239000004433 Thermoplastic polyurethane Substances 0.000 description 2
- 239000004957 Zytel Substances 0.000 description 2
- 229920006102 Zytel® Polymers 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- LJCFOYOSGPHIOO-UHFFFAOYSA-N antimony pentoxide Chemical compound O=[Sb](=O)O[Sb](=O)=O LJCFOYOSGPHIOO-UHFFFAOYSA-N 0.000 description 2
- ADCOVFLJGNWWNZ-UHFFFAOYSA-N antimony trioxide Chemical compound O=[Sb]O[Sb]=O ADCOVFLJGNWWNZ-UHFFFAOYSA-N 0.000 description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 2
- DALDUXIBIKGWTK-UHFFFAOYSA-N benzene;toluene Chemical compound C1=CC=CC=C1.CC1=CC=CC=C1 DALDUXIBIKGWTK-UHFFFAOYSA-N 0.000 description 2
- 229910000085 borane Inorganic materials 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 239000001273 butane Substances 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000001186 cumulative effect Effects 0.000 description 2
- 238000013461 design Methods 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- JMNDBSWHIXOJLR-UHFFFAOYSA-N ethylbenzene;styrene Chemical compound CCC1=CC=CC=C1.C=CC1=CC=CC=C1 JMNDBSWHIXOJLR-UHFFFAOYSA-N 0.000 description 2
- 230000007717 exclusion Effects 0.000 description 2
- 239000012632 extractable Substances 0.000 description 2
- 238000001125 extrusion Methods 0.000 description 2
- 239000011552 falling film Substances 0.000 description 2
- 239000003365 glass fiber Substances 0.000 description 2
- 230000005484 gravity Effects 0.000 description 2
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 2
- JGJLWPGRMCADHB-UHFFFAOYSA-N hypobromite Chemical compound Br[O-] JGJLWPGRMCADHB-UHFFFAOYSA-N 0.000 description 2
- 238000010348 incorporation Methods 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 229920003052 natural elastomer Polymers 0.000 description 2
- 229920001194 natural rubber Polymers 0.000 description 2
- 238000006384 oligomerization reaction Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- KJFMBFZCATUALV-UHFFFAOYSA-N phenolphthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2C(=O)O1 KJFMBFZCATUALV-UHFFFAOYSA-N 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 229920000768 polyamine Polymers 0.000 description 2
- 239000004417 polycarbonate Substances 0.000 description 2
- 229920000515 polycarbonate Polymers 0.000 description 2
- 125000005575 polycyclic aromatic hydrocarbon group Chemical group 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- 229920005990 polystyrene resin Polymers 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 238000004088 simulation Methods 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 2
- 235000010265 sodium sulphite Nutrition 0.000 description 2
- 238000013179 statistical model Methods 0.000 description 2
- 125000003011 styrenyl group Chemical group [H]\C(*)=C(/[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- 239000013589 supplement Substances 0.000 description 2
- 230000002195 synergetic effect Effects 0.000 description 2
- 239000008399 tap water Substances 0.000 description 2
- 235000020679 tap water Nutrition 0.000 description 2
- 229920002803 thermoplastic polyurethane Polymers 0.000 description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 description 2
- DHCDFWKWKRSZHF-UHFFFAOYSA-L thiosulfate(2-) Chemical compound [O-]S([S-])(=O)=O DHCDFWKWKRSZHF-UHFFFAOYSA-L 0.000 description 2
- 238000000844 transformation Methods 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- 229910052727 yttrium Inorganic materials 0.000 description 2
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 description 2
- QXSZNDIIPUOQMB-UHFFFAOYSA-N 1,1,2,2-tetrabromoethane Chemical class BrC(Br)C(Br)Br QXSZNDIIPUOQMB-UHFFFAOYSA-N 0.000 description 1
- QUMDOMSJJIFTCA-UHFFFAOYSA-N 1,1,2-tribromoethane Chemical class BrCC(Br)Br QUMDOMSJJIFTCA-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- RZTQGLJYMDOELQ-UHFFFAOYSA-N 1,2,3-trimethyl-4-phenylbenzene Chemical group CC1=C(C)C(C)=CC=C1C1=CC=CC=C1 RZTQGLJYMDOELQ-UHFFFAOYSA-N 0.000 description 1
- XFNJYAKDBJUJAJ-UHFFFAOYSA-N 1,2-dibromopropane Chemical class CC(Br)CBr XFNJYAKDBJUJAJ-UHFFFAOYSA-N 0.000 description 1
- IBODDUNKEPPBKW-UHFFFAOYSA-N 1,5-dibromopentane Chemical class BrCCCCCBr IBODDUNKEPPBKW-UHFFFAOYSA-N 0.000 description 1
- YIWGJFPJRAEKMK-UHFFFAOYSA-N 1-(2H-benzotriazol-5-yl)-3-methyl-8-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carbonyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione Chemical compound CN1C(=O)N(c2ccc3n[nH]nc3c2)C2(CCN(CC2)C(=O)c2cnc(NCc3cccc(OC(F)(F)F)c3)nc2)C1=O YIWGJFPJRAEKMK-UHFFFAOYSA-N 0.000 description 1
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 1
- XKVLZBNEPALHIO-UHFFFAOYSA-N 1-bromo-2-methylbutane Chemical class CCC(C)CBr XKVLZBNEPALHIO-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical class CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- LSXKDWGTSHCFPP-UHFFFAOYSA-N 1-bromoheptane Chemical class CCCCCCCBr LSXKDWGTSHCFPP-UHFFFAOYSA-N 0.000 description 1
- MNDIARAMWBIKFW-UHFFFAOYSA-N 1-bromohexane Chemical class CCCCCCBr MNDIARAMWBIKFW-UHFFFAOYSA-N 0.000 description 1
- YZWKKMVJZFACSU-UHFFFAOYSA-N 1-bromopentane Chemical class CCCCCBr YZWKKMVJZFACSU-UHFFFAOYSA-N 0.000 description 1
- UPSXAPQYNGXVBF-UHFFFAOYSA-N 2-bromobutane Chemical class CCC(C)Br UPSXAPQYNGXVBF-UHFFFAOYSA-N 0.000 description 1
- ZCUJYXPAKHMBAZ-UHFFFAOYSA-N 2-phenyl-1h-imidazole Chemical compound C1=CNC(C=2C=CC=CC=2)=N1 ZCUJYXPAKHMBAZ-UHFFFAOYSA-N 0.000 description 1
- 239000004925 Acrylic resin Substances 0.000 description 1
- 229920000178 Acrylic resin Polymers 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- FIPWRIJSWJWJAI-UHFFFAOYSA-N Butyl carbitol 6-propylpiperonyl ether Chemical compound C1=C(CCC)C(COCCOCCOCCCC)=CC2=C1OCO2 FIPWRIJSWJWJAI-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 229920002449 FKM Polymers 0.000 description 1
- 244000043261 Hevea brasiliensis Species 0.000 description 1
- MFESCIUQSIBMSM-UHFFFAOYSA-N I-BCP Chemical class ClCCCBr MFESCIUQSIBMSM-UHFFFAOYSA-N 0.000 description 1
- 229910018068 Li 2 O Inorganic materials 0.000 description 1
- 239000004594 Masterbatch (MB) Substances 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 239000004677 Nylon Substances 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical class CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 108091034117 Oligonucleotide Proteins 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 229920002675 Polyoxyl Polymers 0.000 description 1
- 229920000265 Polyparaphenylene Polymers 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- 239000012963 UV stabilizer Substances 0.000 description 1
- UEIGCUVBKYUAIJ-UHFFFAOYSA-N [Li]C(CCC)CCCC Chemical compound [Li]C(CCC)CCCC UEIGCUVBKYUAIJ-UHFFFAOYSA-N 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- PFOLLRNADZZWEX-FFGRCDKISA-N bacampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)[C@H](C(S3)(C)C)C(=O)OC(C)OC(=O)OCC)=CC=CC=C1 PFOLLRNADZZWEX-FFGRCDKISA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 125000001743 benzylic group Chemical group 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 238000000071 blow moulding Methods 0.000 description 1
- 229940006460 bromide ion Drugs 0.000 description 1
- 150000003842 bromide salts Chemical class 0.000 description 1
- XNNQFQFUQLJSQT-UHFFFAOYSA-N bromo(trichloro)methane Chemical compound ClC(Cl)(Cl)Br XNNQFQFUQLJSQT-UHFFFAOYSA-N 0.000 description 1
- AQNQQHJNRPDOQV-UHFFFAOYSA-N bromocyclohexane Chemical class BrC1CCCCC1 AQNQQHJNRPDOQV-UHFFFAOYSA-N 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical class CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- MPMBRWOOISTHJV-UHFFFAOYSA-N but-1-enylbenzene Chemical compound CCC=CC1=CC=CC=C1 MPMBRWOOISTHJV-UHFFFAOYSA-N 0.000 description 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 1
- 229920005549 butyl rubber Polymers 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 229910000420 cerium oxide Inorganic materials 0.000 description 1
- 238000012711 chain transfer polymerization Methods 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 238000000748 compression moulding Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 230000020335 dealkylation Effects 0.000 description 1
- 238000006900 dealkylation reaction Methods 0.000 description 1
- 230000006837 decompression Effects 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000005695 dehalogenation reaction Methods 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Polymers C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229920001973 fluoroelastomer Polymers 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000003517 fume Substances 0.000 description 1
- 238000001879 gelation Methods 0.000 description 1
- 230000017525 heat dissipation Effects 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 235000003642 hunger Nutrition 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- CUILPNURFADTPE-UHFFFAOYSA-N hypobromous acid Chemical compound BrO CUILPNURFADTPE-UHFFFAOYSA-N 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 238000009863 impact test Methods 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 230000002779 inactivation Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N iron Substances [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 238000005184 irreversible process Methods 0.000 description 1
- 238000010902 jet-milling Methods 0.000 description 1
- 235000015141 kefir Nutrition 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000011968 lewis acid catalyst Substances 0.000 description 1
- 229920002521 macromolecule Polymers 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- KFIGICHILYTCJF-UHFFFAOYSA-N n'-methylethane-1,2-diamine Chemical compound CNCCN KFIGICHILYTCJF-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- BMMGVYCKOGBVEV-UHFFFAOYSA-N oxo(oxoceriooxy)cerium Chemical compound [Ce]=O.O=[Ce]=O BMMGVYCKOGBVEV-UHFFFAOYSA-N 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000002161 passivation Methods 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229960005235 piperonyl butoxide Drugs 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920001084 poly(chloroprene) Polymers 0.000 description 1
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000002952 polymeric resin Substances 0.000 description 1
- 239000003505 polymerization initiator Substances 0.000 description 1
- 229920001955 polyphenylene ether Polymers 0.000 description 1
- 229920005606 polypropylene copolymer Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 238000007867 post-reaction treatment Methods 0.000 description 1
- BFPJYWDBBLZXOM-UHFFFAOYSA-L potassium tellurite Chemical compound [K+].[K+].[O-][Te]([O-])=O BFPJYWDBBLZXOM-UHFFFAOYSA-L 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 238000007493 shaping process Methods 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 229940079827 sodium hydrogen sulfite Drugs 0.000 description 1
- VOADVZVYWFSHSM-UHFFFAOYSA-L sodium tellurite Chemical compound [Na+].[Na+].[O-][Te]([O-])=O VOADVZVYWFSHSM-UHFFFAOYSA-L 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000013112 stability test Methods 0.000 description 1
- 230000037351 starvation Effects 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical class [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 230000003797 telogen phase Effects 0.000 description 1
- 229920001897 terpolymer Polymers 0.000 description 1
- RKSOPLXZQNSWAS-UHFFFAOYSA-N tert-butyl bromide Chemical class CC(C)(C)Br RKSOPLXZQNSWAS-UHFFFAOYSA-N 0.000 description 1
- 229920005992 thermoplastic resin Polymers 0.000 description 1
- BYQADQLDVPAGSR-UHFFFAOYSA-N toluene;hydrobromide Chemical compound Br.CC1=CC=CC=C1 BYQADQLDVPAGSR-UHFFFAOYSA-N 0.000 description 1
- 238000006276 transfer reaction Methods 0.000 description 1
- 238000013519 translation Methods 0.000 description 1
- BIKXLKXABVUSMH-UHFFFAOYSA-N trizinc;diborate Chemical compound [Zn+2].[Zn+2].[Zn+2].[O-]B([O-])[O-].[O-]B([O-])[O-] BIKXLKXABVUSMH-UHFFFAOYSA-N 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000003809 water extraction Methods 0.000 description 1
- 239000013585 weight reducing agent Substances 0.000 description 1
- 238000005491 wire drawing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 230000003245 working effect Effects 0.000 description 1
- 210000000707 wrist Anatomy 0.000 description 1
- 238000004876 x-ray fluorescence Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L25/00—Compositions of, homopolymers or copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by an aromatic carbocyclic ring; Compositions of derivatives of such polymers
- C08L25/02—Homopolymers or copolymers of hydrocarbons
- C08L25/04—Homopolymers or copolymers of styrene
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/0008—Organic ingredients according to more than one of the "one dot" groups of C08K5/01 - C08K5/59
- C08K5/0066—Flame-proofing or flame-retarding additives
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F112/00—Homopolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by an aromatic carbocyclic ring
- C08F112/02—Monomers containing only one unsaturated aliphatic radical
- C08F112/04—Monomers containing only one unsaturated aliphatic radical containing one ring
- C08F112/06—Hydrocarbons
- C08F112/08—Styrene
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F12/00—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by an aromatic carbocyclic ring
- C08F12/02—Monomers containing only one unsaturated aliphatic radical
- C08F12/04—Monomers containing only one unsaturated aliphatic radical containing one ring
- C08F12/06—Hydrocarbons
- C08F12/08—Styrene
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F8/00—Chemical modification by after-treatment
- C08F8/18—Introducing halogen atoms or halogen-containing groups
- C08F8/20—Halogenation
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F8/00—Chemical modification by after-treatment
- C08F8/18—Introducing halogen atoms or halogen-containing groups
- C08F8/20—Halogenation
- C08F8/22—Halogenation by reaction with free halogens
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K21/00—Fireproofing materials
- C09K21/14—Macromolecular materials
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/582—Recycling of unreacted starting or intermediate materials
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- General Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Fireproofing Substances (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US11928908P | 2008-12-02 | 2008-12-02 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| TW201030021A TW201030021A (en) | 2010-08-16 |
| TWI494325B true TWI494325B (zh) | 2015-08-01 |
Family
ID=42101849
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| TW098140799A TWI494325B (zh) | 2008-12-02 | 2009-11-30 | 溴化阻燃劑及其前驅物 |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US8933159B2 (https=) |
| EP (1) | EP2370479B1 (https=) |
| JP (1) | JP6231731B2 (https=) |
| KR (1) | KR101717793B1 (https=) |
| CN (2) | CN104072648B (https=) |
| CA (1) | CA2744205A1 (https=) |
| ES (1) | ES2730881T3 (https=) |
| HU (1) | HUE043724T2 (https=) |
| IL (1) | IL213271A (https=) |
| JO (1) | JO3423B1 (https=) |
| MX (1) | MX2011005662A (https=) |
| PL (1) | PL2370479T3 (https=) |
| SG (1) | SG171908A1 (https=) |
| TR (1) | TR201905538T4 (https=) |
| TW (1) | TWI494325B (https=) |
| WO (1) | WO2010065468A1 (https=) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| MX2009013127A (es) | 2007-06-07 | 2010-01-15 | Albemarle Corp | Polimeros bromados de bajo peso molecular y su uso en formulaciones termoplasticas. |
| US8993684B2 (en) | 2008-06-06 | 2015-03-31 | Albemarle Corporation | Low molecular weight brominated polymers, processes for their manufacture and their use in thermoplastic formulations |
| KR20110100216A (ko) | 2008-12-02 | 2011-09-09 | 알베마를 코포레이션 | 분지형 또는 별모양 분지형 스티렌 폴리머, 텔로머, 및 부가물, 그의 합성, 그의 브롬화, 및 그의 용도 |
| US8642821B2 (en) | 2008-12-02 | 2014-02-04 | Albemarle Corporation | Bromination of telomer mixtures derived from toluene and styrene |
| JO3423B1 (ar) | 2008-12-02 | 2019-10-20 | Albemarle Corp | مؤخرات لهب معالجة بالبروم و مواد مشتقه منها |
| CN102224122B (zh) | 2008-12-02 | 2014-09-03 | 雅宝公司 | 甲苯和苯乙烯衍生的调聚物分布物及由其制备的溴化阻燃剂 |
| WO2010127072A1 (en) * | 2009-05-01 | 2010-11-04 | Albemarle Corporation | Pelletized low molecular weight brominated aromatic polymer compositions |
| JO3059B1 (ar) * | 2009-05-01 | 2017-03-15 | Albemarle Corp | معالجة بالبروم لتراكيب بوليمرات عطرية ذات وزن جزيئي منخفض |
| US8753554B2 (en) * | 2009-05-01 | 2014-06-17 | Albemarle Corporation | Pelletized low molecular weight brominated aromatic polymer compositions |
| WO2011156091A1 (en) * | 2010-06-09 | 2011-12-15 | Albemarle Corporation | Translucent or transparent flame retarded thermoplastic polymer compositions and brominated telomeric flame retardants |
| WO2012092338A2 (en) * | 2010-12-29 | 2012-07-05 | Albemarle Corporation | Removal of bromine from gaseous hydrogen bromide |
| HUE066094T2 (hu) | 2016-04-05 | 2024-07-28 | Albemarle Corp | Szénhidrogénnel oldható só-hidrid katalizátor hidrogénnel közvetített só-hidrid alapú anionos láncátviteli polimerizációhoz és az ebbõl elõállított polimereloszlási készítmények és az elõállításához szükséges folyamat |
| WO2019032335A1 (en) | 2017-08-10 | 2019-02-14 | Dow Global Technologies Llc | COMPOSITIONS COMPRISING A BROMED POLYMER FIRE |
| RU2732675C1 (ru) * | 2019-12-26 | 2020-09-22 | Публичное акционерное общество «СИБУР Холдинг» | Способ получения модифицированного диенсодержащего (со)полимера и его применение в качестве антипирена |
| CA3184708A1 (en) * | 2020-07-13 | 2022-01-20 | Chongsoo Lim | Methods of melt blending flame retardant and polymeric compositions |
| EP4192906A1 (en) | 2020-08-07 | 2023-06-14 | Albemarle Corporation | Additives for flame retarded polyolefins |
| US11786891B2 (en) * | 2021-05-24 | 2023-10-17 | Ddp Specialty Electronic Materials Us, Llc | Process for recovering quaternary salt bromination catalyst |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS58201809A (ja) * | 1982-05-19 | 1983-11-24 | Daicel Chem Ind Ltd | 新規ポリスチレン |
| US5112898A (en) * | 1989-06-06 | 1992-05-12 | Ferro Corporation | High impact polystyrene containing low molecular weight brominated polystyrene |
| CN1914239A (zh) * | 2004-01-30 | 2007-02-14 | 新日铁化学株式会社 | 固化性树脂组合物 |
| TW200837129A (en) * | 2007-01-10 | 2008-09-16 | Albemarle Corp | Brominated styrenic polymer compositions and processes for producing same |
Family Cites Families (131)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2243543A (en) * | 1938-10-14 | 1941-05-27 | Us Rubber Co | Parasiticide |
| US2757146A (en) * | 1952-09-08 | 1956-07-31 | Du Pont | Pyrolysis polymers from p-methyl quaternary benzylammonium hydroxides |
| US2914489A (en) * | 1956-01-10 | 1959-11-24 | Du Pont | Production of poly p-xylene polymers containing halogen |
| US2954412A (en) * | 1957-01-10 | 1960-09-27 | Huels Chemische Werke Ag | Process for the preparation of dibenzylbenzenes |
| US3221068A (en) * | 1962-03-01 | 1965-11-30 | Union Carbide Corp | Halogenated di-p-xylylenes |
| US3541149A (en) * | 1963-03-13 | 1970-11-17 | Exxon Research Engineering Co | Crystalline organolithium-tertiary chelating polyamine complexes |
| US3751384A (en) * | 1963-03-13 | 1973-08-07 | Exxon | Organolithium-polyamine compositions |
| US3594396A (en) * | 1963-03-13 | 1971-07-20 | Arthur W Langer Jr | Crystalline organolithium complexes containing silicon |
| US3458586A (en) * | 1964-04-13 | 1969-07-29 | Exxon Research Engineering Co | Linear alkyl aromatic compounds and their preparation |
| US3373135A (en) * | 1964-12-01 | 1968-03-12 | Kalk Chemische Fabrik Gmbh | Shaped articles of self-extinguishing epoxy resins |
| NL126613C (https=) | 1966-03-25 | |||
| US3372880A (en) * | 1966-04-14 | 1968-03-12 | Rexall Drug Chemical | Process for the production of polymer powder |
| US3451988A (en) * | 1966-10-25 | 1969-06-24 | Exxon Research Engineering Co | Polymerization catalyst and uses thereof |
| GB1174845A (en) | 1967-08-25 | 1969-12-17 | Shell Int Research | The Polymerisation of Vinyl-Aromatic Compounds, and the Resulting Polyvinyl-Aromatic Compounds |
| DE1589700A1 (de) | 1967-11-03 | 1970-07-23 | Delma Gmbh | Hochfrequenz-Generator fuer die Elektrochirurgie |
| DE1794072C3 (de) | 1968-09-03 | 1975-09-25 | Basf Ag, 6700 Ludwigshafen | Schwerbrennbare Formmassen auf der Basis von Polymerisaten des Propylene |
| GB1051269A (https=) * | 1969-05-16 | |||
| US3634548A (en) * | 1969-08-11 | 1972-01-11 | Gulf Research Development Co | Polystyrene-ethylene graft copolymer |
| BE757383A (fr) | 1969-10-13 | 1971-04-13 | Phillips Petroleum Co | Compositions ignifuges et systemes d'additifs pour celles-ci |
| DE2063643A1 (de) | 1970-01-15 | 1971-07-29 | Lithium Corp Of Ameria | Telomensationsreaktionen unter Ver wendung von flussigen Kohlenwasserstoff lösungen bestimmter metallorganischer Ver bindungen |
| US3751501A (en) * | 1970-01-15 | 1973-08-07 | Lithium Corp | Telomerization reactions utilizing liquid hydrocarbon solutions of certain organometallic complexes |
| US3668263A (en) * | 1970-01-19 | 1972-06-06 | Lithium Corp | Organolithium polymerization initiators and use thereof in polymerization processes |
| US3725368A (en) * | 1970-01-19 | 1973-04-03 | Lithium Corp | Preparation of polymers |
| US3742077A (en) * | 1970-07-23 | 1973-06-26 | Lithium Corp | Method of preparing telomers utilizing as catalysts hydrocarbon-soluble organometallic complexes of metals of groups i and iia of the periodic table |
| US3850882A (en) * | 1971-12-01 | 1974-11-26 | Phillips Petroleum Co | Flame retarded compositions and additive systems therefor |
| JPS4944115A (https=) * | 1972-09-01 | 1974-04-25 | ||
| US4078019A (en) * | 1972-11-24 | 1978-03-07 | Exxon Research & Engineering Co. | Process for polymer lithiation in graft polymerization |
| IT1025744B (it) * | 1973-11-26 | 1978-08-30 | Basf Ag | Masse per formatura termopla stiche autoestinglenti |
| US4129705A (en) * | 1975-02-02 | 1978-12-12 | Compagnie Generale Des Etablissements Michelin | Polymerization process |
| US4108921A (en) * | 1975-03-28 | 1978-08-22 | Exxon Research & Engineering Co. | Process for polymer lithiation in graft polymerization |
| DE2515473C3 (de) * | 1975-04-09 | 1987-01-22 | Basf Ag, 6700 Ludwigshafen | Flammwidrige, lineare Polyester |
| CA1054161A (en) * | 1975-08-22 | 1979-05-08 | Herbert Naarmann | Manufacture of heat-stable brominated oligomers of monovinyl-aromatic compounds |
| DE2547498A1 (de) * | 1975-10-23 | 1977-04-28 | Huels Chemische Werke Ag | Flammwidrige formmasse |
| US4311818A (en) * | 1976-06-17 | 1982-01-19 | Societe Chimique Des Charbonnages-Cdf. Chimie | Bi- and Trifunctional organolithium initiators and applications thereof |
| US4134938A (en) * | 1976-08-12 | 1979-01-16 | Exxon Research & Engineering Co. | Process for polymer lithiation in graft polymerization |
| DE2645711C3 (de) * | 1976-10-09 | 1979-06-07 | Basf Ag, 6700 Ludwigshafen | Halogenhaltige Flammschutzmittel enthaltende Fasern und Fäden aus linearen, thermoplastischen Polyestern |
| US4041088A (en) * | 1976-11-08 | 1977-08-09 | Lithium Corporation Of America | Recirculation telomerization process and its liquid telomers and liquid telomers produced thereby |
| DE2651435C3 (de) | 1976-11-11 | 1980-11-27 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von bromierten Polymerisationsprodukten des Styrols |
| DE2703419B1 (de) * | 1977-01-28 | 1978-02-02 | Basf Ag | Flammwidrig ausgeruestete polyamid- formmassen |
| DE2727483A1 (de) * | 1977-06-18 | 1979-01-11 | Basf Ag | Selbstverloeschende thermoplastische formmassen |
| DE2756375A1 (de) | 1977-12-17 | 1979-07-05 | Basf Ag | Flammschutzmittelkonzentrat fuer thermoplaste |
| DE2758781A1 (de) | 1977-12-29 | 1979-07-12 | Basf Ag | Kernhalogenierte poly(benzylene) |
| DE3006448A1 (de) * | 1980-02-21 | 1981-08-27 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von mischungen aus bromierten polystyrolen und bromierten aromatischen verbindungen |
| US4268705A (en) * | 1980-03-21 | 1981-05-19 | Phillips Petroleum Company | Addition of monomer in production of liquid polymers |
| JPS5919577B2 (ja) * | 1980-08-25 | 1984-05-07 | 日本エラストマ−株式会社 | 耐衝撃性ポリスチレンの製造方法 |
| FR2498193B1 (fr) * | 1981-01-19 | 1986-03-21 | Poudres & Explosifs Ste Nale | Nouvelles associations de bases resultant de la combinaison d'un alkyl ou aryl lithien avec un amidure ou un hydrure alcalin, procede de polymerisation les utilisant et produit obtenu |
| IT1195303B (it) * | 1981-12-22 | 1988-10-12 | Anic Spa | Iniziatori anionici multifunzionali e loro impiego |
| US4463135A (en) * | 1982-10-25 | 1984-07-31 | The Goodyear Tire & Rubber Company | Process for the functionalization of polystyrene resins |
| JPS59155454A (ja) | 1983-02-24 | 1984-09-04 | Asahi Chem Ind Co Ltd | 難燃化ポリエチレンテレフタレ−ト樹脂組成物 |
| JPS6216438A (ja) * | 1985-07-15 | 1987-01-24 | Kawasaki Steel Corp | 高沸点炭化水素油の製造方法 |
| IT1186743B (it) * | 1985-07-01 | 1987-12-16 | Eniricerche Spa | Metodo per la terminazione di polimeri ottenuti per polimerizzazione anionica di monomeri dienici e/o vinilaromatici e composti adatti allo scopo |
| IT1206738B (it) * | 1985-07-01 | 1989-05-03 | Eniricerche Spa | Metodo per la terminazione di polimeri viventi ottenuti per polimerizzazione anionica di monomeri dienici e/o vinilaromatici e composti adatti allo scopo. |
| US4636540A (en) * | 1985-07-08 | 1987-01-13 | Atlantic Richfield Company | Purification of polymer solutions |
| JPH0635399B2 (ja) | 1985-08-20 | 1994-05-11 | 川崎製鉄株式会社 | 高沸点炭化水素油の製造法 |
| US4755573A (en) * | 1985-11-15 | 1988-07-05 | General Electric Company | Cationic polymerization of bromoalkenyl aromatic compounds with aromatic chain transfer agent, and products |
| US4753745A (en) * | 1985-12-30 | 1988-06-28 | The Lubrizol Corporation | Methylene linked aromatic pour point depressant |
| IT1213077B (it) * | 1986-06-05 | 1989-12-07 | Eniricerche Spa | Composti stabilizzanti polimerici e procedimento per la loro preparazione. |
| EP0277429B1 (en) | 1987-01-28 | 1992-06-10 | Great Lakes Chemical Corporation | Aromatic bromination of polystyrene using bromine as the reaction solvent |
| US4883846A (en) * | 1987-04-20 | 1989-11-28 | The Dow Chemical Company | Anionic polymerization of purified monovinylidene aromatic monomer feed stock |
| US4829135A (en) * | 1987-12-29 | 1989-05-09 | Mobil Oil Corporation | Multi-stage anionic dispersion homopolymerization to form microparticles with narrow size distribution |
| FR2629085B1 (fr) | 1988-03-24 | 1992-09-04 | Atochem | Procede de fabrication de polybutadiene et preparation de resine vinylaromatique choc a partir de polybutadiene |
| EP0431119A4 (en) | 1989-06-06 | 1992-12-09 | Ferro Corporation | High impact polystyrene containing low molecular weight brominated polystyrene |
| US5112896A (en) * | 1989-06-06 | 1992-05-12 | Ferro Corporation | High-impact polystyrene containing low molecular weight brominated polystyrene |
| US5112897A (en) * | 1989-06-06 | 1992-05-12 | Ferro Corporation | High impact polystyrene containing low molecular weight brominated polystyrene |
| US4975496A (en) * | 1989-08-10 | 1990-12-04 | The Dow Chemical Company | Process for brominating aromatic resins |
| US4950721A (en) * | 1989-10-03 | 1990-08-21 | Exxon Chemical Patents Inc. | Ion-exchange reactions for polymeric alkali metal carboxylates |
| CA2047256C (en) * | 1990-07-30 | 2002-03-05 | Saadat Hussain | Process for decabromodiphenylalkane predominant product |
| KR940003782B1 (ko) * | 1991-09-03 | 1994-05-03 | 주식회사 럭키 | 스티렌계 난연수지의 제조방법 |
| US5196622A (en) * | 1991-11-22 | 1993-03-23 | Phillips Petroleum Company | Alkene addition process |
| US5198594A (en) * | 1991-11-27 | 1993-03-30 | Amoco Corporation | Alkylation of alkylaromatics promoted by sonicated alkali metal |
| EP0554675A1 (de) * | 1992-01-31 | 1993-08-11 | Hoechst Aktiengesellschaft | Verfahren zur Herstellung von Polymeren des para-Xylylens und von diesem abgeleiteten Derivaten |
| US6025450A (en) * | 1992-10-02 | 2000-02-15 | Bridgestone Corporation | Amine containing polymers and products therefrom |
| US5625017A (en) * | 1992-10-19 | 1997-04-29 | Bridgestone Corporation | Process for preparing a polymer using lithium initiator prepared by in situ preparation |
| US5457248A (en) * | 1993-04-07 | 1995-10-10 | Great Lakes Chemical Corp. | Brominated diphenylalkane products and processes |
| US5687090A (en) * | 1994-09-01 | 1997-11-11 | Aspen Technology, Inc. | Polymer component characterization method and process simulation apparatus |
| EP0784648B2 (en) * | 1994-10-05 | 2010-10-27 | Great Lakes Chemical Corporation | Continuous bromination process and products thereof |
| JPH08188622A (ja) | 1995-01-13 | 1996-07-23 | Tosoh Corp | 臭素化ポリスチレン低分子量体の製造方法 |
| DE19516563A1 (de) | 1995-05-05 | 1996-11-07 | Basf Ag | Verfahren zur Herstellung von Styrol-Oligomeren und deren Verwendung als Schmiermittel in Thermoplasten |
| US5534592A (en) * | 1995-09-22 | 1996-07-09 | The Goodyear Tire & Rubber Company | High performance blend for tire treads |
| CA2190302A1 (en) | 1995-11-22 | 1997-05-23 | Gregory George Smith | Process for preparing vulcanizable elastomeric compounds from granular elastomer blends and elastomeric articles manufactured therefrom |
| DE19618678A1 (de) * | 1996-05-09 | 1997-11-13 | Basf Ag | Verfahren zur Herstellung von Polystyrol durch kontinuierliche anionische Polymerisation |
| US5637650A (en) * | 1996-06-14 | 1997-06-10 | Ferro Corporation | Brominated polysytrene having improved thermal stability and color and process for the preparation thereof |
| US6518368B2 (en) * | 1996-06-14 | 2003-02-11 | Albemarle Corporation | Brominated polystyrene having improved thermal stability and color and process for the preparation thereof |
| US5723549A (en) | 1996-06-14 | 1998-03-03 | Ferro Corporation | Process for the preparation of brominated polystyrene having improved color characteristics |
| US6235844B1 (en) * | 1996-09-26 | 2001-05-22 | Albemarle Corporation | Brominated polystyrenic resins |
| US6235831B1 (en) * | 1996-09-26 | 2001-05-22 | Albemarle Corporation | Polymer compositions containing brominated polystyrenic resins |
| US6521714B2 (en) * | 1996-09-26 | 2003-02-18 | Albemarle Corporation | Brominated polystyrenic resins |
| US6232408B1 (en) * | 1996-09-26 | 2001-05-15 | Albemarle Corporation | Brominated polstyrenic resins |
| US5767203A (en) * | 1996-09-26 | 1998-06-16 | Albemarle Corporation | Process for brominated styrenic polymers |
| US6326439B1 (en) * | 1996-09-26 | 2001-12-04 | Albemarle Corporation | Process for brominating polystyrenic resins |
| CA2265642C (en) * | 1996-09-26 | 2006-03-14 | Albemarle Corporation | Process for brominated styrenic polymers |
| US6232393B1 (en) * | 1996-09-26 | 2001-05-15 | Albemarle Corporation | Polymers flame retarded with brominated polystyrenic resins |
| US6133381A (en) | 1996-09-26 | 2000-10-17 | Albelmarle Corporation | Brominated polystyrenic flame retardants |
| US5686538A (en) * | 1996-09-26 | 1997-11-11 | Albemarle Corporation | Process for brominating polystyrenic resins |
| US5677390A (en) * | 1996-09-26 | 1997-10-14 | Albemarle Corporation | Process for brominating polystyrenic resins |
| US5728782A (en) * | 1996-12-06 | 1998-03-17 | Union Carbide Chemicals & Plastics Technology Corporation | Gas phase anionic polymerization of dienes and vinyl-substituted aromatic compounds |
| WO1998030520A1 (en) * | 1997-01-08 | 1998-07-16 | Hercules Incorporated | Metal oxide solid acids as catalysts for the preparation of hydrocarbon resins |
| US6008283A (en) * | 1997-03-20 | 1999-12-28 | Great Lakes Chemical Corporation | Oligomeric flame retardant additive |
| CN1122046C (zh) * | 1997-11-18 | 2003-09-24 | 阿尔伯麦尔公司 | 制备具有改进颜色性能的溴化聚苯乙烯方法 |
| DE19754504A1 (de) * | 1997-12-09 | 1999-06-10 | Basf Ag | Verfahren zur Herstellung von Erdalkalidiorganylverbindungen |
| WO1999051650A1 (en) * | 1998-04-07 | 1999-10-14 | The Dow Chemical Company | Improved syndiotactic vinylidene aromatic polymerization process |
| US6093211A (en) * | 1998-04-09 | 2000-07-25 | Aspen Technology, Inc. | Polymer property distribution functions methodology and simulators |
| KR20000019517A (ko) | 1998-09-12 | 2000-04-15 | 이정국 | 스티렌 다이머 및 스티렌 트리머의 용출이 되지 않는 식품포장재용 고순도 폴리스티렌 및 그의 제조방법 |
| US6821456B2 (en) | 1998-09-22 | 2004-11-23 | Albemarle Corporation | Granular polymer additives and their preparation |
| US6355194B1 (en) * | 1999-03-22 | 2002-03-12 | Xerox Corporation | Carrier pelletizing processes |
| US6313230B1 (en) * | 1999-09-21 | 2001-11-06 | Industrial Technology Research Institute | Catalyst composition for hydrogenation of conjugated diene based synthetic rubbers |
| KR100687670B1 (ko) * | 2000-05-08 | 2007-03-02 | 아사히 가세이 가부시키가이샤 | 저분자량 성분의 함량이 감소된 스티렌계 수지 및 그의용도 |
| EP1288260A1 (en) | 2001-08-29 | 2003-03-05 | Albemarle Corporation | Flame retardant compositions |
| DE10218161A1 (de) | 2002-04-23 | 2003-11-13 | Basf Ag | Initiatorzusammensetzung und Verfahren zur anionischen Polymerisation |
| CN1290871C (zh) * | 2002-05-10 | 2006-12-20 | Ps日本株式会社 | 苯乙烯-基聚合物树脂及其组合物 |
| US6657028B1 (en) * | 2002-08-01 | 2003-12-02 | Albemarle Corporation | Anionic polymerization process |
| KR100471716B1 (ko) * | 2002-08-03 | 2005-03-10 | 금호석유화학 주식회사 | 연속식 음이온 중합에 의한 내충격 비닐 방향족 고분자의제조방법 |
| WO2004113400A2 (en) * | 2003-06-20 | 2004-12-29 | Scimed Life Systems, Inc. | End-cappped polymer chains and products thereof |
| US20050209408A1 (en) * | 2004-03-17 | 2005-09-22 | Lee Hyung-Jae | Star-shaped polymer, multiple star polymer and their preparation methods |
| BRPI0418907A (pt) * | 2004-05-20 | 2007-11-27 | Albemarle Corp | aglomerados de polìmeros estirênicos aniÈnicos bromatadas inalterados e método de preparação |
| WO2006039602A2 (en) * | 2004-09-30 | 2006-04-13 | Chemtura Corporation | Improved polymers of bromostyrenes having controlled molecular weight |
| US7351777B2 (en) | 2005-03-30 | 2008-04-01 | Moore Eugene R | Retarded anionic polymerization of vinyl aromatic monomers using insoluble or heterogeneous retardants |
| CN100369941C (zh) | 2005-05-17 | 2008-02-20 | 北京化工大学 | 一种氢化苯乙烯类热塑性弹性体及其制备方法 |
| US7632893B2 (en) * | 2005-06-30 | 2009-12-15 | Albemarle Corporation | Brominated styrenic polymers and their preparation |
| KR100827335B1 (ko) * | 2005-10-06 | 2008-05-06 | 주식회사 엘지화학 | 그라프트 공중합체 및 이의 제조방법 |
| ES2602097T3 (es) * | 2005-12-21 | 2017-02-17 | Albemarle Corporation | Polímeros aniónicos estirénicos bromados y su preparación |
| TW200817447A (en) * | 2006-08-22 | 2008-04-16 | Albemarle Corp | Terminating bromination of styrenic polymer in a bromination reaction mixture |
| WO2008066970A1 (en) | 2006-11-28 | 2008-06-05 | Albemarle Corporation | Converting brominated anionic styrenic polymer into harder and larger form for storage, shipment, and use |
| MX2009013127A (es) | 2007-06-07 | 2010-01-15 | Albemarle Corp | Polimeros bromados de bajo peso molecular y su uso en formulaciones termoplasticas. |
| EP3470441A1 (en) | 2008-06-06 | 2019-04-17 | Albemarle Corporation | Low molecular weight brominated polymers, processes for their manufacture and their use in thermoplastic formulations |
| JO3423B1 (ar) | 2008-12-02 | 2019-10-20 | Albemarle Corp | مؤخرات لهب معالجة بالبروم و مواد مشتقه منها |
| KR20110100216A (ko) | 2008-12-02 | 2011-09-09 | 알베마를 코포레이션 | 분지형 또는 별모양 분지형 스티렌 폴리머, 텔로머, 및 부가물, 그의 합성, 그의 브롬화, 및 그의 용도 |
| US8642821B2 (en) | 2008-12-02 | 2014-02-04 | Albemarle Corporation | Bromination of telomer mixtures derived from toluene and styrene |
| JO3059B1 (ar) | 2009-05-01 | 2017-03-15 | Albemarle Corp | معالجة بالبروم لتراكيب بوليمرات عطرية ذات وزن جزيئي منخفض |
| US8753554B2 (en) | 2009-05-01 | 2014-06-17 | Albemarle Corporation | Pelletized low molecular weight brominated aromatic polymer compositions |
| WO2010127072A1 (en) | 2009-05-01 | 2010-11-04 | Albemarle Corporation | Pelletized low molecular weight brominated aromatic polymer compositions |
-
2009
- 2009-11-24 JO JOP/2009/0445A patent/JO3423B1/ar active
- 2009-11-30 WO PCT/US2009/066134 patent/WO2010065468A1/en not_active Ceased
- 2009-11-30 ES ES09764157T patent/ES2730881T3/es active Active
- 2009-11-30 JP JP2011539618A patent/JP6231731B2/ja active Active
- 2009-11-30 US US13/130,110 patent/US8933159B2/en active Active
- 2009-11-30 KR KR1020117015091A patent/KR101717793B1/ko active Active
- 2009-11-30 CA CA2744205A patent/CA2744205A1/en not_active Abandoned
- 2009-11-30 MX MX2011005662A patent/MX2011005662A/es unknown
- 2009-11-30 HU HUE09764157A patent/HUE043724T2/hu unknown
- 2009-11-30 CN CN201410311236.7A patent/CN104072648B/zh active Active
- 2009-11-30 TW TW098140799A patent/TWI494325B/zh not_active IP Right Cessation
- 2009-11-30 CN CN200980154118.7A patent/CN102272173B/zh active Active
- 2009-11-30 SG SG2011040086A patent/SG171908A1/en unknown
- 2009-11-30 EP EP09764157.5A patent/EP2370479B1/en active Active
- 2009-11-30 TR TR2019/05538T patent/TR201905538T4/tr unknown
- 2009-11-30 PL PL09764157T patent/PL2370479T3/pl unknown
-
2011
- 2011-05-31 IL IL213271A patent/IL213271A/en active IP Right Grant
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS58201809A (ja) * | 1982-05-19 | 1983-11-24 | Daicel Chem Ind Ltd | 新規ポリスチレン |
| US5112898A (en) * | 1989-06-06 | 1992-05-12 | Ferro Corporation | High impact polystyrene containing low molecular weight brominated polystyrene |
| CN1914239A (zh) * | 2004-01-30 | 2007-02-14 | 新日铁化学株式会社 | 固化性树脂组合物 |
| TW200837129A (en) * | 2007-01-10 | 2008-09-16 | Albemarle Corp | Brominated styrenic polymer compositions and processes for producing same |
Also Published As
| Publication number | Publication date |
|---|---|
| MX2011005662A (es) | 2011-08-12 |
| KR20110100245A (ko) | 2011-09-09 |
| CN104072648B (zh) | 2017-07-18 |
| JP6231731B2 (ja) | 2017-11-15 |
| JP2012510517A (ja) | 2012-05-10 |
| TW201030021A (en) | 2010-08-16 |
| HUE043724T2 (hu) | 2019-09-30 |
| US8933159B2 (en) | 2015-01-13 |
| PL2370479T3 (pl) | 2019-10-31 |
| WO2010065468A8 (en) | 2011-06-16 |
| ES2730881T3 (es) | 2019-11-13 |
| IL213271A0 (en) | 2011-07-31 |
| JO3423B1 (ar) | 2019-10-20 |
| CA2744205A1 (en) | 2010-06-10 |
| US20110224353A1 (en) | 2011-09-15 |
| CN104072648A (zh) | 2014-10-01 |
| WO2010065468A1 (en) | 2010-06-10 |
| IL213271A (en) | 2016-11-30 |
| CN102272173B (zh) | 2015-05-06 |
| TR201905538T4 (tr) | 2019-05-21 |
| CN102272173A (zh) | 2011-12-07 |
| EP2370479B1 (en) | 2019-03-13 |
| EP2370479A1 (en) | 2011-10-05 |
| KR101717793B1 (ko) | 2017-03-17 |
| SG171908A1 (en) | 2011-07-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| TWI494325B (zh) | 溴化阻燃劑及其前驅物 | |
| US8476373B2 (en) | Branched and star-branched styrene polymers, telomers, and adducts, their synthesis, their bromination, and their uses | |
| US8168723B2 (en) | Brominated styrenic polymers and their preparation | |
| EP2288628B1 (en) | Low molecular weight brominated polymers, processes for their manufacture and their use in thermoplastic formulations | |
| US8993684B2 (en) | Low molecular weight brominated polymers, processes for their manufacture and their use in thermoplastic formulations | |
| US20150337125A1 (en) | Brominated Flame Retardants and their use in Thermoplastic and Thermosetting Flammable Materials | |
| HK40007663A (en) | Low molecular weight brominated polymers, processes for their manufacture and their use in thermoplastic formulations |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Annulment or lapse of patent due to non-payment of fees |