SU162155A1 - - Google Patents
Info
- Publication number
- SU162155A1 SU162155A1 SU812994A SU812994A SU162155A1 SU 162155 A1 SU162155 A1 SU 162155A1 SU 812994 A SU812994 A SU 812994A SU 812994 A SU812994 A SU 812994A SU 162155 A1 SU162155 A1 SU 162155A1
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- alizarin
- solution
- sulfuric acid
- ozone
- mixture
- Prior art date
Links
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 12
- RGCKGOZRHPZPFP-UHFFFAOYSA-N Alizarin Natural products C1=CC=C2C(=O)C3=C(O)C(O)=CC=C3C(=O)C2=C1 RGCKGOZRHPZPFP-UHFFFAOYSA-N 0.000 description 10
- HFVAFDPGUJEFBQ-UHFFFAOYSA-M alizarin red S Chemical compound [Na+].O=C1C2=CC=CC=C2C(=O)C2=C1C=C(S([O-])(=O)=O)C(O)=C2O HFVAFDPGUJEFBQ-UHFFFAOYSA-M 0.000 description 10
- 239000000203 mixture Substances 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 238000000034 method Methods 0.000 description 5
- 230000003647 oxidation Effects 0.000 description 5
- 238000007254 oxidation reaction Methods 0.000 description 5
- BBNQQADTFFCFGB-UHFFFAOYSA-N purpurin Chemical compound C1=CC=C2C(=O)C3=C(O)C(O)=CC(O)=C3C(=O)C2=C1 BBNQQADTFFCFGB-UHFFFAOYSA-N 0.000 description 5
- 235000007079 manganese sulphate Nutrition 0.000 description 4
- 239000011702 manganese sulphate Substances 0.000 description 4
- SQQMAOCOWKFBNP-UHFFFAOYSA-L manganese(II) sulfate Chemical compound [Mn+2].[O-]S([O-])(=O)=O SQQMAOCOWKFBNP-UHFFFAOYSA-L 0.000 description 4
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 3
- 229940099596 manganese sulfate Drugs 0.000 description 3
- 230000001590 oxidative effect Effects 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000001301 oxygen Substances 0.000 description 3
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 2
- USHRRYVVGLGHAL-UHFFFAOYSA-N chembl1214277 Chemical compound C1=CC(O)=CC=C1CCN1C2=C(C=3C=C(O)C(O)=CC=3)C(=O)C3=CC(O)=C(O)C=C3C2=C2C3=CC(O)=C(O)C=C3C(=O)C(C=3C=C(O)C(O)=CC=3)=C21 USHRRYVVGLGHAL-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 238000006385 ozonation reaction Methods 0.000 description 2
- 238000005192 partition Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 238000005728 strengthening Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- 239000012670 alkaline solution Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU162155A1 true SU162155A1 (enExample) |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE4003309A1 (de) | Verfahren zur kontinuierlichen herstellung von imidoperoxicarbonsaeuren | |
| RU2077475C1 (ru) | Способ получения гидроксиапатита | |
| SU162155A1 (enExample) | ||
| DE1812332B2 (de) | Verfahren zur faellung von mangan, eisen und/oder kobalt aus loesungen derselben | |
| US3369866A (en) | Production of solid potassium metabisulfite | |
| US2940822A (en) | Production of potassium manganates | |
| US4100259A (en) | Process and apparatus for the purification of fumes and gases and for the production of sulfuric acid | |
| SU1677076A1 (ru) | Способ очистки цинковых растворов от хлора | |
| US3773916A (en) | Process for the manufacture of artificial manganese dioxide | |
| SU167834A1 (enExample) | ||
| EP0090390A2 (de) | Verfahren zum Aufschluss von Manganerzen mittels Schwefeldioxid | |
| SU1212938A1 (ru) | Способ получени фосфорной кислоты | |
| SU128547A1 (ru) | Способ окислени 2,2'-дибензантронила в 16,17-диоксивиолантрон | |
| JPS598603A (ja) | 低食塩次亜塩素酸ナトリウム水溶液の製造方法 | |
| KR20210104659A (ko) | 암모늄 메타텅스테이트의 제조방법 | |
| DE2233590A1 (de) | Verfahren zur herstellung von alkandicarbonsaeuren | |
| DK146120B (da) | Fremgangsmaade til fjernelse af svovldioxid fra forbraendingsroeggasser under dannelse af svovlsyre | |
| SU893986A1 (ru) | Способ получени эпихлоргидрина | |
| SU1673508A1 (ru) | Способ получени фосфорной кислоты | |
| SU352845A1 (ru) | Способ регенерации соединений шестивалентногохрома | |
| SU372907A1 (ru) | Способ получени бензолкарбоновых кислот | |
| SU485114A1 (ru) | Способ получени имидазол-4,5-дикарбоновй кислоты | |
| EP0431337B1 (de) | Verfahren zur Entkieselung der Ablauge | |
| SU1708762A1 (ru) | Способ получени фторида кальци | |
| SU1033428A1 (ru) | Способ получени фосфорной кислоты |