SU786889A3 - Способ получени производных 3-(цианимино)-3-(амино)-пропионитрила - Google Patents
Способ получени производных 3-(цианимино)-3-(амино)-пропионитрила Download PDFInfo
- Publication number
- SU786889A3 SU786889A3 SU762386153A SU2386153A SU786889A3 SU 786889 A3 SU786889 A3 SU 786889A3 SU 762386153 A SU762386153 A SU 762386153A SU 2386153 A SU2386153 A SU 2386153A SU 786889 A3 SU786889 A3 SU 786889A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- formula
- amino
- propionitrile
- preparing
- cyamino
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 4
- 239000003960 organic solvent Substances 0.000 claims abstract description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims 1
- NFBYUVCAJNYCEG-UHFFFAOYSA-N n',2-dicyanoethanimidamide Chemical class N#CCC(N)=NC#N NFBYUVCAJNYCEG-UHFFFAOYSA-N 0.000 claims 1
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 1
- -1 piperidino, methylpiperidino-morpholino-pyrrolidino group Chemical group 0.000 claims 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 abstract description 4
- 239000002253 acid Substances 0.000 abstract description 3
- 150000003839 salts Chemical class 0.000 abstract description 3
- DGJMPUGMZIKDRO-UHFFFAOYSA-N cyanoacetamide Chemical compound NC(=O)CC#N DGJMPUGMZIKDRO-UHFFFAOYSA-N 0.000 abstract description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 abstract description 2
- 239000011707 mineral Substances 0.000 abstract description 2
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 abstract description 2
- KTZUXSWSWXTCQG-UHFFFAOYSA-N n,2-dicyanoacetamide Chemical compound N#CCC(=O)NC#N KTZUXSWSWXTCQG-UHFFFAOYSA-N 0.000 abstract 3
- 150000001412 amines Chemical class 0.000 abstract 1
- 238000004519 manufacturing process Methods 0.000 abstract 1
- 239000000047 product Substances 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 5
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 4
- 238000004809 thin layer chromatography Methods 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 101000608752 Phytolacca americana Lectin-C Proteins 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229940059260 amidate Drugs 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- UMXADXYSYVKRJV-UHFFFAOYSA-N ethyl 2-cyanoethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)CC#N UMXADXYSYVKRJV-UHFFFAOYSA-N 0.000 description 1
- NPUKDXXFDDZOKR-LLVKDONJSA-N etomidate Chemical compound CCOC(=O)C1=CN=CN1[C@H](C)C1=CC=CC=C1 NPUKDXXFDDZOKR-LLVKDONJSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- CUONGYYJJVDODC-UHFFFAOYSA-N malononitrile Chemical compound N#CCC#N CUONGYYJJVDODC-UHFFFAOYSA-N 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/195—Radicals derived from nitrogen analogues of carboxylic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/599,912 US4032559A (en) | 1975-07-28 | 1975-07-28 | N,2-dicyanoacetimidates |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU786889A3 true SU786889A3 (ru) | 1980-12-07 |
Family
ID=24401623
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU762386153A SU786889A3 (ru) | 1975-07-28 | 1976-07-27 | Способ получени производных 3-(цианимино)-3-(амино)-пропионитрила |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4032559A (enExample) |
| JP (1) | JPS5949225B2 (enExample) |
| CA (1) | CA1060443A (enExample) |
| CH (1) | CH621772A5 (enExample) |
| DK (1) | DK324776A (enExample) |
| HU (1) | HU176897B (enExample) |
| MX (1) | MX3223E (enExample) |
| SE (3) | SE424547B (enExample) |
| SU (1) | SU786889A3 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2111960C1 (ru) * | 1993-02-19 | 1998-05-27 | Новартис Аг | Способ получения натриевой соли 1-амино-1-цианамидо-2,2-дицианэтилена |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS545608B2 (enExample) * | 1973-12-04 | 1979-03-19 | ||
| JPS5312776Y2 (enExample) * | 1976-10-01 | 1978-04-06 | ||
| US4098791A (en) * | 1977-07-29 | 1978-07-04 | The Upjohn Company | Process for preparing 3-(cyanimino)-3-amino-propionitriles |
| DE2860431D1 (en) * | 1977-10-27 | 1981-02-26 | Basf Ag | Alpha-aminomethylene-beta-formylaminopropionitrile, process for its preparation and its use in the preparation of 2-methyl-4-amino-5-formylaminomethylpyrimidine |
| CH637153A5 (de) * | 1978-06-02 | 1983-07-15 | Ciba Geigy Ag | Azofarbstoffe und verfahren zur herstellung von azofarbstoffen. |
| AR225772A1 (es) * | 1979-08-14 | 1982-04-30 | Du Pont | Nuevo 3-amino-3-alcoxi-n-ciano-2-propenimidato de alquilo y procedimientos para su preparacion y de pirimidinas partiendo de aquellos |
| US4308271A (en) * | 1980-06-23 | 1981-12-29 | The Upjohn Company | Animal feed and process |
| US4515626A (en) * | 1982-10-06 | 1985-05-07 | Ciba Geigy Corporation | N-(Cyclopropyl-triazinyl-n'-(arylsulfonyl) ureas having herbicidal activity |
| DE3642832A1 (de) * | 1986-12-16 | 1988-06-30 | Hoechst Ag | Verfahren zur herstellung von aminopyrimidinen |
| DE3642830A1 (de) * | 1986-12-16 | 1988-07-07 | Hoechst Ag | Verfahren zur herstellung von pyrimidinen |
| FR2671082B1 (fr) * | 1990-12-28 | 1993-04-16 | Oreal | Agent a plusieurs composants ou kit de preparation de la forme sulfo-conjuguee de composes pyrimidino- ou triazino-n-oxyde et procede de mise en óoeuvre. |
| CN107879950B (zh) * | 2017-10-13 | 2020-05-08 | 中国石油天然气股份有限公司 | 一种n’-长链烷基-n,n-二乙基乙脒及其制备方法和应用 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3068274A (en) * | 1960-08-18 | 1962-12-11 | Eastman Kodak Co | (2-cyano-3-amino)thio-2-alkenamides |
| US3225077A (en) * | 1963-03-05 | 1965-12-21 | American Cyanamid Co | N-cyanoimidates and processes for preparing same |
| US3291827A (en) * | 1963-03-05 | 1966-12-13 | American Cyanamid Co | Process for preparing n, n'-dicyanoamidine salts |
| US3641103A (en) * | 1969-06-03 | 1972-02-08 | Grace W R & Co | Process for preparing amidine salts |
| US3910928A (en) * | 1974-04-26 | 1975-10-07 | Upjohn Co | 3-(Cyanimino)-propionitriles |
| US3948915A (en) * | 1974-07-08 | 1976-04-06 | Daiichi Seiyaku, Co., Ltd. | 2-Halopyrimidine derivatives and a method for their preparation |
-
1975
- 1975-07-28 US US05/599,912 patent/US4032559A/en not_active Expired - Lifetime
-
1976
- 1976-06-15 CA CA254,875A patent/CA1060443A/en not_active Expired
- 1976-06-16 MX MX000317U patent/MX3223E/es unknown
- 1976-07-13 JP JP51082626A patent/JPS5949225B2/ja not_active Expired
- 1976-07-16 CH CH914776A patent/CH621772A5/de not_active IP Right Cessation
- 1976-07-16 SE SE7608162A patent/SE424547B/xx not_active IP Right Cessation
- 1976-07-19 DK DK324776A patent/DK324776A/da not_active Application Discontinuation
- 1976-07-27 SU SU762386153A patent/SU786889A3/ru active
- 1976-07-28 HU HU76UO122A patent/HU176897B/hu unknown
-
1982
- 1982-03-30 SE SE8202033A patent/SE8202033L/sv not_active Application Discontinuation
- 1982-03-30 SE SE8202034A patent/SE8202034L/xx not_active Application Discontinuation
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2111960C1 (ru) * | 1993-02-19 | 1998-05-27 | Новартис Аг | Способ получения натриевой соли 1-амино-1-цианамидо-2,2-дицианэтилена |
Also Published As
| Publication number | Publication date |
|---|---|
| SE7608162L (sv) | 1977-01-29 |
| SE8202034L (sv) | 1982-03-30 |
| MX3223E (es) | 1980-07-28 |
| SE8202033L (sv) | 1982-03-30 |
| HU176897B (en) | 1981-05-28 |
| JPS5214726A (en) | 1977-02-03 |
| CA1060443A (en) | 1979-08-14 |
| SE424547B (sv) | 1982-07-26 |
| CH621772A5 (enExample) | 1981-02-27 |
| DK324776A (da) | 1977-01-29 |
| JPS5949225B2 (ja) | 1984-12-01 |
| US4032559A (en) | 1977-06-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU786889A3 (ru) | Способ получени производных 3-(цианимино)-3-(амино)-пропионитрила | |
| US4471137A (en) | Highly sterically hindered guanidines and process for the production thereof | |
| EP0991640A1 (en) | Synthesis of intermediates useful in preparing bromo-substituted tricyclic compounds | |
| SU648104A3 (ru) | Способ получени производных 1,4-диазепина | |
| US6166215A (en) | Process for producing guanidine derivatives, intermediates therefor and their production | |
| SU683623A3 (ru) | Способ получени производных пурина или их солей | |
| Lappertc | Synthesis and characterisation of N-functionalized enetetramines, and their properties | |
| Yoshioka et al. | Studies on stable free radicals. XIII. Synthesis and ESR spectral properties of hindered piperazine N-oxyls | |
| CS203172B2 (en) | Method of producing 2-/4-furoylpiperazin-1-yl-/4-amino-6,7-dimethoxyquinazoline derivatives | |
| US2621162A (en) | J-propargyl-x-quinazolones and acid | |
| Souquet et al. | Use of methylene chloride as a C1 unit in N, N-dialkylaminomethylation reaction | |
| KR20010005943A (ko) | 0-(3-아미노-2-히드록시-프로필)-히드록심산할라이드의 제조방법 | |
| US4292431A (en) | Process for the production of hydroxymethylimidazoles | |
| JP2678758B2 (ja) | 新規なプロパン誘導体 | |
| CA2083977A1 (en) | Pyrroline n-oxide derivatives | |
| US3226379A (en) | Novel 1,3-bis(polyhydroxyalkyl)-2-imidazolidinones and 1,3-bis(polyhydroxyalkyl)-imidazolidine-2-thiones | |
| JP2659587B2 (ja) | 4―アジリジニルピリミジン誘導体及びその製造法 | |
| US3470174A (en) | Cyclodiene carbox amides | |
| HU193454B (en) | Process for producing 3-phenyl-butyraldehyde derivatives | |
| SU645586A3 (ru) | Способ получени замещенных в 14-положении производных винкана | |
| Kanetani et al. | Studies of the Reactions of Amines with Sulfur Trioxide. IV. One-step Synthesis of N-substituted Imidobissulfates from Amines | |
| KR850000427B1 (ko) | 피롤 유도체의 제조방법 | |
| CA1293263C (en) | Process for the preparation of substituted sulfonamidobenzamides and a novel intermediate thereto | |
| SU464116A3 (ru) | Способ получени замещенных аминоалкильных эфиров тиолкарбаминовой кислоты | |
| Pocar et al. | v-Triazolines. Part 7. 3-Arylaminothiophens from hexahydrothiopyrano [3, 4-d]-v-triazoles |