SU791230A3 - Способ получени бетаина пиридилалкилсульфоновой кислоты - Google Patents
Способ получени бетаина пиридилалкилсульфоновой кислоты Download PDFInfo
- Publication number
- SU791230A3 SU791230A3 SU772458751A SU2458751A SU791230A3 SU 791230 A3 SU791230 A3 SU 791230A3 SU 772458751 A SU772458751 A SU 772458751A SU 2458751 A SU2458751 A SU 2458751A SU 791230 A3 SU791230 A3 SU 791230A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- sodium
- acid
- pyridyl
- betaine
- sulfonate
- Prior art date
Links
- 239000002253 acid Substances 0.000 title claims abstract description 10
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 title claims description 53
- 238000000034 method Methods 0.000 title claims description 9
- -1 alkali metal salt Chemical class 0.000 claims abstract description 11
- 125000004076 pyridyl group Chemical group 0.000 claims abstract description 9
- 125000001424 substituent group Chemical group 0.000 claims abstract description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 5
- 239000003795 chemical substances by application Substances 0.000 claims abstract description 3
- 229960003237 betaine Drugs 0.000 claims description 26
- 159000000000 sodium salts Chemical class 0.000 claims description 9
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 7
- 229910052708 sodium Inorganic materials 0.000 claims description 7
- 239000011734 sodium Substances 0.000 claims description 7
- LFYCNCNFPPSEHG-UHFFFAOYSA-N 1-pyridin-2-ylethanesulfonic acid Chemical compound OS(=O)(=O)C(C)C1=CC=CC=N1 LFYCNCNFPPSEHG-UHFFFAOYSA-N 0.000 claims description 5
- RNASMWVEQFLFSS-UHFFFAOYSA-N 1-pyridin-4-ylethanesulfonic acid Chemical compound OS(=O)(=O)C(C)C1=CC=NC=C1 RNASMWVEQFLFSS-UHFFFAOYSA-N 0.000 claims description 5
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- FSSPGSAQUIYDCN-UHFFFAOYSA-N 1,3-Propane sultone Chemical compound O=S1(=O)CCCO1 FSSPGSAQUIYDCN-UHFFFAOYSA-N 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 claims description 3
- 229940073608 benzyl chloride Drugs 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 125000006277 halobenzyl group Chemical group 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Chemical group 0.000 claims description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 125000006177 alkyl benzyl group Chemical group 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- LSPPRHYSWKZGRZ-UHFFFAOYSA-M sodium;3-hydroxybutane-1-sulfonate Chemical compound [Na+].CC(O)CCS([O-])(=O)=O LSPPRHYSWKZGRZ-UHFFFAOYSA-M 0.000 claims description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims description 2
- AKLOQBSHNNYBRY-UHFFFAOYSA-M sodium;2-hydroxybutane-1-sulfonate Chemical compound [Na+].CCC(O)CS([O-])(=O)=O AKLOQBSHNNYBRY-UHFFFAOYSA-M 0.000 claims 2
- UNXCZDNUXJJWHY-UHFFFAOYSA-M sodium;2-hydroxypropane-1-sulfonate Chemical compound [Na+].CC(O)CS([O-])(=O)=O UNXCZDNUXJJWHY-UHFFFAOYSA-M 0.000 claims 2
- MMXFDHQXPRMLDC-UHFFFAOYSA-N CC(CC[Na])O Chemical compound CC(CC[Na])O MMXFDHQXPRMLDC-UHFFFAOYSA-N 0.000 claims 1
- 150000001350 alkyl halides Chemical class 0.000 claims 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 abstract description 7
- 238000009713 electroplating Methods 0.000 abstract description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 abstract 6
- 229910052759 nickel Inorganic materials 0.000 abstract 3
- 239000000654 additive Substances 0.000 abstract 2
- 230000000996 additive effect Effects 0.000 abstract 1
- 239000011248 coating agent Substances 0.000 abstract 1
- 238000000576 coating method Methods 0.000 abstract 1
- 229910052757 nitrogen Inorganic materials 0.000 abstract 1
- 125000004433 nitrogen atom Chemical group N* 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 238000000354 decomposition reaction Methods 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 239000011780 sodium chloride Substances 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 4
- 239000003153 chemical reaction reagent Substances 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 229940098779 methanesulfonic acid Drugs 0.000 description 4
- AFVFQIVMOAPDHO-UHFFFAOYSA-N methanesulfonic acid Substances CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 4
- 239000013078 crystal Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- VQRBXYBBGHOGFT-UHFFFAOYSA-N 1-(chloromethyl)-2-methylbenzene Chemical compound CC1=CC=CC=C1CCl VQRBXYBBGHOGFT-UHFFFAOYSA-N 0.000 description 2
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 125000006179 2-methyl benzyl group Chemical group [H]C1=C([H])C(=C(C([H])=C1[H])C([H])([H])*)C([H])([H])[H] 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- QKHOXQJNDCOOCU-UHFFFAOYSA-M [Na+].N1=C(C=CC=C1)C(C)S(=O)(=O)[O-] Chemical compound [Na+].N1=C(C=CC=C1)C(C)S(=O)(=O)[O-] QKHOXQJNDCOOCU-UHFFFAOYSA-M 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- NVLHGZIXTRYOKT-UHFFFAOYSA-N 1-chloro-2,3-dimethylbenzene Chemical group CC1=CC=CC(Cl)=C1C NVLHGZIXTRYOKT-UHFFFAOYSA-N 0.000 description 1
- BPSNETAIJADFTO-UHFFFAOYSA-N 2-pyridinylacetic acid Chemical compound OC(=O)CC1=CC=CC=N1 BPSNETAIJADFTO-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- GFJMOZYIDADKLJ-UHFFFAOYSA-N 5-bromo-2-chloro-3-methoxypyridine Chemical compound COC1=CC(Br)=CN=C1Cl GFJMOZYIDADKLJ-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 229940106681 chloroacetic acid Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- MHYFEEDKONKGEB-UHFFFAOYSA-N oxathiane 2,2-dioxide Chemical compound O=S1(=O)CCCCO1 MHYFEEDKONKGEB-UHFFFAOYSA-N 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- KCXFHTAICRTXLI-UHFFFAOYSA-N propane-1-sulfonic acid Chemical compound CCCS(O)(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-N 0.000 description 1
- ZNCXUFVDFVBRDO-UHFFFAOYSA-N pyridine;sulfuric acid Chemical compound [H+].[O-]S([O-])(=O)=O.C1=CC=[NH+]C=C1 ZNCXUFVDFVBRDO-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000011265 semifinished product Substances 0.000 description 1
- TZLNJNUWVOGZJU-UHFFFAOYSA-M sodium;3-chloro-2-hydroxypropane-1-sulfonate Chemical compound [Na+].ClCC(O)CS([O-])(=O)=O TZLNJNUWVOGZJU-UHFFFAOYSA-M 0.000 description 1
- VZPUIKDUJMGHMI-UHFFFAOYSA-M sodium;pyridin-2-ylmethanesulfonate Chemical compound [Na+].[O-]S(=O)(=O)CC1=CC=CC=N1 VZPUIKDUJMGHMI-UHFFFAOYSA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/32—Sulfur atoms
- C07D213/34—Sulfur atoms to which a second hetero atom is attached
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25D—PROCESSES FOR THE ELECTROLYTIC OR ELECTROPHORETIC PRODUCTION OF COATINGS; ELECTROFORMING; APPARATUS THEREFOR
- C25D3/00—Electroplating: Baths therefor
- C25D3/02—Electroplating: Baths therefor from solutions
- C25D3/12—Electroplating: Baths therefor from solutions of nickel or cobalt
- C25D3/14—Electroplating: Baths therefor from solutions of nickel or cobalt from baths containing acetylenic or heterocyclic compounds
- C25D3/18—Heterocyclic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Electrochemistry (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Pyridine Compounds (AREA)
- Electroplating And Plating Baths Therefor (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US66652576A | 1976-03-12 | 1976-03-12 | |
| US05/763,452 US4067785A (en) | 1976-03-12 | 1977-01-27 | Electroplating additives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU791230A3 true SU791230A3 (ru) | 1980-12-23 |
Family
ID=27099476
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU772458751A SU791230A3 (ru) | 1976-03-12 | 1977-03-11 | Способ получени бетаина пиридилалкилсульфоновой кислоты |
Country Status (12)
| Country | Link |
|---|---|
| JP (1) | JPS52116475A (OSRAM) |
| AT (1) | AT361266B (OSRAM) |
| BR (1) | BR7701506A (OSRAM) |
| CA (1) | CA1072098A (OSRAM) |
| CH (1) | CH630355A5 (OSRAM) |
| DE (1) | DE2710721A1 (OSRAM) |
| ES (1) | ES456723A1 (OSRAM) |
| FR (1) | FR2343729A1 (OSRAM) |
| GB (1) | GB1578168A (OSRAM) |
| IT (1) | IT1083723B (OSRAM) |
| NL (1) | NL7702673A (OSRAM) |
| SU (1) | SU791230A3 (OSRAM) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2242200B (en) * | 1990-02-20 | 1993-11-17 | Omi International | Plating compositions and processes |
| IT1275486B (it) * | 1995-07-06 | 1997-08-07 | Giuseppe Faranda | Sistema di sintesi per l'ottenimento di piridin propil sulfo betaina, senza rischi per l'uomo e per l'ambiente |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2839456A (en) * | 1956-11-16 | 1958-06-17 | Hanson Van Winkle Munning Co | Electroplating |
| US3444056A (en) * | 1966-06-24 | 1969-05-13 | Cilag Chemie | Nickel electroplating electrolyte |
| DE1621157A1 (de) * | 1967-08-16 | 1971-05-19 | Riedel & Co | Saures galvanisches Nickelbad |
| US3821095A (en) * | 1972-09-26 | 1974-06-28 | M & T Chemicals Inc | Zinc electroplating process and electrolyte therefor |
| US3862019A (en) * | 1974-04-26 | 1975-01-21 | R O Hull & Company Inc | Composition of electroplating bath for the electrodeposition of bright nickel |
-
1977
- 1977-03-04 GB GB931877A patent/GB1578168A/en not_active Expired
- 1977-03-10 JP JP2554577A patent/JPS52116475A/ja active Pending
- 1977-03-10 ES ES456723A patent/ES456723A1/es not_active Expired
- 1977-03-10 IT IT4841677A patent/IT1083723B/it active
- 1977-03-11 CA CA273,773A patent/CA1072098A/en not_active Expired
- 1977-03-11 SU SU772458751A patent/SU791230A3/ru active
- 1977-03-11 BR BR7701506A patent/BR7701506A/pt unknown
- 1977-03-11 FR FR7707349A patent/FR2343729A1/fr active Granted
- 1977-03-11 DE DE19772710721 patent/DE2710721A1/de not_active Withdrawn
- 1977-03-11 NL NL7702673A patent/NL7702673A/xx not_active Application Discontinuation
- 1977-03-11 CH CH310777A patent/CH630355A5/de not_active IP Right Cessation
- 1977-03-11 AT AT166477A patent/AT361266B/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE2710721A1 (de) | 1977-09-15 |
| CA1072098A (en) | 1980-02-19 |
| CH630355A5 (en) | 1982-06-15 |
| NL7702673A (nl) | 1977-09-14 |
| IT1083723B (it) | 1985-05-25 |
| FR2343729A1 (fr) | 1977-10-07 |
| ES456723A1 (es) | 1978-12-16 |
| ATA166477A (de) | 1980-07-15 |
| FR2343729B1 (OSRAM) | 1982-07-02 |
| GB1578168A (en) | 1980-11-05 |
| JPS52116475A (en) | 1977-09-29 |
| AT361266B (de) | 1981-02-25 |
| BR7701506A (pt) | 1977-11-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU575025A3 (ru) | Способ получени 4-арил-1,4-дигидропиридинов или их солей | |
| JPS5940829B2 (ja) | メルカプトエチル置換グアニジンの製法 | |
| SU578870A3 (ru) | Способ получени -(метоксиметил) фурилметил-6,7-бензоморфанов или морфинанов или их солей | |
| JP2547638B2 (ja) | スルホアルキル置換ヒドロキシルアミン類の製造方法 | |
| SU660592A3 (ru) | Способ получени -циклоалкилметил-2-фениламино-имидазолинов-(2) или их солей | |
| SU453836A3 (ru) | Способ получения производных 3-бензилпиридина или их солей | |
| SU791230A3 (ru) | Способ получени бетаина пиридилалкилсульфоновой кислоты | |
| JPS632264B2 (OSRAM) | ||
| JPS59206376A (ja) | オキシラン類の製造法 | |
| US2717268A (en) | Process for preparing phenyldichloro-acetamidopropanediols | |
| US4450274A (en) | Preparation of ethambutol-diisoniazide methane sulfonic acid salt | |
| US2729645A (en) | 1-[2-(dithiocarboxyamino)polymethylene] quaternary ammonium inner salts | |
| JPS5915901B2 (ja) | ｕ↓−アミノアルコ−ルの製造方法 | |
| SU492076A3 (ru) | Способ получени замещенных гуанидина | |
| US5248811A (en) | Process for producing sulfoalkyl-substituted hydroxylamines | |
| SU402218A1 (OSRAM) | ||
| EP1424329B1 (en) | Process for the preparation of 4-(imidazol-1-yl)benzenesulfonamide derivatives | |
| CA2163601C (fr) | Derives d'acide 2-aminobenzenesulfonique et de chlorure de 2-aminobenzenesulfonyle | |
| US2849465A (en) | New compounds and methods of making same | |
| SU520043A3 (ru) | Способ получени пиридиновых производных тиомочевины | |
| SU701531A3 (ru) | Способ получени производных оксима или их солей | |
| JP3042123B2 (ja) | Ｎ−シアノアセトアミジン誘導体の製法 | |
| US4160096A (en) | Process for production of 5-nitroimidazole derivatives | |
| SU443511A1 (ru) | Способ получени серусодержащих производных аминов | |
| JPS6231705B2 (OSRAM) |