SU482044A3 - Способ получени 4-или 5-нитромидазолов - Google Patents
Способ получени 4-или 5-нитромидазоловInfo
- Publication number
- SU482044A3 SU482044A3 SU1878870A SU1878870A SU482044A3 SU 482044 A3 SU482044 A3 SU 482044A3 SU 1878870 A SU1878870 A SU 1878870A SU 1878870 A SU1878870 A SU 1878870A SU 482044 A3 SU482044 A3 SU 482044A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- formula
- compound
- hydrogen
- group
- acid
- Prior art date
Links
- 238000000034 method Methods 0.000 title description 7
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 150000001875 compounds Chemical class 0.000 description 12
- 239000001257 hydrogen Substances 0.000 description 11
- 229910052739 hydrogen Inorganic materials 0.000 description 11
- 125000000217 alkyl group Chemical group 0.000 description 9
- -1 sulfonyl ester Chemical class 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 7
- 239000002585 base Substances 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 5
- 125000003118 aryl group Chemical group 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 150000002431 hydrogen Chemical group 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 150000001555 benzenes Chemical group 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 125000002883 imidazolyl group Chemical group 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 125000004434 sulfur atom Chemical group 0.000 description 3
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 150000001335 aliphatic alkanes Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 125000001072 heteroaryl group Chemical group 0.000 description 2
- 150000002460 imidazoles Chemical class 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M potassium hydroxide Inorganic materials [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 2
- 125000003396 thiol group Chemical group [H]S* 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- NLVXSWCKKBEXTG-UHFFFAOYSA-N vinylsulfonic acid Chemical compound OS(=O)(=O)C=C NLVXSWCKKBEXTG-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- AVQQQNCBBIEMEU-UHFFFAOYSA-N 1,1,3,3-tetramethylurea Chemical compound CN(C)C(=O)N(C)C AVQQQNCBBIEMEU-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- RSOPCRYPVDDVAX-UHFFFAOYSA-N 1-methyl-2-methylsulfonyl-5-nitroimidazole Chemical compound CN1C([N+]([O-])=O)=CN=C1S(C)(=O)=O RSOPCRYPVDDVAX-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- 229940093475 2-ethoxyethanol Drugs 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- BAJQRLZAPXASRD-UHFFFAOYSA-N 4-Nitrobiphenyl Chemical compound C1=CC([N+](=O)[O-])=CC=C1C1=CC=CC=C1 BAJQRLZAPXASRD-UHFFFAOYSA-N 0.000 description 1
- 150000004960 4-nitroimidazoles Chemical class 0.000 description 1
- NVKJOXRVEKMMHS-UHFFFAOYSA-N 5-nitro-1,2,4-triazol-3-one Chemical compound [O-][N+](=O)C1=NC(=O)N=N1 NVKJOXRVEKMMHS-UHFFFAOYSA-N 0.000 description 1
- 150000004958 5-nitroimidazoles Chemical class 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical group CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- YOMFVLRTMZWACQ-UHFFFAOYSA-N ethyltrimethylammonium Chemical group CC[N+](C)(C)C YOMFVLRTMZWACQ-UHFFFAOYSA-N 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- PMRYVIKBURPHAH-UHFFFAOYSA-N methimazole Chemical compound CN1C=CNC1=S PMRYVIKBURPHAH-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- REXKPAQQPPFLNY-UHFFFAOYSA-N n,n-diethylethanamine;n,n-dimethylmethanamine Chemical compound CN(C)C.CCN(CC)CC REXKPAQQPPFLNY-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000004043 oxo group Chemical group O=* 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 230000001766 physiological effect Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 125000000464 thioxo group Chemical group S=* 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/91—Nitro radicals
- C07D233/92—Nitro radicals attached in position 4 or 5
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/70—One oxygen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH181072A CH570399A5 (en) | 1972-02-08 | 1972-02-08 | 4-or-5-nitro-imidazole derivs - with antibacterial, antiprotozoal and anthelmintic activity |
| CH1886772 | 1972-12-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU482044A3 true SU482044A3 (ru) | 1975-08-25 |
Family
ID=25688733
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1878870A SU482044A3 (ru) | 1972-02-08 | 1973-02-02 | Способ получени 4-или 5-нитромидазолов |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3914248A (enExample) |
| JP (1) | JPS4886867A (enExample) |
| AR (2) | AR205433A1 (enExample) |
| AT (1) | AT320639B (enExample) |
| BE (1) | BE795068A (enExample) |
| BG (2) | BG19803A3 (enExample) |
| CA (1) | CA1018982A (enExample) |
| DD (1) | DD106039A5 (enExample) |
| DE (1) | DE2304508A1 (enExample) |
| EG (1) | EG11076A (enExample) |
| FR (1) | FR2181707B1 (enExample) |
| GB (1) | GB1392015A (enExample) |
| HU (1) | HU166379B (enExample) |
| IE (1) | IE37253B1 (enExample) |
| IL (1) | IL41413A (enExample) |
| NL (1) | NL7301602A (enExample) |
| NO (1) | NO137275B (enExample) |
| OA (1) | OA04651A (enExample) |
| PH (1) | PH11056A (enExample) |
| SU (1) | SU482044A3 (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH592653A5 (enExample) * | 1973-09-24 | 1977-10-31 | Ciba Geigy Ag | |
| FR2300563A1 (fr) * | 1975-02-13 | 1976-09-10 | Sandoz Sa | Nouveaux derives du thiazole, leur preparation et leur application comme medicaments |
| US5057613A (en) * | 1986-05-06 | 1991-10-15 | Merrell Dow Pharmaceuticals | Novel thione dopamine beta hydroxylase inhibitors |
| FR2680791B1 (fr) * | 1991-08-30 | 1994-09-09 | Bp Chemicals Snc | Procede de fabrication d'un polymere reticule et utilisation du polymere. |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3642836A (en) * | 1969-02-03 | 1972-02-15 | Searle & Co | N-(2-(2-methyl-5-nitro-1-imidazolyl)ethyl)imides |
| IL39283A (en) * | 1971-05-03 | 1976-01-30 | Ciba Geigy Ag | Substituted 2-oxo or thioxo-3-(5-nitro-imidazol-2-yl)-tetrahydroimidazoles and their manufacture |
-
0
- BE BE795068D patent/BE795068A/xx unknown
-
1973
- 1973-01-01 AR AR246475A patent/AR205433A1/es active
- 1973-01-26 IE IE130/73A patent/IE37253B1/xx unknown
- 1973-01-29 IL IL41413A patent/IL41413A/en unknown
- 1973-01-31 DE DE2304508A patent/DE2304508A1/de active Pending
- 1973-01-31 US US328816*A patent/US3914248A/en not_active Expired - Lifetime
- 1973-01-31 CA CA162,478A patent/CA1018982A/en not_active Expired
- 1973-02-02 NO NO439/73A patent/NO137275B/no unknown
- 1973-02-02 SU SU1878870A patent/SU482044A3/ru active
- 1973-02-05 NL NL7301602A patent/NL7301602A/xx unknown
- 1973-02-06 BG BG022636A patent/BG19803A3/xx unknown
- 1973-02-06 DD DD168733A patent/DD106039A5/xx unknown
- 1973-02-06 FR FR7304100A patent/FR2181707B1/fr not_active Expired
- 1973-02-06 BG BG023406A patent/BG19804A3/xx unknown
- 1973-02-06 AT AT103973A patent/AT320639B/de not_active IP Right Cessation
- 1973-02-06 PH PH14314A patent/PH11056A/en unknown
- 1973-02-07 HU HUCI1338A patent/HU166379B/hu unknown
- 1973-02-07 OA OA54827A patent/OA04651A/xx unknown
- 1973-02-08 GB GB624573A patent/GB1392015A/en not_active Expired
- 1973-02-08 EG EG50/73A patent/EG11076A/xx active
- 1973-02-08 JP JP48015231A patent/JPS4886867A/ja active Pending
- 1973-11-05 AR AR250842A patent/AR208880A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| IL41413A0 (en) | 1973-03-30 |
| BG19803A3 (bg) | 1975-10-10 |
| HU166379B (enExample) | 1975-03-28 |
| EG11076A (en) | 1976-11-30 |
| OA04651A (fr) | 1980-07-31 |
| FR2181707A1 (enExample) | 1973-12-07 |
| AT320639B (de) | 1975-02-25 |
| CA1018982A (en) | 1977-10-11 |
| DE2304508A1 (de) | 1973-08-16 |
| US3914248A (en) | 1975-10-21 |
| AR205433A1 (es) | 1976-05-07 |
| NO137275B (no) | 1977-10-24 |
| GB1392015A (en) | 1975-04-23 |
| BE795068A (fr) | 1973-08-07 |
| IE37253L (en) | 1973-08-08 |
| PH11056A (en) | 1977-10-25 |
| JPS4886867A (enExample) | 1973-11-15 |
| DD106039A5 (enExample) | 1974-05-20 |
| BG19804A3 (bg) | 1975-10-10 |
| FR2181707B1 (enExample) | 1976-04-09 |
| IE37253B1 (en) | 1977-06-08 |
| AR208880A1 (es) | 1977-03-15 |
| IL41413A (en) | 1976-11-30 |
| NL7301602A (enExample) | 1973-08-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR960000047B1 (ko) | 2-(2-피리딜메틸설피닐)벤즈이미다졸 화합물의 제조방법 | |
| RU2086542C1 (ru) | Серосодержащие производные имидазола, способ их получения, новые промежуточные соединения и фармацевтическая композиция | |
| NO160781B (no) | 1,2,5-tiadiazolderivater. | |
| JP2556722B2 (ja) | 新規なスルホンアミド化合物 | |
| EP0449203B1 (en) | 4-Phenylphthalazine derivatives | |
| SU482044A3 (ru) | Способ получени 4-или 5-нитромидазолов | |
| CS250248B2 (en) | Method of imidazole's tricyclic derivatives production | |
| IE55946B1 (en) | Thioethercyanoguanidines and their use as intermediates in producing imidazoles | |
| US4888338A (en) | 5-Methoxy alkyl ammonium tetrahydrofurans and tetrahydrothiophenes as anti-PAF agents | |
| NO743980L (enExample) | ||
| GB2032434A (en) | New Process for the Preparation of 6-piperidino-2,4- diaminopyrimidine-3-oxide | |
| SU1227111A3 (ru) | Способ получени производных гуанидина или их таутомерных соединений или их солей | |
| EP0080739A2 (en) | Process for preparing cimetidine | |
| CS236483B2 (en) | Method of 5,6,7,7a-tetrahydro-4h-thieno-(3,2-c)-2-pyridinone derivatives production | |
| US4160828A (en) | Analgesic phosphinyl compounds and compositions | |
| EP0018732B1 (en) | An alpha-methyl-4(2'-thienyl-carbonyl)phenyl acetic acid derivative, process for its preparation and its pharmaceutical use | |
| CS200213B2 (en) | Method of preparing indazole derivatives | |
| US5086000A (en) | Process for the preparation of alkylene-bis(2-pyridylamine) compounds and karl fischer reagents and methods utilizing such compounds | |
| SU890973A3 (ru) | Способ получени рацемических или оптически активных полупростаноидгликозидов или -тиогликозидов | |
| US4837350A (en) | Process for the preparation of benzoin sulfonates | |
| SU501670A3 (ru) | Способ получени производных циклопентено-хинолона | |
| SU461510A3 (ru) | Способ получени эфиров алкилсульфоновых кислот 1,3,2-оксазафосфациклических соединений | |
| SU593666A3 (ru) | Способ получени производных пиперидина или их солей | |
| US6022980A (en) | Preparation of 4-halo and 6-halomelatonins | |
| US4681943A (en) | 1-acyl-1-(2-pyridinyl)semicarbazides |