SU1102488A3 - Механизм навивани ткани на ткацком станке - Google Patents
Механизм навивани ткани на ткацком станке Download PDFInfo
- Publication number
- SU1102488A3 SU1102488A3 SU792843827A SU2843827A SU1102488A3 SU 1102488 A3 SU1102488 A3 SU 1102488A3 SU 792843827 A SU792843827 A SU 792843827A SU 2843827 A SU2843827 A SU 2843827A SU 1102488 A3 SU1102488 A3 SU 1102488A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- fabric
- movement
- roller
- machine
- shaft
- Prior art date
Links
- 239000004744 fabric Substances 0.000 title claims abstract description 48
- 238000004804 winding Methods 0.000 title claims abstract description 11
- 230000007246 mechanism Effects 0.000 claims abstract description 16
- 238000009941 weaving Methods 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 abstract description 3
- ACWBQPMHZXGDFX-QFIPXVFZSA-N valsartan Chemical class C1=CC(CN(C(=O)CCCC)[C@@H](C(C)C)C(O)=O)=CC=C1C1=CC=CC=C1C1=NN=NN1 ACWBQPMHZXGDFX-QFIPXVFZSA-N 0.000 abstract 1
- 101100162703 Caenorhabditis elegans ani-1 gene Proteins 0.000 description 1
- KRNYOVHEKOBTEF-YUMQZZPRSA-N Val-Val Chemical compound CC(C)[C@H](N)C(=O)N[C@@H](C(C)C)C(O)=O KRNYOVHEKOBTEF-YUMQZZPRSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 238000012421 spiking Methods 0.000 description 1
- 230000007480 spreading Effects 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 108010021889 valylvaline Proteins 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D03—WEAVING
- D03D—WOVEN FABRICS; METHODS OF WEAVING; LOOMS
- D03D49/00—Details or constructional features not specially adapted for looms of a particular type
- D03D49/04—Control of the tension in warp or cloth
- D03D49/20—Take-up motions; Cloth beams
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Looms (AREA)
- Treatment Of Fiber Materials (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1238578A CH632543A5 (de) | 1978-12-05 | 1978-12-05 | Abzugsvorrichtung fuer die stoffbahn an einer textilmaschine. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU1102488A3 true SU1102488A3 (ru) | 1984-07-07 |
Family
ID=4382497
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU792843827A SU1102488A3 (ru) | 1978-12-05 | 1979-11-23 | Механизм навивани ткани на ткацком станке |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4276911A (enExample) |
| EP (1) | EP0011788B1 (enExample) |
| JP (1) | JPS5580553A (enExample) |
| AT (1) | AT363392B (enExample) |
| CH (1) | CH632543A5 (enExample) |
| CS (1) | CS232708B2 (enExample) |
| DE (1) | DE2854256C2 (enExample) |
| HU (1) | HU176888B (enExample) |
| SU (1) | SU1102488A3 (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6260287U (enExample) * | 1985-10-04 | 1987-04-14 | ||
| BE904266A (nl) * | 1986-02-24 | 1986-08-25 | Picanol Nv | Doekopwikkelinrichting voor weefmachines. |
| EP0333781B1 (de) * | 1987-09-21 | 1992-07-08 | Textilma AG | Webmaschine |
| BE1001913A3 (nl) * | 1988-05-03 | 1990-04-10 | Picanol Nv | Inrichting voor het afvoeren van het weefsel bij weefmachines. |
| IT1266136B1 (it) * | 1993-02-18 | 1996-12-20 | Inter Patent Limited | Dispositivo per l'avanzamento del tessuto |
| US6125754A (en) * | 1998-10-30 | 2000-10-03 | Harris; J. C. | Web pressurizing channeled roller and method |
| DE29909377U1 (de) | 1999-05-28 | 1999-09-09 | Lindauer Dornier Gmbh, 88131 Lindau | Vorrichtung zum Vermeiden einer Faltenbildung in Geweben im Bereich des Gewebeabzuges von Webmaschinen |
| DE10211149A1 (de) | 2002-03-14 | 2003-10-02 | Dornier Gmbh Lindauer | Breithalteeinrichtung |
| TW200907134A (en) * | 2007-08-09 | 2009-02-16 | Zheng Chuan Tian | Ribbon roller set transmission device of ribbon loom |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD78973A (enExample) * | ||||
| DE305679C (enExample) * | ||||
| FR682481A (fr) * | 1929-01-15 | 1930-05-28 | Dauphinoise De Const Mecanique | Poitrinière à multiples usages pour métiers à tisser les soieries |
| DE530994C (de) * | 1929-11-26 | 1931-08-03 | Beckers & Hueskes | Breithaltevorrichtung fuer Webstuehle |
| US2267483A (en) * | 1940-12-09 | 1941-12-23 | Crompton & Knowles Loom Works | Cloth spreader for looms |
| CH255870A (de) * | 1947-12-24 | 1948-07-15 | Bechter Hermann | Vorrichtung zum Strecken der Stoffbahn in der Schussrichtung an Webstühlen. |
| US2717037A (en) * | 1950-05-03 | 1955-09-06 | Beloit Iron Works | Winder and sheet separator |
| US2884015A (en) * | 1953-10-22 | 1959-04-28 | Bechter Hermann | Tensioning roller for weaving looms |
| US2776677A (en) * | 1955-03-14 | 1957-01-08 | Draper Corp | Means for preventing creases in fabrics as taken up in looms |
| DE1228210B (de) * | 1958-02-13 | 1966-11-03 | Jean Dautricourt | Rundwebmaschine mit einer Einrichtung zum Abziehen und Aufwickeln der Ware auf einen Warenbaum |
| US3405884A (en) * | 1964-02-03 | 1968-10-15 | Beloit Corp | Boundary layer eliminator |
| CH457316A (de) * | 1966-05-27 | 1968-05-31 | Sulzer Ag | Webmaschine |
| DE1950056U (de) * | 1966-09-15 | 1966-11-17 | Erhardt & Leimer O H G | Auflegebreithalter fuer wickelmaschinen. |
| DE1982425U (de) * | 1967-08-10 | 1968-04-04 | Kleinewefers Soehne J | Mehrwalzen-breithalter mit verstellbarer mittelwalze. |
| NL6905194A (enExample) * | 1969-04-02 | 1970-10-06 | ||
| CS151319B1 (enExample) * | 1971-05-07 | 1973-10-19 | ||
| SE405991B (sv) * | 1973-05-22 | 1979-01-15 | Jurgens Maschbau Gmbh & Co | Tygavdragsanordning for vevmaskiner |
| US3885600A (en) * | 1973-07-17 | 1975-05-27 | Jack G Altmann | Method and temple apparatus for guiding fabric lengths through textile weaving machines |
| DE2731316A1 (de) * | 1977-06-20 | 1978-12-21 | Sulzer Ag | Warenabzugsvorrichtung |
| CH615644A5 (enExample) * | 1978-01-19 | 1980-02-15 | Sulzer Ag |
-
1978
- 1978-12-05 CH CH1238578A patent/CH632543A5/de not_active IP Right Cessation
- 1978-12-13 AT AT0888078A patent/AT363392B/de not_active IP Right Cessation
- 1978-12-15 DE DE2854256A patent/DE2854256C2/de not_active Expired
-
1979
- 1979-10-25 HU HU79SU1039A patent/HU176888B/hu unknown
- 1979-11-02 US US06/090,694 patent/US4276911A/en not_active Expired - Lifetime
- 1979-11-19 EP EP79104555A patent/EP0011788B1/de not_active Expired
- 1979-11-23 SU SU792843827A patent/SU1102488A3/ru active
- 1979-12-04 JP JP15736379A patent/JPS5580553A/ja active Granted
- 1979-12-05 CS CS798455A patent/CS232708B2/cs unknown
Non-Patent Citations (1)
| Title |
|---|
| 1. Патент СССР № 1026657, кл. D 03 Б 49/20, 1978 (прототип). * |
Also Published As
| Publication number | Publication date |
|---|---|
| CH632543A5 (de) | 1982-10-15 |
| CS845579A2 (en) | 1984-06-18 |
| ATA888078A (de) | 1980-12-15 |
| DE2854256C2 (de) | 1984-10-04 |
| US4276911A (en) | 1981-07-07 |
| AT363392B (de) | 1981-07-27 |
| HU176888B (en) | 1981-05-28 |
| JPS6151057B2 (enExample) | 1986-11-07 |
| EP0011788A1 (de) | 1980-06-11 |
| CS232708B2 (en) | 1985-02-14 |
| JPS5580553A (en) | 1980-06-17 |
| DE2854256A1 (de) | 1980-06-12 |
| EP0011788B1 (de) | 1983-04-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU1102488A3 (ru) | Механизм навивани ткани на ткацком станке | |
| US3940833A (en) | Method for compressively shrinking textile fabrics at high speed | |
| US2594846A (en) | Means for stretching the cloth web in weft direction in looms | |
| US3471907A (en) | Apparatus for continuously and mechanically compacting webs of fibrous material | |
| US2885763A (en) | Compressive shrinking machine | |
| SU536759A3 (ru) | Устройство дл передачи вращени рабочему органу нитеподающего механизма | |
| US4380311A (en) | Device for guiding a knitted or woven fabric | |
| US2156244A (en) | Means and method of treating strands | |
| US1487375A (en) | Wiping attachment for film-drying apparatus | |
| US3066517A (en) | Apparatus for the fluid treatment of textile webs of varying widths | |
| US4390139A (en) | Oscillating guide roll assembly for cloth winder | |
| US4332192A (en) | Roll nip arrangement | |
| JPS5854066B2 (ja) | オリモノキカイヨウイトクリダシソウチ | |
| SU1026657A3 (ru) | Механизм навивани ткани на ткацком станке | |
| US813288A (en) | Felt-regulating device for paper-machines. | |
| SU1524813A3 (ru) | Устройство дл съема текстильного полотна на текстильном, преимущественно ткацком, станке | |
| SU461995A1 (ru) | Устройство дл направлени уточной нити в бердо к многозевному ткацкому станку | |
| RU2144580C1 (ru) | Направляющий орган ткацкого станка | |
| US4108708A (en) | Scrim machine | |
| SU397572A1 (ru) | МЕХАНИЗМ к ТКАЦКОМУ СТАНКУ ДЛЯ ОТМЕРИВАНИЯ | |
| SU417561A1 (ru) | СПОСОБ ЦЕНТРИРОВАНИЯ ПОЛОТНА3 П Т Б J^.г,цп .:5;:ri'^nr?Tug4 ФУ»Д ^••'-^^-' '^^'\ | |
| US537445A (en) | edmunds | |
| US2879992A (en) | Reeling of material | |
| US2252659A (en) | Dye jig | |
| US2851043A (en) | Apparatus for washing rubber threads |