SU433681A3 - Способ получения 1,2.4^триазин-5-онов - Google Patents
Способ получения 1,2.4^триазин-5-оновInfo
- Publication number
- SU433681A3 SU433681A3 SU1814625A SU1814625A SU433681A3 SU 433681 A3 SU433681 A3 SU 433681A3 SU 1814625 A SU1814625 A SU 1814625A SU 1814625 A SU1814625 A SU 1814625A SU 433681 A3 SU433681 A3 SU 433681A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- mol
- ethyl
- triazin
- solution
- phenyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title description 12
- 239000000243 solution Substances 0.000 description 30
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 18
- -1 cyckyl Chemical group 0.000 description 17
- 239000002904 solvent Substances 0.000 description 17
- 238000003756 stirring Methods 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- 239000002253 acid Substances 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- 125000003118 aryl group Chemical group 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 125000003342 alkenyl group Chemical group 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 125000000753 cycloalkyl group Chemical group 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 4
- HHLFWLYXYJOTON-UHFFFAOYSA-N Glyoxylic acid Natural products OC(=O)C=O HHLFWLYXYJOTON-UHFFFAOYSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 4
- 125000003710 aryl alkyl group Chemical group 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- LRDJLICCIZGMSB-UHFFFAOYSA-N ethenyldiazene Chemical class C=CN=N LRDJLICCIZGMSB-UHFFFAOYSA-N 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 125000000547 substituted alkyl group Chemical group 0.000 description 4
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 150000002168 ethanoic acid esters Chemical class 0.000 description 3
- 125000004494 ethyl ester group Chemical group 0.000 description 3
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 3
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 3
- 238000001665 trituration Methods 0.000 description 3
- 150000003920 1,2,4-triazines Chemical class 0.000 description 2
- QMNWYGTWTXOQTP-UHFFFAOYSA-N 1h-triazin-6-one Chemical compound O=C1C=CN=NN1 QMNWYGTWTXOQTP-UHFFFAOYSA-N 0.000 description 2
- PZKXJBJRDHCSGW-UHFFFAOYSA-N 2-(1-chloropropylidenehydrazinylidene)-2-phenylacetyl chloride Chemical compound C1(=CC=CC=C1)C(=NN=C(CC)Cl)C(=O)Cl PZKXJBJRDHCSGW-UHFFFAOYSA-N 0.000 description 2
- BFNNILAMSKQDRN-UHFFFAOYSA-N 2h-1,2,4-triazin-5-one Chemical class O=C1C=NNC=N1 BFNNILAMSKQDRN-UHFFFAOYSA-N 0.000 description 2
- PGXRPCZXSVQWPW-UHFFFAOYSA-N 4-amino-6-tert-butyl-2-ethyl-3H-1,2,4-triazin-5-one Chemical compound C(C)N1N=C(C(N(C1)N)=O)C(C)(C)C PGXRPCZXSVQWPW-UHFFFAOYSA-N 0.000 description 2
- VVJKKWFAADXIJK-UHFFFAOYSA-N Allylamine Chemical compound NCC=C VVJKKWFAADXIJK-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000005036 alkoxyphenyl group Chemical group 0.000 description 2
- 125000005037 alkyl phenyl group Chemical group 0.000 description 2
- 125000000304 alkynyl group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 235000014121 butter Nutrition 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- KKRQYQQLGVANLL-UHFFFAOYSA-N ethyl 2-(1-chloropropylidenehydrazinylidene)-2-phenylacetate Chemical compound CCC(Cl)=NN=C(C(=O)OCC)C1=CC=CC=C1 KKRQYQQLGVANLL-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- QKLCQKPAECHXCQ-UHFFFAOYSA-N ethyl phenylglyoxylate Chemical compound CCOC(=O)C(=O)C1=CC=CC=C1 QKLCQKPAECHXCQ-UHFFFAOYSA-N 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 125000003884 phenylalkyl group Chemical group 0.000 description 2
- FAQJJMHZNSSFSM-UHFFFAOYSA-N phenylglyoxylic acid Chemical compound OC(=O)C(=O)C1=CC=CC=C1 FAQJJMHZNSSFSM-UHFFFAOYSA-N 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- XULSZEJIHQWWEB-UHFFFAOYSA-N 1,2,4-triazin-5-amine Chemical compound NC1=CN=NC=N1 XULSZEJIHQWWEB-UHFFFAOYSA-N 0.000 description 1
- KFCLOPRWEZEAJG-UHFFFAOYSA-N 1,3-diazete Chemical compound C1=NC=N1 KFCLOPRWEZEAJG-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ROFVGYAMRSGUSQ-UHFFFAOYSA-N 1-(2-bromoethyl)piperazine;hydrobromide Chemical compound Br.BrCCN1CCNCC1 ROFVGYAMRSGUSQ-UHFFFAOYSA-N 0.000 description 1
- RSFGQHXMDKOHRA-UHFFFAOYSA-N 3-ethyl-4-methyl-6-phenyl-1,2,4-triazin-5-one Chemical compound O=C1N(C)C(CC)=NN=C1C1=CC=CC=C1 RSFGQHXMDKOHRA-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- MYRZHMIBRIKWDO-UHFFFAOYSA-N 4h-triazin-5-one Chemical compound O=C1CN=NN=C1 MYRZHMIBRIKWDO-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 101100490437 Mus musculus Acvrl1 gene Proteins 0.000 description 1
- BFBYTZBZEZHFGT-UHFFFAOYSA-N N#CC=NN=CCl Chemical class N#CC=NN=CCl BFBYTZBZEZHFGT-UHFFFAOYSA-N 0.000 description 1
- CIPIAPNWTLWNSY-UHFFFAOYSA-N N-(methylideneamino)propan-1-imine Chemical compound C(C)C=NN=C CIPIAPNWTLWNSY-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- OFLXLNCGODUUOT-UHFFFAOYSA-N acetohydrazide Chemical compound C\C(O)=N\N OFLXLNCGODUUOT-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000012320 chlorinating reagent Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- JFYKIEHOOZWARC-UHFFFAOYSA-N cyclopropanecarbohydrazide Chemical compound NNC(=O)C1CC1 JFYKIEHOOZWARC-UHFFFAOYSA-N 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- FSFFJEWAYWRLFT-UHFFFAOYSA-N ethyl 2-(4-methoxyphenyl)-2-oxoacetate Chemical group CCOC(=O)C(=O)C1=CC=C(OC)C=C1 FSFFJEWAYWRLFT-UHFFFAOYSA-N 0.000 description 1
- 229940014425 exodus Drugs 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- NBHLEUNJGNIKRR-UHFFFAOYSA-N n-(methylideneamino)methanimine Chemical compound C=NN=C NBHLEUNJGNIKRR-UHFFFAOYSA-N 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 239000003495 polar organic solvent Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 238000012958 reprocessing Methods 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/64—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with three nitrogen atoms as the only ring hetero atoms
- A01N43/707—1,2,3- or 1,2,4-triazines; Hydrogenated 1,2,3- or 1,2,4-triazines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D253/00—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00
- C07D253/02—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00 not condensed with other rings
- C07D253/06—1,2,4-Triazines
- C07D253/065—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members
- C07D253/07—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members with hetero atoms, or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Dentistry (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Plant Pathology (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2138031A DE2138031C3 (de) | 1971-07-29 | 1971-07-29 | Verfahren zur Herstellung von 1.2.4-Triazin-5-onen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU433681A3 true SU433681A3 (ru) | 1974-06-25 |
Family
ID=5815225
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1814625A SU433681A3 (ru) | 1971-07-29 | 1972-07-26 | Способ получения 1,2.4^триазин-5-онов |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US3910909A (enExample) |
| JP (2) | JPS5626666B1 (enExample) |
| BE (1) | BE786840A (enExample) |
| BR (1) | BR7205073D0 (enExample) |
| CH (1) | CH582682A5 (enExample) |
| CS (1) | CS167996B2 (enExample) |
| DD (2) | DD110043A5 (enExample) |
| DE (1) | DE2138031C3 (enExample) |
| FR (1) | FR2147748A5 (enExample) |
| GB (1) | GB1357852A (enExample) |
| HU (1) | HU164712B (enExample) |
| IL (1) | IL40005A (enExample) |
| IT (1) | IT963443B (enExample) |
| NL (1) | NL7210467A (enExample) |
| PL (1) | PL89679B1 (enExample) |
| RO (2) | RO62510A (enExample) |
| SU (1) | SU433681A3 (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2224161A1 (de) * | 1972-05-18 | 1973-11-29 | Bayer Ag | Selektiv herbizide mittel |
| DE2346936C2 (de) * | 1973-09-18 | 1982-05-06 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von neuen 3,4-Dihydro-1,2,4-triazinen sowie drei Verbindungen dieses Typs und deren Verwendung |
| JPS5424444B2 (enExample) * | 1975-01-21 | 1979-08-21 | ||
| DE2527490A1 (de) * | 1975-06-20 | 1976-12-30 | Basf Ag | 1,2,4-dihydrotriazin-4-oxide und verfahren zu ihrer herstellung |
| DE2528285A1 (de) * | 1975-06-25 | 1977-01-20 | Basf Ag | Verfahren zur herstellung von 1,2,4-dihydrotriazin-4-oxid-spiro- (3,1')- eckige klammer auf oximino- (2')-cycloalkanen eckige klammer zu |
| DE2537290A1 (de) * | 1975-08-21 | 1977-03-03 | Bayer Ag | Mittel zur selektiven unkrautbekaempfung in rueben |
| NZ186511A (en) * | 1977-03-19 | 1980-11-14 | Smith Kline French Lab | 3-substituted alkylamino-6-substituted alkyl-1,2,4-triazin-5-ones and pharmaceutical compositions 3-substituted thio-1,2,4-triazin-5-ones |
| GR65206B (en) * | 1977-07-20 | 1980-07-29 | Ciba Geigy Ag | Herbicidal derivative of 1,2,4-briazin-5-ons |
| US4447258A (en) * | 1979-03-07 | 1984-05-08 | Bayer Aktiengesellschaft | 3-Dimethylamino-4-methyl-1,2,4-triazin-5(4H)-ones and herbicidal compositions |
| CN1278607C (zh) | 1999-11-17 | 2006-10-11 | 拜尔公司 | 基于2,6-二取代的吡啶衍生物的选择性除草剂 |
| DE10212887A1 (de) * | 2002-03-22 | 2003-10-02 | Bayer Cropscience Ag | Selektive Herbizide auf Basis von substituierten Aminotriazinonen und substituierten Benzoylcyclohexandionen |
| US7834178B2 (en) * | 2006-03-01 | 2010-11-16 | Bristol-Myers Squibb Company | Triazine 11-beta hydroxysteroid dehydrogenase type 1 inhibitors |
| GB201305750D0 (en) * | 2013-03-28 | 2013-05-15 | Syngenta Ltd | Herbicidal Compounds |
| CN104186493A (zh) * | 2014-08-15 | 2014-12-10 | 成都蜀农昊农业有限公司 | 一种广谱型除草剂 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH495110A (de) * | 1966-04-16 | 1970-08-31 | Bayer Ag | Herbizides Mittel |
| DE2107757C3 (de) * | 1971-02-18 | 1980-02-28 | Bayer Ag, 5090 Leverkusen | 4-Amino-1,2,4-triazin-5-one, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide |
-
0
- BE BE786840D patent/BE786840A/xx not_active IP Right Cessation
-
1971
- 1971-07-29 DE DE2138031A patent/DE2138031C3/de not_active Expired
-
1972
- 1972-07-18 US US272921A patent/US3910909A/en not_active Expired - Lifetime
- 1972-07-20 CS CS5173*BA patent/CS167996B2/cs unknown
- 1972-07-26 IL IL40005A patent/IL40005A/en unknown
- 1972-07-26 SU SU1814625A patent/SU433681A3/ru active
- 1972-07-26 DD DD164689A patent/DD110043A5/xx unknown
- 1972-07-26 DD DD179909*A patent/DD112072A5/xx unknown
- 1972-07-27 CH CH1121572A patent/CH582682A5/xx not_active IP Right Cessation
- 1972-07-27 IT IT27513/72A patent/IT963443B/it active
- 1972-07-28 PL PL1972156998A patent/PL89679B1/pl unknown
- 1972-07-28 HU HUBA2778A patent/HU164712B/hu not_active IP Right Cessation
- 1972-07-28 BR BR5073/72A patent/BR7205073D0/pt unknown
- 1972-07-28 GB GB3541272A patent/GB1357852A/en not_active Expired
- 1972-07-28 FR FR7227397A patent/FR2147748A5/fr not_active Expired
- 1972-07-28 NL NL7210467A patent/NL7210467A/xx not_active Application Discontinuation
- 1972-07-29 JP JP7557772A patent/JPS5626666B1/ja active Pending
- 1972-07-29 RO RO7200071789A patent/RO62510A/ro unknown
- 1972-07-29 RO RO7200079297A patent/RO62702A/ro unknown
- 1972-07-29 JP JP7557872A patent/JPS5654284B1/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| IL40005A (en) | 1976-10-31 |
| DE2138031C3 (de) | 1979-04-19 |
| DE2138031B2 (de) | 1978-07-13 |
| IL40005A0 (en) | 1972-09-28 |
| PL89679B1 (enExample) | 1976-12-31 |
| HU164712B (enExample) | 1974-04-11 |
| JPS5626666B1 (enExample) | 1981-06-19 |
| JPS5654284B1 (enExample) | 1981-12-24 |
| DD110043A5 (enExample) | 1974-12-05 |
| BR7205073D0 (pt) | 1973-09-18 |
| RO62510A (fr) | 1978-02-15 |
| DE2138031A1 (de) | 1973-02-08 |
| DD112072A5 (enExample) | 1975-03-20 |
| GB1357852A (en) | 1974-06-26 |
| CH582682A5 (enExample) | 1976-12-15 |
| FR2147748A5 (enExample) | 1973-03-09 |
| BE786840A (fr) | 1973-01-29 |
| CS167996B2 (enExample) | 1976-05-28 |
| IT963443B (it) | 1974-01-10 |
| RO62702A (fr) | 1978-10-15 |
| US3910909A (en) | 1975-10-07 |
| NL7210467A (enExample) | 1973-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU433681A3 (ru) | Способ получения 1,2.4^триазин-5-онов | |
| KR850000886B1 (ko) | 삼-치환 이미다졸 유도체의 제조방법 | |
| SU791236A3 (ru) | Способ получени производных 1,2,4-триазин-5-она | |
| US4824949A (en) | Process for the preparation of pyrimidines | |
| RU2378261C2 (ru) | Способ получения солевого соединения (4,5-дигидроизоксазол-3-ил)тиокарбоксамидина | |
| US4113733A (en) | Process for making 5-amino-1,2,3-thiadiazoles | |
| US2450386A (en) | Manufacture of compounds containing amidine groups | |
| US3962272A (en) | 1h-tetrazole-1-acetate esters and acids and process therefor | |
| RU2117007C1 (ru) | Способ получения 2-замещенных 4,6-диалкоксипиримидинов,2-n-бутиламино-4,6-диметоксипиримидин и способ получения галогенпроизводных пиримидина | |
| FI111543B (fi) | Menetelmä epäsymmetrisesti substituoitujen triatsiinien valmistamiseksi | |
| US3466296A (en) | Process for the preparation of alkyl 3,5-disubstituted-isoxazole-4-carboxylates | |
| US3249610A (en) | Synthesis of 3-amino, 5-chloro, 6-substituted-pyrazinoates | |
| SU464998A3 (ru) | Способ получени производных 3-амино- -пиразолина | |
| US4001284A (en) | Process for the manufacture of 5-sulfamoyl-anthranilic acids | |
| US5162529A (en) | Process for the preparation of 5-hydroxy-3,4,5,6-tetrahydro-pyrimidine derivatives | |
| CA1180014A (en) | Process for the preparation of 3,6-disubstituted 4- amino-1,2,4-triazin-5-ones | |
| KR860001568B1 (ko) | 선택적 설폰화 방법에 의한 페닐렌디아민 유도체의 제조 방법 | |
| SU799651A3 (ru) | Способ получени амидов -кето-КАРбОНОВыХ КиСлОТ | |
| EP0276000B1 (en) | Process for producing alpha-(benzylidene)-acetonylphosphonates | |
| US4772747A (en) | Preparation of 2,4,6-trichlorophenylhydrazine | |
| SU753360A3 (ru) | Способ получени 6,7-диметокси-4амино-2(4,/2-фуроил/-1-пиперазинил)хиназолина | |
| US3497509A (en) | Imino ester method for producing 1,4,5,6-tetrahydro-as-triazine | |
| US3225048A (en) | Process for the preparation of 2,6-diketo-8-thiapurines | |
| SU1490121A1 (ru) | Способ получени 5-гидрокси-5-метил-4-оксо-3-арилпирролидино[1,2- @ ]пиразолов | |
| SU977453A1 (ru) | Способ получени 1,2-гидроксиламинооксимов |