SU1168098A3 - Способ крашени или печати природных,синтетических полиамидов или натуральной кожи - Google Patents
Способ крашени или печати природных,синтетических полиамидов или натуральной кожи Download PDFInfo
- Publication number
- SU1168098A3 SU1168098A3 SU802980104A SU2980104A SU1168098A3 SU 1168098 A3 SU1168098 A3 SU 1168098A3 SU 802980104 A SU802980104 A SU 802980104A SU 2980104 A SU2980104 A SU 2980104A SU 1168098 A3 SU1168098 A3 SU 1168098A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- hydrogen
- dye
- printing
- natural
- amino
- Prior art date
Links
- 238000007639 printing Methods 0.000 title claims abstract description 22
- 239000004952 Polyamide Substances 0.000 title claims abstract description 13
- 229920002647 polyamide Polymers 0.000 title claims abstract description 13
- 238000000034 method Methods 0.000 title claims description 13
- 239000010985 leather Substances 0.000 title abstract description 5
- 238000004043 dyeing Methods 0.000 claims abstract description 18
- 239000001257 hydrogen Substances 0.000 claims abstract description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 10
- 150000003839 salts Chemical group 0.000 claims abstract description 10
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 9
- 239000000758 substrate Substances 0.000 claims abstract description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims abstract description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims abstract description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims abstract description 7
- 229910052794 bromium Inorganic materials 0.000 claims abstract description 7
- 239000000460 chlorine Chemical group 0.000 claims abstract description 7
- 229910052801 chlorine Inorganic materials 0.000 claims abstract description 7
- 229910052799 carbon Inorganic materials 0.000 claims abstract description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 3
- 239000000975 dye Substances 0.000 claims description 32
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 150000002431 hydrogen Chemical class 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 239000000987 azo dye Substances 0.000 claims description 4
- 229910052804 chromium Inorganic materials 0.000 claims description 4
- 239000011651 chromium Substances 0.000 claims description 4
- 150000004696 coordination complex Chemical class 0.000 claims description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 3
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 claims 2
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 12
- 239000002253 acid Substances 0.000 abstract description 7
- 210000002268 wool Anatomy 0.000 abstract description 5
- 239000004677 Nylon Substances 0.000 abstract description 3
- 150000001844 chromium Chemical class 0.000 abstract description 3
- 229920001778 nylon Polymers 0.000 abstract description 3
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 abstract description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 abstract 3
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 abstract 3
- 229910052782 aluminium Inorganic materials 0.000 abstract 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 abstract 1
- 239000000976 ink Substances 0.000 abstract 1
- 239000004922 lacquer Substances 0.000 abstract 1
- 229910052751 metal Inorganic materials 0.000 abstract 1
- 239000002184 metal Substances 0.000 abstract 1
- 150000002739 metals Chemical class 0.000 abstract 1
- 229920000098 polyolefin Polymers 0.000 abstract 1
- 229920002635 polyurethane Polymers 0.000 abstract 1
- 239000004814 polyurethane Substances 0.000 abstract 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 22
- -1 ammonium ions Chemical class 0.000 description 13
- 239000000243 solution Substances 0.000 description 10
- 150000001768 cations Chemical class 0.000 description 9
- 150000001875 compounds Chemical class 0.000 description 9
- 239000000463 material Substances 0.000 description 8
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 7
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 238000004040 coloring Methods 0.000 description 5
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 4
- RXCMFQDTWCCLBL-UHFFFAOYSA-N 4-amino-3-hydroxynaphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(N)=C(O)C=C(S(O)(=O)=O)C2=C1 RXCMFQDTWCCLBL-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical class [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 3
- KEQFTVQCIQJIQW-UHFFFAOYSA-N N-Phenyl-2-naphthylamine Chemical compound C=1C=C2C=CC=CC2=CC=1NC1=CC=CC=C1 KEQFTVQCIQJIQW-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- VAHBTQLPYPOTEG-UHFFFAOYSA-N 2-amino-4-chloro-5-nitrophenol N-phenylnaphthalen-2-amine Chemical compound C1(=CC=CC=C1)NC1=CC2=CC=CC=C2C=C1.NC1=C(C=C(C(=C1)Cl)[N+](=O)[O-])O VAHBTQLPYPOTEG-UHFFFAOYSA-N 0.000 description 2
- WDOGAHHZDMNMCG-UHFFFAOYSA-N 4-amino-3-hydroxynaphthalene-1-sulfonic acid;naphthalen-2-ol Chemical compound C1=CC=CC2=CC(O)=CC=C21.C1=CC=C2C(N)=C(O)C=C(S(O)(=O)=O)C2=C1 WDOGAHHZDMNMCG-UHFFFAOYSA-N 0.000 description 2
- SHYJXVVBEJRYLL-UHFFFAOYSA-N C1(=CC=CC=C1)NC1=CC2=CC=CC=C2C=C1.NC1=C(C=C(C=C1)[N+](=O)[O-])O Chemical compound C1(=CC=CC=C1)NC1=CC2=CC=CC=C2C=C1.NC1=C(C=C(C=C1)[N+](=O)[O-])O SHYJXVVBEJRYLL-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 229920002292 Nylon 6 Polymers 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 229910001413 alkali metal ion Inorganic materials 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 229950011260 betanaphthol Drugs 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000003973 paint Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 235000011121 sodium hydroxide Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- FHMMQQXRSYSWCM-UHFFFAOYSA-N 1-aminonaphthalen-2-ol Chemical compound C1=CC=C2C(N)=C(O)C=CC2=C1 FHMMQQXRSYSWCM-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- DOPJTDJKZNWLRB-UHFFFAOYSA-N 2-Amino-5-nitrophenol Chemical compound NC1=CC=C([N+]([O-])=O)C=C1O DOPJTDJKZNWLRB-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- ZARYBZGMUVAJMK-UHFFFAOYSA-N 2-amino-4-chloro-5-nitrophenol Chemical compound NC1=CC(Cl)=C([N+]([O-])=O)C=C1O ZARYBZGMUVAJMK-UHFFFAOYSA-N 0.000 description 1
- FDWBJLDYOMACII-UHFFFAOYSA-N 2-amino-4-nitrophenol N-phenylnaphthalen-2-amine Chemical compound C1(=CC=CC=C1)NC1=CC2=CC=CC=C2C=C1.NC1=C(C=CC(=C1)[N+](=O)[O-])O FDWBJLDYOMACII-UHFFFAOYSA-N 0.000 description 1
- ZDMBLPBTZZZSIW-UHFFFAOYSA-N 2-amino-6-methyl-4-nitrophenol Chemical compound CC1=CC([N+]([O-])=O)=CC(N)=C1O ZDMBLPBTZZZSIW-UHFFFAOYSA-N 0.000 description 1
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- YVPCXPUYVWWSFM-UHFFFAOYSA-N 4-amino-3-hydroxy-7-nitronaphthalene-1-sulfonic acid;naphthalen-2-ol Chemical compound C1=CC=CC2=CC(O)=CC=C21.[O-][N+](=O)C1=CC=C2C(N)=C(O)C=C(S(O)(=O)=O)C2=C1 YVPCXPUYVWWSFM-UHFFFAOYSA-N 0.000 description 1
- SHLXAOFEAFXGPS-UHFFFAOYSA-N C1(=CC=CC=C1)NC1=CC2=CC=CC=C2C=C1.NC1=C(C(=CC(=C1)[N+](=O)[O-])Cl)O Chemical compound C1(=CC=CC=C1)NC1=CC2=CC=CC=C2C=C1.NC1=C(C(=CC(=C1)[N+](=O)[O-])Cl)O SHLXAOFEAFXGPS-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- 241000218657 Picea Species 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- NGPGDYLVALNKEG-UHFFFAOYSA-N azanium;azane;2,3,4-trihydroxy-4-oxobutanoate Chemical compound [NH4+].[NH4+].[O-]C(=O)C(O)C(O)C([O-])=O NGPGDYLVALNKEG-UHFFFAOYSA-N 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 238000003763 carbonization Methods 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 229940028356 diethylene glycol monobutyl ether Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-O ethylaminium Chemical compound CC[NH3+] QUSNBJAOOMFDIB-UHFFFAOYSA-O 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 238000010409 ironing Methods 0.000 description 1
- 238000000622 liquid--liquid extraction Methods 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 1
- IMNDHOCGZLYMRO-UHFFFAOYSA-N n,n-dimethylbenzamide Chemical compound CN(C)C(=O)C1=CC=CC=C1 IMNDHOCGZLYMRO-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000005416 organic matter Substances 0.000 description 1
- JCGNDDUYTRNOFT-UHFFFAOYSA-N oxolane-2,4-dione Chemical compound O=C1COC(=O)C1 JCGNDDUYTRNOFT-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- QXYMVUZOGFVPGH-UHFFFAOYSA-N picramic acid Chemical compound NC1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1O QXYMVUZOGFVPGH-UHFFFAOYSA-N 0.000 description 1
- 229920000768 polyamine Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 229920001451 polypropylene glycol Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000000992 solvent dye Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- QEMXHQIAXOOASZ-UHFFFAOYSA-N tetramethylammonium Chemical compound C[N+](C)(C)C QEMXHQIAXOOASZ-UHFFFAOYSA-N 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- YODZTKMDCQEPHD-UHFFFAOYSA-N thiodiglycol Chemical compound OCCSCCO YODZTKMDCQEPHD-UHFFFAOYSA-N 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-O triethanolammonium Chemical compound OCC[NH+](CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-O 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B45/00—Complex metal compounds of azo dyes
- C09B45/02—Preparation from dyes containing in o-position a hydroxy group and in o'-position hydroxy, alkoxy, carboxyl, amino or keto groups
- C09B45/04—Azo compounds in general
- C09B45/10—Cobalt compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Inks, Pencil-Leads, Or Crayons (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH8600/79A CH649773A5 (de) | 1979-09-24 | 1979-09-24 | Asymmetrische 1:2-chromkomplexe aromatischer azoverbindungen, verfahren zu ihrer herstellung und diese enthaltende praeparate. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU1168098A3 true SU1168098A3 (ru) | 1985-07-15 |
Family
ID=4342473
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU802980104A SU1168098A3 (ru) | 1979-09-24 | 1980-09-23 | Способ крашени или печати природных,синтетических полиамидов или натуральной кожи |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4396544A (https=) |
| JP (1) | JPS5655457A (https=) |
| AU (1) | AU541681B2 (https=) |
| BR (1) | BR8006083A (https=) |
| CH (1) | CH649773A5 (https=) |
| DE (1) | DE3034576C2 (https=) |
| ES (1) | ES8200135A1 (https=) |
| FR (1) | FR2465768A1 (https=) |
| GB (1) | GB2059431B (https=) |
| HK (1) | HK59786A (https=) |
| IT (1) | IT1128567B (https=) |
| SU (1) | SU1168098A3 (https=) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4502860A (en) * | 1982-07-02 | 1985-03-05 | Ciba-Geigy Corporation | Bis-1:2-chromium complexes of disazo dyes, and their preparation and use |
| CH658252A5 (de) * | 1984-03-08 | 1986-10-31 | Ciba Geigy Ag | Verfahren zur herstellung von 1:2-chromkomplexfarbstoffen. |
| CH658065A5 (de) * | 1984-03-08 | 1986-10-15 | Ciba Geigy Ag | Verfahren zur herstellung von 1:2-chromkomplexazofarbstoffen. |
| CH664763A5 (de) * | 1985-01-24 | 1988-03-31 | Ciba Geigy Ag | Unsymmetrische chromkomplexfarbstoffe. |
| CH688281A5 (de) * | 1987-12-04 | 1997-07-15 | Ciba Geigy Ag | Verfahren zur Herstellung von 1:2-Metallkomplexazofarbstoffen. |
| ES2241919T3 (es) * | 2002-04-26 | 2005-11-01 | Okt Kunststofftechnik Gmbh | Procedimiento para mejorar los efectos metalicos y los criterios del procesamiento. |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2906746A (en) * | 1959-09-29 | Metalliferous azo dyestuffs | ||
| US3005813A (en) * | 1953-05-22 | 1961-10-24 | Ciba Ltd | Metalliferous azo-dyestuffs |
| DE1012007B (de) * | 1953-06-08 | 1957-07-11 | Ciba Geigy | Verfahren zur Herstellung chromhaltiger Azofarbstoffe |
| US2806760A (en) * | 1953-06-10 | 1957-09-17 | Ciba Ltd | Process for dyeing nitrogenous fibers with metalliferous monoazo dyestuffs |
| DE1262478B (de) * | 1961-12-21 | 1968-03-07 | Wolfen Filmfab Veb | Verfahren zur Herstellung eines chromhaltigen Mischkomplexfarbstoffes aus Monoazofarbstoffen |
| CH427095A (de) * | 1965-10-01 | 1966-12-31 | Sandoz Ag | Verfahren zur Herstellung von Mischkomplexverbindungen |
| GB1163713A (en) | 1966-02-10 | 1969-09-10 | Ici Ltd | Chromium-Containing Azo Dyestuffs |
| CH499585A (de) * | 1967-03-08 | 1970-11-30 | Sandoz Ag | Verfahren zur Herstellung von Monoazofarbstoffen und ihren Metallkomplexen |
| US4159983A (en) * | 1975-07-25 | 1979-07-03 | Sandoz Ltd. | Pure and substantially pure asymmetric 1:2 cobalt complexes of monoazo compounds |
| CH616444A5 (en) * | 1975-07-25 | 1980-03-31 | Sandoz Ag | Process for the preparation of asymmetric 1:2 cobalt complex azo compounds |
-
1979
- 1979-09-24 CH CH8600/79A patent/CH649773A5/de not_active IP Right Cessation
-
1980
- 1980-09-13 DE DE3034576A patent/DE3034576C2/de not_active Expired
- 1980-09-19 US US06/188,624 patent/US4396544A/en not_active Expired - Lifetime
- 1980-09-22 GB GB8030516A patent/GB2059431B/en not_active Expired
- 1980-09-22 ES ES495246A patent/ES8200135A1/es not_active Expired
- 1980-09-22 JP JP13088380A patent/JPS5655457A/ja active Granted
- 1980-09-22 AU AU62583/80A patent/AU541681B2/en not_active Ceased
- 1980-09-23 SU SU802980104A patent/SU1168098A3/ru active
- 1980-09-23 BR BR8006083A patent/BR8006083A/pt unknown
- 1980-09-23 IT IT49724/80A patent/IT1128567B/it active
- 1980-09-24 FR FR8020475A patent/FR2465768A1/fr active Granted
-
1986
- 1986-08-14 HK HK597/86A patent/HK59786A/xx not_active IP Right Cessation
Non-Patent Citations (1)
| Title |
|---|
| 1. Патент DE № 2631830, кл. D 06 Р 3/24, опублик. 1979 (прототип). * |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5655457A (en) | 1981-05-16 |
| GB2059431B (en) | 1983-05-25 |
| BR8006083A (pt) | 1981-04-07 |
| JPS6123948B2 (https=) | 1986-06-09 |
| HK59786A (en) | 1986-08-22 |
| IT8049724A0 (it) | 1980-09-23 |
| IT1128567B (it) | 1986-05-28 |
| FR2465768A1 (fr) | 1981-03-27 |
| CH649773A5 (de) | 1985-06-14 |
| ES495246A0 (es) | 1981-10-16 |
| DE3034576C2 (de) | 1987-04-09 |
| AU6258380A (en) | 1981-04-09 |
| ES8200135A1 (es) | 1981-10-16 |
| US4396544A (en) | 1983-08-02 |
| GB2059431A (en) | 1981-04-23 |
| DE3034576A1 (de) | 1981-04-09 |
| AU541681B2 (en) | 1985-01-17 |
| FR2465768B1 (https=) | 1984-11-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2002510735A (ja) | 有機基材染色用のトリフェンジオキサジン染料 | |
| SU1168098A3 (ru) | Способ крашени или печати природных,синтетических полиамидов или натуральной кожи | |
| ES2806080T3 (es) | Colorantes bisazo y mezclas de estos | |
| DE2704364C2 (https=) | ||
| DE2636798C2 (de) | Asymmetrische 1:2-Chromkomplex-azoverbindungen, deren Herstellung und Verwendung | |
| CN1085233C (zh) | 纤维活性染料 | |
| JPH08253698A (ja) | 反応染料混合物 | |
| DE4130806A1 (de) | Unsymmetrische 1:2-chromkomplexfarbstoffe | |
| JPH06287460A (ja) | １：２クロム錯体染料 | |
| CA1045134A (en) | Anthraquinone compounds | |
| SU556734A3 (ru) | Способ крашени текстильного материала из шерст ных или синтетических полиамидных волокон | |
| SU651711A3 (ru) | Способ получени асимметричных 1:2-хромовых комплексов азокрасителей | |
| JPH0129826B2 (https=) | ||
| CH639121A5 (en) | Monoazo compounds having a fibre-reactive radical, preparation thereof and use thereof in dyeing and printing leather | |
| DE1904112A1 (de) | Verfahren zur Herstellung von faserreaktiven,schwermetallhaltigen Formazanfarbstoffen | |
| DE1928542C (de) | Braune Reaktivfarbstoffe und ihre Verwendung | |
| DE2608535A1 (de) | Neue chromkomplexfarbstoffe, ihre herstellung und verwendung | |
| GB2055117A (en) | Improvement in or relating to organic compounds | |
| EP0219741A2 (de) | Mischungen und Präparationen wasserlöslicher Reaktivfarbstoffe | |
| DE2824211A1 (de) | Verfahren zur herstellung wasserloeslicher phthalocyaninfarbstoffe | |
| JPS604850B2 (ja) | 純非対称型１：２コバルト錯塩染料およびその製法 | |
| DE2429524C2 (de) | Chromhaltige Azofarbstoffe, deren Herstellung und Verwendung | |
| US4217270A (en) | Sulfo substituted chromium containing azo pyrazolone dyestuff | |
| CH664764A5 (de) | Unsymmetrische 1:2-chromkomplexfarbstoffe. | |
| KR0131760B1 (ko) | 프탈로시아닌 화합물 및 이를 사용하기 유기 기재를 염색 또는 프린팅하는 방법 |