SU691060A3 - Гербицидна композици - Google Patents
Гербицидна композициInfo
- Publication number
- SU691060A3 SU691060A3 SU762377702A SU2377702A SU691060A3 SU 691060 A3 SU691060 A3 SU 691060A3 SU 762377702 A SU762377702 A SU 762377702A SU 2377702 A SU2377702 A SU 2377702A SU 691060 A3 SU691060 A3 SU 691060A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- methyl
- pyridinone
- dihydro
- trifluoromethylphenyl
- phenyl
- Prior art date
Links
- 230000002363 herbicidal effect Effects 0.000 title description 13
- 239000004009 herbicide Substances 0.000 title description 4
- 150000001875 compounds Chemical class 0.000 description 30
- 238000012360 testing method Methods 0.000 description 19
- 239000000203 mixture Substances 0.000 description 14
- -1 3-trifluoromethylphenyl Chemical group 0.000 description 13
- 241000196324 Embryophyta Species 0.000 description 13
- 230000000694 effects Effects 0.000 description 8
- 238000002474 experimental method Methods 0.000 description 8
- 230000035784 germination Effects 0.000 description 5
- 239000002689 soil Substances 0.000 description 5
- 238000012545 processing Methods 0.000 description 4
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical compound OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 238000011156 evaluation Methods 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 2
- 235000013339 cereals Nutrition 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 238000010899 nucleation Methods 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 150000003222 pyridines Chemical class 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- VRWBDTPZJOEALB-UHFFFAOYSA-N 1-methyl-3-(3-methylphenyl)-5-phenyl-2,3-dihydropyridin-4-one Chemical compound C=1N(C)CC(C=2C=C(C)C=CC=2)C(=O)C=1C1=CC=CC=C1 VRWBDTPZJOEALB-UHFFFAOYSA-N 0.000 description 1
- HDDWJXJLZCWVBF-UHFFFAOYSA-N 1-methyl-3-phenyl-5-[3-(trifluoromethyl)phenyl]piperidin-4-one Chemical compound C1N(C)CC(C=2C=CC=CC=2)C(=O)C1C1=CC=CC(C(F)(F)F)=C1 HDDWJXJLZCWVBF-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- POXOWTWAYFMUDK-UHFFFAOYSA-N 3-(3-chlorophenyl)-5-(4-chlorophenyl)-1-methylpiperidin-4-one Chemical compound C1N(C)CC(C=2C=CC(Cl)=CC=2)C(=O)C1C1=CC=CC(Cl)=C1 POXOWTWAYFMUDK-UHFFFAOYSA-N 0.000 description 1
- NHHKJUWLMVJWOV-UHFFFAOYSA-N 3-(3-methoxyphenyl)-1-methyl-5-phenyl-2,3-dihydropyridin-4-one Chemical compound COC1=CC=CC(C2C(C(=CN(C)C2)C=2C=CC=CC=2)=O)=C1 NHHKJUWLMVJWOV-UHFFFAOYSA-N 0.000 description 1
- DHVKGOFDTAPPAB-UHFFFAOYSA-N 3-(4-fluorophenyl)-1-methyl-5-[3-(trifluoromethyl)phenyl]-2,3-dihydropyridin-4-one Chemical compound C=1N(C)CC(C=2C=CC(F)=CC=2)C(=O)C=1C1=CC=CC(C(F)(F)F)=C1 DHVKGOFDTAPPAB-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- UBFIMJNRWYPSEV-UHFFFAOYSA-N 3-ethyl-1-methyl-5-[3-(trifluoromethyl)phenyl]piperidin-4-one Chemical compound O=C1C(CC)CN(C)CC1C1=CC=CC(C(F)(F)F)=C1 UBFIMJNRWYPSEV-UHFFFAOYSA-N 0.000 description 1
- HKKVGDHYQYPCOP-UHFFFAOYSA-N 5-(3-chlorophenyl)-3-(4-chlorophenyl)-1-methyl-2,3-dihydropyridin-4-one Chemical compound C=1N(C)CC(C=2C=CC(Cl)=CC=2)C(=O)C=1C1=CC=CC(Cl)=C1 HKKVGDHYQYPCOP-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 241001174492 Carex flava var. alpina Species 0.000 description 1
- 240000006162 Chenopodium quinoa Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- 240000003768 Solanum lycopersicum Species 0.000 description 1
- OBASDBHRXUCXKQ-UHFFFAOYSA-N [F].[Br] Chemical compound [F].[Br] OBASDBHRXUCXKQ-UHFFFAOYSA-N 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- XTLNYNMNUCLWEZ-UHFFFAOYSA-N ethanol;propan-2-one Chemical compound CCO.CC(C)=O XTLNYNMNUCLWEZ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D211/74—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/80—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D211/84—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen directly attached to ring carbon atoms
- C07D211/86—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/63—One oxygen atom
- C07D213/68—One oxygen atom attached in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Hydrogenated Pyridines (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US59309575A | 1975-07-03 | 1975-07-03 | |
| US05/685,409 US4065290A (en) | 1975-07-03 | 1976-05-20 | Herbicidal β-phenyl-4-piperidinones |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU691060A3 true SU691060A3 (ru) | 1979-10-05 |
Family
ID=27081623
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU762377702A SU691060A3 (ru) | 1975-07-03 | 1976-07-02 | Гербицидна композици |
| SU772453148A SU688126A3 (ru) | 1975-07-03 | 1977-02-17 | Способ получени производных пиперидина |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU772453148A SU688126A3 (ru) | 1975-07-03 | 1977-02-17 | Способ получени производных пиперидина |
Country Status (18)
| Country | Link |
|---|---|
| JP (1) | JPS527970A (enExample) |
| AU (1) | AU497882B2 (enExample) |
| BR (1) | BR7604362A (enExample) |
| CA (1) | CA1088543A (enExample) |
| CH (2) | CH624273A5 (enExample) |
| DE (1) | DE2628992A1 (enExample) |
| ES (1) | ES449530A1 (enExample) |
| FR (1) | FR2315851A1 (enExample) |
| GB (1) | GB1555966A (enExample) |
| GR (1) | GR62256B (enExample) |
| IE (1) | IE43851B1 (enExample) |
| IL (1) | IL49858A (enExample) |
| IT (1) | IT1065058B (enExample) |
| NL (1) | NL7607421A (enExample) |
| OA (1) | OA05373A (enExample) |
| PT (1) | PT65313B (enExample) |
| SU (2) | SU691060A3 (enExample) |
| TR (1) | TR18922A (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2720612C2 (de) * | 1977-05-07 | 1987-02-19 | Basf Ag, 6700 Ludwigshafen | 3,5-Dimethyl-piperidin-4-one |
| US4808720A (en) * | 1986-06-09 | 1989-02-28 | Stauffer Chemical Company | Certain 3-benzoyl-4-oxolactams |
-
1976
- 1976-06-14 CA CA254,796A patent/CA1088543A/en not_active Expired
- 1976-06-15 GR GR51000A patent/GR62256B/el unknown
- 1976-06-15 IE IE1295/76A patent/IE43851B1/en unknown
- 1976-06-22 IL IL49858A patent/IL49858A/xx unknown
- 1976-06-28 GB GB26770/76A patent/GB1555966A/en not_active Expired
- 1976-06-28 DE DE19762628992 patent/DE2628992A1/de not_active Withdrawn
- 1976-07-01 OA OA55871A patent/OA05373A/xx unknown
- 1976-07-02 IT IT25001/76A patent/IT1065058B/it active
- 1976-07-02 SU SU762377702A patent/SU691060A3/ru active
- 1976-07-02 ES ES449530A patent/ES449530A1/es not_active Expired
- 1976-07-02 BR BR7604362A patent/BR7604362A/pt unknown
- 1976-07-02 CH CH851576A patent/CH624273A5/de not_active IP Right Cessation
- 1976-07-02 PT PT65313A patent/PT65313B/pt unknown
- 1976-07-02 AU AU15538/76A patent/AU497882B2/en not_active Expired
- 1976-07-02 TR TR18922A patent/TR18922A/xx unknown
- 1976-07-02 FR FR7620260A patent/FR2315851A1/fr active Granted
- 1976-07-03 JP JP51079407A patent/JPS527970A/ja active Pending
- 1976-07-05 NL NL7607421A patent/NL7607421A/xx not_active Application Discontinuation
-
1977
- 1977-02-17 SU SU772453148A patent/SU688126A3/ru active
-
1980
- 1980-04-25 CH CH322980A patent/CH624392A5/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IE43851B1 (en) | 1981-06-17 |
| OA05373A (fr) | 1981-02-28 |
| CH624273A5 (en) | 1981-07-31 |
| ES449530A1 (es) | 1977-12-01 |
| JPS527970A (en) | 1977-01-21 |
| DE2628992A1 (de) | 1977-01-20 |
| BR7604362A (pt) | 1977-07-26 |
| AU497882B2 (en) | 1979-01-18 |
| CA1088543A (en) | 1980-10-28 |
| SU688126A3 (ru) | 1979-09-25 |
| IL49858A (en) | 1980-06-30 |
| GB1555966A (en) | 1979-11-14 |
| FR2315851A1 (fr) | 1977-01-28 |
| NL7607421A (nl) | 1977-01-05 |
| AU1553876A (en) | 1978-01-05 |
| IT1065058B (it) | 1985-02-25 |
| PT65313B (en) | 1978-01-05 |
| IL49858A0 (en) | 1976-08-31 |
| PT65313A (en) | 1976-08-01 |
| IE43851L (en) | 1977-01-03 |
| FR2315851B1 (enExample) | 1978-05-05 |
| GR62256B (en) | 1979-03-19 |
| TR18922A (tr) | 1977-12-20 |
| CH624392A5 (en) | 1981-07-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69607827T2 (de) | Herbizide zusammensetzungen von 4-benzoylisoxazolen oder 2-cyano-1,3-dionherbiziden und antidots für diese | |
| RU2029471C1 (ru) | Производные пиримидина, гербицидная композиция и способ борьбы с сорняками с использованием композиции | |
| US4626276A (en) | Herbicidal trans-2-[(3-chloroallyloxyimino)alkyl]-5-(substitutedsulfinylalkyl)-cyclohexane-1,3-diones and derivatives thereof | |
| KR100241238B1 (ko) | 쌀작물의 보호방법 및 이를 위해 사용되는 조성물 | |
| EP0256785B1 (en) | Herbicide | |
| SU691060A3 (ru) | Гербицидна композици | |
| WO1983000329A1 (en) | S-benzyl thiolcarbamates and their use in controlling weeds in rice fields | |
| US4139366A (en) | 2-[5-aryl-2-isoxazolin-3-yl]benzoates and use as herbicides | |
| US4398944A (en) | Herbicidal composition and method for inhibiting growth of weeds | |
| US3880644A (en) | Sulfanilamide herbicides | |
| KR840000857B1 (ko) | 5-치환 옥사졸리딘 제초제 해제독의 제조방법 | |
| SU797542A3 (ru) | Гербицидна композици | |
| JPS6058918B2 (ja) | チオフエン誘導体および農園芸用殺菌剤 | |
| DE2952483C2 (de) | O-Sulfamoylglykolsäureamid-Derivate und deren Verwendung in einem herbiziden Mittel | |
| JP2871113B2 (ja) | 除草用組成物 | |
| JPS604834B2 (ja) | 新規ウラゾール誘導体および除草剤 | |
| JPS5827243B2 (ja) | サツソヴザイ | |
| SU668566A3 (ru) | Гербицидный состав | |
| US3971649A (en) | S-methyl-N-[4-(4'-chlorophenoxy)phenyl] thiolcarbamate | |
| CH624554A5 (en) | Method of protecting crops of plants | |
| KR840000859B1 (ko) | 5치환 옥사졸리딘 제초제 해독제의 제조방법 | |
| US3715199A (en) | Method of killing weeds in rice crops utilizing benzyl n,n-dialkyl-dithiocarbamates | |
| US4568378A (en) | Herbicidal 5-cycloalkylamino-3-oxo-4-(substituted-phenyl)-2,3-dihydrofuran and derivatives thereof | |
| US4428767A (en) | Synergistic herbicidal compositions | |
| US3972899A (en) | α-Pyrone derivatives |