SU795485A3 - Способ получени триазолсодержа-щиХ эфиРОВ ТиОфОСфОРНыХ КиСлОТ - Google Patents
Способ получени триазолсодержа-щиХ эфиРОВ ТиОфОСфОРНыХ КиСлОТ Download PDFInfo
- Publication number
- SU795485A3 SU795485A3 SU772541750A SU2541750A SU795485A3 SU 795485 A3 SU795485 A3 SU 795485A3 SU 772541750 A SU772541750 A SU 772541750A SU 2541750 A SU2541750 A SU 2541750A SU 795485 A3 SU795485 A3 SU 795485A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- carbon atoms
- solution
- triazole
- triazol
- mol
- Prior art date
Links
- 150000003852 triazoles Chemical class 0.000 title description 14
- 238000000034 method Methods 0.000 title description 12
- 150000003580 thiophosphoric acid esters Chemical class 0.000 title description 4
- 125000000217 alkyl group Chemical group 0.000 abstract description 7
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 abstract description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract description 6
- 241000255925 Diptera Species 0.000 abstract description 5
- 229920002554 vinyl polymer Polymers 0.000 abstract description 5
- 241000238876 Acari Species 0.000 abstract description 4
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 abstract description 4
- 241000255777 Lepidoptera Species 0.000 abstract description 3
- 241000244206 Nematoda Species 0.000 abstract description 3
- 150000003014 phosphoric acid esters Chemical class 0.000 abstract description 3
- 241000254173 Coleoptera Species 0.000 abstract description 2
- 241000238814 Orthoptera Species 0.000 abstract description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 abstract description 2
- 125000004432 carbon atom Chemical group C* 0.000 abstract 7
- 101150009274 nhr-1 gene Proteins 0.000 abstract 2
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 abstract 1
- 206010061217 Infestation Diseases 0.000 abstract 1
- 229910019142 PO4 Inorganic materials 0.000 abstract 1
- 241000607479 Yersinia pestis Species 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- 125000000304 alkynyl group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 abstract 1
- YYJNOYZRYGDPNH-MFKUBSTISA-N fenpyroximate Chemical compound C=1C=C(C(=O)OC(C)(C)C)C=CC=1CO/N=C/C=1C(C)=NN(C)C=1OC1=CC=CC=C1 YYJNOYZRYGDPNH-MFKUBSTISA-N 0.000 abstract 1
- 125000001188 haloalkyl group Chemical group 0.000 abstract 1
- 239000000543 intermediate Substances 0.000 abstract 1
- 235000021317 phosphate Nutrition 0.000 abstract 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 abstract 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 abstract 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 30
- 239000000243 solution Substances 0.000 description 29
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 24
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- 239000000047 product Substances 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 22
- 239000000203 mixture Substances 0.000 description 15
- 239000002904 solvent Substances 0.000 description 14
- 238000002360 preparation method Methods 0.000 description 13
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- -1 polyhaloxy Polymers 0.000 description 12
- 230000004071 biological effect Effects 0.000 description 11
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 10
- 239000002689 soil Substances 0.000 description 10
- 229960000583 acetic acid Drugs 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 9
- 239000006185 dispersion Substances 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 7
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 7
- 229910052794 bromium Inorganic materials 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 241000196324 Embryophyta Species 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000012044 organic layer Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- MDTUWBLTRPRXBX-UHFFFAOYSA-N 1,2,4-triazol-3-one Chemical class O=C1N=CN=N1 MDTUWBLTRPRXBX-UHFFFAOYSA-N 0.000 description 4
- 241001124076 Aphididae Species 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000003480 eluent Substances 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 238000007363 ring formation reaction Methods 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- LAJLZSPXJPKRML-UHFFFAOYSA-N 5-acetyl-2-phenyl-1h-1,2,4-triazol-3-one Chemical compound N1C(C(=O)C)=NC(=O)N1C1=CC=CC=C1 LAJLZSPXJPKRML-UHFFFAOYSA-N 0.000 description 3
- 241000238631 Hexapoda Species 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 229940044631 ferric chloride hexahydrate Drugs 0.000 description 3
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 230000000749 insecticidal effect Effects 0.000 description 3
- NQXWGWZJXJUMQB-UHFFFAOYSA-K iron trichloride hexahydrate Chemical compound O.O.O.O.O.O.[Cl-].Cl[Fe+]Cl NQXWGWZJXJUMQB-UHFFFAOYSA-K 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 230000001069 nematicidal effect Effects 0.000 description 3
- 150000007659 semicarbazones Chemical class 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- FFSJPOPLSWBGQY-UHFFFAOYSA-N triazol-4-one Chemical group O=C1C=NN=N1 FFSJPOPLSWBGQY-UHFFFAOYSA-N 0.000 description 3
- DOORGKNGFZOACY-UHFFFAOYSA-N 1-amino-1-methylurea Chemical compound CN(N)C(N)=O DOORGKNGFZOACY-UHFFFAOYSA-N 0.000 description 2
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical compound N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 description 2
- DLHGUSPWVYHOPK-UHFFFAOYSA-N 5-(2-chlorocyclohexen-1-yl)-2-methyl-1h-1,2,4-triazol-3-one Chemical compound O=C1N(C)NC(C=2CCCCC=2Cl)=N1 DLHGUSPWVYHOPK-UHFFFAOYSA-N 0.000 description 2
- LRGRRXLFTKMPFS-UHFFFAOYSA-N 5-ethenyl-2-phenyl-1h-1,2,4-triazol-3-one Chemical compound N1C(C=C)=NC(=O)N1C1=CC=CC=C1 LRGRRXLFTKMPFS-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- ZBXUKDPWPXFKMQ-UHFFFAOYSA-N CCC1=NC(=O)N=N1 Chemical compound CCC1=NC(=O)N=N1 ZBXUKDPWPXFKMQ-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 2
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 240000003768 Solanum lycopersicum Species 0.000 description 2
- 230000000895 acaricidal effect Effects 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 235000013601 eggs Nutrition 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 229940032296 ferric chloride Drugs 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- 235000021374 legumes Nutrition 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000012047 saturated solution Substances 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- LZTSCEYDCZBRCJ-UHFFFAOYSA-N 1,2-dihydro-1,2,4-triazol-3-one Chemical class OC=1N=CNN=1 LZTSCEYDCZBRCJ-UHFFFAOYSA-N 0.000 description 1
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 description 1
- YTQQIHUQLOZOJI-UHFFFAOYSA-N 2,3-dihydro-1,2-thiazole Chemical compound C1NSC=C1 YTQQIHUQLOZOJI-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- SSORSZACHCNXSJ-UHFFFAOYSA-N 2-[2-(3,4-dichlorophenyl)-3-[2-(2-hydroxypropylamino)pyrimidin-4-yl]imidazol-4-yl]acetonitrile Chemical compound ClC=1C=C(C=CC=1Cl)C=1N(C(=CN=1)CC#N)C1=NC(=NC=C1)NCC(C)O SSORSZACHCNXSJ-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- ZWQUGNYOWIGFKS-UHFFFAOYSA-N 5-benzoyl-2-phenyl-1h-1,2,4-triazol-3-one Chemical compound C=1C=CC=CC=1C(=O)C(N1)=NC(=O)N1C1=CC=CC=C1 ZWQUGNYOWIGFKS-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 241000238659 Blatta Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XRHGWAGWAHHFLF-UHFFFAOYSA-N Isazofos Chemical compound CCOP(=S)(OCC)OC=1N=C(Cl)N(C(C)C)N=1 XRHGWAGWAHHFLF-UHFFFAOYSA-N 0.000 description 1
- 241000721715 Macrosiphum Species 0.000 description 1
- 241001143352 Meloidogyne Species 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- 101150003085 Pdcl gene Proteins 0.000 description 1
- 244000088415 Raphanus sativus Species 0.000 description 1
- 235000006140 Raphanus sativus var sativus Nutrition 0.000 description 1
- 241000256248 Spodoptera Species 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- RYYWUUFWQRZTIU-UHFFFAOYSA-N Thiophosphoric acid Chemical compound OP(O)(S)=O RYYWUUFWQRZTIU-UHFFFAOYSA-N 0.000 description 1
- ODUIXUGXPFKQLG-QWRGUYRKSA-N [2-(4-chloro-2-fluoroanilino)-5-methyl-1,3-thiazol-4-yl]-[(2s,3s)-2,3-dimethylpiperidin-1-yl]methanone Chemical compound C[C@H]1[C@@H](C)CCCN1C(=O)C1=C(C)SC(NC=2C(=CC(Cl)=CC=2)F)=N1 ODUIXUGXPFKQLG-QWRGUYRKSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- KMJJJTCKNZYTEY-UHFFFAOYSA-N chloro-diethoxy-sulfanylidene-$l^{5}-phosphane Chemical compound CCOP(Cl)(=S)OCC KMJJJTCKNZYTEY-UHFFFAOYSA-N 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002903 organophosphorus compounds Chemical class 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000007979 thiazole derivatives Chemical class 0.000 description 1
- 150000003557 thiazoles Chemical class 0.000 description 1
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 1
- RYYWUUFWQRZTIU-UHFFFAOYSA-K thiophosphate Chemical compound [O-]P([O-])([O-])=S RYYWUUFWQRZTIU-UHFFFAOYSA-K 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
- C07D249/10—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D249/12—Oxygen or sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT29420/76A IT1068010B (it) | 1976-11-17 | 1976-11-17 | Nuovi esteri fosforici derivati dall' 1-2-4 triazolo ad azione insetticida,nematocida e acaricida e loro preparazione |
| IT2085577A IT1113760B (it) | 1977-03-03 | 1977-03-03 | Nuovi esteri fosforici derivati dall'1, 2, 4-triazolo ad azione insetticida,nematocida e acaricida,e loro preparazione |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU795485A3 true SU795485A3 (ru) | 1981-01-07 |
Family
ID=26327687
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU772541750A SU795485A3 (ru) | 1976-11-17 | 1977-11-16 | Способ получени триазолсодержа-щиХ эфиРОВ ТиОфОСфОРНыХ КиСлОТ |
Country Status (25)
| Country | Link |
|---|---|
| US (2) | US4220789A (enExample) |
| JP (1) | JPS5363380A (enExample) |
| AR (1) | AR224612A1 (enExample) |
| AU (1) | AU516865B2 (enExample) |
| BR (1) | BR7707633A (enExample) |
| CA (1) | CA1095058A (enExample) |
| CH (1) | CH640541A5 (enExample) |
| DD (2) | DD132664A5 (enExample) |
| DE (1) | DE2750813A1 (enExample) |
| DK (1) | DK501077A (enExample) |
| EG (1) | EG12811A (enExample) |
| ES (1) | ES464206A1 (enExample) |
| FR (2) | FR2379543A1 (enExample) |
| GB (1) | GB1576964A (enExample) |
| GR (1) | GR71997B (enExample) |
| IL (1) | IL53390A (enExample) |
| IN (1) | IN148991B (enExample) |
| KE (1) | KE3138A (enExample) |
| LU (1) | LU78528A1 (enExample) |
| NL (1) | NL7712430A (enExample) |
| NO (1) | NO773853L (enExample) |
| OA (1) | OA05803A (enExample) |
| PT (1) | PT67279B (enExample) |
| RO (1) | RO75961A (enExample) |
| SU (1) | SU795485A3 (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DK501077A (da) * | 1976-11-17 | 1978-05-18 | Montedison Spa | Nye phosphorsyreestere afledt af 1,2,4-triazol med insekticid nematodicid og acaricid virkning og fremgangsmaade til fremstilling deraf |
| DE3931303A1 (de) * | 1989-09-20 | 1991-03-28 | Desowag Materialschutz Gmbh | Verfahren zum vorbeugenden materialschutz gegenueber staendig und/oder temporaer im boden lebenden schaedlingen, insbesondere termiten |
| JPH06279421A (ja) * | 1993-03-24 | 1994-10-04 | Nippon Paint Co Ltd | 新規なトリアゾール化合物、その中間体およびその合成法 |
| US5728834A (en) * | 1996-11-14 | 1998-03-17 | Wyckoff Chemical Company, Inc. | Process for preparation of 4-aryl-1,2,4-triazol-3-ones |
| DE19823131A1 (de) * | 1998-05-23 | 1999-11-25 | Bayer Ag | Sulfonylamino(thio)carbonyltriazolin(thi)one mit Alkenyl-Substituenten |
| US6492527B1 (en) | 1999-10-13 | 2002-12-10 | Fmc Corporation | Process to prepare aryltriazolinones and novel intermediates thereto |
| US7476743B2 (en) * | 2002-10-11 | 2009-01-13 | Cytokinetics, Inc. | Compounds, compositions, and methods |
| CN101643451B (zh) * | 2008-08-07 | 2013-03-06 | 浙江海正药业股份有限公司 | 过氧化物酶增殖物激活受体亚型δ类激动剂化合物及其制备方法 |
| JP2012508181A (ja) * | 2008-11-06 | 2012-04-05 | シェーリング コーポレイション | γ−セクレターゼ調節剤 |
| CN106543139B (zh) * | 2015-09-17 | 2020-03-17 | 沈阳中化农药化工研发有限公司 | 一种三唑酮类化合物及其用途 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE805763C (de) * | 1949-02-10 | 1951-05-28 | Dr Heinz Gehlen | Verfahren zur Darstellung von am C-Atom substituierten 1,2,4-Triazolonen-(3) |
| NL86689C (enExample) * | 1951-04-20 | 1900-01-01 | ||
| DE1235930B (de) * | 1963-10-15 | 1967-03-09 | Acraf | Verfahren zur Herstellung von als Heilmittel geeignetem 1-Phenyl-3-butyl-4-methyl-triazolon-(5) |
| CH523017A (de) * | 1969-11-21 | 1972-05-31 | Agripat Sa | Schädlingsbekämpfungsmittel |
| DE2150169A1 (de) * | 1970-10-22 | 1972-04-27 | Agripat Sa | Neue Ester |
| BE792452A (fr) * | 1971-12-10 | 1973-06-08 | Ciba Geigy | Esters triazolyliques d'acides du phosphore et produits pesticides qui en renferment |
| BE792450A (fr) * | 1971-12-10 | 1973-06-08 | Ciba Geigy | Composes organophosphores et produits pesticides qui en contiennent |
| IT998314B (it) | 1973-08-02 | 1976-01-20 | Montedison Spa | Alfa alchil mercapto alfa sostitui te formilidene fenil idrazine attive per via interna contro le malattie fungine delle piante |
| DK501077A (da) * | 1976-11-17 | 1978-05-18 | Montedison Spa | Nye phosphorsyreestere afledt af 1,2,4-triazol med insekticid nematodicid og acaricid virkning og fremgangsmaade til fremstilling deraf |
-
1977
- 1977-11-11 DK DK501077A patent/DK501077A/da unknown
- 1977-11-11 NL NL7712430A patent/NL7712430A/xx not_active Application Discontinuation
- 1977-11-11 NO NO773853A patent/NO773853L/no unknown
- 1977-11-14 EG EG638/77A patent/EG12811A/xx active
- 1977-11-14 US US05/851,202 patent/US4220789A/en not_active Expired - Lifetime
- 1977-11-14 DE DE19772750813 patent/DE2750813A1/de not_active Ceased
- 1977-11-14 AR AR269963A patent/AR224612A1/es active
- 1977-11-14 RO RO7792111A patent/RO75961A/ro unknown
- 1977-11-14 GR GR54788A patent/GR71997B/el unknown
- 1977-11-15 AU AU30664/77A patent/AU516865B2/en not_active Expired
- 1977-11-15 DD DD7700202092A patent/DD132664A5/xx unknown
- 1977-11-15 DD DD77204435A patent/DD135030A5/xx unknown
- 1977-11-15 IL IL53390A patent/IL53390A/xx unknown
- 1977-11-15 PT PT67279A patent/PT67279B/pt unknown
- 1977-11-16 SU SU772541750A patent/SU795485A3/ru active
- 1977-11-16 JP JP13677977A patent/JPS5363380A/ja active Granted
- 1977-11-16 CA CA291,003A patent/CA1095058A/en not_active Expired
- 1977-11-16 FR FR7734447A patent/FR2379543A1/fr active Granted
- 1977-11-16 ES ES464206A patent/ES464206A1/es not_active Expired
- 1977-11-16 LU LU78528A patent/LU78528A1/xx unknown
- 1977-11-16 BR BR7707633A patent/BR7707633A/pt unknown
- 1977-11-17 CH CH1408677A patent/CH640541A5/de not_active IP Right Cessation
- 1977-11-17 GB GB47948/77A patent/GB1576964A/en not_active Expired
- 1977-11-17 OA OA56317A patent/OA05803A/xx unknown
-
1978
- 1978-04-14 FR FR7811029A patent/FR2379527A1/fr active Granted
-
1979
- 1979-01-03 IN IN07/CAL/79A patent/IN148991B/en unknown
-
1980
- 1980-01-29 US US06/116,547 patent/US4400517A/en not_active Expired - Lifetime
-
1981
- 1981-06-29 KE KE3138A patent/KE3138A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IL53390A0 (en) | 1978-01-31 |
| AU516865B2 (en) | 1981-06-25 |
| DK501077A (da) | 1978-05-18 |
| DE2750813A1 (de) | 1978-05-18 |
| US4400517A (en) | 1983-08-23 |
| DD135030A5 (de) | 1979-04-11 |
| JPH0134996B2 (enExample) | 1989-07-21 |
| RO75961A (ro) | 1981-03-30 |
| GB1576964A (en) | 1980-10-15 |
| FR2379543B1 (enExample) | 1982-03-05 |
| AU3066477A (en) | 1979-05-24 |
| BR7707633A (pt) | 1978-06-13 |
| IN148991B (enExample) | 1981-08-08 |
| OA05803A (fr) | 1981-05-31 |
| DD132664A5 (de) | 1978-10-18 |
| PT67279B (en) | 1979-04-19 |
| NO773853L (no) | 1978-05-19 |
| FR2379543A1 (fr) | 1978-09-01 |
| JPS5363380A (en) | 1978-06-06 |
| ES464206A1 (es) | 1978-07-16 |
| GR71997B (enExample) | 1983-08-26 |
| AR224612A1 (es) | 1981-12-30 |
| IL53390A (en) | 1982-03-31 |
| PT67279A (en) | 1977-12-01 |
| US4220789A (en) | 1980-09-02 |
| KE3138A (en) | 1981-07-24 |
| EG12811A (en) | 1979-12-31 |
| FR2379527B1 (enExample) | 1982-07-30 |
| LU78528A1 (enExample) | 1978-07-14 |
| NL7712430A (nl) | 1978-05-19 |
| FR2379527A1 (fr) | 1978-09-01 |
| CH640541A5 (de) | 1984-01-13 |
| CA1095058A (en) | 1981-02-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2037488C1 (ru) | Производные 3-циано-5-алкокси-1-арилпиразолов и композиция на их основе | |
| US4012506A (en) | Pyrimidyl thio- and dithio-phosphoric acid esters | |
| SU795485A3 (ru) | Способ получени триазолсодержа-щиХ эфиРОВ ТиОфОСфОРНыХ КиСлОТ | |
| CA1177081A (en) | Pyrazol-4-yl phosphates | |
| US3948935A (en) | Pyrazoline derivatives | |
| US4256902A (en) | Process for the preparation of 3-chloro-5-hydroxypyrazoles | |
| US4209512A (en) | Mono- and di-thiophosphate esters containing an isoxazolinone ring and compositions and methods containing the same | |
| US5134133A (en) | Oxime phosphate pesticidal compounds, compositions and methods | |
| US4560682A (en) | Organophosphoric acid esters of benzofuranols and pesticidal compositions thereof | |
| US3847936A (en) | O,o-dialkyl-o-(1,2-diazolidin-ones-5-yl-3)-thionophosphates | |
| US4013793A (en) | Combating pests with o-ethyl-s-propyl-thionothiol or dithiophosphoric acid phenyl or naphthyl esters | |
| CA1225650A (en) | Insecticidal carbamates | |
| CA1106387A (en) | 1,2,4-triazole intermediate derivatives | |
| AU622653B2 (en) | 1-dimethylcarbamoyl-3-substituted-5-substituted-1h-1,2,4- triazoles | |
| US4015974A (en) | Amido phosphorothiolates | |
| KR800001183B1 (ko) | 1,2,4-트리아졸 인산에스테르의 제조법 | |
| SU847895A3 (ru) | Инсектоакарицидное средство | |
| US4499098A (en) | Insecticidal N-carbamoyl-oxadiazolidin-5-ones and thiones | |
| US3824268A (en) | Perhalocoumalin derivatives | |
| IL41505A (en) | Thiazolymethylthio(or dithio)phosphoric and thio-(or dithio)phosphonic acid esters as insecticidal compounds of low mammalian toxicity | |
| US3242191A (en) | Thiol_ or thionothiolphosphoric (-phosphonic, -phosphinic) acid esters of chloromethoxy benzotriazole compounds | |
| US3401220A (en) | Methods of killing pests selected from the group consisting of mites and insects with phosphonothioates | |
| KR860000853B1 (ko) | 피라졸계 인산에스테르류의 제조법 | |
| US4533658A (en) | Insecticidal 3-alkyl-5-(alkoxy- or alkylthio-phosphynyl or phosphinothioyl-thiomethyl)-1,2,4-oxadiazoles | |
| US3755591A (en) | Biocidal methods employing perhalocoumalin derivatives |