SU1015822A3 - Способ получени галогенангидридов сульфаминовой кислоты - Google Patents
Способ получени галогенангидридов сульфаминовой кислоты Download PDFInfo
- Publication number
- SU1015822A3 SU1015822A3 SU792846544A SU2846544A SU1015822A3 SU 1015822 A3 SU1015822 A3 SU 1015822A3 SU 792846544 A SU792846544 A SU 792846544A SU 2846544 A SU2846544 A SU 2846544A SU 1015822 A3 SU1015822 A3 SU 1015822A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- mol
- phosphorus
- parts
- sulfamic acid
- halogen
- Prior art date
Links
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 title claims abstract description 7
- 238000004519 manufacturing process Methods 0.000 title claims abstract description 4
- 150000008064 anhydrides Chemical class 0.000 title description 2
- 239000002904 solvent Substances 0.000 claims abstract description 15
- 238000000034 method Methods 0.000 claims abstract description 11
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 9
- 150000002367 halogens Chemical class 0.000 claims abstract description 8
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims abstract description 7
- 229910052698 phosphorus Inorganic materials 0.000 claims abstract description 7
- 239000011574 phosphorus Substances 0.000 claims abstract description 7
- 229910052751 metal Inorganic materials 0.000 claims abstract description 6
- 239000002184 metal Substances 0.000 claims abstract description 6
- 150000003839 salts Chemical class 0.000 claims abstract description 6
- 239000004215 Carbon black (E152) Substances 0.000 claims abstract description 4
- 229930195733 hydrocarbon Natural products 0.000 claims abstract description 4
- 150000002430 hydrocarbons Chemical class 0.000 claims abstract description 4
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract description 3
- 239000003795 chemical substances by application Substances 0.000 claims abstract 4
- 230000002140 halogenating effect Effects 0.000 claims abstract 4
- -1 SULFAMIC ACID HYDRIDES Chemical class 0.000 claims description 5
- 238000010438 heat treatment Methods 0.000 claims 1
- 239000002253 acid Substances 0.000 abstract description 7
- 125000005843 halogen group Chemical group 0.000 abstract 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 abstract 1
- 229940124530 sulfonamide Drugs 0.000 abstract 1
- 239000000460 chlorine Substances 0.000 description 17
- 229910052801 chlorine Inorganic materials 0.000 description 17
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 17
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 16
- 239000000203 mixture Substances 0.000 description 16
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 10
- 239000007789 gas Substances 0.000 description 8
- 239000007787 solid Substances 0.000 description 6
- OBSZRRSYVTXPNB-UHFFFAOYSA-N tetraphosphorus Chemical compound P12P3P1P32 OBSZRRSYVTXPNB-UHFFFAOYSA-N 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 4
- SIVVHUQWDOGLJN-UHFFFAOYSA-N ethylsulfamic acid Chemical compound CCNS(O)(=O)=O SIVVHUQWDOGLJN-UHFFFAOYSA-N 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- JUDKSMSHAHXBFK-UHFFFAOYSA-N n-ethylsulfamoyl chloride Chemical compound CCNS(Cl)(=O)=O JUDKSMSHAHXBFK-UHFFFAOYSA-N 0.000 description 3
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- TUMNHQRORINJKE-UHFFFAOYSA-N 1,1-diethylurea Chemical compound CCN(CC)C(N)=O TUMNHQRORINJKE-UHFFFAOYSA-N 0.000 description 1
- YBBLOADPFWKNGS-UHFFFAOYSA-N 1,1-dimethylurea Chemical compound CN(C)C(N)=O YBBLOADPFWKNGS-UHFFFAOYSA-N 0.000 description 1
- OCKGFTQIICXDQW-ZEQRLZLVSA-N 5-[(1r)-1-hydroxy-2-[4-[(2r)-2-hydroxy-2-(4-methyl-1-oxo-3h-2-benzofuran-5-yl)ethyl]piperazin-1-yl]ethyl]-4-methyl-3h-2-benzofuran-1-one Chemical compound C1=C2C(=O)OCC2=C(C)C([C@@H](O)CN2CCN(CC2)C[C@H](O)C2=CC=C3C(=O)OCC3=C2C)=C1 OCKGFTQIICXDQW-ZEQRLZLVSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- BAVYZALUXZFZLV-UHFFFAOYSA-O Methylammonium ion Chemical compound [NH3+]C BAVYZALUXZFZLV-UHFFFAOYSA-O 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- WUDNUHPRLBTKOJ-UHFFFAOYSA-N ethyl isocyanate Chemical compound CCN=C=O WUDNUHPRLBTKOJ-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- MYMDOKBFMTVEGE-UHFFFAOYSA-N methylsulfamic acid Chemical compound CNS(O)(=O)=O MYMDOKBFMTVEGE-UHFFFAOYSA-N 0.000 description 1
- MZADUJSDVCPGLK-UHFFFAOYSA-N methylsulfamic acid;hydrochloride Chemical compound Cl.CNS(O)(=O)=O MZADUJSDVCPGLK-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- UJJUEJRWNWVHCM-UHFFFAOYSA-N n-methylsulfamoyl chloride Chemical compound CNS(Cl)(=O)=O UJJUEJRWNWVHCM-UHFFFAOYSA-N 0.000 description 1
- AGRDPCWQGGNEQL-UHFFFAOYSA-N n-propan-2-ylsulfamoyl chloride Chemical compound CC(C)NS(Cl)(=O)=O AGRDPCWQGGNEQL-UHFFFAOYSA-N 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000004476 plant protection product Substances 0.000 description 1
- 238000005201 scrubbing Methods 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid group Chemical class S(N)(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000002912 waste gas Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C307/00—Amides of sulfuric acids, i.e. compounds having singly-bound oxygen atoms of sulfate groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C307/02—Monoamides of sulfuric acids or esters thereof, e.g. sulfamic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782852274 DE2852274A1 (de) | 1978-12-02 | 1978-12-02 | Verfahren zur herstellung von sulfamidsaeurehalogeniden |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU1015822A3 true SU1015822A3 (ru) | 1983-04-30 |
Family
ID=6056204
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU792846544A SU1015822A3 (ru) | 1978-12-02 | 1979-11-27 | Способ получени галогенангидридов сульфаминовой кислоты |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4260560A (https=) |
| EP (1) | EP0011794B1 (https=) |
| JP (1) | JPS5585559A (https=) |
| DE (2) | DE2852274A1 (https=) |
| HU (1) | HU183084B (https=) |
| IL (1) | IL58745A (https=) |
| SU (1) | SU1015822A3 (https=) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU199815B (en) * | 1985-12-03 | 1990-03-28 | Nitrokemia Ipartelepek | Process for producing 3-isopropylbenzo-2-thia-1,3-diazinone-/4/2,2-dioxide |
| AU2003240656A1 (en) * | 2002-05-16 | 2003-12-02 | Basf Aktiengesellschaft | Method for the production of sulphamic acid halogenides |
| DE102006045406B3 (de) * | 2006-09-26 | 2007-09-27 | Dräger Safety AG & Co. KGaA | Vorrichtung zur Bestimmung von Chlordioxid und Verfahren |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2888486A (en) * | 1953-11-20 | 1959-05-26 | Du Pont | Process for producing aromatic sulfonyl halides |
| US3621017A (en) * | 1967-09-30 | 1971-11-16 | Basf Ag | Salts of thiadiazinones |
| BG17705A3 (bg) | 1969-07-24 | 1973-12-25 | Basf Aktiengesellschaft | Хербицидно средство |
| CH557803A (de) * | 1971-02-02 | 1975-01-15 | Basf Ag | Verfahren zur herstellung von o-sulfamylamidobenzoesaeuren. |
| DE2105687C2 (de) * | 1971-02-08 | 1981-09-24 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von 3-substituierten 2,1,3-Benzothiadiazin-4-on-2,2-dioxiden |
| DE2131401C3 (de) * | 1971-06-24 | 1981-09-24 | Basf Ag, 6700 Ludwigshafen | Herbizides Gemisch auf Benzothiadiazinondioxid-Basis |
| BE793231A (fr) | 1971-12-23 | 1973-06-22 | Basf Ag | Procede de preparation d'halogenures d'acides |
| BE794013A (fr) * | 1972-01-13 | 1973-07-12 | Basf Ag | Anilides d'acide o-(aminosulfonyl)-glycolique substitues |
| US3992444A (en) * | 1972-12-19 | 1976-11-16 | Basf Aktiengesellschaft | Production of sulfamic acid halides |
| DE2310757A1 (de) * | 1973-03-03 | 1974-09-12 | Basf Ag | Substituierte o-(aminosulfonyl)glykolsaeureanilide |
| DE2349114C2 (de) * | 1973-09-29 | 1985-11-14 | Basf Ag, 6700 Ludwigshafen | 3-sek.-Butyl-2,1,3-benzothiadiazin-(4)-on-2,2-dioxid |
| US4014931A (en) * | 1974-01-08 | 1977-03-29 | Basf Aktiengesellschaft | Production of β-haloalkylaminosulfonyl halides |
| DE2424371C2 (de) | 1974-05-20 | 1984-07-26 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Amidosulfonsäuren |
| US4101571A (en) * | 1975-03-29 | 1978-07-18 | Basf Aktiengesellschaft | Manufacture of sulfamic acid halides |
| DE2514937A1 (de) * | 1975-04-05 | 1976-10-14 | Basf Ag | Verfahren zur herstellung von sulfamidsaeurehalogeniden |
| DE2553460C2 (de) * | 1975-11-28 | 1987-05-14 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Sulfamidsäurehalogeniden |
| DE2628195C2 (de) * | 1976-06-23 | 1978-06-08 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Amidosulfonsäuren |
-
1978
- 1978-12-02 DE DE19782852274 patent/DE2852274A1/de not_active Withdrawn
-
1979
- 1979-11-19 IL IL58745A patent/IL58745A/xx unknown
- 1979-11-19 EP EP79104566A patent/EP0011794B1/de not_active Expired
- 1979-11-19 DE DE7979104566T patent/DE2961027D1/de not_active Expired
- 1979-11-26 US US06/097,310 patent/US4260560A/en not_active Expired - Lifetime
- 1979-11-27 SU SU792846544A patent/SU1015822A3/ru active
- 1979-11-30 JP JP15447679A patent/JPS5585559A/ja active Granted
- 1979-11-30 HU HU79BA3897A patent/HU183084B/hu unknown
Non-Patent Citations (1)
| Title |
|---|
| 1. выложенна за вка DE 2514937, КЛ. С 07 С 143/86, опублик. 1976. 2. Вьшоженна за вка DE 2164176, кл. 12 в,, 6/04, опублик. 1973 (прототип). * |
Also Published As
| Publication number | Publication date |
|---|---|
| HU183084B (en) | 1984-04-28 |
| EP0011794A2 (de) | 1980-06-11 |
| JPS5585559A (en) | 1980-06-27 |
| EP0011794A3 (en) | 1980-06-25 |
| IL58745A0 (en) | 1980-02-29 |
| DE2961027D1 (en) | 1981-12-24 |
| EP0011794B1 (de) | 1981-10-14 |
| DE2852274A1 (de) | 1980-06-19 |
| JPS6317058B2 (https=) | 1988-04-12 |
| IL58745A (en) | 1983-07-31 |
| US4260560A (en) | 1981-04-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU1015822A3 (ru) | Способ получени галогенангидридов сульфаминовой кислоты | |
| DK174513B1 (da) | Fremgangsmåde til fremstilling af bis-(3,5-dioxopiperazinyl)-alkaner eller -alkener | |
| US3969466A (en) | Preparation of hydrazodicarbonamide | |
| US3868418A (en) | Novel N-(ortho- and para-nitrobenzoyl)-sulfoximine intermediates and process for their production | |
| US3393253A (en) | Ureidophosphonates and preparation thereof | |
| US4379769A (en) | Process for preparing arylsulfonyl isocyanates by phosgenation of arylsulfonamides | |
| CA1047504A (en) | N-(2-pyrrolidinyl alkyl) substitutes and derivatives thereof | |
| HU201542B (en) | Process for production of ethilene-sulphat | |
| US4012467A (en) | Process for preparing an ester of the N-methyl-N-hydroxyethylguanidine | |
| US4558161A (en) | Process for preparing halo-substituted diarylsulfones | |
| US2706738A (en) | Method of preparing pyrophosphortetraamides of secondary aliphatic and secondary heterocyclic amines in the presence of an inorganic base | |
| US3542849A (en) | Process for the preparation of n-aryl-alpha-amino carboxylic acid esters | |
| US2800498A (en) | Carbamates of dialkylaminoalkyl p-aminobenzoates | |
| US3175001A (en) | Nitroarylamido-phosphoric acid esters and a process for their production | |
| US2850530A (en) | Substituted urea compounds and processes for preparing the same | |
| US3308132A (en) | 6, 8-dithiooctanoyl amides and intermediates | |
| JPS5840945B2 (ja) | 0−置換−n−ヒドロキシフタルイミドの製造方法 | |
| US2359863A (en) | Organic quaternary ammonium derivatives | |
| US2809966A (en) | Aminobenzene-sulphoiyyl-z-amino- | |
| US2475674A (en) | Dicyandiamide hydrochloride | |
| US3642776A (en) | 1-formyl-2-halogeno-azacycloalkenes and process for their production | |
| US3075012A (en) | Process for the production of n1-arylsulfonyl-n2-alkyl ureas | |
| US3525738A (en) | Piperazine estrone sulfate process | |
| JPH04224525A (ja) | 9,9−ジアルキルフルオレンの製造方法 | |
| JPS6324508B2 (https=) |