SU1251802A3 - Способ получени производных триазола - Google Patents
Способ получени производных триазола Download PDFInfo
- Publication number
- SU1251802A3 SU1251802A3 SU843712079A SU3712079A SU1251802A3 SU 1251802 A3 SU1251802 A3 SU 1251802A3 SU 843712079 A SU843712079 A SU 843712079A SU 3712079 A SU3712079 A SU 3712079A SU 1251802 A3 SU1251802 A3 SU 1251802A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- methylene chloride
- triazole
- water
- mixture
- triazol
- Prior art date
Links
- 238000000034 method Methods 0.000 title description 5
- 229940042055 systemic antimycotics triazole derivative Drugs 0.000 title description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 27
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 14
- 150000001875 compounds Chemical class 0.000 claims description 13
- -1 2,4-Dichloro-2,4-difluorophenyl Chemical group 0.000 claims description 8
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 claims description 7
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 238000002955 isolation Methods 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 150000003852 triazoles Chemical class 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 57
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 15
- 239000000203 mixture Substances 0.000 description 14
- 239000003463 adsorbent Substances 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 238000001704 evaporation Methods 0.000 description 8
- 230000008020 evaporation Effects 0.000 description 8
- 239000000284 extract Substances 0.000 description 7
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- 235000019341 magnesium sulphate Nutrition 0.000 description 7
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 239000000377 silicon dioxide Substances 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000008096 xylene Substances 0.000 description 4
- 241000228197 Aspergillus flavus Species 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 125000004215 2,4-difluorophenyl group Chemical group [H]C1=C([H])C(*)=C(F)C([H])=C1F 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- 230000000843 anti-fungal effect Effects 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- KRIOVPPHQSLHCZ-UHFFFAOYSA-N propiophenone Chemical compound CCC(=O)C1=CC=CC=C1 KRIOVPPHQSLHCZ-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- XMAYWYJOQHXEEK-OZXSUGGESA-N (2R,4S)-ketoconazole Chemical compound C1CN(C(=O)C)CCN1C(C=C1)=CC=C1OC[C@@H]1O[C@@](CN2C=NC=C2)(C=2C(=CC(Cl)=CC=2)Cl)OC1 XMAYWYJOQHXEEK-OZXSUGGESA-N 0.000 description 1
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical compound CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- 125000003626 1,2,4-triazol-1-yl group Chemical group [*]N1N=C([H])N=C1[H] 0.000 description 1
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical compound N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- YWSJLXANNDSMLR-UHFFFAOYSA-N 2-(4-chlorophenyl)-1,3-bis(1,2,4-triazol-1-yl)butan-2-ol Chemical compound C1=NC=NN1CC(O)(C=1C=CC(Cl)=CC=1)C(C)N1C=NC=N1 YWSJLXANNDSMLR-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 201000002909 Aspergillosis Diseases 0.000 description 1
- 208000036641 Aspergillus infections Diseases 0.000 description 1
- 241000222122 Candida albicans Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M Methanesulfonate Chemical compound CS([O-])(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 244000007853 Sarothamnus scoparius Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- MOQOOKGPCBQMCY-UHFFFAOYSA-N acetic acid;hexane Chemical compound CC(O)=O.CCCCCC MOQOOKGPCBQMCY-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 229960002798 cetrimide Drugs 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- GWZLAOIJICWIRB-UHFFFAOYSA-N ethyl acetate;n-ethylethanamine;hexane Chemical compound CCNCC.CCCCCC.CCOC(C)=O GWZLAOIJICWIRB-UHFFFAOYSA-N 0.000 description 1
- QWKLHPQCHMOZAP-UHFFFAOYSA-N ethyl acetate;n-ethylethanamine;methanol Chemical compound OC.CCNCC.CCOC(C)=O QWKLHPQCHMOZAP-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000011440 grout Substances 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229960004125 ketoconazole Drugs 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 230000004083 survival effect Effects 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Landscapes
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB838307232A GB8307232D0 (en) | 1983-03-16 | 1983-03-16 | Antifungal agents |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU1251802A3 true SU1251802A3 (ru) | 1986-08-15 |
Family
ID=10539674
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU843712079A SU1251802A3 (ru) | 1983-03-16 | 1984-03-15 | Способ получени производных триазола |
Country Status (5)
| Country | Link |
|---|---|
| JP (1) | JPS59176266A (https=) |
| DD (1) | DD246296A5 (https=) |
| GB (1) | GB8307232D0 (https=) |
| SU (1) | SU1251802A3 (https=) |
| ZA (1) | ZA841894B (https=) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2141955C1 (ru) * | 1997-06-04 | 1999-11-27 | Санкт-Петербургский государственный университет технологии и дизайна | Способ получения бис-1,2-(1,2,4-триазол-1-ил)этана |
| RU2142947C1 (ru) * | 1994-02-07 | 1999-12-20 | Эйсай Ко., Лтд. | Соединения азола, способы их получения, промежуточные соединения, способы их получения, фармацевтическая композиция, обладающая противогрибковой активностью |
| RU2156760C2 (ru) * | 1995-08-05 | 2000-09-27 | Пфайзер Рисерч Энд Дивелопмент Компани, Н.В./С.А. | Способ получения триазолов, конечные и промежуточные продукты способа |
| RU2580318C2 (ru) * | 2010-05-19 | 2016-04-10 | Сандоз Аг | Получение промежуточных продуктов для синтеза позаконазола |
| RU2585683C2 (ru) * | 2010-05-19 | 2016-06-10 | Сандоз Аг | Очистка позаконазола и промежуточных продуктов для синтеза позаконазола |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IE58738B1 (en) * | 1984-09-05 | 1993-11-03 | Ici Plc | Antifungal azole compounds |
| GB8819308D0 (en) * | 1988-08-13 | 1988-09-14 | Pfizer Ltd | Triazole antifungal agents |
-
1983
- 1983-03-16 GB GB838307232A patent/GB8307232D0/en active Pending
-
1984
- 1984-03-14 ZA ZA841894A patent/ZA841894B/xx unknown
- 1984-03-15 SU SU843712079A patent/SU1251802A3/ru active
- 1984-03-16 JP JP5081984A patent/JPS59176266A/ja active Granted
-
1985
- 1985-07-30 DD DD27914585A patent/DD246296A5/de unknown
Non-Patent Citations (1)
| Title |
|---|
| Патент Великобританни 2099818, кл. С 07 D 249/08, 1982. Патент GB № 2078719, кл. С 07 D 403/06, 1982. * |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2142947C1 (ru) * | 1994-02-07 | 1999-12-20 | Эйсай Ко., Лтд. | Соединения азола, способы их получения, промежуточные соединения, способы их получения, фармацевтическая композиция, обладающая противогрибковой активностью |
| RU2156760C2 (ru) * | 1995-08-05 | 2000-09-27 | Пфайзер Рисерч Энд Дивелопмент Компани, Н.В./С.А. | Способ получения триазолов, конечные и промежуточные продукты способа |
| RU2141955C1 (ru) * | 1997-06-04 | 1999-11-27 | Санкт-Петербургский государственный университет технологии и дизайна | Способ получения бис-1,2-(1,2,4-триазол-1-ил)этана |
| RU2580318C2 (ru) * | 2010-05-19 | 2016-04-10 | Сандоз Аг | Получение промежуточных продуктов для синтеза позаконазола |
| RU2585683C2 (ru) * | 2010-05-19 | 2016-06-10 | Сандоз Аг | Очистка позаконазола и промежуточных продуктов для синтеза позаконазола |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6346075B2 (https=) | 1988-09-13 |
| GB8307232D0 (en) | 1983-04-20 |
| ZA841894B (en) | 1985-11-27 |
| DD246296A5 (de) | 1987-06-03 |
| JPS59176266A (ja) | 1984-10-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69428125T2 (de) | Fungizide tetrahydrofurane | |
| DE69628117T2 (de) | Antifungale tetrahydrofurane | |
| US4898954A (en) | Process for the preparation of oxiranes | |
| DD284010A5 (de) | Verfahren zum herstellen von gengen pilzbefall wirksamen triazol-verbindungen | |
| RO109648B1 (ro) | Derivati 1 h-1,2,4-triazol,procedee pentru prepararea acestora,intermediari pentru realizarea procedeelor si metoda pentru tratarea sau prevenirea infectiei fungice | |
| SK48894A3 (en) | Fungicidal trisubstituted tetrahydrofurans | |
| FR2542315A1 (fr) | Nouveaux composes azoliques, leur preparation et leur utilisation comme antifongiques et fongicides | |
| DE69323667T2 (de) | 4-substituierte 1,2,4-Triazolderivate | |
| SU1251802A3 (ru) | Способ получени производных триазола | |
| US4210657A (en) | Aryl imidazolyl vinyl ethers and processes for using same | |
| DE69224507T2 (de) | Beta-Oxo-Beta-Benzenepropanthioamidderivate | |
| DK160825B (da) | Analogifremgangsmaade til fremstilling af 2-(halogensubstitueret pyridyl)-1,3-bis(1h-1,2,4-triazol-1-yl)propan-2-ol-derivater eller farmaceutisk acceptable syreadditionssalte deraf | |
| EP0115400B1 (en) | Triazole antifungal agents | |
| HU211515A9 (en) | Optically active triazole derivatives and compositions | |
| EP0323799B1 (de) | Imidazolderivate II | |
| NO138025B (no) | Analogifremgangsm}te til fremstilling av antimykotisk virksomme 1-etyl-imidazoler | |
| DE3732385A1 (de) | Hydroxyalkylcyclopropyl1-1,2,4-triazolyl- oder -imidazolyl-derivate und ihre verwendung als antimykotische mittel | |
| DE69713276T2 (de) | Azolverbindungen mit antimykotischer aktivität zur menschlichen und tierärztlichen verwendung | |
| AU621815B2 (en) | 1-(1-aryl-2-hydroxyethyl)-imidazoles and salts thereof, processes for the preparation thereof, medicaments containing these compounds, and the use thereof | |
| DE69009642T2 (de) | Verfahren zur Trennung optischer Isomere von Derivaten des 1,4-Dihydropyridins. | |
| EP0169439A2 (de) | Verfahren und Zwischenprodukte zur Synthese von diastereomeren Triazolyl-O,N-acetalen | |
| US4607045A (en) | Azolylmethylcycloacetals, their preparation and their use as drugs | |
| SI9600165A (en) | Process for preparation of biological active derivative of 1,2,4- triazole and intermediates useful in this process | |
| EP1395580B1 (de) | Verfahren zur reinigung von triazolylmethyl-oxiranen | |
| GB2039887A (en) | Acyl-1h-1,2,4-triazoles |