SU533336A3 - Способ получени аминопропанолов,их солей или оптически-активных антиподов - Google Patents
Способ получени аминопропанолов,их солей или оптически-активных антиподовInfo
- Publication number
- SU533336A3 SU533336A3 SU1907907A SU1907907A SU533336A3 SU 533336 A3 SU533336 A3 SU 533336A3 SU 1907907 A SU1907907 A SU 1907907A SU 1907907 A SU1907907 A SU 1907907A SU 533336 A3 SU533336 A3 SU 533336A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- alkyl
- salts
- acid
- optically active
- carbon atoms
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 title description 13
- 238000000034 method Methods 0.000 title description 10
- MXZROAOUCUVNHX-UHFFFAOYSA-N 2-Aminopropanol Chemical compound CCC(N)O MXZROAOUCUVNHX-UHFFFAOYSA-N 0.000 title 1
- 125000000217 alkyl group Chemical group 0.000 description 26
- -1 Tpetf Chemical group 0.000 description 24
- 125000004432 carbon atom Chemical group C* 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 239000002253 acid Substances 0.000 description 12
- 125000003545 alkoxy group Chemical group 0.000 description 12
- 150000001875 compounds Chemical class 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 2
- 125000000304 alkynyl group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 2
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- PXACTUVBBMDKRW-UHFFFAOYSA-N 4-bromobenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Br)C=C1 PXACTUVBBMDKRW-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 244000144725 Amygdalus communis Species 0.000 description 1
- 235000011437 Amygdalus communis Nutrition 0.000 description 1
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- 101150079162 CHDH gene Proteins 0.000 description 1
- 102100024482 Cell division cycle-associated protein 4 Human genes 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- 244000131522 Citrus pyriformis Species 0.000 description 1
- 206010011906 Death Diseases 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 101000980898 Homo sapiens Cell division cycle-associated protein 4 Proteins 0.000 description 1
- 241001397173 Kali <angiosperm> Species 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- QIVBCDIJIAJPQS-VIFPVBQESA-N L-tryptophane Chemical compound C1=CC=C2C(C[C@H](N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-VIFPVBQESA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 241000124033 Salix Species 0.000 description 1
- QIVBCDIJIAJPQS-UHFFFAOYSA-N Tryptophan Natural products C1=CC=C2C(CC(N)C(O)=O)=CNC2=C1 QIVBCDIJIAJPQS-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 125000002355 alkine group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 description 1
- 125000004849 alkoxymethyl group Chemical group 0.000 description 1
- 125000005055 alkyl alkoxy group Chemical group 0.000 description 1
- 125000006350 alkyl thio alkyl group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 235000020224 almond Nutrition 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 235000013365 dairy product Nutrition 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000002934 lysing effect Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000005429 oxyalkyl group Chemical group 0.000 description 1
- OXNIZHLAWKMVMX-UHFFFAOYSA-N picric acid Chemical class OC1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-N 0.000 description 1
- RPDAUEIUDPHABB-UHFFFAOYSA-N potassium ethoxide Chemical compound [K+].CC[O-] RPDAUEIUDPHABB-UHFFFAOYSA-N 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- 125000004001 thioalkyl group Chemical group 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/13—Amines
- A61K31/135—Amines having aromatic rings, e.g. ketamine, nortriptyline
- A61K31/138—Aryloxyalkylamines, e.g. propranolol, tamoxifen, phenoxybenzamine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/28—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines
- C07C217/30—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring
- C07C217/32—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/02—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C217/04—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C217/28—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines
- C07C217/30—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring
- C07C217/32—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted
- C07C217/34—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having etherified hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having one amino group and at least two singly-bound oxygen atoms, with at least one being part of an etherified hydroxy group, bound to the carbon skeleton, e.g. ethers of polyhydroxy amines having the oxygen atom of at least one of the etherified hydroxy groups further bound to a carbon atom of a six-membered aromatic ring the six-membered aromatic ring or condensed ring system containing that ring being further substituted by halogen atoms, by trihalomethyl, nitro or nitroso groups, or by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C271/00—Derivatives of carbamic acids, i.e. compounds containing any of the groups, the nitrogen atom not being part of nitro or nitroso groups
- C07C271/06—Esters of carbamic acids
- C07C271/08—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms
- C07C271/10—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C271/16—Esters of carbamic acids having oxygen atoms of carbamate groups bound to acyclic carbon atoms with the nitrogen atoms of the carbamate groups bound to hydrogen atoms or to acyclic carbon atoms to carbon atoms of hydrocarbon radicals substituted by singly-bound oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Epoxy Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE7204321A SE384853B (sv) | 1972-04-04 | 1972-04-04 | Forfarande for framstellning av nya aminer |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU533336A3 true SU533336A3 (ru) | 1976-10-25 |
Family
ID=20263926
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1907907A SU533336A3 (ru) | 1972-04-04 | 1973-04-03 | Способ получени аминопропанолов,их солей или оптически-активных антиподов |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3996382A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5924971B2 (cg-RX-API-DMAC7.html) |
| AR (1) | AR204982A1 (cg-RX-API-DMAC7.html) |
| AT (1) | AT321276B (cg-RX-API-DMAC7.html) |
| BE (1) | BE797414A (cg-RX-API-DMAC7.html) |
| BR (1) | BR7302430D0 (cg-RX-API-DMAC7.html) |
| CA (1) | CA1017755A (cg-RX-API-DMAC7.html) |
| CH (3) | CH587222A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2316727C3 (cg-RX-API-DMAC7.html) |
| ES (3) | ES413316A1 (cg-RX-API-DMAC7.html) |
| FI (1) | FI63741C (cg-RX-API-DMAC7.html) |
| FR (1) | FR2179069B1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1421824A (cg-RX-API-DMAC7.html) |
| IE (1) | IE38302B1 (cg-RX-API-DMAC7.html) |
| NL (1) | NL7304606A (cg-RX-API-DMAC7.html) |
| NO (1) | NO139167C (cg-RX-API-DMAC7.html) |
| SE (1) | SE384853B (cg-RX-API-DMAC7.html) |
| SU (1) | SU533336A3 (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA732119B (cg-RX-API-DMAC7.html) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU169464B (cg-RX-API-DMAC7.html) * | 1974-02-20 | 1976-11-28 | ||
| IL48309A (en) * | 1974-10-25 | 1980-01-31 | Robins Co Inc A H | 1-aryloxy-4-amino-2-butanols and pharmaceutical compositions containing them |
| JPS5337126A (en) * | 1976-09-17 | 1978-04-06 | Nishida Marine Boiler | Obtaining method of nickel from low grade nickel ore |
| JPS55161036A (en) * | 1979-06-05 | 1980-12-15 | Ooeyama Nickel Kk | Nickel oxide ore smelting method |
| ZW9881A1 (en) * | 1980-06-02 | 1981-12-23 | Hoffmann La Roche | Substituted phenoxyaminopropanol derivatives |
| FR2497194B1 (fr) * | 1980-08-07 | 1985-06-14 | Sandoz Sa | Nouveaux composes phenoliques |
| CH643527A5 (en) * | 1980-10-24 | 1984-06-15 | Ciba Geigy Ag | Process for the preparation of 1-alkylamino-3-(4-(2-lower alkoxy-ethyl)phenoxy)-2-propanols |
| DE3125636A1 (de) * | 1981-06-30 | 1983-01-13 | Merck Patent Gmbh, 6100 Darmstadt | 1-(p-2-isopropoxyethoxymethyl-phenoxy)-3-isopropylamino-propan-2-ol zur senkung des augeninnendrucks und ophtalmikum, enthalten diese verbindung |
| SE457505B (sv) * | 1984-01-10 | 1989-01-09 | Lejus Medical Ab | Laminatbelagd oral farmaceutisk komposition och foerfarande foer dess framstaellning |
| US5064827A (en) * | 1988-12-15 | 1991-11-12 | Du Pont Merck Pharmaceutical Company | Polyhydroxybenzyloxpropanolamines |
| US4959390A (en) * | 1988-12-15 | 1990-09-25 | E. I. Du Pont De Nemours And Company | Polyhydroxybenzyloxypropanolamines |
| KR100469947B1 (ko) * | 1998-04-14 | 2005-04-08 | 삼성정밀화학 주식회사 | 키랄(s)-3-아미노-1,2-프로판디올의제조방법 |
| KR100489649B1 (ko) * | 1998-04-14 | 2005-09-02 | 삼성정밀화학 주식회사 | (s)-3-치환-2-히드록시프로필아민의제조방법 |
| KR100469946B1 (ko) * | 1998-04-14 | 2005-05-17 | 삼성정밀화학 주식회사 | 키랄(s)-2,3-치환-1-프로필아민유도체의제조방법 |
| US20010018446A1 (en) | 1999-09-23 | 2001-08-30 | G.D. Searle & Co. | Substituted N-Aliphatic-N-Aromatictertiary-Heteroalkylamines useful for inhibiting cholesteryl ester transfer protein activity |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1220440B (de) * | 1962-02-14 | 1966-07-07 | Sanol Arznei Schwarz Gmbh | Verfahren zur Herstellung von Derivaten des 1-(o-Bromphenoxy)-2-hydroxy-3-amino-propans und deren Saeureadditionssalzen |
| US3459782A (en) * | 1963-08-26 | 1969-08-05 | Boehringer Sohn Ingelheim | 1-substituted phenoxy-2-hydroxy-3-isopropylamino-propanes |
| CH465640A (de) * | 1964-09-10 | 1968-11-30 | Ciba Geigy | Verfahren zur Herstellung neuer Amine |
| NL6504268A (cg-RX-API-DMAC7.html) * | 1965-04-03 | 1966-10-04 | ||
| FR1547605A (fr) * | 1967-09-27 | 1968-11-29 | Amp Inc | Connecteurs pour fusibles en cartouches |
| CH512427A (de) * | 1967-12-18 | 1971-09-15 | Boehringer Sohn Ingelheim | Verfahren zur Herstellung von neuen racemischen oder optisch aktiven 1-Phenoxy-2-hydroxy-3-sec. -alkylaminopropanen |
| US3740444A (en) * | 1968-01-25 | 1973-06-19 | Boehringer Sohn Ingelheim | Therapeutic compositions and method |
| GB1285038A (en) * | 1969-02-21 | 1972-08-09 | Ici Ltd | Alkanolamine derivatives |
| US3639634A (en) * | 1969-03-06 | 1972-02-01 | Dow Chemical Co | Cardiac antiarrhythmic method and composition employing alkylamino-alkoxyhalophenol compounds |
| JPS4943947B1 (cg-RX-API-DMAC7.html) * | 1970-04-03 | 1974-11-25 | ||
| SE372762B (cg-RX-API-DMAC7.html) * | 1969-05-21 | 1975-01-13 | Haessle Ab | |
| SE354851B (cg-RX-API-DMAC7.html) * | 1970-02-18 | 1973-03-26 | Haessle Ab |
-
1972
- 1972-04-04 SE SE7204321A patent/SE384853B/xx unknown
-
1973
- 1973-01-01 AR AR250907A patent/AR204982A1/es active
- 1973-03-27 ZA ZA732119A patent/ZA732119B/xx unknown
- 1973-03-28 BE BE129334A patent/BE797414A/xx not_active IP Right Cessation
- 1973-04-03 NL NL7304606A patent/NL7304606A/xx not_active Application Discontinuation
- 1973-04-03 FI FI1026/73A patent/FI63741C/fi active
- 1973-04-03 ES ES413316A patent/ES413316A1/es not_active Expired
- 1973-04-03 CA CA167,812A patent/CA1017755A/en not_active Expired
- 1973-04-03 GB GB1584673A patent/GB1421824A/en not_active Expired
- 1973-04-03 FR FR7312015A patent/FR2179069B1/fr not_active Expired
- 1973-04-03 SU SU1907907A patent/SU533336A3/ru active
- 1973-04-03 IE IE520/73A patent/IE38302B1/xx unknown
- 1973-04-04 AT AT293873A patent/AT321276B/de active
- 1973-04-04 BR BR732430A patent/BR7302430D0/pt unknown
- 1973-04-04 JP JP48037950A patent/JPS5924971B2/ja not_active Expired
- 1973-04-04 DE DE2316727A patent/DE2316727C3/de not_active Expired
- 1973-04-04 CH CH481673A patent/CH587222A5/xx not_active IP Right Cessation
- 1973-04-04 US US05/347,625 patent/US3996382A/en not_active Expired - Lifetime
- 1973-04-04 CH CH238076A patent/CH587225A5/xx not_active IP Right Cessation
- 1973-04-04 CH CH237976A patent/CH587224A5/xx not_active IP Right Cessation
- 1973-04-04 NO NO1377/73A patent/NO139167C/no unknown
-
1975
- 1975-07-29 ES ES439803A patent/ES439803A1/es not_active Expired
- 1975-07-29 ES ES439804A patent/ES439804A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FI63741B (fi) | 1983-04-29 |
| FR2179069A1 (cg-RX-API-DMAC7.html) | 1973-11-16 |
| IE38302L (en) | 1973-10-04 |
| FR2179069B1 (cg-RX-API-DMAC7.html) | 1976-04-09 |
| GB1421824A (en) | 1976-01-21 |
| ZA732119B (en) | 1974-01-30 |
| DE2316727A1 (de) | 1974-01-10 |
| DE2316727C3 (de) | 1979-02-22 |
| AT321276B (de) | 1975-03-25 |
| ES439803A1 (es) | 1977-04-16 |
| DE2316727B2 (de) | 1978-06-22 |
| NO139167B (no) | 1978-10-09 |
| ES439804A1 (es) | 1977-04-16 |
| BR7302430D0 (pt) | 1974-02-07 |
| SE384853B (sv) | 1976-05-24 |
| AR204982A1 (es) | 1976-03-31 |
| CA1017755A (en) | 1977-09-20 |
| JPS4913129A (cg-RX-API-DMAC7.html) | 1974-02-05 |
| CH587224A5 (cg-RX-API-DMAC7.html) | 1977-04-29 |
| CH587225A5 (cg-RX-API-DMAC7.html) | 1977-04-29 |
| NO139167C (no) | 1979-01-17 |
| ES413316A1 (es) | 1976-06-01 |
| IE38302B1 (en) | 1978-02-15 |
| CH587222A5 (cg-RX-API-DMAC7.html) | 1977-04-29 |
| FI63741C (fi) | 1983-08-10 |
| JPS5924971B2 (ja) | 1984-06-13 |
| BE797414A (fr) | 1973-07-16 |
| NL7304606A (cg-RX-API-DMAC7.html) | 1973-10-08 |
| US3996382A (en) | 1976-12-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU533336A3 (ru) | Способ получени аминопропанолов,их солей или оптически-активных антиподов | |
| DE69321835T2 (de) | 7-(2-aminoethyl)-benzothiazolone | |
| NO870078L (no) | Diarylalkyl-substituerte alkylaminer, fremgangsmaate til deres fremstilling, deres anvendelse samt legemidler som inneholder dem. | |
| EP0470310A1 (en) | Novel benzopyrans and process for their production | |
| US2870151A (en) | Mqrpholine -ethers | |
| JPH0473432B2 (cg-RX-API-DMAC7.html) | ||
| SU1342415A3 (ru) | Способ получени производных пиридазина | |
| CS219944B2 (en) | Method of making the racemic and optically unite derivatives of the 1-phenyl-2-cyclohexen-1-alkylamine | |
| US3557127A (en) | Substituted cyclohexenes,derivatives thereof and processes for obtaining same | |
| EP0011447B1 (en) | Blood platelet aggregation inhibitory 1-benzyl-1,2,5,6-tetrahydropyridine-3-carboxylic acid derivatives and salts thereof; pharmaceutical compositions thereof; and analogy processes for the manufacture thereof | |
| US2355659A (en) | Piperidine derivatives and process for the manufacture of the same | |
| DE69105786T2 (de) | Harnstoffderivate, deren Herstellung sowie diese enthaltende pharmazeutische Zusammensetzungen. | |
| US3105854A (en) | Meta-substituted phenoxyethylamines | |
| US3247199A (en) | Diphenyl-methanes | |
| DK170233B1 (da) | Fremgangsmåde til fremstilling af alkoxymethylether- og alkoxymethylesterderivater af glyceroler | |
| US2628973A (en) | Aryloxyacetates of basically substituted arylakanols and derivatives thereof | |
| US3886167A (en) | 2-Aryl-6-trifluoromethyl-4-pyridylcarbinolamine antimalarials | |
| EP0420116B1 (en) | Novel substituted alkyl piperidines and their use as inhibitors of cholesterol synthesis | |
| FR2522000A1 (fr) | Nouvelles thiopyrannopyrimidines, utiles notamment comme agents hypoglycemiants, et leur fabrication | |
| US4416827A (en) | Process for the resolution of the racemate (1RS,2SR)-2-amino-1-phenyl-propan-1-ol | |
| NO154551B (no) | Analogifremgangsmaate til fremstilling av tiazolinderivater med terapeutisk virkning. | |
| EP0005091B1 (fr) | Nouvelles pipérazines monosubstituées, leurs procédés de préparation et les compositions pharmaceutiques les renfermant | |
| US4010280A (en) | Phenoxyalkylamine derivatives and preparation thereof | |
| EP0178073B1 (en) | Amide compounds, process for preparing the same and pharmaceutical compositions containing the same | |
| US2625566A (en) | Beta-(ortho-methoxy) phenyl-isopropyl benzyl alkyl amines and salts thereof |