YU35759B - Process for preparing 1,1-dimethyl-4,4-bipyridylium salts - Google Patents
Process for preparing 1,1-dimethyl-4,4-bipyridylium saltsInfo
- Publication number
- YU35759B YU35759B YU156/71A YU15671A YU35759B YU 35759 B YU35759 B YU 35759B YU 156/71 A YU156/71 A YU 156/71A YU 15671 A YU15671 A YU 15671A YU 35759 B YU35759 B YU 35759B
- Authority
- YU
- Yugoslavia
- Prior art keywords
- dimethyl
- preparing
- bipyridylium salts
- bipyridylium
- salts
- Prior art date
Links
- JCCUZZFWTDQXCL-UHFFFAOYSA-N 4-(1,1-dimethyl-2H-pyridin-1-ium-4-yl)pyridine Chemical class C1=C[N+](C)(C)CC=C1C1=CC=NC=C1 JCCUZZFWTDQXCL-UHFFFAOYSA-N 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/06—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom
- C07D213/22—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom containing only hydrogen and carbon atoms in addition to the ring nitrogen atom containing two or more pyridine rings directly linked together, e.g. bipyridyl
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB343370 | 1970-01-23 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| YU15671A YU15671A (en) | 1980-12-31 |
| YU35759B true YU35759B (en) | 1981-06-30 |
Family
ID=9758253
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| YU156/71A YU35759B (en) | 1970-01-23 | 1971-01-22 | Process for preparing 1,1-dimethyl-4,4-bipyridylium salts |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US3793335A (enExample) |
| JP (1) | JPS4911703B1 (enExample) |
| AT (1) | AT303038B (enExample) |
| BE (1) | BE761949R (enExample) |
| CA (1) | CA939353A (enExample) |
| CH (1) | CH566314A5 (enExample) |
| CS (1) | CS179914B2 (enExample) |
| DE (1) | DE2103047C3 (enExample) |
| DK (1) | DK141020B (enExample) |
| ES (1) | ES387565A1 (enExample) |
| FR (1) | FR2085576B2 (enExample) |
| GB (1) | GB1308561A (enExample) |
| HU (1) | HU163410B (enExample) |
| IE (1) | IE34875B1 (enExample) |
| IL (1) | IL36040A (enExample) |
| IT (1) | IT983086B (enExample) |
| NL (1) | NL167958C (enExample) |
| PL (1) | PL89667B1 (enExample) |
| SE (1) | SE383514B (enExample) |
| SU (1) | SU496731A3 (enExample) |
| YU (1) | YU35759B (enExample) |
| ZA (1) | ZA71256B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3899499A (en) * | 1968-07-01 | 1975-08-12 | Ici Ltd | Manufacture of bipyridylium salts |
| US3899500A (en) * | 1968-07-01 | 1975-08-12 | Ici Ltd | Manufacture of bipyridylium salts |
| US3905986A (en) * | 1970-03-05 | 1975-09-16 | Ici Ltd | Manufacture of 1,1-disubstituted-4,4-bipyridylium salts |
-
1970
- 1970-01-23 GB GB343370A patent/GB1308561A/en not_active Expired
-
1971
- 1971-01-14 IE IE40/71A patent/IE34875B1/xx unknown
- 1971-01-15 ZA ZA710256A patent/ZA71256B/xx unknown
- 1971-01-18 US US00107412A patent/US3793335A/en not_active Expired - Lifetime
- 1971-01-18 CA CA102,994A patent/CA939353A/en not_active Expired
- 1971-01-21 SE SE7100715A patent/SE383514B/xx unknown
- 1971-01-21 NL NL7100806A patent/NL167958C/xx not_active IP Right Cessation
- 1971-01-21 HU HUIE426A patent/HU163410B/hu unknown
- 1971-01-21 PL PL1971145761A patent/PL89667B1/pl unknown
- 1971-01-22 FR FR717102243A patent/FR2085576B2/fr not_active Expired
- 1971-01-22 DK DK29271AA patent/DK141020B/da unknown
- 1971-01-22 JP JP46001627A patent/JPS4911703B1/ja active Pending
- 1971-01-22 SU SU1616288A patent/SU496731A3/ru active
- 1971-01-22 IL IL36040A patent/IL36040A/xx unknown
- 1971-01-22 AT AT52671A patent/AT303038B/de not_active IP Right Cessation
- 1971-01-22 YU YU156/71A patent/YU35759B/xx unknown
- 1971-01-22 DE DE2103047A patent/DE2103047C3/de not_active Expired
- 1971-01-22 CS CS7100000496A patent/CS179914B2/cs unknown
- 1971-01-22 BE BE761949A patent/BE761949R/xx active
- 1971-01-23 ES ES387565A patent/ES387565A1/es not_active Expired
- 1971-01-23 IT IT19708/71A patent/IT983086B/it active
- 1971-01-25 CH CH108171A patent/CH566314A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| HU163410B (enExample) | 1973-08-28 |
| IL36040A0 (en) | 1971-03-24 |
| DE2103047B2 (de) | 1980-04-30 |
| ZA71256B (en) | 1971-10-27 |
| CA939353A (en) | 1974-01-01 |
| PL89667B1 (enExample) | 1976-12-31 |
| CH566314A5 (enExample) | 1975-09-15 |
| IE34875L (en) | 1971-07-23 |
| JPS4911703B1 (enExample) | 1974-03-19 |
| NL7100806A (enExample) | 1971-07-27 |
| FR2085576B2 (enExample) | 1973-06-08 |
| US3793335A (en) | 1974-02-19 |
| SU496731A3 (ru) | 1975-12-25 |
| IE34875B1 (en) | 1975-09-03 |
| BE761949R (fr) | 1971-07-22 |
| YU15671A (en) | 1980-12-31 |
| NL167958C (nl) | 1982-02-16 |
| FR2085576A2 (enExample) | 1971-12-24 |
| SE383514B (sv) | 1976-03-15 |
| IT983086B (it) | 1974-10-31 |
| NL167958B (nl) | 1981-09-16 |
| CS179914B2 (en) | 1977-12-30 |
| DE2103047C3 (de) | 1981-01-15 |
| AT303038B (de) | 1972-11-10 |
| DK141020B (da) | 1979-12-24 |
| IL36040A (en) | 1974-11-29 |
| DK141020C (enExample) | 1980-06-09 |
| GB1308561A (en) | 1973-02-21 |
| DE2103047A1 (de) | 1971-07-29 |
| ES387565A1 (es) | 1973-05-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| YU48171A (en) | Process for preparing n-(1,1,1-trisubstituted)-methylazoles | |
| YU254979A (en) | Process for preparing new 3,4-dihydrocarbostyryl-derivatives | |
| YU18471A (en) | Process for preparing novel 1,4-dihydropyridines | |
| HU173507B (hu) | Sposob poluchenija proizvodnykh 11,15-bis-tetragidro-piraniloksi-omega-tetrano-16-fenoksi-prostaglandina | |
| YU1971A (en) | Process for preparing 1,2,3,4-tetrahydro-4-phenylisoquinoline derivatives | |
| YU34884B (en) | Process for preparing 1,2,3-tiadiazole derivatives | |
| YU128373A (en) | Process for preparing 6-phenyl-substituted 3-methyl-4-amino-5h-1,2,4-triazine-5-ones | |
| YU35760B (en) | Process for preparing 1,1-dimethyl-4,4-bipyridylium salts | |
| YU196371A (en) | Process for preparing 3,4-dideoxkanamycin b | |
| YU35759B (en) | Process for preparing 1,1-dimethyl-4,4-bipyridylium salts | |
| YU292273A (en) | Process for obtaining 1,2-dialkyl-3,5-diphenyl-pyrazolium salts | |
| YU168569A (en) | Process for preparing 1,1-dimethyl-4,4-bipyridinium salts | |
| YU35589B (en) | Process for preparing novel oxo-3-dihydro-2,3-benzoxazine -1,4 derivatives | |
| YU248971A (en) | Process for preparing 1-aminoalkane-1,1-diphosphic acids | |
| YU254970A (en) | Process for preparing 1,1-dimethyl-4,4-bipyridylium salts | |
| IL35951A0 (en) | Method for preparing 1,3,4-thiadiazol-2-ylureas | |
| YU81569A (en) | Process for preparing 1,1-dimethyl-4,4-bipyridylium salts | |
| YU34403B (en) | Process for preparing 1,1-dimethyl-4,4-bipyridylium salts | |
| YU34592B (en) | Process for preparing 1,2-delta-methylene-6,7-delta-difluoro-methylene-20-spirox-4-en-3-one | |
| YU267871A (en) | Process for preparing 2,4-diamino-5-benzylpyrimidines | |
| YU248678A (en) | Process for preparing 1-73-cyano-3,3-diarylpropyl)-4-phenylpiperidine derivatives | |
| ZA712725B (en) | Substituted alkanol-thio-alkyl-amines and salts thereof as well as a method for preparing same | |
| YU277871A (en) | Process for preparing 2,3-dihydro-benzodiazepines | |
| YU237070A (en) | Process for preparing 4,5,6,7-tetrahydrobenzotriazoles | |
| YU206470A (en) | Process for preparing 4,5,6,7-tetrahydro-indazoles |