SU582766A3 - Способ получени производных 3-хинолинкарбоновой кислоты или их солей - Google Patents
Способ получени производных 3-хинолинкарбоновой кислоты или их солейInfo
- Publication number
- SU582766A3 SU582766A3 SU7502147968A SU2147968A SU582766A3 SU 582766 A3 SU582766 A3 SU 582766A3 SU 7502147968 A SU7502147968 A SU 7502147968A SU 2147968 A SU2147968 A SU 2147968A SU 582766 A3 SU582766 A3 SU 582766A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- oxo
- salts
- mol
- acid
- spectrum
- Prior art date
Links
- 238000000034 method Methods 0.000 title description 3
- 150000003839 salts Chemical class 0.000 title description 3
- DJXNJVFEFSWHLY-UHFFFAOYSA-N quinoline-3-carboxylic acid Chemical class C1=CC=CC2=CC(C(=O)O)=CN=C21 DJXNJVFEFSWHLY-UHFFFAOYSA-N 0.000 title description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 238000002329 infrared spectrum Methods 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 239000004323 potassium nitrate Substances 0.000 description 5
- 235000010333 potassium nitrate Nutrition 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- YPNPPIZSVBWIAA-UHFFFAOYSA-N [1,3]dioxolo[4,5-h]quinoline-7-carboxylic acid Chemical compound C1=CC2=CC(C(=O)O)=CN=C2C2=C1OCO2 YPNPPIZSVBWIAA-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- ATHHXGZTWNVVOU-UHFFFAOYSA-N N-methylformamide Chemical compound CNC=O ATHHXGZTWNVVOU-UHFFFAOYSA-N 0.000 description 2
- -1 SALTS derivatives of 3-quinolinecarboxylic acid Chemical class 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000003518 caustics Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000002211 ultraviolet spectrum Methods 0.000 description 2
- JFDQCWWNDXUTMP-UHFFFAOYSA-N 10,12-dioxa-8-azatricyclo[7.3.1.02,7]trideca-1(13),2,4,6,8-pentaene-13-carboxylic acid Chemical compound C1OC2=NC3=CC=CC=C3C(=C2C(=O)O)O1 JFDQCWWNDXUTMP-UHFFFAOYSA-N 0.000 description 1
- 101150043532 CISH gene Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229940000425 combination drug Drugs 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 235000013372 meat Nutrition 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- DQWPFSLDHJDLRL-UHFFFAOYSA-N triethyl phosphate Chemical compound CCOP(=O)(OCC)OCC DQWPFSLDHJDLRL-UHFFFAOYSA-N 0.000 description 1
- ZJVTYKZWDWVIFD-UHFFFAOYSA-N zinc;hydrochloride Chemical compound Cl.[Zn] ZJVTYKZWDWVIFD-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D491/00—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00
- C07D491/02—Heterocyclic compounds containing in the condensed ring system both one or more rings having oxygen atoms as the only ring hetero atoms and one or more rings having nitrogen atoms as the only ring hetero atoms, not provided for by groups C07D451/00 - C07D459/00, C07D463/00, C07D477/00 or C07D489/00 in which the condensed system contains two hetero rings
- C07D491/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUCI1485A HU170681B (enExample) | 1974-06-25 | 1974-06-25 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU582766A3 true SU582766A3 (ru) | 1977-11-30 |
Family
ID=10994523
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU7502147968A SU582766A3 (ru) | 1974-06-25 | 1975-06-24 | Способ получени производных 3-хинолинкарбоновой кислоты или их солей |
Country Status (10)
| Country | Link |
|---|---|
| AT (1) | AT341526B (enExample) |
| CS (1) | CS188379B1 (enExample) |
| DD (1) | DD118431A1 (enExample) |
| DK (1) | DK137927B (enExample) |
| ES (1) | ES438816A1 (enExample) |
| FI (1) | FI751869A7 (enExample) |
| FR (1) | FR2276049A1 (enExample) |
| HU (1) | HU170681B (enExample) |
| NO (1) | NO142783C (enExample) |
| SU (1) | SU582766A3 (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1994002145A2 (en) * | 1992-07-22 | 1994-02-03 | Genelabs Technologies, Inc. | 2-aryl-4-quinolones as antitumor compounds |
| US5571822A (en) * | 1994-09-30 | 1996-11-05 | The University Of North Carolina At Chapel Hill | Antitumor compounds |
-
1974
- 1974-06-25 HU HUCI1485A patent/HU170681B/hu unknown
-
1975
- 1975-06-23 CS CS754437A patent/CS188379B1/cs unknown
- 1975-06-23 FR FR7519545A patent/FR2276049A1/fr active Granted
- 1975-06-23 NO NO752224A patent/NO142783C/no unknown
- 1975-06-23 AT AT478375A patent/AT341526B/de not_active IP Right Cessation
- 1975-06-24 DD DD186854A patent/DD118431A1/xx unknown
- 1975-06-24 FI FI751869A patent/FI751869A7/fi not_active Application Discontinuation
- 1975-06-24 DK DK287075AA patent/DK137927B/da not_active IP Right Cessation
- 1975-06-24 SU SU7502147968A patent/SU582766A3/ru active
- 1975-06-24 ES ES438816A patent/ES438816A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DK137927B (da) | 1978-06-05 |
| DK287075A (enExample) | 1975-12-26 |
| FR2276049A1 (fr) | 1976-01-23 |
| FI751869A7 (enExample) | 1975-12-26 |
| DK137927C (enExample) | 1978-10-30 |
| NO142783B (no) | 1980-07-07 |
| AT341526B (de) | 1978-02-10 |
| ATA478375A (de) | 1977-06-15 |
| NO142783C (no) | 1980-10-15 |
| DD118431A1 (enExample) | 1976-03-05 |
| NO752224L (enExample) | 1975-12-30 |
| ES438816A1 (es) | 1977-02-01 |
| HU170681B (enExample) | 1977-08-28 |
| FR2276049B1 (enExample) | 1979-08-17 |
| CS188379B1 (enExample) | 1979-03-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4599408A (en) | Perylene-3,4,9,10-tetracarboxylic acid monoanhydride monoimides | |
| SU582766A3 (ru) | Способ получени производных 3-хинолинкарбоновой кислоты или их солей | |
| EP0036636B1 (en) | A method and intermediates for preparing 3,3'-azo-bis-(6-hydroxy benzoic acid) | |
| US3960856A (en) | Process for the preparation of 4-hydroxy-3-(5-methyl-3-isoxazolylcarbamoyl)-2-methyl-2H-1,2-benzothiazine 1,1-dioxide | |
| US5162584A (en) | Fluorobenzene derivatives | |
| PL75064B1 (enExample) | ||
| JPH0583550B2 (enExample) | ||
| NO179517B (no) | Fremgangsmåte for fremstilling av 8-klorkinolonderivater | |
| SU545262A3 (ru) | Способ получени производных 4-оксо4н-пирано-(3,2-с) хинолин-2-карбоновых кислот или их солей | |
| SU578869A3 (ru) | Способ получени 4-окси-3-нитрокарбостирилов | |
| SU638258A3 (ru) | Способ получени производных нафтиридинов | |
| CN111072656B (zh) | 一种吡喹酮的合成方法 | |
| CS202069B2 (en) | Method of preparing 2-/4-substituted piperazine-1-yl/-4-amino-6,7-dimethoxyquinazolines | |
| SU1498390A3 (ru) | Способ получени 6-амино-1,2-дигидро-1-окси-2-имино-4-пиперидинопиримидина | |
| CA2044796C (en) | Process for producing pyrido[1,2-a] pyrimidine derivative | |
| EP0026675B1 (en) | 1-azaxanthone-3-carboxylic acids, their preparation and pharmaceutical compositions containing them | |
| CN109912406B (zh) | 一种2-羟基异己酸钙的合成方法 | |
| KR100549354B1 (ko) | 케토산의정제방법 | |
| SU1145020A1 (ru) | Способ получени 3-карбоксикумаринов | |
| RU2076104C1 (ru) | Способ получения производных 5,6-фталилфенотиазина | |
| RU2065440C1 (ru) | Способ получения производных 3-фенилтиоантра[1,9-cd]-изоксазол-6-она | |
| KR100280925B1 (ko) | 2-니트로티오잔톤의 제조방법 | |
| SU1068417A1 (ru) | Способ получени производных 1,2-диоксо-3-хлорнафталина или 4,5-диоксоиндола | |
| JPH06279414A (ja) | アリールヒダントインの製造方法 | |
| JP2002173607A (ja) | フルオラン化合物の製造法 |