SU496731A3 - Способ получени катионного радикала 1,1-дизамещенного 4,4бипиридили - Google Patents
Способ получени катионного радикала 1,1-дизамещенного 4,4бипиридилиInfo
- Publication number
- SU496731A3 SU496731A3 SU1616288A SU1616288A SU496731A3 SU 496731 A3 SU496731 A3 SU 496731A3 SU 1616288 A SU1616288 A SU 1616288A SU 1616288 A SU1616288 A SU 1616288A SU 496731 A3 SU496731 A3 SU 496731A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- solution
- dimethyl
- toluene
- reaction
- salt
- Prior art date
Links
- 238000000034 method Methods 0.000 title description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 65
- 239000000243 solution Substances 0.000 description 36
- 238000006243 chemical reaction Methods 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- 239000007864 aqueous solution Substances 0.000 description 18
- 150000003839 salts Chemical class 0.000 description 16
- 239000000203 mixture Substances 0.000 description 14
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 8
- 239000007800 oxidant agent Substances 0.000 description 7
- 230000003647 oxidation Effects 0.000 description 7
- 238000007254 oxidation reaction Methods 0.000 description 7
- QAIGYXWRIHZZAA-UHFFFAOYSA-M 1-methylpyridin-1-ium;chloride Chemical compound [Cl-].C[N+]1=CC=CC=C1 QAIGYXWRIHZZAA-UHFFFAOYSA-M 0.000 description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- 229910052760 oxygen Inorganic materials 0.000 description 6
- 239000001301 oxygen Substances 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 239000008346 aqueous phase Substances 0.000 description 5
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 5
- -1 image | baths Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- ROFVEXUMMXZLPA-UHFFFAOYSA-N Bipyridyl Chemical group N1=CC=CC=C1C1=CC=CC=N1 ROFVEXUMMXZLPA-UHFFFAOYSA-N 0.000 description 4
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 3
- MWVTWFVJZLCBMC-UHFFFAOYSA-N 4,4'-bipyridine Chemical group C1=NC=CC(C=2C=CN=CC=2)=C1 MWVTWFVJZLCBMC-UHFFFAOYSA-N 0.000 description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- ZRQWXZLJRJZNJO-UHFFFAOYSA-M 2-pyridin-1-ium-1-ylethanol;chloride Chemical compound [Cl-].OCC[N+]1=CC=CC=C1 ZRQWXZLJRJZNJO-UHFFFAOYSA-M 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical class C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- WWRCTCWJBIULBY-UHFFFAOYSA-N disodium oxygen(2-) hydrate Chemical compound O.[O-2].[Na+].[Na+] WWRCTCWJBIULBY-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000000523 sample Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- NACWJEQGDKTEKR-UHFFFAOYSA-M 1,1-dimethyl-4-pyridin-1-ium-4-yl-2h-pyridin-1-ium;dichloride Chemical compound [Cl-].[Cl-].C1=C[N+](C)(C)CC=C1C1=CC=[NH+]C=C1 NACWJEQGDKTEKR-UHFFFAOYSA-M 0.000 description 1
- ZITSIOCNMCGZQE-UHFFFAOYSA-N 2-(1,2-dihydropyridin-2-yl)pyridine Chemical group N1C=CC=CC1C1=CC=CC=N1 ZITSIOCNMCGZQE-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical group CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- ITQTTZVARXURQS-UHFFFAOYSA-N 3-methylpyridine Chemical compound CC1=CC=CN=C1 ITQTTZVARXURQS-UHFFFAOYSA-N 0.000 description 1
- PQVHMOLNSYFXIJ-UHFFFAOYSA-N 4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]pyrazole-3-carboxylic acid Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(N1CC2=C(CC1)NN=N2)=O)C(=O)O PQVHMOLNSYFXIJ-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- QPFYXYFORQJZEC-FOCLMDBBSA-N Phenazopyridine Chemical compound NC1=NC(N)=CC=C1\N=N\C1=CC=CC=C1 QPFYXYFORQJZEC-FOCLMDBBSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- HUMHYXGDUOGHTG-HEZXSMHISA-N alpha-D-GalpNAc-(1->3)-[alpha-L-Fucp-(1->2)]-D-Galp Chemical compound O[C@H]1[C@H](O)[C@H](O)[C@H](C)O[C@H]1O[C@@H]1[C@@H](O[C@@H]2[C@@H]([C@@H](O)[C@@H](O)[C@@H](CO)O2)NC(C)=O)[C@@H](O)[C@@H](CO)OC1O HUMHYXGDUOGHTG-HEZXSMHISA-N 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000001669 calcium Chemical class 0.000 description 1
- 229940075397 calomel Drugs 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 210000000085 cashmere Anatomy 0.000 description 1
- 230000001364 causal effect Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 125000004925 dihydropyridyl group Chemical group N1(CC=CC=C1)* 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- ZOMNIUBKTOKEHS-UHFFFAOYSA-L dimercury dichloride Chemical compound Cl[Hg][Hg]Cl ZOMNIUBKTOKEHS-UHFFFAOYSA-L 0.000 description 1
- XGZRAKBCYZIBKP-UHFFFAOYSA-L disodium;dihydroxide Chemical compound [OH-].[OH-].[Na+].[Na+] XGZRAKBCYZIBKP-UHFFFAOYSA-L 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910001416 lithium ion Inorganic materials 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229940043265 methyl isobutyl ketone Drugs 0.000 description 1
- 238000005191 phase separation Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- 229940070891 pyridium Drugs 0.000 description 1
- 150000004053 quinones Chemical class 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000012488 sample solution Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- CSMWJXBSXGUPGY-UHFFFAOYSA-L sodium dithionate Chemical compound [Na+].[Na+].[O-]S(=O)(=O)S([O-])(=O)=O CSMWJXBSXGUPGY-UHFFFAOYSA-L 0.000 description 1
- 229940075931 sodium dithionate Drugs 0.000 description 1
- JBJWASZNUJCEKT-UHFFFAOYSA-M sodium;hydroxide;hydrate Chemical compound O.[OH-].[Na+] JBJWASZNUJCEKT-UHFFFAOYSA-M 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- JSPLKZUTYZBBKA-UHFFFAOYSA-N trioxidane Chemical class OOO JSPLKZUTYZBBKA-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/06—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom
- C07D213/22—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom containing two or more pyridine rings directly linked together, e.g. bipyridyl
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB343370 | 1970-01-23 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU496731A3 true SU496731A3 (ru) | 1975-12-25 |
Family
ID=9758253
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1616288A SU496731A3 (ru) | 1970-01-23 | 1971-01-22 | Способ получени катионного радикала 1,1-дизамещенного 4,4бипиридили |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US3793335A (enExample) |
| JP (1) | JPS4911703B1 (enExample) |
| AT (1) | AT303038B (enExample) |
| BE (1) | BE761949R (enExample) |
| CA (1) | CA939353A (enExample) |
| CH (1) | CH566314A5 (enExample) |
| CS (1) | CS179914B2 (enExample) |
| DE (1) | DE2103047C3 (enExample) |
| DK (1) | DK141020B (enExample) |
| ES (1) | ES387565A1 (enExample) |
| FR (1) | FR2085576B2 (enExample) |
| GB (1) | GB1308561A (enExample) |
| HU (1) | HU163410B (enExample) |
| IE (1) | IE34875B1 (enExample) |
| IL (1) | IL36040A (enExample) |
| IT (1) | IT983086B (enExample) |
| NL (1) | NL167958C (enExample) |
| PL (1) | PL89667B1 (enExample) |
| SE (1) | SE383514B (enExample) |
| SU (1) | SU496731A3 (enExample) |
| YU (1) | YU35759B (enExample) |
| ZA (1) | ZA71256B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3899499A (en) * | 1968-07-01 | 1975-08-12 | Ici Ltd | Manufacture of bipyridylium salts |
| US3899500A (en) * | 1968-07-01 | 1975-08-12 | Ici Ltd | Manufacture of bipyridylium salts |
| US3905986A (en) * | 1970-03-05 | 1975-09-16 | Ici Ltd | Manufacture of 1,1-disubstituted-4,4-bipyridylium salts |
-
1970
- 1970-01-23 GB GB343370A patent/GB1308561A/en not_active Expired
-
1971
- 1971-01-14 IE IE40/71A patent/IE34875B1/xx unknown
- 1971-01-15 ZA ZA710256A patent/ZA71256B/xx unknown
- 1971-01-18 CA CA102,994A patent/CA939353A/en not_active Expired
- 1971-01-18 US US00107412A patent/US3793335A/en not_active Expired - Lifetime
- 1971-01-21 SE SE7100715A patent/SE383514B/xx unknown
- 1971-01-21 NL NL7100806A patent/NL167958C/xx not_active IP Right Cessation
- 1971-01-21 HU HUIE426A patent/HU163410B/hu unknown
- 1971-01-21 PL PL1971145761A patent/PL89667B1/pl unknown
- 1971-01-22 AT AT52671A patent/AT303038B/de not_active IP Right Cessation
- 1971-01-22 BE BE761949A patent/BE761949R/xx active
- 1971-01-22 YU YU156/71A patent/YU35759B/xx unknown
- 1971-01-22 CS CS7100000496A patent/CS179914B2/cs unknown
- 1971-01-22 DK DK29271AA patent/DK141020B/da unknown
- 1971-01-22 FR FR717102243A patent/FR2085576B2/fr not_active Expired
- 1971-01-22 DE DE2103047A patent/DE2103047C3/de not_active Expired
- 1971-01-22 SU SU1616288A patent/SU496731A3/ru active
- 1971-01-22 JP JP46001627A patent/JPS4911703B1/ja active Pending
- 1971-01-22 IL IL36040A patent/IL36040A/xx unknown
- 1971-01-23 IT IT19708/71A patent/IT983086B/it active
- 1971-01-23 ES ES387565A patent/ES387565A1/es not_active Expired
- 1971-01-25 CH CH108171A patent/CH566314A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DK141020B (da) | 1979-12-24 |
| GB1308561A (en) | 1973-02-21 |
| IE34875L (en) | 1971-07-23 |
| FR2085576B2 (enExample) | 1973-06-08 |
| FR2085576A2 (enExample) | 1971-12-24 |
| IE34875B1 (en) | 1975-09-03 |
| ZA71256B (en) | 1971-10-27 |
| JPS4911703B1 (enExample) | 1974-03-19 |
| NL167958B (nl) | 1981-09-16 |
| HU163410B (enExample) | 1973-08-28 |
| CH566314A5 (enExample) | 1975-09-15 |
| CS179914B2 (en) | 1977-12-30 |
| PL89667B1 (enExample) | 1976-12-31 |
| CA939353A (en) | 1974-01-01 |
| YU15671A (en) | 1980-12-31 |
| US3793335A (en) | 1974-02-19 |
| BE761949R (fr) | 1971-07-22 |
| DE2103047A1 (de) | 1971-07-29 |
| ES387565A1 (es) | 1973-05-01 |
| AT303038B (de) | 1972-11-10 |
| SE383514B (sv) | 1976-03-15 |
| IT983086B (it) | 1974-10-31 |
| IL36040A (en) | 1974-11-29 |
| DK141020C (enExample) | 1980-06-09 |
| YU35759B (en) | 1981-06-30 |
| NL167958C (nl) | 1982-02-16 |
| IL36040A0 (en) | 1971-03-24 |
| NL7100806A (enExample) | 1971-07-27 |
| DE2103047C3 (de) | 1981-01-15 |
| DE2103047B2 (de) | 1980-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Hardt et al. | Fluorescence thermochromism of pyridine copper iodides and copper iodide | |
| SU496731A3 (ru) | Способ получени катионного радикала 1,1-дизамещенного 4,4бипиридили | |
| Schumb et al. | The measurement of the molal ferric-ferrous electrode potential | |
| CN109320535B (zh) | 一种检测Cu2+的比率型荧光探针、其制备方法及应用 | |
| US3770735A (en) | Ferroin reagent and method of making same | |
| Bolzan et al. | Hydrolytic equilibria of metallic ions—I The hydrolysis of Co (II) ion in NaClO4 solution | |
| Feigl et al. | Ultramicro detection of iodine in inorganic and organic compounds | |
| CN107831165B (zh) | 一种双通道铜离子检测试纸及其制备方法 | |
| SU879416A1 (ru) | Способ определени гумусовых веществ | |
| DE68908761T2 (de) | Monopersulfate von stickstoffenthaltenden heterocyclischen Polypercarbonsäuren. | |
| US743668A (en) | Extracting chromium from chrome-iron ore. | |
| US3793319A (en) | Manufacture of 1,1'-disubstituted-4,4'-bipyridylium salts | |
| SU509222A3 (ru) | Способ получени солей 1,11-дизамещенного4,41-дипиридили | |
| Gerry et al. | Extension of the Willgerodt Reaction | |
| SU893866A1 (ru) | Способ определени металлического натри в гидриде натри | |
| SU1343350A1 (ru) | Способ количественного определени циануровой кислоты | |
| IL32455A (en) | Manufacture of bipyridylium salts | |
| SU883735A1 (ru) | Способ качественного определени дифенилтиомочевины | |
| SU850591A1 (ru) | Способ качественного определени ВиСМуТА | |
| Low et al. | Homosolvolysis | |
| SU280976A1 (ru) | Способ определения металлического железа в присутствии его моносульфидов | |
| Hennig et al. | The thermal behaviour of mon-oxalato-bis-bipyridine-cobalt (III) complexes | |
| SU400089A1 (ru) | СПОСОБ ПОЛУЧЕНИЯ 1,Г-ДВУЗАМЕЩЕННЫХ 4,4'-БИПИРИДИЛОВЫХ СОЛЕЙИзвестен способ получени солей 4,4'-би- пирндилов из самого пиридина под действием галоидных алкнлов. Использование цианамидов дл восстановлени Ы-замещенных пиридиновых солей привело к получению новых бипиридиловых солей, обладающих гербицид- ными свойствами.Иредлагаемый способ получени 1,1'-дву- замещенных 4,4'-бипнридиловых солей заключаетс в том, что на N-замещенную пиридиновую соль общей формулы2 | |
| DE1933419B2 (de) | Verfahren zur Herstellung eines l,r-Dimethyl-4,4'-bipyridyliumsalzes | |
| SU938145A1 (ru) | Способ растворени кислородсодержащих вольфрамовых бронз |