SU682126A3 - Способ получени 4а-арил-цис-декагидроизохинолинов - Google Patents
Способ получени 4а-арил-цис-декагидроизохинолиновInfo
- Publication number
- SU682126A3 SU682126A3 SU752169463A SU2169463A SU682126A3 SU 682126 A3 SU682126 A3 SU 682126A3 SU 752169463 A SU752169463 A SU 752169463A SU 2169463 A SU2169463 A SU 2169463A SU 682126 A3 SU682126 A3 SU 682126A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- hydrogen
- ether
- decahydroisoquinoline
- methoxyphenyl
- mmol
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 8
- 238000002360 preparation method Methods 0.000 title description 3
- -1 lithium aluminum hydride Chemical compound 0.000 claims description 61
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 58
- 239000011541 reaction mixture Substances 0.000 claims description 30
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 29
- 229910052739 hydrogen Inorganic materials 0.000 claims description 24
- 239000001257 hydrogen Substances 0.000 claims description 24
- 239000012280 lithium aluminium hydride Substances 0.000 claims description 21
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 11
- 150000002431 hydrogen Chemical class 0.000 claims description 9
- 229910052731 fluorine Inorganic materials 0.000 claims description 7
- 239000011737 fluorine Substances 0.000 claims description 7
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 5
- 238000009835 boiling Methods 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- 125000001153 fluoro group Chemical group F* 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 125000004981 cycloalkylmethyl group Chemical group 0.000 claims description 2
- 238000002955 isolation Methods 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 3
- 125000004122 cyclic group Chemical group 0.000 claims 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 claims 1
- 238000011084 recovery Methods 0.000 claims 1
- 239000006188 syrup Substances 0.000 claims 1
- 235000020357 syrup Nutrition 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 129
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 107
- 239000000047 product Substances 0.000 description 62
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 54
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 53
- 239000000203 mixture Substances 0.000 description 52
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 51
- 239000000243 solution Substances 0.000 description 50
- 239000003921 oil Substances 0.000 description 42
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 38
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 35
- 239000000725 suspension Substances 0.000 description 27
- 239000012299 nitrogen atmosphere Substances 0.000 description 25
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 22
- 238000010992 reflux Methods 0.000 description 22
- 150000003839 salts Chemical class 0.000 description 19
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 239000000706 filtrate Substances 0.000 description 18
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 16
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 15
- 239000012312 sodium hydride Substances 0.000 description 15
- 229910000104 sodium hydride Inorganic materials 0.000 description 15
- 229920006395 saturated elastomer Polymers 0.000 description 14
- 229910052757 nitrogen Inorganic materials 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 12
- 239000000284 extract Substances 0.000 description 12
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 12
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 12
- 239000005457 ice water Substances 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- 238000001704 evaporation Methods 0.000 description 10
- 230000008020 evaporation Effects 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical class CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 229910000027 potassium carbonate Inorganic materials 0.000 description 8
- 229910052799 carbon Inorganic materials 0.000 description 7
- 239000012259 ether extract Substances 0.000 description 7
- NENLYAQPNATJSU-UHFFFAOYSA-N 1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline Chemical compound C1NCCC2CCCCC21 NENLYAQPNATJSU-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 239000012298 atmosphere Substances 0.000 description 6
- 230000015572 biosynthetic process Effects 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- 239000012043 crude product Substances 0.000 description 6
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 6
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 238000001953 recrystallisation Methods 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 238000000605 extraction Methods 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 235000019341 magnesium sulphate Nutrition 0.000 description 5
- 229910052763 palladium Inorganic materials 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 239000012267 brine Substances 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- 229910052753 mercury Inorganic materials 0.000 description 4
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 4
- 239000002002 slurry Substances 0.000 description 4
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 4
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical compound BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 3
- 239000007832 Na2SO4 Substances 0.000 description 3
- JFBZPFYRPYOZCQ-UHFFFAOYSA-N [Li].[Al] Chemical compound [Li].[Al] JFBZPFYRPYOZCQ-UHFFFAOYSA-N 0.000 description 3
- 229910052796 boron Inorganic materials 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000003245 coal Substances 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 2
- VGVHNLRUAMRIEW-UHFFFAOYSA-N 4-methylcyclohexan-1-one Chemical compound CC1CCC(=O)CC1 VGVHNLRUAMRIEW-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- TXHIDIHEXDFONW-UHFFFAOYSA-N benzene;propan-2-one Chemical compound CC(C)=O.C1=CC=CC=C1 TXHIDIHEXDFONW-UHFFFAOYSA-N 0.000 description 2
- AEILLAXRDHDKDY-UHFFFAOYSA-N bromomethylcyclopropane Chemical compound BrCC1CC1 AEILLAXRDHDKDY-UHFFFAOYSA-N 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- RCJVRSBWZCNNQT-UHFFFAOYSA-N dichloridooxygen Chemical compound ClOCl RCJVRSBWZCNNQT-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- XBMJPPLETQINDG-UHFFFAOYSA-N ethyl 2-(2-oxo-1-phenylcyclohexyl)acetate Chemical compound C=1C=CC=CC=1C1(CC(=O)OCC)CCCCC1=O XBMJPPLETQINDG-UHFFFAOYSA-N 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- FKHIFSZMMVMEQY-UHFFFAOYSA-N talc Chemical compound [Mg+2].[O-][Si]([O-])=O FKHIFSZMMVMEQY-UHFFFAOYSA-N 0.000 description 2
- NENLYAQPNATJSU-IUCAKERBSA-N (4as,8ar)-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline Chemical compound C1NCC[C@@H]2CCCC[C@H]21 NENLYAQPNATJSU-IUCAKERBSA-N 0.000 description 1
- LRGZZEOWQURWFK-UHFFFAOYSA-N 1,2,3,4,4a,5,6,7-octahydroisoquinoline Chemical compound C1NCCC2CCCC=C21 LRGZZEOWQURWFK-UHFFFAOYSA-N 0.000 description 1
- GHEXBSWBFDHXLT-UHFFFAOYSA-N 1-(2-bromoethyl)-2,4-dimethoxybenzene Chemical compound COC1=CC=C(CCBr)C(OC)=C1 GHEXBSWBFDHXLT-UHFFFAOYSA-N 0.000 description 1
- FQGDFWIQBCQXPS-UHFFFAOYSA-N 1-(2-bromoethyl)-2-fluorobenzene Chemical compound FC1=CC=CC=C1CCBr FQGDFWIQBCQXPS-UHFFFAOYSA-N 0.000 description 1
- LKPWGXCMVLJRIK-UHFFFAOYSA-N 1-(2-bromoethyl)-3-chlorobenzene Chemical compound ClC1=CC=CC(CCBr)=C1 LKPWGXCMVLJRIK-UHFFFAOYSA-N 0.000 description 1
- SDCBYRLJYGORNK-UHFFFAOYSA-N 1-(2-methylphenyl)ethanol Chemical compound CC(O)C1=CC=CC=C1C SDCBYRLJYGORNK-UHFFFAOYSA-N 0.000 description 1
- RGVPOXRFEPSFGH-UHFFFAOYSA-N 1-[(3,4,5-trimethoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol Chemical compound COC1=C(OC)C(OC)=CC(CC2C3=CC(O)=C(O)C=C3CCN2)=C1 RGVPOXRFEPSFGH-UHFFFAOYSA-N 0.000 description 1
- APTDRDYSJZQPPI-UHFFFAOYSA-N 1-bromo-4-(2-bromoethyl)benzene Chemical compound BrCCC1=CC=C(Br)C=C1 APTDRDYSJZQPPI-UHFFFAOYSA-N 0.000 description 1
- QGRPVMLBTFGQDQ-UHFFFAOYSA-N 1-chloro-2-methoxybenzene Chemical compound COC1=CC=CC=C1Cl QGRPVMLBTFGQDQ-UHFFFAOYSA-N 0.000 description 1
- DDXRPPRCVOVITE-UHFFFAOYSA-N 1-chloro-3-methoxycyclohexane Chemical compound ClC1CC(CCC1)OC DDXRPPRCVOVITE-UHFFFAOYSA-N 0.000 description 1
- RIQMBKNUYCZYJD-UHFFFAOYSA-N 2-(2-methoxyphenyl)-4-methylcyclohexan-1-one Chemical compound COC1=CC=CC=C1C1C(=O)CCC(C)C1 RIQMBKNUYCZYJD-UHFFFAOYSA-N 0.000 description 1
- VIKJTJUHWIWYNO-UHFFFAOYSA-N 2-(2-oxo-1-phenylcyclohexyl)acetic acid Chemical compound C=1C=CC=CC=1C1(CC(=O)O)CCCCC1=O VIKJTJUHWIWYNO-UHFFFAOYSA-N 0.000 description 1
- QDZAWVLWIMOXJT-UHFFFAOYSA-N 2-(4-methylphenyl)acetyl chloride Chemical compound CC1=CC=C(CC(Cl)=O)C=C1 QDZAWVLWIMOXJT-UHFFFAOYSA-N 0.000 description 1
- ATDSLTNNQHIUGT-UHFFFAOYSA-N 2-(cyclohexylmethyl)-4a-phenyl-4,5,6,7-tetrahydroisoquinoline-1,3-dione Chemical compound O=C1CC2(C=3C=CC=CC=3)CCCC=C2C(=O)N1CC1CCCCC1 ATDSLTNNQHIUGT-UHFFFAOYSA-N 0.000 description 1
- WWTJXBUTVKGNMX-UHFFFAOYSA-N 2-(hydroxymethyl)-2-phenylcyclohexan-1-one Chemical compound C=1C=CC=CC=1C1(CO)CCCCC1=O WWTJXBUTVKGNMX-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical class CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- RGHQKFQZGLKBCF-UHFFFAOYSA-N 2-bromoethyl acetate Chemical compound CC(=O)OCCBr RGHQKFQZGLKBCF-UHFFFAOYSA-N 0.000 description 1
- CCHNWURRBFGQCD-UHFFFAOYSA-N 2-chlorocyclohexan-1-one Chemical compound ClC1CCCCC1=O CCHNWURRBFGQCD-UHFFFAOYSA-N 0.000 description 1
- OFTKFKYVSBNYEC-UHFFFAOYSA-N 2-furoyl chloride Chemical compound ClC(=O)C1=CC=CO1 OFTKFKYVSBNYEC-UHFFFAOYSA-N 0.000 description 1
- MDCSEDZSJXOKHT-UHFFFAOYSA-N 2-methyl-4a-phenyl-4,5,6,7-tetrahydroisoquinoline-1,3-dione Chemical compound C1CCC=C2C(=O)N(C)C(=O)CC21C1=CC=CC=C1 MDCSEDZSJXOKHT-UHFFFAOYSA-N 0.000 description 1
- DRLVMOAWNVOSPE-UHFFFAOYSA-N 2-phenylcyclohexan-1-one Chemical compound O=C1CCCCC1C1=CC=CC=C1 DRLVMOAWNVOSPE-UHFFFAOYSA-N 0.000 description 1
- LADYEQUWPOAPDC-UHFFFAOYSA-N 4a-(3-methoxyphenyl)-4,5,6,7-tetrahydroisoquinoline-1,3-dione Chemical compound COC1=CC=CC(C23C(=CCCC2)C(=O)NC(=O)C3)=C1 LADYEQUWPOAPDC-UHFFFAOYSA-N 0.000 description 1
- KYCGFUJZJABSFO-UHFFFAOYSA-N 4a-phenyl-4,5,6,7-tetrahydroisoquinoline-1,3-dione Chemical compound C1CCC=C2C(=O)NC(=O)CC21C1=CC=CC=C1 KYCGFUJZJABSFO-UHFFFAOYSA-N 0.000 description 1
- OCKGFTQIICXDQW-ZEQRLZLVSA-N 5-[(1r)-1-hydroxy-2-[4-[(2r)-2-hydroxy-2-(4-methyl-1-oxo-3h-2-benzofuran-5-yl)ethyl]piperazin-1-yl]ethyl]-4-methyl-3h-2-benzofuran-1-one Chemical compound C1=C2C(=O)OCC2=C(C)C([C@@H](O)CN2CCN(CC2)C[C@H](O)C2=CC=C3C(=O)OCC3=C2C)=C1 OCKGFTQIICXDQW-ZEQRLZLVSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 101000927799 Homo sapiens Rho guanine nucleotide exchange factor 6 Proteins 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- SUAKHGWARZSWIH-UHFFFAOYSA-N N,N‐diethylformamide Chemical compound CCN(CC)C=O SUAKHGWARZSWIH-UHFFFAOYSA-N 0.000 description 1
- 102100033202 Rho guanine nucleotide exchange factor 6 Human genes 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 1
- FLHFTXCMKFVKRP-UHFFFAOYSA-N bromomethylcyclobutane Chemical compound BrCC1CCC1 FLHFTXCMKFVKRP-UHFFFAOYSA-N 0.000 description 1
- UUWSLBWDFJMSFP-UHFFFAOYSA-N bromomethylcyclohexane Chemical compound BrCC1CCCCC1 UUWSLBWDFJMSFP-UHFFFAOYSA-N 0.000 description 1
- 235000014121 butter Nutrition 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 229910001902 chlorine oxide Inorganic materials 0.000 description 1
- MAYPHUUCLRDEAZ-UHFFFAOYSA-N chlorine peroxide Chemical compound ClOOCl MAYPHUUCLRDEAZ-UHFFFAOYSA-N 0.000 description 1
- JEIJBKDXJPNHGD-UHFFFAOYSA-N chloroform;pyridine Chemical compound ClC(Cl)Cl.C1=CC=NC=C1 JEIJBKDXJPNHGD-UHFFFAOYSA-N 0.000 description 1
- 238000013329 compounding Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- WPOPOPFNZYPKAV-UHFFFAOYSA-N cyclobutylmethanol Chemical compound OCC1CCC1 WPOPOPFNZYPKAV-UHFFFAOYSA-N 0.000 description 1
- FKGIKRMZMCYOAL-UHFFFAOYSA-N cyclobutylmethyl methanesulfonate Chemical compound CS(=O)(=O)OCC1CCC1 FKGIKRMZMCYOAL-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- OILAPAOANZDPGE-UHFFFAOYSA-N ethyl 2-cyano-1-(4-fluorophenyl)-2-methyl-3-oxocyclohexane-1-carboxylate Chemical compound C(#N)C1(C(CCCC1(C(=O)OCC)C1=CC=C(C=C1)F)=O)C OILAPAOANZDPGE-UHFFFAOYSA-N 0.000 description 1
- HXMQZACSJVGWMY-UHFFFAOYSA-N ethyl 2-cyano-1-phenylcyclohex-2-ene-1-carboxylate Chemical compound C=1C=CC=CC=1C1(C(=O)OCC)CCCC=C1C#N HXMQZACSJVGWMY-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- KDCIHNCMPUBDKT-UHFFFAOYSA-N hexane;propan-2-one Chemical compound CC(C)=O.CCCCCC KDCIHNCMPUBDKT-UHFFFAOYSA-N 0.000 description 1
- BHEPBYXIRTUNPN-UHFFFAOYSA-N hydridophosphorus(.) (triplet) Chemical compound [PH] BHEPBYXIRTUNPN-UHFFFAOYSA-N 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 238000010409 ironing Methods 0.000 description 1
- SIAPCJWMELPYOE-UHFFFAOYSA-N lithium hydride Chemical compound [LiH] SIAPCJWMELPYOE-UHFFFAOYSA-N 0.000 description 1
- 229910000103 lithium hydride Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 229950002475 mesilate Drugs 0.000 description 1
- MQWCXKGKQLNYQG-UHFFFAOYSA-N methyl cyclohexan-4-ol Natural products CC1CCC(O)CC1 MQWCXKGKQLNYQG-UHFFFAOYSA-N 0.000 description 1
- MGJXBDMLVWIYOQ-UHFFFAOYSA-N methylazanide Chemical compound [NH-]C MGJXBDMLVWIYOQ-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000000199 molecular distillation Methods 0.000 description 1
- XONPDZSGENTBNJ-UHFFFAOYSA-N molecular hydrogen;sodium Chemical compound [Na].[H][H] XONPDZSGENTBNJ-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229940117803 phenethylamine Drugs 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 229940075930 picrate Drugs 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical class OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000010025 steaming Methods 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
- C07D217/04—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines with hydrocarbon or substituted hydrocarbon radicals attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/587—Unsaturated compounds containing a keto groups being part of a ring
- C07C49/687—Unsaturated compounds containing a keto groups being part of a ring containing halogen
- C07C49/697—Unsaturated compounds containing a keto groups being part of a ring containing halogen containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/12—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring
- C07D217/14—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring other than aralkyl radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/12—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring
- C07D217/14—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring other than aralkyl radicals
- C07D217/16—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring other than aralkyl radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/22—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the nitrogen-containing ring
- C07D217/24—Oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Other In-Based Heterocyclic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US50430274A | 1974-09-09 | 1974-09-09 | |
| US59946175A | 1975-08-01 | 1975-08-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU682126A3 true SU682126A3 (ru) | 1979-08-25 |
Family
ID=27054787
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU752169463A SU682126A3 (ru) | 1974-09-09 | 1975-09-08 | Способ получени 4а-арил-цис-декагидроизохинолинов |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4150135A (enExample) |
| JP (1) | JPS5154572A (enExample) |
| AR (1) | AR208562A1 (enExample) |
| AU (1) | AU503631B2 (enExample) |
| BE (1) | BE833212A (enExample) |
| DD (1) | DD123190A5 (enExample) |
| DE (1) | DE2539907A1 (enExample) |
| DK (1) | DK401575A (enExample) |
| ES (2) | ES440830A1 (enExample) |
| FI (1) | FI752516A7 (enExample) |
| FR (2) | FR2283681A1 (enExample) |
| GB (1) | GB1484431A (enExample) |
| IE (1) | IE41898B1 (enExample) |
| IL (1) | IL48061A (enExample) |
| LU (1) | LU73348A1 (enExample) |
| NL (1) | NL7510617A (enExample) |
| NO (1) | NO753062L (enExample) |
| SE (1) | SE7509022L (enExample) |
| SU (1) | SU682126A3 (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4419517A (en) * | 1973-06-01 | 1983-12-06 | E. I. Du Pont De Nemours & Co. | 4a-Aryl-trans-decahydroisoquinolines |
| US4219652A (en) * | 1975-09-30 | 1980-08-26 | Eli Lilly And Company | N-Methyl and N-phenethyl-cis-decahydroisoquinolines |
| US4301290A (en) * | 1975-12-16 | 1981-11-17 | Sandoz Ltd. | Organic compounds |
| DE2636684C3 (de) * | 1976-08-14 | 1980-06-19 | Merck Patent Gmbh, 6100 Darmstadt | Phenylcyclohexanderivate und ihre Verwendung in flüssigkristallinen Dielektrika |
| DE2702598C2 (de) * | 1977-01-22 | 1984-10-25 | Merck Patent Gmbh, 6100 Darmstadt | Cyclohexylcyclohexane und diese enthaltende Dielektrika |
| US4118386A (en) * | 1977-04-04 | 1978-10-03 | Hoffmann-La Roche Inc. | Synthesis of imidazo[1,5-a]diazepine-3-carboxylates |
| US4289882A (en) | 1978-04-26 | 1981-09-15 | The United States Of America As Represented By The Department Of Health & Human Services | 4A-Aryl-decahydroisoquinolines |
| JPS57122041A (en) * | 1981-01-21 | 1982-07-29 | Suntory Ltd | Phenylclohexane derivative |
| US4349677A (en) * | 1981-11-09 | 1982-09-14 | Morton-Norwich Products, Inc. | 3,4-Dihydro-3,4-isoquinolinedione 4-oxime |
| US4579952A (en) * | 1981-12-28 | 1986-04-01 | E. I. Du Pont De Nemours And Company | Intermediates for octahydrobenzofuro[3,2-e]isoquinolines |
| US4537963A (en) * | 1981-12-28 | 1985-08-27 | E. I. Du Pont De Nemours And Company | Intermediates for octahydrobenzofuro[3,2-E]isoquinolines |
| US4421916A (en) * | 1981-12-28 | 1983-12-20 | E. I. Du Pont De Nemours & Co. | Intermediates for octahydrobenzofuro[3,2-e]isoquinolines |
| IT1307327B1 (it) * | 1995-09-12 | 2001-10-30 | Smithkline Beecham Spa | Derivati idroisochinolinici sostituiti |
| SG11201600082VA (en) | 2013-07-10 | 2016-02-26 | Vertex Pharma | Fused piperidine amides as modulators of ion channels |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2740788A (en) * | 1956-04-03 | J-hydroxy-n-propargyl-morphinanes | ||
| DE1670694B2 (de) | 1966-05-05 | 1976-07-22 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von tetrahydroisochinolinen |
| US3546227A (en) * | 1966-12-01 | 1970-12-08 | Sandoz Ag | 2,3-dihydro-1h-benz(d,e)isoquinoline carboxamidines |
| US3666763A (en) * | 1970-01-06 | 1972-05-30 | Hoffmann La Roche | 4-phenyl isoquinolines and process for preparing same |
| AT330179B (de) * | 1972-07-20 | 1976-06-25 | Du Pont | Verfahren zur herstellung von neuen 4a-aryl- transdecahydroisochinolinderivaten sowie deren optischen isomeren |
-
1975
- 1975-08-12 SE SE7509022A patent/SE7509022L/xx unknown
- 1975-09-05 IL IL48061A patent/IL48061A/xx unknown
- 1975-09-08 LU LU73348A patent/LU73348A1/xx unknown
- 1975-09-08 NO NO753062A patent/NO753062L/no unknown
- 1975-09-08 FI FI752516A patent/FI752516A7/fi not_active Application Discontinuation
- 1975-09-08 SU SU752169463A patent/SU682126A3/ru active
- 1975-09-08 GB GB36885/75A patent/GB1484431A/en not_active Expired
- 1975-09-08 DD DD188238A patent/DD123190A5/xx unknown
- 1975-09-08 DK DK401575A patent/DK401575A/da not_active Application Discontinuation
- 1975-09-08 AU AU84608/75A patent/AU503631B2/en not_active Expired
- 1975-09-08 DE DE19752539907 patent/DE2539907A1/de not_active Withdrawn
- 1975-09-09 JP JP50109420A patent/JPS5154572A/ja active Pending
- 1975-09-09 IE IE1959/75A patent/IE41898B1/en unknown
- 1975-09-09 ES ES440830A patent/ES440830A1/es not_active Expired
- 1975-09-09 BE BE159859A patent/BE833212A/xx unknown
- 1975-09-09 NL NL7510617A patent/NL7510617A/xx not_active Application Discontinuation
- 1975-09-09 AR AR260314A patent/AR208562A1/es active
- 1975-09-09 FR FR7527562A patent/FR2283681A1/fr not_active Withdrawn
-
1976
- 1976-06-03 FR FR7616802A patent/FR2309536A1/fr active Granted
-
1977
- 1977-02-22 ES ES456168A patent/ES456168A1/es not_active Expired
- 1977-03-04 US US05/774,436 patent/US4150135A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| LU73348A1 (enExample) | 1976-08-13 |
| FI752516A7 (enExample) | 1976-03-10 |
| BE833212A (fr) | 1976-03-09 |
| DK401575A (da) | 1976-03-10 |
| US4150135A (en) | 1979-04-17 |
| IL48061A0 (en) | 1975-11-25 |
| IE41898L (en) | 1976-03-09 |
| FR2309536A1 (fr) | 1976-11-26 |
| AU503631B2 (en) | 1979-09-13 |
| AR208562A1 (es) | 1977-02-15 |
| DE2539907A1 (de) | 1976-03-25 |
| IL48061A (en) | 1979-09-30 |
| GB1484431A (en) | 1977-09-01 |
| JPS5154572A (en) | 1976-05-13 |
| DD123190A5 (enExample) | 1976-12-05 |
| ES440830A1 (es) | 1977-07-01 |
| IE41898B1 (en) | 1980-04-23 |
| SE7509022L (sv) | 1976-03-10 |
| ES456168A1 (es) | 1978-08-01 |
| NL7510617A (nl) | 1976-03-11 |
| FR2283681A1 (fr) | 1976-04-02 |
| AU8460875A (en) | 1977-03-17 |
| FR2309536B1 (enExample) | 1979-07-27 |
| NO753062L (enExample) | 1976-03-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU682126A3 (ru) | Способ получени 4а-арил-цис-декагидроизохинолинов | |
| DK165003B (da) | Chlorsulfat | |
| DE69204627T2 (de) | Prostaglandine. | |
| US4177346A (en) | 1,5-Disubstituted-2-pyrrolidones | |
| SU923365A3 (ru) | Способ получени простановых производных или их солей | |
| NO318146B1 (no) | Fremgangsmate for fremstilling av semisyntetiske statiner samt nye mellomprodukter ved fremgangsmaten | |
| EP0304138A1 (en) | Process for making 1,3-dioxane derivatives | |
| JPH06507171A (ja) | 抗炎症剤としての2−および5−アルキルおよびフェニル置換4−(1−ヒドロキシ、1−アシルオキシまたは1−カルバモイルオキシ)−5ヒドロキシ−2(5h)−フラノン | |
| JPS61238758A (ja) | エピポドフイロトキシンおよび関連化合物を製造する中間体並びにその製造および使用方法 | |
| SU850000A3 (ru) | Способ получени производных пирролидина | |
| Grieco et al. | Helenanolides: stereocontrolled total synthesis of dl-bigelovin, dl-mexicanin I, and dl-linifolin A | |
| Valeev et al. | Stereochemical aspects of the beckman rearrangement of oximes of levoglucosenone and its dihydro derivative. Enantioselective synthesis of (+)-γ-pelargonolactone | |
| US4212828A (en) | Novel process for asymmetric synthesis of optically active 2-alkanoyl-1,2,3,4-tetrahydro-2-naphthol compounds | |
| DK147070B (da) | Analogifremgangsmaade til fremstilling af 13,14-dehydro-11-deoxy-prostaglandiner | |
| US4148809A (en) | Process for preparing dl-cis-1-hydroxy-3-substituted-6,6-dimethyl-6,6a,7,8,10,10a-hexahydro-9H-dibenzo[b,d]pyran-9-ones | |
| US5760244A (en) | Process for the preparation of 3-isoxazolecarboxylic acid | |
| US5496849A (en) | Sulfonic acid derivative and its pharmaceutical application | |
| BRPI0616977A2 (pt) | composto, processo para a sìntese de inibidores de hmg-coa redutase e uso de composto na sìntese de estatinas | |
| FI88292B (fi) | Foerfarande foer framstaellning av n-(sulfonylmetyl)formamider | |
| RU2024512C1 (ru) | Производные бензоксазолона, обладающие противовоспалительной активностью | |
| TANAKA et al. | Synthetic Studies on a Picrotoxane Sesquiterpene, Coriamyrtin. I. The Grignard Reaction of 5-(2-Methyl-1, 3-dioxo-2-cyclopentyl) methyl-2, 5H-furanone with Isopropenylmagnesium Bromide and Stereochemistries of the Products | |
| SU451239A3 (ru) | Способ получени 3-кетостероидов | |
| US3019233A (en) | 5-hydroxy-2-oxyphenylcyclopentane-alkanols and intermediates | |
| US5461156A (en) | Stereocontrolled synthesis of cis-bicyclic compounds | |
| US4906765A (en) | Process for the production of 4-alkoxy-2(5H) thiophenones |