SU595280A1 - Способ получени арилперфторалкиловых эфиров - Google Patents
Способ получени арилперфторалкиловых эфировInfo
- Publication number
- SU595280A1 SU595280A1 SU742071094A SU2071094A SU595280A1 SU 595280 A1 SU595280 A1 SU 595280A1 SU 742071094 A SU742071094 A SU 742071094A SU 2071094 A SU2071094 A SU 2071094A SU 595280 A1 SU595280 A1 SU 595280A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- arylperfluoroalkyl
- esters
- preparing
- hydrogen fluoride
- raw material
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 4
- 150000002148 esters Chemical class 0.000 title 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 claims description 5
- 229910000040 hydrogen fluoride Inorganic materials 0.000 claims description 5
- QHMQWEPBXSHHLH-UHFFFAOYSA-N sulfur tetrafluoride Chemical compound FS(F)(F)F QHMQWEPBXSHHLH-UHFFFAOYSA-N 0.000 claims description 4
- 239000002994 raw material Substances 0.000 claims 2
- ABDBNWQRPYOPDF-UHFFFAOYSA-N carbonofluoridic acid Chemical class OC(F)=O ABDBNWQRPYOPDF-UHFFFAOYSA-N 0.000 claims 1
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical class C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 claims 1
- 150000002170 ethers Chemical class 0.000 claims 1
- 238000000926 separation method Methods 0.000 claims 1
- 239000007858 starting material Substances 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- YSGKVOMJRCQYMT-UHFFFAOYSA-N 1,1,2,2-tetrafluoro-1-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethoxy]-2-(trifluoromethoxy)ethane Chemical compound FC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)F YSGKVOMJRCQYMT-UHFFFAOYSA-N 0.000 description 1
- IHYMJUVQLSNPPP-UHFFFAOYSA-N 2,2-difluoro-2-(trifluoromethoxy)acetic acid Chemical compound OC(=O)C(F)(F)OC(F)(F)F IHYMJUVQLSNPPP-UHFFFAOYSA-N 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- -1 bromophenyl ester Chemical class 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/27—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups
- C07C205/35—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/36—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
- C07C205/37—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by etherified hydroxy groups having nitro groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system the oxygen atom of at least one of the etherified hydroxy groups being further bound to an acyclic carbon atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU742071094A SU595280A1 (ru) | 1974-11-01 | 1974-11-01 | Способ получени арилперфторалкиловых эфиров |
| JP12939075A JPS5253828A (en) | 1974-11-01 | 1975-10-29 | Process for preparing aryl perfluoroalkyl ester |
| DE19752548458 DE2548458A1 (de) | 1974-11-01 | 1975-10-29 | Arylperfluoralkylaether und verfahren zu ihrer herstellung |
| DD18914775A DD121633A1 (pm) | 1974-11-01 | 1975-10-30 | |
| GB4512075A GB1466520A (en) | 1974-11-01 | 1975-10-31 | Aryl perfluoro-alkyl ethers and method of producing them |
| FR7533504A FR2291176A1 (fr) | 1974-11-01 | 1975-11-03 | Ethers arylperfluoroalcoyliques et leur procede de preparation |
| US05/728,598 US4093665A (en) | 1974-11-01 | 1976-09-29 | Aryl perfluoro-alkyl ethers and method of producing them |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SU742071094A SU595280A1 (ru) | 1974-11-01 | 1974-11-01 | Способ получени арилперфторалкиловых эфиров |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU595280A1 true SU595280A1 (ru) | 1978-02-28 |
Family
ID=20599500
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU742071094A SU595280A1 (ru) | 1974-11-01 | 1974-11-01 | Способ получени арилперфторалкиловых эфиров |
Country Status (6)
| Country | Link |
|---|---|
| JP (1) | JPS5253828A (pm) |
| DD (1) | DD121633A1 (pm) |
| DE (1) | DE2548458A1 (pm) |
| FR (1) | FR2291176A1 (pm) |
| GB (1) | GB1466520A (pm) |
| SU (1) | SU595280A1 (pm) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4727187A (en) * | 1984-06-15 | 1988-02-23 | Ciba-Geigy Corporation | Process for the preparation of α, α-difluoroalkyl phenyl ether derivatives |
-
1974
- 1974-11-01 SU SU742071094A patent/SU595280A1/ru active
-
1975
- 1975-10-29 JP JP12939075A patent/JPS5253828A/ja active Granted
- 1975-10-29 DE DE19752548458 patent/DE2548458A1/de not_active Withdrawn
- 1975-10-30 DD DD18914775A patent/DD121633A1/xx unknown
- 1975-10-31 GB GB4512075A patent/GB1466520A/en not_active Expired
- 1975-11-03 FR FR7533504A patent/FR2291176A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| GB1466520A (en) | 1977-03-09 |
| JPS54896B2 (pm) | 1979-01-18 |
| JPS5253828A (en) | 1977-04-30 |
| FR2291176A1 (fr) | 1976-06-11 |
| DD121633A1 (pm) | 1976-08-12 |
| FR2291176B1 (pm) | 1979-04-06 |
| DE2548458A1 (de) | 1976-05-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2426224A (en) | Processes for producing dibasic acids and derivatives of dibasic acids | |
| SU595280A1 (ru) | Способ получени арилперфторалкиловых эфиров | |
| JP2572501B2 (ja) | 2−フルオロイソ酪酸エステルの製造方法 | |
| SU149419A1 (ru) | Способ получени эфиров дихлоруксусной кислоты | |
| SU427923A1 (ru) | Способ получения сложных эфиров непределбпб1х оксикарбоновых кислот | |
| SU397002A1 (ru) | Ан ссср | |
| SU371202A1 (ru) | СПОСОБ ПОЛУЧЕНИЯ СЛОЖНЫХ ЭФИРОВ КСИЛИТАИ ЖИРНЫХ кислот | |
| SU407883A1 (ru) | СПОСОБ ПОЛУЧЕНИЯ а^'-НИТРОСПИРТОВ | |
| SU382633A1 (ru) | СПОСОБ ПОЛУЧЕНИЯ ЭФИРОВ Ы-СУЛЬФОЛАНИЛАЛ\ИНО-уксусной кислоты | |
| SU98700A1 (ru) | Способ получени эфиров хлорфеноксиуксусных кислот | |
| SU550391A1 (ru) | 1,3-Диоксанкарбоновые кислоты в качестве пластификаторов поливинилхлорида | |
| SU642302A1 (ru) | Способ получени 2-фтор-2,2-динитроэтилсерной кислоты | |
| SU507559A1 (ru) | Способ получени алкиловых эфиров -фенилакриловой кислоты | |
| SU647300A1 (ru) | Способ получени 2-метил-3,4,6гептатриенола-2 | |
| SU430107A1 (ru) | Способ получения дихлорангидридов алкил(арил)-тиометилфосфоновых кислот | |
| SU149421A1 (ru) | Способ получени ацетальдегида | |
| SU140795A1 (ru) | Способ получени 1-алкокси-З, 3-дихлор-2-алкилпропенов-1 | |
| SU407898A1 (ru) | К АВТОРСКОМУ СВИДЕТЕЛЬСТВУМ. Кл С 07d 7/10 С 07с 43/10УДК 547.811.547.421.5 (088.8) | |
| SU385959A1 (ru) | Способ получения | |
| SU469683A1 (ru) | Способ получени оксифениловых эфиров метакриловой кислоты, содержащих кетонные или альдегидные группы | |
| SU407914A1 (ru) | Способ получения карбо-(м-диалкиламино)- метиламидов диалкилфосфорных кислот | |
| SU461933A1 (ru) | Способ получени бромфторангидридов -бромалкилфосфоновых кислот | |
| SU487893A1 (ru) | Способ получени 0,0,0,0-тетраалкил- -изопропилен-бис-дитиофосфатов | |
| SU406830A1 (ru) | СПОСОБ ПОЛУЧЕНИЯ р-АЛКОКСИНИТРОАЛКАНОВ | |
| SU405882A1 (ru) | Ан ссср |