TWI461426B - (二氫)咪唑並異〔5,1-a〕喹啉類 - Google Patents
(二氫)咪唑並異〔5,1-a〕喹啉類 Download PDFInfo
- Publication number
- TWI461426B TWI461426B TW099114528A TW99114528A TWI461426B TW I461426 B TWI461426 B TW I461426B TW 099114528 A TW099114528 A TW 099114528A TW 99114528 A TW99114528 A TW 99114528A TW I461426 B TWI461426 B TW I461426B
- Authority
- TW
- Taiwan
- Prior art keywords
- alkyl
- group
- vacuo
- concentrated
- methoxy
- Prior art date
Links
- 150000003248 quinolines Chemical class 0.000 title description 14
- 229940111121 antirheumatic drug quinolines Drugs 0.000 title description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 146
- -1 quinoline compound Chemical class 0.000 claims description 109
- 150000001875 compounds Chemical class 0.000 claims description 108
- 125000003545 alkoxy group Chemical group 0.000 claims description 43
- 125000000592 heterocycloalkyl group Chemical group 0.000 claims description 43
- 125000001072 heteroaryl group Chemical group 0.000 claims description 35
- 229910052736 halogen Inorganic materials 0.000 claims description 34
- 150000002367 halogens Chemical class 0.000 claims description 34
- 125000001424 substituent group Chemical group 0.000 claims description 30
- 125000003277 amino group Chemical group 0.000 claims description 26
- 125000003342 alkenyl group Chemical group 0.000 claims description 24
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 23
- 150000003839 salts Chemical class 0.000 claims description 23
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims description 21
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 20
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 20
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 19
- 125000004414 alkyl thio group Chemical group 0.000 claims description 19
- 229920006395 saturated elastomer Polymers 0.000 claims description 19
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 claims description 18
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 14
- 125000000304 alkynyl group Chemical group 0.000 claims description 13
- SMWDFEZZVXVKRB-UHFFFAOYSA-N anhydrous quinoline Natural products N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 claims description 13
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 12
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 12
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 12
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 11
- 125000006254 cycloalkyl carbonyl group Chemical group 0.000 claims description 10
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 10
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 8
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims description 8
- 150000001412 amines Chemical class 0.000 claims description 8
- 239000003814 drug Substances 0.000 claims description 8
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 8
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 8
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 7
- 150000001540 azides Chemical class 0.000 claims description 7
- 125000000000 cycloalkoxy group Chemical group 0.000 claims description 7
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 6
- 125000005553 heteroaryloxy group Chemical group 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 239000008194 pharmaceutical composition Substances 0.000 claims description 6
- 125000006598 aminocarbonylamino group Chemical group 0.000 claims description 5
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 5
- 125000005241 heteroarylamino group Chemical group 0.000 claims description 5
- 125000005224 heteroarylcarbonylamino group Chemical group 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 5
- 150000001335 aliphatic alkanes Chemical class 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 3
- OWIKHYCFFJSOEH-UHFFFAOYSA-N Isocyanic acid Chemical group N=C=O OWIKHYCFFJSOEH-UHFFFAOYSA-N 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- SFZULDYEOVSIKM-UHFFFAOYSA-N chembl321317 Chemical compound C1=CC(C(=N)NO)=CC=C1C1=CC=C(C=2C=CC(=CC=2)C(=N)NO)O1 SFZULDYEOVSIKM-UHFFFAOYSA-N 0.000 claims description 2
- 125000004496 thiazol-5-yl group Chemical group S1C=NC=C1* 0.000 claims description 2
- KAESVJOAVNADME-UHFFFAOYSA-N 1H-pyrrole Natural products C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 claims 1
- 125000005169 cycloalkylcarbonylamino group Chemical group 0.000 claims 1
- 125000001475 halogen functional group Chemical group 0.000 claims 1
- 239000000546 pharmaceutical excipient Substances 0.000 claims 1
- 125000003396 thiol group Chemical class [H]S* 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 755
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 327
- 235000019439 ethyl acetate Nutrition 0.000 description 274
- 239000000047 product Substances 0.000 description 211
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 192
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 183
- 239000000203 mixture Substances 0.000 description 174
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 171
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 170
- 239000011541 reaction mixture Substances 0.000 description 170
- 239000000243 solution Substances 0.000 description 132
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 118
- 239000012044 organic layer Substances 0.000 description 104
- 238000005160 1H NMR spectroscopy Methods 0.000 description 103
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 102
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 98
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 93
- 238000004587 chromatography analysis Methods 0.000 description 89
- 238000003756 stirring Methods 0.000 description 86
- 229930192474 thiophene Natural products 0.000 description 85
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 83
- 238000004809 thin layer chromatography Methods 0.000 description 71
- 239000012267 brine Substances 0.000 description 67
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 67
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 56
- 239000007787 solid Substances 0.000 description 56
- 125000004432 carbon atom Chemical group C* 0.000 description 50
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 45
- 238000000034 method Methods 0.000 description 43
- 239000000460 chlorine Substances 0.000 description 41
- 239000002904 solvent Substances 0.000 description 40
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical class OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 37
- 239000012317 TBTU Substances 0.000 description 37
- CLZISMQKJZCZDN-UHFFFAOYSA-N [benzotriazol-1-yloxy(dimethylamino)methylidene]-dimethylazanium Chemical compound C1=CC=C2N(OC(N(C)C)=[N+](C)C)N=NC2=C1 CLZISMQKJZCZDN-UHFFFAOYSA-N 0.000 description 37
- 238000005481 NMR spectroscopy Methods 0.000 description 36
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 29
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 29
- 239000001307 helium Substances 0.000 description 29
- 229910052734 helium Inorganic materials 0.000 description 29
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 description 29
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 28
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 28
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 27
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- 239000000725 suspension Substances 0.000 description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 25
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 25
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 24
- 238000006243 chemical reaction Methods 0.000 description 22
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 22
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- 210000004027 cell Anatomy 0.000 description 20
- 239000008188 pellet Substances 0.000 description 19
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 18
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 17
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 17
- 238000002953 preparative HPLC Methods 0.000 description 16
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 15
- 229910052757 nitrogen Inorganic materials 0.000 description 15
- 108010060374 FSH Receptors Proteins 0.000 description 14
- 230000015572 biosynthetic process Effects 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 14
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 14
- ZQGJEUVBUVKZKS-UHFFFAOYSA-N n,2-dimethylpropan-2-amine Chemical compound CNC(C)(C)C ZQGJEUVBUVKZKS-UHFFFAOYSA-N 0.000 description 14
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 14
- 239000012453 solvate Substances 0.000 description 14
- 238000003786 synthesis reaction Methods 0.000 description 14
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 13
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 12
- 102000008175 FSH Receptors Human genes 0.000 description 12
- 102000012673 Follicle Stimulating Hormone Human genes 0.000 description 12
- 108010079345 Follicle Stimulating Hormone Proteins 0.000 description 12
- 229910052799 carbon Inorganic materials 0.000 description 12
- 125000005842 heteroatom Chemical group 0.000 description 12
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 12
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 12
- 239000010410 layer Substances 0.000 description 12
- 102000005962 receptors Human genes 0.000 description 12
- 108020003175 receptors Proteins 0.000 description 12
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 11
- ZMNWMAGZLQKXFS-UHFFFAOYSA-N N-tert-butyl-N-methyldecan-1-amine Chemical compound CCCCCCCCCCN(C)C(C)(C)C ZMNWMAGZLQKXFS-UHFFFAOYSA-N 0.000 description 11
- 230000008878 coupling Effects 0.000 description 11
- 238000010168 coupling process Methods 0.000 description 11
- 238000005859 coupling reaction Methods 0.000 description 11
- 239000003480 eluent Substances 0.000 description 11
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 11
- 239000000651 prodrug Substances 0.000 description 11
- 229940002612 prodrug Drugs 0.000 description 11
- 125000001544 thienyl group Chemical group 0.000 description 11
- DTQVDTLACAAQTR-UHFFFAOYSA-N trifluoroacetic acid Substances OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 11
- 239000002253 acid Substances 0.000 description 10
- 239000002585 base Substances 0.000 description 10
- 229940028334 follicle stimulating hormone Drugs 0.000 description 10
- NDMFETHQFUOIQX-UHFFFAOYSA-N 1-(3-chloropropyl)imidazolidin-2-one Chemical compound ClCCCN1CCNC1=O NDMFETHQFUOIQX-UHFFFAOYSA-N 0.000 description 9
- QGFYFOHMBDMGBZ-UHFFFAOYSA-N 5-[(7-chloroquinolin-4-yl)amino]-2-(diethylaminomethyl)phenol Chemical compound C1=C(O)C(CN(CC)CC)=CC=C1NC1=CC=NC2=CC(Cl)=CC=C12 QGFYFOHMBDMGBZ-UHFFFAOYSA-N 0.000 description 9
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- 150000001721 carbon Chemical group 0.000 description 9
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 9
- 239000005457 ice water Substances 0.000 description 9
- 229940098779 methanesulfonic acid Drugs 0.000 description 9
- 239000011734 sodium Substances 0.000 description 9
- 229910000104 sodium hydride Inorganic materials 0.000 description 9
- 230000000638 stimulation Effects 0.000 description 9
- 238000012360 testing method Methods 0.000 description 9
- HVCNXQOWACZAFN-UHFFFAOYSA-N 4-ethylmorpholine Chemical compound CCN1CCOCC1 HVCNXQOWACZAFN-UHFFFAOYSA-N 0.000 description 8
- 238000001914 filtration Methods 0.000 description 8
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 8
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 8
- 125000004076 pyridyl group Chemical group 0.000 description 8
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 8
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 7
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 7
- 230000027455 binding Effects 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 7
- 230000014509 gene expression Effects 0.000 description 7
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 6
- 238000001035 drying Methods 0.000 description 6
- 235000019253 formic acid Nutrition 0.000 description 6
- 125000002883 imidazolyl group Chemical group 0.000 description 6
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 6
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 6
- 230000016087 ovulation Effects 0.000 description 6
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Natural products C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- 238000001946 ultra-performance liquid chromatography-mass spectrometry Methods 0.000 description 6
- DXJSJHFRGIYTJZ-UHFFFAOYSA-N 5-butyl-5-(5-butylnonan-5-yloxy)nonane Chemical compound CCCCC(CCCC)(CCCC)OC(CCCC)(CCCC)CCCC DXJSJHFRGIYTJZ-UHFFFAOYSA-N 0.000 description 5
- 108020004414 DNA Proteins 0.000 description 5
- 102000003864 Human Follicle Stimulating Hormone Human genes 0.000 description 5
- 108010082302 Human Follicle Stimulating Hormone Proteins 0.000 description 5
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 5
- 108700008625 Reporter Genes Proteins 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 239000003153 chemical reaction reagent Substances 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 208000000509 infertility Diseases 0.000 description 5
- 230000036512 infertility Effects 0.000 description 5
- 231100000535 infertility Toxicity 0.000 description 5
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 5
- 230000002611 ovarian Effects 0.000 description 5
- 230000003647 oxidation Effects 0.000 description 5
- 238000007254 oxidation reaction Methods 0.000 description 5
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 5
- 238000002360 preparation method Methods 0.000 description 5
- ANOUKFYBOAKOIR-UHFFFAOYSA-N 3,4-dimethoxyphenylethylamine Chemical compound COC1=CC=C(CCN)C=C1OC ANOUKFYBOAKOIR-UHFFFAOYSA-N 0.000 description 4
- WBZLGNODHLEZLU-UHFFFAOYSA-N 5,6-dihydroimidazo[5,1-a]isoquinoline Chemical class C12=CC=CC=C2CCN2C1=CN=C2 WBZLGNODHLEZLU-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 102000006771 Gonadotropins Human genes 0.000 description 4
- 108010086677 Gonadotropins Proteins 0.000 description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Chemical class NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 4
- OLBVUFHMDRJKTK-UHFFFAOYSA-N [N].[O] Chemical compound [N].[O] OLBVUFHMDRJKTK-UHFFFAOYSA-N 0.000 description 4
- 230000001270 agonistic effect Effects 0.000 description 4
- 150000001299 aldehydes Chemical class 0.000 description 4
- 125000004429 atom Chemical group 0.000 description 4
- 150000004985 diamines Chemical class 0.000 description 4
- OJCSPXHYDFONPU-UHFFFAOYSA-N etoac etoac Chemical compound CCOC(C)=O.CCOC(C)=O OJCSPXHYDFONPU-UHFFFAOYSA-N 0.000 description 4
- 125000002541 furyl group Chemical group 0.000 description 4
- 239000002622 gonadotropin Substances 0.000 description 4
- 229940094892 gonadotropins Drugs 0.000 description 4
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 4
- 150000002576 ketones Chemical class 0.000 description 4
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 4
- 238000006138 lithiation reaction Methods 0.000 description 4
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 4
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 210000001672 ovary Anatomy 0.000 description 4
- 125000002971 oxazolyl group Chemical group 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- BLTDCIWCFCUQCB-UHFFFAOYSA-N quinoline-3-carboxamide Chemical compound C1=CC=CC2=CC(C(=O)N)=CN=C21 BLTDCIWCFCUQCB-UHFFFAOYSA-N 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 238000006722 reduction reaction Methods 0.000 description 4
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 125000001113 thiadiazolyl group Chemical group 0.000 description 4
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 4
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 3
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 3
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 3
- GHORVQYSFFISFC-UHFFFAOYSA-N 8-methoxy-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline-3,9-dicarboxylic acid Chemical compound C=12C=3C=C(C(O)=O)C(OC)=CC=3CCN2C(C(O)=O)=NC=1C1=CC=CS1 GHORVQYSFFISFC-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- XJUZRXYOEPSWMB-UHFFFAOYSA-N Chloromethyl methyl ether Chemical compound COCCl XJUZRXYOEPSWMB-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 108060001084 Luciferase Proteins 0.000 description 3
- 239000005089 Luciferase Substances 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 108091027981 Response element Proteins 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 3
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 238000003556 assay Methods 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 3
- 230000021523 carboxylation Effects 0.000 description 3
- 238000006473 carboxylation reaction Methods 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 229940043279 diisopropylamine Drugs 0.000 description 3
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 3
- CNUDBTRUORMMPA-UHFFFAOYSA-N formylthiophene Chemical compound O=CC1=CC=CS1 CNUDBTRUORMMPA-UHFFFAOYSA-N 0.000 description 3
- 230000006870 function Effects 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 238000007429 general method Methods 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- 238000002955 isolation Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910052744 lithium Inorganic materials 0.000 description 3
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 230000001404 mediated effect Effects 0.000 description 3
- 239000002609 medium Substances 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- 238000007911 parenteral administration Methods 0.000 description 3
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 3
- 239000002243 precursor Substances 0.000 description 3
- 229960004134 propofol Drugs 0.000 description 3
- 108090000623 proteins and genes Proteins 0.000 description 3
- 125000003226 pyrazolyl group Chemical group 0.000 description 3
- 238000011160 research Methods 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- 238000006798 ring closing metathesis reaction Methods 0.000 description 3
- 239000012312 sodium hydride Substances 0.000 description 3
- 230000004936 stimulating effect Effects 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 125000003831 tetrazolyl group Chemical group 0.000 description 3
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 3
- VZXTWGWHSMCWGA-UHFFFAOYSA-N 1,3,5-triazine-2,4-diamine Chemical group NC1=NC=NC(N)=N1 VZXTWGWHSMCWGA-UHFFFAOYSA-N 0.000 description 2
- BGRKDLVBPMCBJW-UHFFFAOYSA-N 2-ethyltetrazole Chemical compound CCN1N=CN=N1 BGRKDLVBPMCBJW-UHFFFAOYSA-N 0.000 description 2
- YEDUAINPPJYDJZ-UHFFFAOYSA-N 2-hydroxybenzothiazole Chemical compound C1=CC=C2SC(O)=NC2=C1 YEDUAINPPJYDJZ-UHFFFAOYSA-N 0.000 description 2
- BKOOMYPCSUNDGP-UHFFFAOYSA-N 2-methylbut-2-ene Chemical compound CC=C(C)C BKOOMYPCSUNDGP-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- NKSZCPBUWGZONP-UHFFFAOYSA-N 3,4-dihydroisoquinoline Chemical compound C1=CC=C2C=NCCC2=C1 NKSZCPBUWGZONP-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- WSNMPAVSZJSIMT-UHFFFAOYSA-N COc1c(C)c2COC(=O)c2c(O)c1CC(O)C1(C)CCC(=O)O1 Chemical compound COc1c(C)c2COC(=O)c2c(O)c1CC(O)C1(C)CCC(=O)O1 WSNMPAVSZJSIMT-UHFFFAOYSA-N 0.000 description 2
- 108090000331 Firefly luciferases Proteins 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 108091006065 Gs proteins Proteins 0.000 description 2
- RAXXELZNTBOGNW-UHFFFAOYSA-O Imidazolium Chemical compound C1=C[NH+]=CN1 RAXXELZNTBOGNW-UHFFFAOYSA-O 0.000 description 2
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- NAXKFVIRJICPAO-LHNWDKRHSA-N [(1R,3S,4R,6R,7R,9S,10S,12R,13S,15S,16R,18S,19S,21S,22S,24S,25S,27S,28R,30R,31R,33S,34S,36R,37R,39R,40S,42R,44R,46S,48S,50R,52S,54S,56S)-46,48,50,52,54,56-hexakis(hydroxymethyl)-2,8,14,20,26,32,38,43,45,47,49,51,53,55-tetradecaoxa-5,11,17,23,29,35,41-heptathiapentadecacyclo[37.3.2.23,7.29,13.215,19.221,25.227,31.233,37.04,6.010,12.016,18.022,24.028,30.034,36.040,42]hexapentacontan-44-yl]methanol Chemical compound OC[C@H]1O[C@H]2O[C@H]3[C@H](CO)O[C@H](O[C@H]4[C@H](CO)O[C@H](O[C@@H]5[C@@H](CO)O[C@H](O[C@H]6[C@H](CO)O[C@H](O[C@H]7[C@H](CO)O[C@@H](O[C@H]8[C@H](CO)O[C@@H](O[C@@H]1[C@@H]1S[C@@H]21)[C@@H]1S[C@H]81)[C@H]1S[C@@H]71)[C@H]1S[C@H]61)[C@H]1S[C@@H]51)[C@H]1S[C@@H]41)[C@H]1S[C@H]31 NAXKFVIRJICPAO-LHNWDKRHSA-N 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 239000000556 agonist Substances 0.000 description 2
- 125000003282 alkyl amino group Chemical group 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 229940027991 antiseptic and disinfectant quinoline derivative Drugs 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 229910002091 carbon monoxide Inorganic materials 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 210000004978 chinese hamster ovary cell Anatomy 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 239000002178 crystalline material Substances 0.000 description 2
- 230000018044 dehydration Effects 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 208000035475 disorder Diseases 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 238000009510 drug design Methods 0.000 description 2
- 229940011871 estrogen Drugs 0.000 description 2
- 239000000262 estrogen Substances 0.000 description 2
- 230000035558 fertility Effects 0.000 description 2
- 230000004720 fertilization Effects 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 230000008217 follicular development Effects 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 238000004108 freeze drying Methods 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229940088597 hormone Drugs 0.000 description 2
- 239000005556 hormone Substances 0.000 description 2
- 150000004677 hydrates Chemical class 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- BMFVGAAISNGQNM-UHFFFAOYSA-N isopentylamine Chemical compound CC(C)CCN BMFVGAAISNGQNM-UHFFFAOYSA-N 0.000 description 2
- 239000007937 lozenge Substances 0.000 description 2
- 230000002503 metabolic effect Effects 0.000 description 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 description 2
- XQOIBQBPAXOVGP-UHFFFAOYSA-N n-ethyl-2-methylpropan-2-amine Chemical compound CCNC(C)(C)C XQOIBQBPAXOVGP-UHFFFAOYSA-N 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000005022 packaging material Substances 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- IPCSVZSSVZVIGE-UHFFFAOYSA-N palmitic acid group Chemical group C(CCCCCCCCCCCCCCC)(=O)O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 2
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 2
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 230000023603 positive regulation of transcription initiation, DNA-dependent Effects 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 230000008569 process Effects 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- FSYKKLYZXJSNPZ-UHFFFAOYSA-N sarcosine Chemical compound C[NH2+]CC([O-])=O FSYKKLYZXJSNPZ-UHFFFAOYSA-N 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- UCSJYZPVAKXKNQ-HZYVHMACSA-N streptomycin Chemical compound CN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@@H]1[C@](C=O)(O)[C@H](C)O[C@H]1O[C@@H]1[C@@H](NC(N)=N)[C@H](O)[C@@H](NC(N)=N)[C@H](O)[C@H]1O UCSJYZPVAKXKNQ-HZYVHMACSA-N 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 150000003536 tetrazoles Chemical class 0.000 description 2
- 229940124597 therapeutic agent Drugs 0.000 description 2
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- DKZBBWMURDFHNE-UHFFFAOYSA-N trans-coniferylaldehyde Natural products COC1=CC(C=CC=O)=CC=C1O DKZBBWMURDFHNE-UHFFFAOYSA-N 0.000 description 2
- GOWNSHUNTJWVOM-UHFFFAOYSA-N tributyl(1,3-thiazol-5-yl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C1=CN=CS1 GOWNSHUNTJWVOM-UHFFFAOYSA-N 0.000 description 2
- CFQJBWKKHCMCGJ-UHFFFAOYSA-N tributyl(pyridin-3-yl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C1=CC=CN=C1 CFQJBWKKHCMCGJ-UHFFFAOYSA-N 0.000 description 2
- MWOOGOJBHIARFG-UHFFFAOYSA-N vanillin Chemical compound COC1=CC(C=O)=CC=C1O MWOOGOJBHIARFG-UHFFFAOYSA-N 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- CXNIUSPIQKWYAI-UHFFFAOYSA-N xantphos Chemical compound C=12OC3=C(P(C=4C=CC=CC=4)C=4C=CC=CC=4)C=CC=C3C(C)(C)C2=CC=CC=1P(C=1C=CC=CC=1)C1=CC=CC=C1 CXNIUSPIQKWYAI-UHFFFAOYSA-N 0.000 description 2
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 1
- KYMWDQNBDSDOQI-UHFFFAOYSA-N (2,2-dimethylpyrrolidin-1-yl)-(8-methoxy-9-propan-2-yloxy-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinolin-3-yl)methanone Chemical compound C=12C=3C=C(OC(C)C)C(OC)=CC=3CCN2C(C(=O)N2C(CCC2)(C)C)=NC=1C1=CC=CS1 KYMWDQNBDSDOQI-UHFFFAOYSA-N 0.000 description 1
- VJDTXRZCRGFYRC-UHFFFAOYSA-N (2-ethylpyrrolidin-1-yl)-(8-methoxy-9-propan-2-yloxy-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinolin-3-yl)methanone Chemical compound CCC1CCCN1C(=O)C1=NC(C=2SC=CC=2)=C2N1CCC1=CC(OC)=C(OC(C)C)C=C12 VJDTXRZCRGFYRC-UHFFFAOYSA-N 0.000 description 1
- JKFYKCYQEWQPTM-SSDOTTSWSA-N (2r)-2-amino-2-(4-fluorophenyl)acetic acid Chemical compound OC(=O)[C@H](N)C1=CC=C(F)C=C1 JKFYKCYQEWQPTM-SSDOTTSWSA-N 0.000 description 1
- FMCAFXHLMUOIGG-IWFBPKFRSA-N (2s)-2-[[(2s)-2-[[(2s)-2-[[(2r)-2-formamido-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxy-2,5-dimethylphenyl)propanoyl]amino]-4-methylsulfanylbutanoic acid Chemical compound O=CN[C@@H](CS)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(O)=O)CC1=CC(C)=C(O)C=C1C FMCAFXHLMUOIGG-IWFBPKFRSA-N 0.000 description 1
- NLLGFYPSWCMUIV-UHFFFAOYSA-N (3-methoxyphenyl)boronic acid Chemical compound COC1=CC=CC(B(O)O)=C1 NLLGFYPSWCMUIV-UHFFFAOYSA-N 0.000 description 1
- PYOMDAOBIJGQBR-UHFFFAOYSA-N (6-methoxy-7-propan-2-yloxyisoquinolin-1-yl)-thiophen-2-ylmethanone Chemical compound C=12C=C(OC(C)C)C(OC)=CC2=CC=NC=1C(=O)C1=CC=CS1 PYOMDAOBIJGQBR-UHFFFAOYSA-N 0.000 description 1
- WKTYLRUJMKNNDG-UHFFFAOYSA-N (8,9-dimethoxy-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinolin-3-yl)-(2-methylpyrrolidin-1-yl)methanone Chemical compound C=12C=3C=C(OC)C(OC)=CC=3CCN2C(C(=O)N2C(CCC2)C)=NC=1C1=CC=CS1 WKTYLRUJMKNNDG-UHFFFAOYSA-N 0.000 description 1
- ZQTUDDTXASOZOI-UHFFFAOYSA-N (8-methoxy-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinolin-9-yl) methanesulfonate Chemical compound C=12C=3C=C(OS(C)(=O)=O)C(OC)=CC=3CCN2C=NC=1C1=CC=CS1 ZQTUDDTXASOZOI-UHFFFAOYSA-N 0.000 description 1
- KDTWXGUXWNBYGS-UHFFFAOYSA-N 1,2,3,3,4,4-hexamethyl-5H-diazepine Chemical compound CC1(C(N(N(C=CC1)C)C)(C)C)C KDTWXGUXWNBYGS-UHFFFAOYSA-N 0.000 description 1
- DIIIISSCIXVANO-UHFFFAOYSA-N 1,2-Dimethylhydrazine Chemical compound CNNC DIIIISSCIXVANO-UHFFFAOYSA-N 0.000 description 1
- LRANPJDWHYRCER-UHFFFAOYSA-N 1,2-diazepine Chemical compound N1C=CC=CC=N1 LRANPJDWHYRCER-UHFFFAOYSA-N 0.000 description 1
- QUKGLNCXGVWCJX-UHFFFAOYSA-N 1,3,4-thiadiazol-2-amine Chemical compound NC1=NN=CS1 QUKGLNCXGVWCJX-UHFFFAOYSA-N 0.000 description 1
- ZFTDZCSCEUPINX-UHFFFAOYSA-N 1,3-dibromo-8-methoxy-9-(2-methylpropyl)-5,6-dihydroimidazo[5,1-a]isoquinoline Chemical compound C1CN2C(Br)=NC(Br)=C2C2=C1C=C(OC)C(CC(C)C)=C2 ZFTDZCSCEUPINX-UHFFFAOYSA-N 0.000 description 1
- UAZUEDJLHSYTDR-UHFFFAOYSA-N 1,3-dibromo-8-methoxy-9-propan-2-yloxy-5,6-dihydroimidazo[5,1-a]isoquinoline Chemical compound C1CN2C(Br)=NC(Br)=C2C2=C1C=C(OC)C(OC(C)C)=C2 UAZUEDJLHSYTDR-UHFFFAOYSA-N 0.000 description 1
- HMVYYTRDXNKRBQ-UHFFFAOYSA-N 1,3-thiazole-4-carboxylic acid Chemical compound OC(=O)C1=CSC=N1 HMVYYTRDXNKRBQ-UHFFFAOYSA-N 0.000 description 1
- RNHDAKUGFHSZEV-UHFFFAOYSA-N 1,4-dioxane;hydrate Chemical compound O.C1COCCO1 RNHDAKUGFHSZEV-UHFFFAOYSA-N 0.000 description 1
- MEBSCXWLVOHDOS-UHFFFAOYSA-N 1-(2-bromophenyl)imidazole-4-carboxylic acid Chemical compound C1=NC(C(=O)O)=CN1C1=CC=CC=C1Br MEBSCXWLVOHDOS-UHFFFAOYSA-N 0.000 description 1
- CVUSMPAFGCSWPQ-UHFFFAOYSA-N 1-(4-fluorophenyl)-8,9-dimethoxy-5,6-dihydroimidazo[5,1-a]isoquinoline-3-carboxylic acid Chemical compound C=12C=3C=C(OC)C(OC)=CC=3CCN2C(C(O)=O)=NC=1C1=CC=C(F)C=C1 CVUSMPAFGCSWPQ-UHFFFAOYSA-N 0.000 description 1
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 1
- AWNXKZVIZARMME-UHFFFAOYSA-N 1-[[5-[2-[(2-chloropyridin-4-yl)amino]pyrimidin-4-yl]-4-(cyclopropylmethyl)pyrimidin-2-yl]amino]-2-methylpropan-2-ol Chemical compound N=1C(NCC(C)(O)C)=NC=C(C=2N=C(NC=3C=C(Cl)N=CC=3)N=CC=2)C=1CC1CC1 AWNXKZVIZARMME-UHFFFAOYSA-N 0.000 description 1
- VEGAJYYPDNUANT-UHFFFAOYSA-N 1-benzyl-3-phenyl-5,6-dihydroimidazo[5,1-a]isoquinoline Chemical compound C=1C=CC=CC=1CC(=C1C2=CC=CC=C2CCN11)N=C1C1=CC=CC=C1 VEGAJYYPDNUANT-UHFFFAOYSA-N 0.000 description 1
- RRFCJCJCKNHARP-SNAWJCMRSA-N 1-bromo-2-methoxy-4-[(e)-2-nitroethenyl]benzene Chemical compound COC1=CC(\C=C\[N+]([O-])=O)=CC=C1Br RRFCJCJCKNHARP-SNAWJCMRSA-N 0.000 description 1
- JNBDWVGFFDOHJL-UHFFFAOYSA-N 1-bromo-4-(2-isocyanoethyl)-2-methoxybenzene Chemical compound COC1=CC(CC[N+]#[C-])=CC=C1Br JNBDWVGFFDOHJL-UHFFFAOYSA-N 0.000 description 1
- NNQDMQVWOWCVEM-UHFFFAOYSA-N 1-bromoprop-1-ene Chemical compound CC=CBr NNQDMQVWOWCVEM-UHFFFAOYSA-N 0.000 description 1
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- ONQBOTKLCMXPOF-UHFFFAOYSA-N 1-ethylpyrrolidine Chemical compound CCN1CCCC1 ONQBOTKLCMXPOF-UHFFFAOYSA-N 0.000 description 1
- IHEKXWINFWGDNL-UHFFFAOYSA-N 1-fluoro-5-(2-isocyanoethyl)-3-methoxy-2-(2-methylpropyl)benzene Chemical compound COC1=CC(CC[N+]#[C-])=CC(F)=C1CC(C)C IHEKXWINFWGDNL-UHFFFAOYSA-N 0.000 description 1
- KPTHWGDXTGXGSZ-UHFFFAOYSA-N 1-methyl-3-phenyl-5,6-dihydroimidazo[5,1-a]isoquinoline Chemical compound N12CCC3=CC=CC=C3C2=C(C)N=C1C1=CC=CC=C1 KPTHWGDXTGXGSZ-UHFFFAOYSA-N 0.000 description 1
- KMNFDXZAGPYFHD-UHFFFAOYSA-N 10-fluoro-8-methoxy-9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline Chemical compound C=12C=3C(F)=C(CC(C)C)C(OC)=CC=3CCN2C=NC=1C1=CC=CS1 KMNFDXZAGPYFHD-UHFFFAOYSA-N 0.000 description 1
- KJUGUADJHNHALS-UHFFFAOYSA-N 1H-tetrazole Substances C=1N=NNN=1 KJUGUADJHNHALS-UHFFFAOYSA-N 0.000 description 1
- POXWDTQUDZUOGP-UHFFFAOYSA-N 1h-1,4-diazepine Chemical compound N1C=CC=NC=C1 POXWDTQUDZUOGP-UHFFFAOYSA-N 0.000 description 1
- PHODFIDDEBEGCS-UHFFFAOYSA-N 2,2-dimethylpyrrolidine Chemical compound CC1(C)CCCN1 PHODFIDDEBEGCS-UHFFFAOYSA-N 0.000 description 1
- XKBUFTXNLBWTFP-UHFFFAOYSA-N 2-(2,3-dimethoxyphenyl)ethanamine Chemical compound COC1=CC=CC(CCN)=C1OC XKBUFTXNLBWTFP-UHFFFAOYSA-N 0.000 description 1
- FMOIXKQKOWLYEK-UHFFFAOYSA-N 2-(2-chloroethyl)thiophene Chemical compound ClCCC1=CC=CS1 FMOIXKQKOWLYEK-UHFFFAOYSA-N 0.000 description 1
- HJGNAXXDNNYRNN-UHFFFAOYSA-N 2-(3-methoxy-4-propan-2-yloxyphenyl)ethanamine Chemical compound COC1=CC(CCN)=CC=C1OC(C)C HJGNAXXDNNYRNN-UHFFFAOYSA-N 0.000 description 1
- KNLHFRSNELASBY-UHFFFAOYSA-N 2-(4-bromo-3-methoxyphenyl)ethanamine Chemical compound COC1=CC(CCN)=CC=C1Br KNLHFRSNELASBY-UHFFFAOYSA-N 0.000 description 1
- RILLZYSZSDGYGV-UHFFFAOYSA-N 2-(propan-2-ylamino)ethanol Chemical compound CC(C)NCCO RILLZYSZSDGYGV-UHFFFAOYSA-N 0.000 description 1
- YMYRWSAOKZNKEL-UHFFFAOYSA-N 2-[3-fluoro-5-methoxy-4-(2-methylprop-1-enyl)phenyl]ethanamine Chemical compound COC1=CC(CCN)=CC(F)=C1C=C(C)C YMYRWSAOKZNKEL-UHFFFAOYSA-N 0.000 description 1
- DEZSEBNNJATSMB-UHFFFAOYSA-N 2-[3-methoxy-4-(2-methylprop-1-enyl)phenyl]ethanamine Chemical compound COC1=CC(CCN)=CC=C1C=C(C)C DEZSEBNNJATSMB-UHFFFAOYSA-N 0.000 description 1
- 125000006016 2-bromoethoxy group Chemical group 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- LRLQQERNMXHASR-UHFFFAOYSA-N 2-diphenylphosphanylpropan-2-yl(diphenyl)phosphane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)C(C)(C)P(C=1C=CC=CC=1)C1=CC=CC=C1 LRLQQERNMXHASR-UHFFFAOYSA-N 0.000 description 1
- JFZLDRUSMYBXRI-UHFFFAOYSA-N 2-ethylpyrrolidine Chemical compound CCC1CCCN1 JFZLDRUSMYBXRI-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- XIJXCJCWHKUKAW-UHFFFAOYSA-N 2-isocyanoethylbenzene Chemical compound [C-]#[N+]CCC1=CC=CC=C1 XIJXCJCWHKUKAW-UHFFFAOYSA-N 0.000 description 1
- OFIVHIQUSDBPEN-VOTSOKGWSA-N 2-methoxy-1-(2-methylprop-1-enyl)-4-[(e)-2-nitroethenyl]benzene Chemical compound COC1=CC(\C=C\[N+]([O-])=O)=CC=C1C=C(C)C OFIVHIQUSDBPEN-VOTSOKGWSA-N 0.000 description 1
- SZRCDNPCLQFMIS-VOTSOKGWSA-N 2-methoxy-4-[(e)-2-nitroethenyl]-1-propan-2-yloxybenzene Chemical compound COC1=CC(\C=C\[N+]([O-])=O)=CC=C1OC(C)C SZRCDNPCLQFMIS-VOTSOKGWSA-N 0.000 description 1
- RGHPCLZJAFCTIK-UHFFFAOYSA-N 2-methylpyrrolidine Chemical compound CC1CCCN1 RGHPCLZJAFCTIK-UHFFFAOYSA-N 0.000 description 1
- PIAOLBVUVDXHHL-UHFFFAOYSA-N 2-nitroethenylbenzene Chemical class [O-][N+](=O)C=CC1=CC=CC=C1 PIAOLBVUVDXHHL-UHFFFAOYSA-N 0.000 description 1
- OOGOFUKAJDPHDJ-UHFFFAOYSA-N 3-fluoro-4-hydroxy-5-methoxybenzaldehyde Chemical compound COC1=CC(C=O)=CC(F)=C1O OOGOFUKAJDPHDJ-UHFFFAOYSA-N 0.000 description 1
- AUBBVPIQUDFRQI-UHFFFAOYSA-N 3-hydroxy-4-nitrobenzaldehyde Chemical compound OC1=CC(C=O)=CC=C1[N+]([O-])=O AUBBVPIQUDFRQI-UHFFFAOYSA-N 0.000 description 1
- DUCKVDDRLJJTGS-UHFFFAOYSA-N 3-methoxy-4-(2-methylprop-1-enyl)benzaldehyde Chemical compound COC1=CC(C=O)=CC=C1C=C(C)C DUCKVDDRLJJTGS-UHFFFAOYSA-N 0.000 description 1
- WUTIWOZYHHSBBU-UHFFFAOYSA-N 3-methoxy-4-nitrobenzaldehyde Chemical compound COC1=CC(C=O)=CC=C1[N+]([O-])=O WUTIWOZYHHSBBU-UHFFFAOYSA-N 0.000 description 1
- BSVXIKDDVDCMIO-UHFFFAOYSA-N 3-methoxy-4-propan-2-yloxybenzaldehyde Chemical compound COC1=CC(C=O)=CC=C1OC(C)C BSVXIKDDVDCMIO-UHFFFAOYSA-N 0.000 description 1
- GFPASKVYWQLKGJ-UHFFFAOYSA-N 3-methyl-5,6-dihydroimidazo[5,1-a]isoquinoline-1-carboxamide Chemical compound C1=CC=C2CCN3C(C)=NC(C(N)=O)=C3C2=C1 GFPASKVYWQLKGJ-UHFFFAOYSA-N 0.000 description 1
- FGXFVFNZDYMFON-UHFFFAOYSA-N 3-phenyl-5,6-dihydroimidazo[5,1-a]isoquinoline Chemical class C12=CC=CC=C2CCN2C1=CN=C2C1=CC=CC=C1 FGXFVFNZDYMFON-UHFFFAOYSA-N 0.000 description 1
- AWRIOTVUTPLWLF-UHFFFAOYSA-N 4-(2-aminoethyl)-2-methoxyphenol;hydron;chloride Chemical compound Cl.COC1=CC(CCN)=CC=C1O AWRIOTVUTPLWLF-UHFFFAOYSA-N 0.000 description 1
- SNFXKHJDUXYNSU-UHFFFAOYSA-N 4-(3-chlorophenyl)morpholine Chemical compound ClC1=CC=CC(N2CCOCC2)=C1 SNFXKHJDUXYNSU-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- GNSWIAYWYINAGV-UHFFFAOYSA-N 4-amino-3-methoxybenzaldehyde Chemical compound COC1=CC(C=O)=CC=C1N GNSWIAYWYINAGV-UHFFFAOYSA-N 0.000 description 1
- HKLCOMKRVBQSHA-UHFFFAOYSA-N 4-bromo-3-methoxybenzaldehyde Chemical compound COC1=CC(C=O)=CC=C1Br HKLCOMKRVBQSHA-UHFFFAOYSA-N 0.000 description 1
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- GNHSSAFFXFZXJT-UHFFFAOYSA-N 5,6-dihydroimidazo[5,1-a]isoquinolin-3-amine Chemical class C1=CC=C2CCN3C(N)=NC=C3C2=C1 GNHSSAFFXFZXJT-UHFFFAOYSA-N 0.000 description 1
- HWQBWXKEPBEVFG-UHFFFAOYSA-N 5,6-dihydroimidazo[5,1-a]isoquinoline-1-carboxylic acid Chemical compound C1=CC=C2C3=C(C(=O)O)N=CN3CCC2=C1 HWQBWXKEPBEVFG-UHFFFAOYSA-N 0.000 description 1
- FCUQWKSTFGQTMY-UHFFFAOYSA-N 5-bromo-2-(1-phenylethyl)-1H-imidazole Chemical compound C1(=CC=CC=C1)C(C)C=1NC(=CN=1)Br FCUQWKSTFGQTMY-UHFFFAOYSA-N 0.000 description 1
- WNWMDFJRBUJYGT-UHFFFAOYSA-N 5-ethyl-3h-thiadiazol-2-amine Chemical compound CCC1=CNN(N)S1 WNWMDFJRBUJYGT-UHFFFAOYSA-N 0.000 description 1
- XHLKOHSAWQPOFO-UHFFFAOYSA-N 5-phenyl-1h-imidazole Chemical class N1C=NC=C1C1=CC=CC=C1 XHLKOHSAWQPOFO-UHFFFAOYSA-N 0.000 description 1
- UFDLCGLLPHVNRN-UHFFFAOYSA-N 6-methoxy-7-propan-2-yloxy-1-(thiophen-2-ylmethyl)-3,4-dihydroisoquinoline Chemical compound C1=2C=C(OC(C)C)C(OC)=CC=2CCN=C1CC1=CC=CS1 UFDLCGLLPHVNRN-UHFFFAOYSA-N 0.000 description 1
- VNGKMURMGUXGAN-UHFFFAOYSA-N 8,9-dimethoxy-1-phenyl-5,6-dihydroimidazo[5,1-a]isoquinoline Chemical compound C=12C=3C=C(OC)C(OC)=CC=3CCN2C=NC=1C1=CC=CC=C1 VNGKMURMGUXGAN-UHFFFAOYSA-N 0.000 description 1
- ZFZSMLBYCHKXBS-UHFFFAOYSA-N 8,9-dimethoxy-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline Chemical compound C=12C=3C=C(OC)C(OC)=CC=3CCN2C=NC=1C1=CC=CS1 ZFZSMLBYCHKXBS-UHFFFAOYSA-N 0.000 description 1
- VBWUETKNYYECSW-UHFFFAOYSA-N 8,9-dimethoxy-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline-3-carboxylic acid Chemical compound C=12C=3C=C(OC)C(OC)=CC=3CCN2C(C(O)=O)=NC=1C1=CC=CS1 VBWUETKNYYECSW-UHFFFAOYSA-N 0.000 description 1
- SENIZCBCQVYIFS-UHFFFAOYSA-N 8-ethenyl-9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline Chemical compound N1=CN2CCC=3C=C(C=C)C(CC(C)C)=CC=3C2=C1C1=CC=CS1 SENIZCBCQVYIFS-UHFFFAOYSA-N 0.000 description 1
- IXKJCXBPTCAUQV-UHFFFAOYSA-N 8-ethoxy-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline-3-carboxylic acid Chemical compound C(C)OC=1C=C2CCN3C(C2=CC=1)=C(N=C3C(=O)O)C=1SC=CC=1 IXKJCXBPTCAUQV-UHFFFAOYSA-N 0.000 description 1
- FVPKQFPMQZLOSI-UHFFFAOYSA-N 8-methoxy-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinolin-9-ol Chemical compound C=12C=3C=C(O)C(OC)=CC=3CCN2C=NC=1C1=CC=CS1 FVPKQFPMQZLOSI-UHFFFAOYSA-N 0.000 description 1
- BKDWACXXZUXXAA-UHFFFAOYSA-N 8-methoxy-9-(1-methylpyrazol-4-yl)-1-thiophen-2-ylimidazo[5,1-a]isoquinoline-3-carboxylic acid Chemical compound COC=1C=C2C=CN3C(C2=CC=1C=1C=NN(C=1)C)=C(N=C3C(=O)O)C=1SC=CC=1 BKDWACXXZUXXAA-UHFFFAOYSA-N 0.000 description 1
- OEOQFTVKNKQDAQ-UHFFFAOYSA-N 8-methoxy-9-(2-methylpropyl)-1-(1,3-oxazol-2-yl)-5,6-dihydroimidazo[5,1-a]isoquinoline-3-carboxylic acid Chemical compound C(C(C)C)C1=C(C=C2CCN3C(C2=C1)=C(N=C3C(=O)O)C=3OC=CN3)OC OEOQFTVKNKQDAQ-UHFFFAOYSA-N 0.000 description 1
- QUDCSAUQUYSLIU-UHFFFAOYSA-N 8-methoxy-9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline Chemical compound C=12C=3C=C(CC(C)C)C(OC)=CC=3CCN2C=NC=1C1=CC=CS1 QUDCSAUQUYSLIU-UHFFFAOYSA-N 0.000 description 1
- MJOFQOQJEJRQTK-UHFFFAOYSA-N 8-methoxy-9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline-3-carboxylic acid Chemical compound COc1cc2CCn3c(nc(-c4cccs4)c3-c2cc1CC(C)C)C(O)=O MJOFQOQJEJRQTK-UHFFFAOYSA-N 0.000 description 1
- NDXGKSSOQSIPMB-UHFFFAOYSA-N 8-methoxy-9-(2-methylpropyl)-5,6-dihydroimidazo[5,1-a]isoquinoline Chemical compound C1CN2C=NC=C2C2=C1C=C(OC)C(CC(C)C)=C2 NDXGKSSOQSIPMB-UHFFFAOYSA-N 0.000 description 1
- URZUIQSCVKOXBH-UHFFFAOYSA-N 8-methoxy-9-(methoxymethoxy)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline Chemical compound N1=CN2CCC=3C=C(OC)C(OCOC)=CC=3C2=C1C1=CC=CS1 URZUIQSCVKOXBH-UHFFFAOYSA-N 0.000 description 1
- FFVOOMHQIJAJGA-UHFFFAOYSA-N 8-methoxy-9-phenoxy-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline Chemical compound C=12C=3C=C(OC=4C=CC=CC=4)C(OC)=CC=3CCN2C=NC=1C1=CC=CS1 FFVOOMHQIJAJGA-UHFFFAOYSA-N 0.000 description 1
- ONZUUBYWCHBCEW-UHFFFAOYSA-N 8-methoxy-9-propan-2-yloxy-1-(1,3-thiazol-5-yl)-5,6-dihydroimidazo[5,1-a]isoquinoline-3-carboxylic acid Chemical compound C(C)(C)OC1=C(C=C2CCN3C(C2=C1)=C(N=C3C(=O)O)C3=CN=CS3)OC ONZUUBYWCHBCEW-UHFFFAOYSA-N 0.000 description 1
- JJNRBDIBYCJRFO-UHFFFAOYSA-N 8-methoxy-9-propan-2-yloxy-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline Chemical compound C=12C=3C=C(OC(C)C)C(OC)=CC=3CCN2C=NC=1C1=CC=CS1 JJNRBDIBYCJRFO-UHFFFAOYSA-N 0.000 description 1
- VSFKQRIRUCOVHM-UHFFFAOYSA-N 8-methoxy-9-propan-2-yloxy-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline-3-carboxylic acid Chemical compound COc1cc2CCn3c(nc(-c4cccs4)c3-c2cc1OC(C)C)C(O)=O VSFKQRIRUCOVHM-UHFFFAOYSA-N 0.000 description 1
- CYPLSNDAKMAYAA-UHFFFAOYSA-N 8-methoxy-9-propan-2-yloxy-1-thiophen-2-ylimidazo[5,1-a]isoquinoline Chemical compound C=12C=3C=C(OC(C)C)C(OC)=CC=3C=CN2C=NC=1C1=CC=CS1 CYPLSNDAKMAYAA-UHFFFAOYSA-N 0.000 description 1
- YRABEXWQUTVOII-UHFFFAOYSA-N 8-methoxy-9-propan-2-yloxy-1-thiophen-2-ylimidazo[5,1-a]isoquinoline-3-carboxylic acid Chemical compound C(C)(C)OC1=C(C=C2C=CN3C(C2=C1)=C(N=C3C(=O)O)C=3SC=CC3)OC YRABEXWQUTVOII-UHFFFAOYSA-N 0.000 description 1
- OVGPRJDCUGAYPD-UHFFFAOYSA-N 8-methoxy-9-propan-2-yloxy-5,6-dihydroimidazo[5,1-a]isoquinoline Chemical compound C1CN2C=NC=C2C2=C1C=C(OC)C(OC(C)C)=C2 OVGPRJDCUGAYPD-UHFFFAOYSA-N 0.000 description 1
- TZRYCEYOSYKEQK-UHFFFAOYSA-N 9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinolin-8-ol Chemical compound N1=CN2CCC=3C=C(O)C(CC(C)C)=CC=3C2=C1C1=CC=CS1 TZRYCEYOSYKEQK-UHFFFAOYSA-N 0.000 description 1
- UYIJIGMOEYYHOY-UHFFFAOYSA-N 9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline Chemical compound C=12C3=CC(CC(C)C)=CC=C3CCN2C=NC=1C1=CC=CS1 UYIJIGMOEYYHOY-UHFFFAOYSA-N 0.000 description 1
- JEINOVBURHTCPL-UHFFFAOYSA-N 9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline-3-carboxylic acid Chemical compound C(C(C)C)C1=CC=C2CCN3C(C2=C1)=C(N=C3C(=O)O)C=3SC=CC3 JEINOVBURHTCPL-UHFFFAOYSA-N 0.000 description 1
- SZTUAXGNGCAGSZ-UHFFFAOYSA-N 9-bromo-1-tert-butyl-8-methoxy-5,6-dihydroimidazo[5,1-a]isoquinoline Chemical compound C1CN2C=NC(C(C)(C)C)=C2C2=C1C=C(OC)C(Br)=C2 SZTUAXGNGCAGSZ-UHFFFAOYSA-N 0.000 description 1
- QKOMVMIPTNSNOX-UHFFFAOYSA-N 9-bromo-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinolin-8-ol Chemical compound C=12C=3C=C(Br)C(O)=CC=3CCN2C=NC=1C1=CC=CS1 QKOMVMIPTNSNOX-UHFFFAOYSA-N 0.000 description 1
- YSGPKOCHPMMXBX-UHFFFAOYSA-N 9-bromo-8-ethoxy-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline Chemical compound C=12C=3C=C(Br)C(OCC)=CC=3CCN2C=NC=1C1=CC=CS1 YSGPKOCHPMMXBX-UHFFFAOYSA-N 0.000 description 1
- HFRZKCQFNPEZDL-UHFFFAOYSA-N 9-bromo-8-methoxy-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline Chemical compound C=12C=3C=C(Br)C(OC)=CC=3CCN2C=NC=1C1=CC=CS1 HFRZKCQFNPEZDL-UHFFFAOYSA-N 0.000 description 1
- MZMSJPAJRQLSBT-UHFFFAOYSA-N 9-ethenyl-8-methoxy-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinoline Chemical compound C=12C=3C=C(C=C)C(OC)=CC=3CCN2C=NC=1C1=CC=CS1 MZMSJPAJRQLSBT-UHFFFAOYSA-N 0.000 description 1
- 102000002260 Alkaline Phosphatase Human genes 0.000 description 1
- 108020004774 Alkaline Phosphatase Proteins 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- 241000271566 Aves Species 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 101001011741 Bos taurus Insulin Proteins 0.000 description 1
- BMJTUOSTBJJDDS-UHFFFAOYSA-N C1=CSC(=C1)C(C(=N)N)C(=O)O Chemical compound C1=CSC(=C1)C(C(=N)N)C(=O)O BMJTUOSTBJJDDS-UHFFFAOYSA-N 0.000 description 1
- JKEYBJLRWCDDKP-UHFFFAOYSA-N CC1=C2C3=CC=CC=C3CCN2C=N1 Chemical compound CC1=C2C3=CC=CC=C3CCN2C=N1 JKEYBJLRWCDDKP-UHFFFAOYSA-N 0.000 description 1
- IAXHVADDMMYQNH-UHFFFAOYSA-N CC1=CC(=C(C(=C1)F)OS(=O)(=O)C(F)(F)F)OC Chemical compound CC1=CC(=C(C(=C1)F)OS(=O)(=O)C(F)(F)F)OC IAXHVADDMMYQNH-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-NJFSPNSNSA-N Carbon-14 Chemical compound [14C] OKTJSMMVPCPJKN-NJFSPNSNSA-N 0.000 description 1
- 108091026890 Coding region Proteins 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- 241000699802 Cricetulus griseus Species 0.000 description 1
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-OUBTZVSYSA-N Deuterium Chemical compound [2H] YZCKVEUIGOORGS-OUBTZVSYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 102000003688 G-Protein-Coupled Receptors Human genes 0.000 description 1
- 108090000045 G-Protein-Coupled Receptors Proteins 0.000 description 1
- 102000001895 Gonadotropin Receptors Human genes 0.000 description 1
- 108010040490 Gonadotropin Receptors Proteins 0.000 description 1
- 239000000579 Gonadotropin-Releasing Hormone Substances 0.000 description 1
- 108010043121 Green Fluorescent Proteins Proteins 0.000 description 1
- 102000004144 Green Fluorescent Proteins Human genes 0.000 description 1
- 239000007821 HATU Substances 0.000 description 1
- 238000006842 Henry reaction Methods 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- ZGUNAGUHMKGQNY-ZETCQYMHSA-N L-alpha-phenylglycine zwitterion Chemical compound OC(=O)[C@@H](N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-ZETCQYMHSA-N 0.000 description 1
- FFEARJCKVFRZRR-BYPYZUCNSA-N L-methionine Chemical compound CSCC[C@H](N)C(O)=O FFEARJCKVFRZRR-BYPYZUCNSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229910010082 LiAlH Inorganic materials 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 208000007466 Male Infertility Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- XRTPAAOXGZILHW-UHFFFAOYSA-N N-[(6-methoxy-7-propan-2-yloxyisoquinolin-1-yl)-thiophen-2-ylmethylidene]hydroxylamine Chemical compound C=12C=C(OC(C)C)C(OC)=CC2=CC=NC=1C(=NO)C1=CC=CS1 XRTPAAOXGZILHW-UHFFFAOYSA-N 0.000 description 1
- JJMIDXJZILYYKO-UHFFFAOYSA-N N-tert-butyl-N-ethyldecan-1-amine Chemical compound CC(C)(N(CC)CCCCCCCCCC)C JJMIDXJZILYYKO-UHFFFAOYSA-N 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 101150003085 Pdcl gene Proteins 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 108010077895 Sarcosine Proteins 0.000 description 1
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 101000857870 Squalus acanthias Gonadoliberin Proteins 0.000 description 1
- 229920002472 Starch Chemical class 0.000 description 1
- 238000006619 Stille reaction Methods 0.000 description 1
- 238000007059 Strecker synthesis reaction Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 238000006069 Suzuki reaction reaction Methods 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- WOAORAPRPVIATR-UHFFFAOYSA-N [3-(trifluoromethyl)phenyl]boronic acid Chemical compound OB(O)C1=CC=CC(C(F)(F)F)=C1 WOAORAPRPVIATR-UHFFFAOYSA-N 0.000 description 1
- IRIGFUJFJPQYDH-UHFFFAOYSA-N [9-(2-methylpropyl)-1-thiophen-2-yl-5,6-dihydroimidazo[5,1-a]isoquinolin-8-yl] trifluoromethanesulfonate Chemical compound N1=CN2CCC=3C=C(OS(=O)(=O)C(F)(F)F)C(CC(C)C)=CC=3C2=C1C1=CC=CS1 IRIGFUJFJPQYDH-UHFFFAOYSA-N 0.000 description 1
- BWWJPRJTQKEZQL-UHFFFAOYSA-N [difluoromethyl(phenyl)phosphoryl]benzene Chemical compound C=1C=CC=CC=1P(=O)(C(F)F)C1=CC=CC=C1 BWWJPRJTQKEZQL-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000008043 acidic salts Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 150000001263 acyl chlorides Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 102000030621 adenylate cyclase Human genes 0.000 description 1
- 108060000200 adenylate cyclase Proteins 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000002862 amidating effect Effects 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 210000004198 anterior pituitary gland Anatomy 0.000 description 1
- 108010054176 apotransferrin Proteins 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 150000001502 aryl halides Chemical class 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 238000005815 base catalysis Methods 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000006664 bond formation reaction Methods 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- UWTDFICHZKXYAC-UHFFFAOYSA-N boron;oxolane Chemical compound [B].C1CCOC1 UWTDFICHZKXYAC-UHFFFAOYSA-N 0.000 description 1
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 1
- IXIBAKNTJSCKJM-BUBXBXGNSA-N bovine insulin Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H]1CSSC[C@H]2C(=O)N[C@@H](C)C(=O)N[C@@H](CO)C(=O)N[C@H](C(=O)N[C@H](C(N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=3C=CC(O)=CC=3)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC=3C=CC(O)=CC=3)C(=O)N[C@@H](CSSC[C@H](NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=3C=CC(O)=CC=3)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](C)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC=3NC=NC=3)NC(=O)[C@H](CO)NC(=O)CNC1=O)C(=O)NCC(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)NCC(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H]([C@@H](C)O)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(O)=O)C(=O)N[C@@H](CC(N)=O)C(O)=O)=O)CSSC[C@@H](C(N2)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](C(C)C)NC(=O)[C@@H](NC(=O)CN)[C@@H](C)CC)C(C)C)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(N)=O)NC(=O)[C@@H](NC(=O)[C@@H](N)CC=1C=CC=CC=1)C(C)C)C1=CN=CN1 IXIBAKNTJSCKJM-BUBXBXGNSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- KVNRLNFWIYMESJ-UHFFFAOYSA-N butyronitrile Chemical compound CCCC#N KVNRLNFWIYMESJ-UHFFFAOYSA-N 0.000 description 1
- 230000001593 cAMP accumulation Effects 0.000 description 1
- CREMABGTGYGIQB-UHFFFAOYSA-N carbon carbon Chemical compound C.C CREMABGTGYGIQB-UHFFFAOYSA-N 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 239000001913 cellulose Chemical class 0.000 description 1
- 229920002678 cellulose Chemical class 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 238000007265 chloromethylation reaction Methods 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000010549 co-Evaporation Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000009137 competitive binding Effects 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- NKNDPYCGAZPOFS-UHFFFAOYSA-M copper(i) bromide Chemical compound Br[Cu] NKNDPYCGAZPOFS-UHFFFAOYSA-M 0.000 description 1
- 238000006880 cross-coupling reaction Methods 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- 238000006352 cycloaddition reaction Methods 0.000 description 1
- 150000001925 cycloalkenes Chemical class 0.000 description 1
- 125000005112 cycloalkylalkoxy group Chemical group 0.000 description 1
- JFWMYCVMQSLLOO-UHFFFAOYSA-N cyclobutanecarbonyl chloride Chemical compound ClC(=O)C1CCC1 JFWMYCVMQSLLOO-UHFFFAOYSA-N 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 230000020335 dealkylation Effects 0.000 description 1
- 238000006900 dealkylation reaction Methods 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 229910052805 deuterium Inorganic materials 0.000 description 1
- SOCTUWSJJQCPFX-UHFFFAOYSA-N dichromate(2-) Chemical compound [O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O SOCTUWSJJQCPFX-UHFFFAOYSA-N 0.000 description 1
- LCSNDSFWVKMJCT-UHFFFAOYSA-N dicyclohexyl-(2-phenylphenyl)phosphane Chemical group C1CCCCC1P(C=1C(=CC=CC=1)C=1C=CC=CC=1)C1CCCCC1 LCSNDSFWVKMJCT-UHFFFAOYSA-N 0.000 description 1
- IRUNKQSGDBYUDC-UHFFFAOYSA-N diethoxymethyl acetate Chemical compound CCOC(OCC)OC(C)=O IRUNKQSGDBYUDC-UHFFFAOYSA-N 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 125000005675 difluoroethenyl group Chemical group [H]C(*)=C(F)F 0.000 description 1
- 238000005906 dihydroxylation reaction Methods 0.000 description 1
- 229910001873 dinitrogen Inorganic materials 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- CNXMDTWQWLGCPE-UHFFFAOYSA-N ditert-butyl-(2-phenylphenyl)phosphane Chemical group CC(C)(C)P(C(C)(C)C)C1=CC=CC=C1C1=CC=CC=C1 CNXMDTWQWLGCPE-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000012039 electrophile Substances 0.000 description 1
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- QBTBXIBGCYOSSE-UHFFFAOYSA-N ethyl 8-methoxy-1-thiophen-2-yl-9-(trifluoromethylsulfonyloxy)imidazo[5,1-a]isoquinoline-3-carboxylate Chemical compound C=12C3=CC(OS(=O)(=O)C(F)(F)F)=C(OC)C=C3C=CN2C(C(=O)OCC)=NC=1C1=CC=CS1 QBTBXIBGCYOSSE-UHFFFAOYSA-N 0.000 description 1
- IQXHVIBINSNOQM-UHFFFAOYSA-N ethyl 8-methoxy-9-propan-2-yloxy-1-thiophen-2-ylimidazo[5,1-a]isoquinoline-3-carboxylate Chemical compound C=12C3=CC(OC(C)C)=C(OC)C=C3C=CN2C(C(=O)OCC)=NC=1C1=CC=CS1 IQXHVIBINSNOQM-UHFFFAOYSA-N 0.000 description 1
- AAZHXAQSTOHEAC-UHFFFAOYSA-N ethyl 9-hydroxy-8-methoxy-1-thiophen-2-ylimidazo[5,1-a]isoquinoline-3-carboxylate Chemical compound C=12C3=CC(O)=C(OC)C=C3C=CN2C(C(=O)OCC)=NC=1C1=CC=CS1 AAZHXAQSTOHEAC-UHFFFAOYSA-N 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000006437 ethyl cyclopropyl group Chemical group 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 201000003585 eunuchism Diseases 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000007850 fluorescent dye Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 150000002333 glycines Chemical class 0.000 description 1
- 230000002710 gonadal effect Effects 0.000 description 1
- XLXSAKCOAKORKW-AQJXLSMYSA-N gonadorelin Chemical compound C([C@@H](C(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N1[C@@H](CCC1)C(=O)NCC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CC=1C2=CC=CC=C2NC=1)NC(=O)[C@H](CC=1N=CNC=1)NC(=O)[C@H]1NC(=O)CC1)C1=CC=C(O)C=C1 XLXSAKCOAKORKW-AQJXLSMYSA-N 0.000 description 1
- 229940035638 gonadotropin-releasing hormone Drugs 0.000 description 1
- 239000005090 green fluorescent protein Substances 0.000 description 1
- 159000000011 group IA salts Chemical class 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000005885 heterocycloalkylalkyl group Chemical group 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 239000003668 hormone analog Substances 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- ZAVXICQEZRMZHE-UHFFFAOYSA-N imidazo[5,1-a]isoquinoline Chemical class C1=CC=C2C3=CN=CN3C=CC2=C1 ZAVXICQEZRMZHE-UHFFFAOYSA-N 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 238000005462 in vivo assay Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 150000002527 isonitriles Chemical class 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- FEWQWMKPPJZYCQ-UHFFFAOYSA-N isoquinolin-1-ylmethanamine Chemical class C1=CC=C2C(CN)=NC=CC2=C1 FEWQWMKPPJZYCQ-UHFFFAOYSA-N 0.000 description 1
- 125000004551 isoquinolin-3-yl group Chemical group C1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 150000002537 isoquinolines Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 1
- 150000002641 lithium Chemical class 0.000 description 1
- ANYSGBYRTLOUPO-UHFFFAOYSA-N lithium tetramethylpiperidide Chemical compound [Li]N1C(C)(C)CCCC1(C)C ANYSGBYRTLOUPO-UHFFFAOYSA-N 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 238000004020 luminiscence type Methods 0.000 description 1
- CCERQOYLJJULMD-UHFFFAOYSA-M magnesium;carbanide;chloride Chemical compound [CH3-].[Mg+2].[Cl-] CCERQOYLJJULMD-UHFFFAOYSA-M 0.000 description 1
- 208000037106 male hypogonadism Diseases 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 210000004962 mammalian cell Anatomy 0.000 description 1
- 210000001161 mammalian embryo Anatomy 0.000 description 1
- 239000003550 marker Substances 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 230000035800 maturation Effects 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 102000006240 membrane receptors Human genes 0.000 description 1
- 108020004084 membrane receptors Proteins 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 1
- 229930182817 methionine Natural products 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000010369 molecular cloning Methods 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 229960005181 morphine Drugs 0.000 description 1
- 238000006452 multicomponent reaction Methods 0.000 description 1
- 230000035772 mutation Effects 0.000 description 1
- PBMIETCUUSQZCG-UHFFFAOYSA-N n'-cyclohexylmethanediimine Chemical compound N=C=NC1CCCCC1 PBMIETCUUSQZCG-UHFFFAOYSA-N 0.000 description 1
- NALMPLUMOWIVJC-UHFFFAOYSA-N n,n,4-trimethylbenzeneamine oxide Chemical compound CC1=CC=C([N+](C)(C)[O-])C=C1 NALMPLUMOWIVJC-UHFFFAOYSA-N 0.000 description 1
- OUQVKRKGTAUJQA-UHFFFAOYSA-N n-[(1-chloro-4-hydroxyisoquinolin-3-yl)carbonyl]glycine Chemical compound C1=CC=CC2=C(O)C(C(=O)NCC(=O)O)=NC(Cl)=C21 OUQVKRKGTAUJQA-UHFFFAOYSA-N 0.000 description 1
- VLGQNQFDMBFHKA-UHFFFAOYSA-N n-[2-(3-methoxy-4-propan-2-yloxyphenyl)ethyl]-2-thiophen-2-ylacetamide Chemical compound C1=C(OC(C)C)C(OC)=CC(CCNC(=O)CC=2SC=CC=2)=C1 VLGQNQFDMBFHKA-UHFFFAOYSA-N 0.000 description 1
- ZUDPFJIIAMREQV-UHFFFAOYSA-N n-[2-(4-bromo-3-methoxyphenyl)ethyl]formamide Chemical compound COC1=CC(CCNC=O)=CC=C1Br ZUDPFJIIAMREQV-UHFFFAOYSA-N 0.000 description 1
- KSYJNFVRTCFPLQ-UHFFFAOYSA-N n-[2-[3-fluoro-5-methoxy-4-(2-methylpropyl)phenyl]ethyl]formamide Chemical compound COC1=CC(CCNC=O)=CC(F)=C1CC(C)C KSYJNFVRTCFPLQ-UHFFFAOYSA-N 0.000 description 1
- LXAOSBZXWIUGGA-UHFFFAOYSA-N n-[2-[3-methoxy-4-(2-methylprop-1-enyl)phenyl]ethyl]formamide Chemical compound COC1=CC(CCNC=O)=CC=C1C=C(C)C LXAOSBZXWIUGGA-UHFFFAOYSA-N 0.000 description 1
- RPEXEGSZCCUGPP-UHFFFAOYSA-N n-[2-[3-methoxy-4-(2-methylpropyl)phenyl]ethyl]formamide Chemical compound COC1=CC(CCNC=O)=CC=C1CC(C)C RPEXEGSZCCUGPP-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- HPCUOTQJNQXHAG-UHFFFAOYSA-N n-methyl-n-(2-phenylethyl)aniline Chemical class C=1C=CC=CC=1N(C)CCC1=CC=CC=C1 HPCUOTQJNQXHAG-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000007922 nasal spray Substances 0.000 description 1
- 229940097496 nasal spray Drugs 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 238000010653 organometallic reaction Methods 0.000 description 1
- 229910000489 osmium tetroxide Inorganic materials 0.000 description 1
- 239000012285 osmium tetroxide Substances 0.000 description 1
- 210000002394 ovarian follicle Anatomy 0.000 description 1
- 230000027758 ovulation cycle Effects 0.000 description 1
- ADIMAYPTOBDMTL-UHFFFAOYSA-N oxazepam Chemical compound C12=CC(Cl)=CC=C2NC(=O)C(O)N=C1C1=CC=CC=C1 ADIMAYPTOBDMTL-UHFFFAOYSA-N 0.000 description 1
- 229960004535 oxazepam Drugs 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 229940056360 penicillin g Drugs 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 229940117803 phenethylamine Drugs 0.000 description 1
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- 150000007925 phenylethylamine derivatives Chemical class 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 230000001817 pituitary effect Effects 0.000 description 1
- 210000002826 placenta Anatomy 0.000 description 1
- 229920001184 polypeptide Polymers 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 230000035935 pregnancy Effects 0.000 description 1
- 102000004196 processed proteins & peptides Human genes 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- YLHJACXHRQQNQR-UHFFFAOYSA-N pyridine;2,4,6-tris(ethenyl)-1,3,5,2,4,6-trioxatriborinane Chemical compound C1=CC=NC=C1.C=CB1OB(C=C)OB(C=C)O1 YLHJACXHRQQNQR-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- DJXNJVFEFSWHLY-UHFFFAOYSA-M quinoline-3-carboxylate Chemical compound C1=CC=CC2=CC(C(=O)[O-])=CN=C21 DJXNJVFEFSWHLY-UHFFFAOYSA-M 0.000 description 1
- 230000002285 radioactive effect Effects 0.000 description 1
- 239000012048 reactive intermediate Substances 0.000 description 1
- 239000000018 receptor agonist Substances 0.000 description 1
- 229940044601 receptor agonist Drugs 0.000 description 1
- 239000012925 reference material Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000027272 reproductive process Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000004007 reversed phase HPLC Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 210000000717 sertoli cell Anatomy 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 239000011697 sodium iodate Substances 0.000 description 1
- 235000015281 sodium iodate Nutrition 0.000 description 1
- 229940032753 sodium iodate Drugs 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000008247 solid mixture Substances 0.000 description 1
- 239000007790 solid phase Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 230000021595 spermatogenesis Effects 0.000 description 1
- KXCAEQNNTZANTK-UHFFFAOYSA-N stannane Chemical compound [SnH4] KXCAEQNNTZANTK-UHFFFAOYSA-N 0.000 description 1
- 229910000080 stannane Inorganic materials 0.000 description 1
- 239000008107 starch Chemical class 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 230000010009 steroidogenesis Effects 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 229960005322 streptomycin Drugs 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 230000002381 testicular Effects 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000000147 tetrahydroquinolinyl group Chemical class N1(CCCC2=CC=CC=C12)* 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- HJZYBDPHAHGHAZ-UHFFFAOYSA-N thiadiazole-4-carboxylic acid Chemical compound OC(=O)C1=CSN=N1 HJZYBDPHAHGHAZ-UHFFFAOYSA-N 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 238000013518 transcription Methods 0.000 description 1
- 230000035897 transcription Effects 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 238000013519 translation Methods 0.000 description 1
- CPKHFNMJTBLKLK-UHFFFAOYSA-N tri(propan-2-yl)-sulfanylsilane Chemical compound CC(C)[Si](S)(C(C)C)C(C)C CPKHFNMJTBLKLK-UHFFFAOYSA-N 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- YOWGRWHKDCHINP-UHFFFAOYSA-N tributyl(1,3-oxazol-2-yl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C1=NC=CO1 YOWGRWHKDCHINP-UHFFFAOYSA-N 0.000 description 1
- MLQLAUOYIFRPAO-UHFFFAOYSA-N tributyl-(2-ethyltetrazol-5-yl)stannane Chemical compound CCCC[Sn](CCCC)(CCCC)C=1N=NN(CC)N=1 MLQLAUOYIFRPAO-UHFFFAOYSA-N 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- WRECIMRULFAWHA-UHFFFAOYSA-N trimethyl borate Chemical compound COB(OC)OC WRECIMRULFAWHA-UHFFFAOYSA-N 0.000 description 1
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Substances C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 1
- 210000005239 tubule Anatomy 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P15/00—Drugs for genital or sexual disorders; Contraceptives
- A61P15/08—Drugs for genital or sexual disorders; Contraceptives for gonadal disorders or for enhancing fertility, e.g. inducers of ovulation or of spermatogenesis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D519/00—Heterocyclic compounds containing more than one system of two or more relevant hetero rings condensed among themselves or condensed with a common carbocyclic ring system not provided for in groups C07D453/00 or C07D455/00
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Reproductive Health (AREA)
- General Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Endocrinology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Gynecology & Obstetrics (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pregnancy & Childbirth (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| EP09161274 | 2009-05-27 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| TW201107322A TW201107322A (en) | 2011-03-01 |
| TWI461426B true TWI461426B (zh) | 2014-11-21 |
Family
ID=42315817
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| TW099114528A TWI461426B (zh) | 2009-05-27 | 2010-05-06 | (二氫)咪唑並異〔5,1-a〕喹啉類 |
Country Status (8)
| Country | Link |
|---|---|
| EP (1) | EP2435433B1 (OSRAM) |
| JP (1) | JP5647675B2 (OSRAM) |
| CN (1) | CN102448961B (OSRAM) |
| AR (1) | AR076703A1 (OSRAM) |
| AU (1) | AU2010252007B2 (OSRAM) |
| CA (1) | CA2763118A1 (OSRAM) |
| TW (1) | TWI461426B (OSRAM) |
| WO (1) | WO2010136438A1 (OSRAM) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES2796774T3 (es) | 2011-07-01 | 2020-11-30 | Merck Patent Gmbh | Dihidropirazoles, composiciones farmacéuticas de los mismos y su uso para el tratamiento de trastornos de fertilidad |
| CA2834199C (en) | 2011-07-18 | 2020-01-07 | Merck Patent Gmbh | Benzamides as allosteric modulators of the fsh receptor |
| US9409897B2 (en) | 2012-01-10 | 2016-08-09 | Merck Patent Gmbh | Benzamide derivatives as modulators of the follicle stimulating hormone |
| CN104114544A (zh) | 2012-02-08 | 2014-10-22 | 默克专利有限公司 | 用作卵泡刺激素受体激动剂的氘化噻唑烷酮类似物 |
| EP3013823B1 (en) | 2013-06-24 | 2017-11-01 | Merck Patent GmbH | Imidazole compounds as modulators of fshr and uses thereof |
| SG11201509411VA (en) * | 2013-06-24 | 2015-12-30 | Merck Patent Gmbh | Pyrazole compounds as modulators of fshr and uses thereof |
| TWI720451B (zh) | 2014-02-13 | 2021-03-01 | 美商英塞特控股公司 | 作為lsd1抑制劑之環丙胺 |
| US9493442B2 (en) | 2014-02-13 | 2016-11-15 | Incyte Corporation | Cyclopropylamines as LSD1 inhibitors |
| KR102421235B1 (ko) | 2014-02-13 | 2022-07-15 | 인사이트 코포레이션 | Lsd1 저해제로서 사이클로프로필아민 |
| US9527835B2 (en) | 2014-02-13 | 2016-12-27 | Incyte Corporation | Cyclopropylamines as LSD1 inhibitors |
| WO2015196335A1 (en) | 2014-06-23 | 2015-12-30 | Tocopherx, Inc. | Pyrazole compounds as modulators of fshr and uses thereof |
| TW201613925A (en) | 2014-07-10 | 2016-04-16 | Incyte Corp | Imidazopyrazines as LSD1 inhibitors |
| WO2016007722A1 (en) | 2014-07-10 | 2016-01-14 | Incyte Corporation | Triazolopyridines and triazolopyrazines as lsd1 inhibitors |
| US9758523B2 (en) | 2014-07-10 | 2017-09-12 | Incyte Corporation | Triazolopyridines and triazolopyrazines as LSD1 inhibitors |
| TWI687419B (zh) | 2014-07-10 | 2020-03-11 | 美商英塞特公司 | 作為lsd1抑制劑之咪唑并吡啶及咪唑并吡嗪 |
| SG11201708047UA (en) | 2015-04-03 | 2017-10-30 | Incyte Corp | Heterocyclic compounds as lsd1 inhibitors |
| CN110402244B (zh) | 2015-08-12 | 2023-02-03 | 因赛特公司 | Lsd1抑制剂的盐 |
| SG10202010414QA (en) | 2016-04-22 | 2020-11-27 | Incyte Corp | Formulations of an lsd1 inhibitor |
| CN106866692A (zh) * | 2017-03-30 | 2017-06-20 | 毛阿龙 | 具有苯并1,4‑二氧杂环己二烯酮结构的fshr拮抗剂的制备方法 |
| WO2020047198A1 (en) | 2018-08-31 | 2020-03-05 | Incyte Corporation | Salts of an lsd1 inhibitor and processes for preparing the same |
| JP2025535050A (ja) * | 2022-10-05 | 2025-10-22 | ラディオネティクス オンコロジー,インク. | 卵胞刺激ホルモン受容体(fshr)を標的とした治療薬およびその使用 |
| TW202435866A (zh) | 2023-03-08 | 2024-09-16 | 荷蘭商菲林公司 | 小分子fsh受體調節劑 |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2000008015A2 (en) * | 1998-08-07 | 2000-02-17 | Applied Research Systems Ars Holding N.V. | Fsh mimetics for the treatment of infertility |
| WO2003004028A1 (en) * | 2001-07-02 | 2003-01-16 | Akzo Nobel N.V. | Tetrahydroquinoline derivatives |
| US20040259792A1 (en) * | 2003-04-01 | 2004-12-23 | Palmer Stephen S. | Inhibitors of phosphodiesterases in infertility |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RO66059A (ro) * | 1973-05-25 | 1981-05-30 | Gruppo Lepetit Spa,It | Procedeu de obtinere a unor derivati de triazolochinoline |
| PH15001A (en) * | 1977-07-25 | 1982-03-22 | Sandoz Ag | Prolactin secretion inhibitors |
| TW200510407A (en) * | 2003-06-30 | 2005-03-16 | Altana Pharma Ag | Novel pyrrolodihydroisoquinolines as PDE 10 inhibitors |
| TW200944523A (en) * | 2008-02-08 | 2009-11-01 | Organon Nv | (Dihydro)pyrrolo[2,1-a]isoquinolines |
-
2010
- 2010-05-06 TW TW099114528A patent/TWI461426B/zh not_active IP Right Cessation
- 2010-05-25 JP JP2012512338A patent/JP5647675B2/ja not_active Expired - Fee Related
- 2010-05-25 CN CN201080023361.8A patent/CN102448961B/zh not_active Expired - Fee Related
- 2010-05-25 AU AU2010252007A patent/AU2010252007B2/en not_active Ceased
- 2010-05-25 CA CA2763118A patent/CA2763118A1/en not_active Abandoned
- 2010-05-25 WO PCT/EP2010/057134 patent/WO2010136438A1/en not_active Ceased
- 2010-05-25 EP EP10723991.5A patent/EP2435433B1/en not_active Not-in-force
- 2010-05-26 AR ARP100101803A patent/AR076703A1/es unknown
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO2000008015A2 (en) * | 1998-08-07 | 2000-02-17 | Applied Research Systems Ars Holding N.V. | Fsh mimetics for the treatment of infertility |
| WO2003004028A1 (en) * | 2001-07-02 | 2003-01-16 | Akzo Nobel N.V. | Tetrahydroquinoline derivatives |
| US20040259792A1 (en) * | 2003-04-01 | 2004-12-23 | Palmer Stephen S. | Inhibitors of phosphodiesterases in infertility |
Also Published As
| Publication number | Publication date |
|---|---|
| WO2010136438A1 (en) | 2010-12-02 |
| EP2435433B1 (en) | 2013-08-28 |
| AR076703A1 (es) | 2011-06-29 |
| AU2010252007A1 (en) | 2011-12-22 |
| CA2763118A1 (en) | 2010-12-02 |
| TW201107322A (en) | 2011-03-01 |
| JP2012528105A (ja) | 2012-11-12 |
| AU2010252007B2 (en) | 2014-06-05 |
| CN102448961A (zh) | 2012-05-09 |
| CN102448961B (zh) | 2016-01-06 |
| EP2435433A1 (en) | 2012-04-04 |
| JP5647675B2 (ja) | 2015-01-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| TWI461426B (zh) | (二氫)咪唑並異〔5,1-a〕喹啉類 | |
| KR102384668B1 (ko) | Apj 효능제로서의 6-히드록시-5-(페닐/헤테로아릴술포닐)피리미딘-4(1h)-온 | |
| JP5620823B2 (ja) | (ジヒドロ)ピロロ[2,1−a]イソキノリン | |
| CN101490014A (zh) | 苯并咪唑和氮杂苯并咪唑的区域选择性钯催化合成 | |
| JP2013510168A (ja) | ヘキサヒドロインデノピリジン及びオクタヒドロベンゾキノリンのアリール−及びヘテロアリールカルボニル誘導体 | |
| TW201725203A (zh) | 作為apj受體促效劑之雜芳基羥基嘧啶酮 | |
| CN110072850A (zh) | 3-磺酰基-5-氨基吡啶-2,4-二醇apj激动剂 | |
| EP2079738A2 (en) | 7-azaindole derivatives as c-met kinase inhibitors | |
| JP2013541592A (ja) | ヘキサヒドロインデノピリジン及びオクタヒドロベンゾキノリンのアリール−及びヘテロアリールカルボニル誘導体 | |
| CN105189508B (zh) | 作为janus激酶抑制剂的环烷基腈吡唑并吡啶酮 | |
| KR20200083529A (ko) | 파르네소이드 x 수용체 조정제로서의 알켄 스피로시클릭 화합물 | |
| IL186831A (en) | History 4 - Phenyl - 5 - Oxo - 8,7,6,5,4,1 - Hexahydroquinoline as a drug for the treatment of infertility | |
| KR20090074179A (ko) | Ppar 조절제로서 유용한 1h인돌2카르복실산 유도체 | |
| US8431564B2 (en) | Ring-annulated dihydropyrrolo[2,1-α]isoquinolines | |
| CA2849111C (en) | Fsh receptor antagonists | |
| RU2530775C2 (ru) | ПРОИЗВОДНЫЕ 1Н-ПИРАЗОЛО[4,3-c]ИЗОХИНОЛИНОВ, СПОСОБ ИХ ПОЛУЧЕНИЯ И ПРИМЕНЕНИЕ В ТЕРАПИИ | |
| EP2459551B1 (en) | Dihydrobenzoindazoles | |
| US8071589B2 (en) | Dihydrobenzoindazoles | |
| US8071587B2 (en) | (Dihydro)imidazoiso[5,1-A]quinolines | |
| TW201116531A (en) | Ring-annulated dihydropyrrolo[2,1-a]isoquinolines | |
| TW200524902A (en) | 2-substituted benzimidazole piperidines analogs as selective melanin concentrating hormone receptor antagonists for the treatment of obesity and related disorders | |
| CN119176808B (zh) | 一种glp-1激动剂及其制备方法和应用 | |
| CN119176808A (zh) | 一种glp-1激动剂及其制备方法和应用 | |
| MXPA05006588A (es) | Compuestos de pirazol como derivados antagonistas del receptor de la integrina. | |
| HK1124044A (en) | 6-heteroarylpyridoindolone derivatives, their preparation and therapeutic use thereof |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | Annulment or lapse of patent due to non-payment of fees |