SU1063290A3 - Композици дл получени окрашенного в массе высокомолекул рного органического полимерного материала - Google Patents
Композици дл получени окрашенного в массе высокомолекул рного органического полимерного материала Download PDFInfo
- Publication number
- SU1063290A3 SU1063290A3 SU752192802A SU2192802A SU1063290A3 SU 1063290 A3 SU1063290 A3 SU 1063290A3 SU 752192802 A SU752192802 A SU 752192802A SU 2192802 A SU2192802 A SU 2192802A SU 1063290 A3 SU1063290 A3 SU 1063290A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- yellow
- resin
- group
- polyethylene
- carbamoyl
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 10
- 239000000463 material Substances 0.000 title claims 2
- -1 nitro, carbamoyl Chemical group 0.000 claims abstract description 21
- 229920000877 Melamine resin Polymers 0.000 claims abstract description 9
- 229920000642 polymer Polymers 0.000 claims abstract description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 5
- 229920000915 polyvinyl chloride Polymers 0.000 claims abstract description 4
- 239000004800 polyvinyl chloride Substances 0.000 claims abstract description 4
- 125000001841 imino group Chemical group [H]N=* 0.000 claims abstract description 3
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 3
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 3
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical group [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 10
- 239000004698 Polyethylene Substances 0.000 claims description 8
- 229920000573 polyethylene Polymers 0.000 claims description 8
- 150000004696 coordination complex Chemical class 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 229910052759 nickel Chemical group 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical group [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 3
- 239000004640 Melamine resin Substances 0.000 claims description 3
- 229910017052 cobalt Inorganic materials 0.000 claims description 3
- 239000010941 cobalt Substances 0.000 claims description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical group [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 239000010949 copper Chemical group 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 230000005012 migration Effects 0.000 claims description 3
- 238000013508 migration Methods 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 2
- 125000003368 amide group Chemical group 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims description 2
- 238000009833 condensation Methods 0.000 claims description 2
- 230000005494 condensation Effects 0.000 claims description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 239000011593 sulfur Chemical group 0.000 claims description 2
- 229920005989 resin Polymers 0.000 claims 5
- 239000011347 resin Substances 0.000 claims 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 150000001733 carboxylic acid esters Chemical class 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 239000000049 pigment Substances 0.000 abstract description 6
- 229920000180 alkyd Polymers 0.000 abstract description 4
- 239000002184 metal Substances 0.000 abstract description 4
- 229910052751 metal Inorganic materials 0.000 abstract description 4
- 239000004922 lacquer Substances 0.000 abstract description 3
- 229920000139 polyethylene terephthalate Polymers 0.000 abstract description 3
- 239000005020 polyethylene terephthalate Substances 0.000 abstract description 3
- 239000011248 coating agent Substances 0.000 abstract description 2
- 238000000576 coating method Methods 0.000 abstract description 2
- 239000008187 granular material Substances 0.000 abstract description 2
- PXZQEOJJUGGUIB-UHFFFAOYSA-N isoindolin-1-one Chemical compound C1=CC=C2C(=O)NCC2=C1 PXZQEOJJUGGUIB-UHFFFAOYSA-N 0.000 abstract description 2
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 abstract description 2
- 125000005115 alkyl carbamoyl group Chemical group 0.000 abstract 2
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- 229910052736 halogen Inorganic materials 0.000 abstract 2
- 150000002367 halogens Chemical class 0.000 abstract 2
- 125000006704 (C5-C6) cycloalkyl group Chemical group 0.000 abstract 1
- 235000013162 Cocos nucifera Nutrition 0.000 abstract 1
- 244000060011 Cocos nucifera Species 0.000 abstract 1
- 229910010413 TiO 2 Inorganic materials 0.000 abstract 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 abstract 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 abstract 1
- 150000001342 alkaline earth metals Chemical group 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 abstract 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 abstract 1
- 239000005030 aluminium foil Substances 0.000 abstract 1
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- 125000005116 aryl carbamoyl group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000004429 atom Chemical group 0.000 abstract 1
- 239000011230 binding agent Substances 0.000 abstract 1
- 229910052799 carbon Inorganic materials 0.000 abstract 1
- 239000003795 chemical substances by application Substances 0.000 abstract 1
- 238000007598 dipping method Methods 0.000 abstract 1
- 239000000975 dye Substances 0.000 abstract 1
- VXPLXMJHHKHSOA-UHFFFAOYSA-N propham Chemical compound CC(C)OC(=O)NC1=CC=CC=C1 VXPLXMJHHKHSOA-UHFFFAOYSA-N 0.000 abstract 1
- 239000002904 solvent Substances 0.000 abstract 1
- 239000011877 solvent mixture Substances 0.000 abstract 1
- 238000005507 spraying Methods 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 6
- 238000003756 stirring Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- 229920000178 Acrylic resin Polymers 0.000 description 4
- 239000004925 Acrylic resin Substances 0.000 description 4
- 229920000620 organic polymer Polymers 0.000 description 4
- 239000002861 polymer material Substances 0.000 description 4
- 229920001155 polypropylene Polymers 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 239000004743 Polypropylene Substances 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 229920002239 polyacrylonitrile Polymers 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- BWOVACANEIVHST-UHFFFAOYSA-N 2-(1h-benzimidazol-2-yl)acetonitrile Chemical compound C1=CC=C2NC(CC#N)=NC2=C1 BWOVACANEIVHST-UHFFFAOYSA-N 0.000 description 2
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 2
- CXJCEZRISSJRNL-UHFFFAOYSA-N 4-imino-3ah-isoindole-1,3-dione;hydrochloride Chemical compound Cl.N=C1C=CC=C2C(=O)NC(=O)C12 CXJCEZRISSJRNL-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- ZWWOYERTGZZDMF-UHFFFAOYSA-N 4,5,6,7-tetrachloro-3,3-dimethoxy-2h-isoindol-1-one Chemical compound ClC1=C(Cl)C(Cl)=C(Cl)C2=C1C(OC)(OC)NC2=O ZWWOYERTGZZDMF-UHFFFAOYSA-N 0.000 description 1
- XWPDFUADMNYBAY-UHFFFAOYSA-N 4-chloro-3,3-dimethoxy-2h-isoindol-1-one Chemical compound C1=CC(Cl)=C2C(OC)(OC)NC(=O)C2=C1 XWPDFUADMNYBAY-UHFFFAOYSA-N 0.000 description 1
- VQBQWUVBIQRLFK-UHFFFAOYSA-N 5-chloro-3,3-dimethoxy-2h-isoindol-1-one Chemical compound C1=C(Cl)C=C2C(OC)(OC)NC(=O)C2=C1 VQBQWUVBIQRLFK-UHFFFAOYSA-N 0.000 description 1
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 1
- 241000208202 Linaceae Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- MQRWBMAEBQOWAF-UHFFFAOYSA-N acetic acid;nickel Chemical compound [Ni].CC(O)=O.CC(O)=O MQRWBMAEBQOWAF-UHFFFAOYSA-N 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Substances ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 1
- 229940011182 cobalt acetate Drugs 0.000 description 1
- QAHREYKOYSIQPH-UHFFFAOYSA-L cobalt(II) acetate Chemical compound [Co+2].CC([O-])=O.CC([O-])=O QAHREYKOYSIQPH-UHFFFAOYSA-L 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 229940078494 nickel acetate Drugs 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- XQZYPMVTSDWCCE-UHFFFAOYSA-N phthalonitrile Chemical compound N#CC1=CC=CC=C1C#N XQZYPMVTSDWCCE-UHFFFAOYSA-N 0.000 description 1
- 229920013716 polyethylene resin Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 239000001052 yellow pigment Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B57/00—Other synthetic dyes of known constitution
- C09B57/04—Isoindoline dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Plural Heterocyclic Compounds (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Pigments, Carbon Blacks, Or Wood Stains (AREA)
- Inks, Pencil-Leads, Or Crayons (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1762572A CH580678A5 (enExample) | 1972-12-04 | 1972-12-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU1063290A3 true SU1063290A3 (ru) | 1983-12-23 |
Family
ID=4426818
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU752192802A SU1063290A3 (ru) | 1972-12-04 | 1975-11-21 | Композици дл получени окрашенного в массе высокомолекул рного органического полимерного материала |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3897439A (enExample) |
| JP (1) | JPS5544783B2 (enExample) |
| AR (1) | AR200749A1 (enExample) |
| AU (1) | AU476693B2 (enExample) |
| BE (1) | BE808134A (enExample) |
| BR (1) | BR7309471D0 (enExample) |
| CA (1) | CA996562A (enExample) |
| CH (1) | CH580678A5 (enExample) |
| CS (1) | CS176258B2 (enExample) |
| DE (1) | DE2359791C3 (enExample) |
| DK (1) | DK143808C (enExample) |
| FR (1) | FR2208942B1 (enExample) |
| GB (1) | GB1403510A (enExample) |
| NL (1) | NL176862C (enExample) |
| SU (1) | SU1063290A3 (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3919235A (en) * | 1972-11-20 | 1975-11-11 | Sterling Drug Inc | Polycyclic iminoisoindoline chelates |
| US4002635A (en) * | 1972-12-04 | 1977-01-11 | Ciba-Geigy Corporation | Isoindolinone compounds useful in preparing heavy metal containing pigments |
| US4111947A (en) * | 1974-02-06 | 1978-09-05 | Ciba-Geigy Corporation | Novel metal complexes of azomethines and process for their manufacture |
| CH594721A5 (enExample) * | 1974-09-05 | 1978-01-31 | Ciba Geigy Ag | |
| CH606282A5 (enExample) * | 1974-10-17 | 1978-10-31 | Ciba Geigy Ag | |
| CH606335A5 (enExample) * | 1974-10-17 | 1978-10-31 | Ciba Geigy Ag | |
| DE2848622A1 (de) * | 1978-11-09 | 1980-05-22 | Bayer Ag | Saure monomethin-metallkomplexfarbstoffe |
| CH644145A5 (de) * | 1979-05-02 | 1984-07-13 | Sandoz Ag | Metallkomplexe von oximinoverbindungen und ihre verwendung als pigmente. |
| DE3062284D1 (en) * | 1979-08-03 | 1983-04-14 | Ciba Geigy Ag | Iminoisoindolinone metal complexes, process for their manufacture, method for pigmenting an organic high-molecular material and high-molecular organic material containing such a metal complex |
| US4515955A (en) * | 1982-03-08 | 1985-05-07 | Minnesota Mining And Manufacturing Company | Isoindoline cationic dyes |
| DE3443465A1 (de) * | 1984-11-29 | 1986-05-28 | Basf Ag, 6700 Ludwigshafen | Neue isoindolinverbindungen, deren metallkomplexe und deren verwendung |
| DE3508553A1 (de) * | 1985-03-11 | 1986-09-11 | Hüls AG, 4370 Marl | Verfahren und vorrichtung zum katalytischen umsetzen von gasen |
| TW217426B (enExample) * | 1992-01-08 | 1993-12-11 | Mekku Kk | |
| US5667856A (en) * | 1992-01-24 | 1997-09-16 | Revlon Consumer Products Corporation | Radiation curable pigmented compositions and decorated substrates |
| US5571359A (en) * | 1992-01-24 | 1996-11-05 | Revlon Consumer Products Corporation | Radiation curable pigmented compositions |
| US6136382A (en) | 1997-12-29 | 2000-10-24 | Deco Patents, Inc. | Method and compositions for decorating vitreous articles with radiation curable inks having improved adhesion and durability |
| TWI798182B (zh) * | 2016-09-02 | 2023-04-11 | 日商住友化學股份有限公司 | 著色組成物及化合物 |
| DE102018109102A1 (de) * | 2018-04-17 | 2019-10-17 | Schott Ag | Bedruckte Gerätekomponente |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3256291A (en) * | 1965-03-08 | 1966-06-14 | Du Pont | Neutral and ionic chelates of 1-pyrazoledithiocarboxylic acids with divalent metals of atomic number 24-30 |
| US3481945A (en) * | 1966-12-09 | 1969-12-02 | Moleculon Corp | Tetrabenzimidazole |
| US3678007A (en) * | 1971-08-23 | 1972-07-18 | Ppg Industries Inc | Metal salt complexes of imidazolium salts as curing agents for one part epoxy resins |
-
1972
- 1972-12-04 CH CH1762572A patent/CH580678A5/xx not_active IP Right Cessation
-
1973
- 1973-11-08 CA CA185,304A patent/CA996562A/en not_active Expired
- 1973-11-13 AU AU62445/73A patent/AU476693B2/en not_active Expired
- 1973-11-21 US US417849A patent/US3897439A/en not_active Expired - Lifetime
- 1973-11-29 DK DK646573A patent/DK143808C/da not_active IP Right Cessation
- 1973-11-30 DE DE2359791A patent/DE2359791C3/de not_active Expired
- 1973-12-03 AR AR251323A patent/AR200749A1/es active
- 1973-12-03 FR FR7342977A patent/FR2208942B1/fr not_active Expired
- 1973-12-03 GB GB5590373A patent/GB1403510A/en not_active Expired
- 1973-12-03 BE BE138440A patent/BE808134A/xx not_active IP Right Cessation
- 1973-12-03 BR BR9471/73A patent/BR7309471D0/pt unknown
- 1973-12-04 JP JP13726973A patent/JPS5544783B2/ja not_active Expired
- 1973-12-04 NL NLAANVRAGE7316597,A patent/NL176862C/xx not_active IP Right Cessation
- 1973-12-04 CS CS8349A patent/CS176258B2/cs unknown
-
1975
- 1975-11-21 SU SU752192802A patent/SU1063290A3/ru active
Non-Patent Citations (1)
| Title |
|---|
| 1„ Извести высших учебных за.ведений. Сери Хими . Т„7, 1964, № 1, с. 116 (прототип). -. * |
Also Published As
| Publication number | Publication date |
|---|---|
| US3897439A (en) | 1975-07-29 |
| CH580678A5 (enExample) | 1976-10-15 |
| JPS4987732A (enExample) | 1974-08-22 |
| DE2359791C3 (de) | 1979-07-12 |
| JPS5544783B2 (enExample) | 1980-11-14 |
| NL7316597A (enExample) | 1974-06-06 |
| GB1403510A (en) | 1975-08-28 |
| DE2359791B2 (de) | 1978-10-12 |
| DK143808C (da) | 1982-03-29 |
| CS176258B2 (enExample) | 1977-06-30 |
| NL176862B (nl) | 1985-01-16 |
| DK143808B (da) | 1981-10-12 |
| FR2208942B1 (enExample) | 1976-06-25 |
| DE2359791A1 (de) | 1974-06-06 |
| BR7309471D0 (pt) | 1974-09-24 |
| BE808134A (fr) | 1974-06-04 |
| NL176862C (nl) | 1985-06-17 |
| AR200749A1 (es) | 1974-12-13 |
| FR2208942A1 (enExample) | 1974-06-28 |
| CA996562A (en) | 1976-09-07 |
| AU6244573A (en) | 1975-05-15 |
| AU476693B2 (en) | 1976-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU1063290A3 (ru) | Композици дл получени окрашенного в массе высокомолекул рного органического полимерного материала | |
| US5847156A (en) | Polymerizable diketopyrrolopyrroles and polymers prepared therewith | |
| US4931566A (en) | Process for the preparation of pyrrolo[3,4-c]pyrroles | |
| CS228540B2 (en) | Method for dyeing high-molecular organic material in mass | |
| US4044036A (en) | Metal complexes of bis-azomethines from hydroxy-aldehydes and alkylene diamines | |
| US4613669A (en) | Preparation of 1,4-diketopyrrolo-[3,4-c]pyrroles | |
| US3979386A (en) | Iminoisoindoline pigments and processes for the preparation thereof | |
| CH680367A5 (enExample) | ||
| JPS62220562A (ja) | アゾ化合物のアミン塩の新規顔料、その製造方法、及びその使用による高分子有機材料の着色方法 | |
| US4564680A (en) | Isoindolazines | |
| US5817832A (en) | Blue diketopyrrolopyrrole pigments | |
| US4009165A (en) | Naphtholactam dyes | |
| US4077960A (en) | Imido-quinoline dyes | |
| DE2157547B2 (de) | Perinonfarbstoffe, Verfahren zu deren Herstellung und deren Verwendung | |
| EP1611206B1 (de) | Heterocyclische farbmittel auf basis von benzodipyrrolen | |
| US5378276A (en) | Diketopyrrolopyrroles containing nitroxyl groups | |
| US4052410A (en) | Iminoisoindoline pigments | |
| US4116959A (en) | Isoindoline pigments | |
| US4042611A (en) | Water-in-soluble disazo methine compounds | |
| JPS61183359A (ja) | ビス―イソインドリン顔料及び合成樹脂、印刷インキ又はワニスの着色法 | |
| US4096145A (en) | Naphtholactam derivatives | |
| US3926987A (en) | Dioxazine dyes | |
| US4725685A (en) | Novel isoindoline compounds, their metal complexes and their use as pigments | |
| US4097484A (en) | Mixed complexes of methine dyes | |
| US4730014A (en) | Use of pyridoquinolone derivatives as pigments |