SE445455B - Forfarande for framstellning av nikotinylestern av 6-aminonikotinsyra - Google Patents
Forfarande for framstellning av nikotinylestern av 6-aminonikotinsyraInfo
- Publication number
- SE445455B SE445455B SE8203854A SE8203854A SE445455B SE 445455 B SE445455 B SE 445455B SE 8203854 A SE8203854 A SE 8203854A SE 8203854 A SE8203854 A SE 8203854A SE 445455 B SE445455 B SE 445455B
- Authority
- SE
- Sweden
- Prior art keywords
- temperature
- yield
- reaction
- aminonicotinic acid
- reflux temperature
- Prior art date
Links
- -1 NICOTINYL Chemical class 0.000 title claims description 18
- 238000000034 method Methods 0.000 title claims description 8
- 239000002253 acid Substances 0.000 title description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 24
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 23
- 238000006243 chemical reaction Methods 0.000 claims description 22
- ZCIFWRHIEBXBOY-UHFFFAOYSA-N 6-aminonicotinic acid Chemical compound NC1=CC=C(C(O)=O)C=N1 ZCIFWRHIEBXBOY-UHFFFAOYSA-N 0.000 claims description 18
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 16
- 238000010992 reflux Methods 0.000 claims description 13
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 12
- UZGLOGCJCWBBIV-UHFFFAOYSA-N 3-(chloromethyl)pyridin-1-ium;chloride Chemical compound Cl.ClCC1=CC=CN=C1 UZGLOGCJCWBBIV-UHFFFAOYSA-N 0.000 claims description 10
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 8
- 239000000376 reactant Substances 0.000 claims description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 claims 1
- NQXJJZAGIYNYLT-UHFFFAOYSA-N pyridin-3-ylmethyl 6-aminopyridine-3-carboxylate Chemical compound C1=NC(N)=CC=C1C(=O)OCC1=CC=CN=C1 NQXJJZAGIYNYLT-UHFFFAOYSA-N 0.000 claims 1
- 239000011541 reaction mixture Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000007810 chemical reaction solvent Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
- C07D213/80—Acids; Esters in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/275,577 US4375545A (en) | 1981-06-22 | 1981-06-22 | Process for the synthesis of the nicotinyl ester of 6-aminonicotinic acid |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| SE8203854D0 SE8203854D0 (sv) | 1982-06-21 |
| SE8203854L SE8203854L (sv) | 1982-12-23 |
| SE445455B true SE445455B (sv) | 1986-06-23 |
Family
ID=23052926
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE8203854A SE445455B (sv) | 1981-06-22 | 1982-06-21 | Forfarande for framstellning av nikotinylestern av 6-aminonikotinsyra |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4375545A (member.php) |
| JP (1) | JPS58964A (member.php) |
| AU (1) | AU551677B2 (member.php) |
| BE (1) | BE893603A (member.php) |
| CA (1) | CA1167852A (member.php) |
| CH (1) | CH648551A5 (member.php) |
| DE (1) | DE3222780A1 (member.php) |
| DK (1) | DK154969C (member.php) |
| FI (1) | FI77233C (member.php) |
| FR (1) | FR2508041B1 (member.php) |
| GB (1) | GB2105709B (member.php) |
| GR (1) | GR79491B (member.php) |
| IE (1) | IE53376B1 (member.php) |
| MY (1) | MY8800121A (member.php) |
| NZ (1) | NZ200815A (member.php) |
| SE (1) | SE445455B (member.php) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS60103066A (ja) * | 1983-11-02 | 1985-06-07 | 永大産業株式会社 | 成形物 |
| DE102004049761A1 (de) | 2004-10-12 | 2006-04-13 | Bayer Cropscience Ag | Fungizide Wirkstoffkombinationen |
| EP2910126A1 (en) | 2015-05-05 | 2015-08-26 | Bayer CropScience AG | Active compound combinations having insecticidal properties |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2199839A (en) * | 1938-02-28 | 1940-05-07 | Pyridium Corp | Esters of 6-amino-nicotinic acid |
| US4031104A (en) * | 1972-04-18 | 1977-06-21 | Bayer Aktiengesellschaft | 1,4-Dihydropyridine carboxylic acid esters |
| GB1442474A (en) * | 1974-09-05 | 1976-07-14 | Merz & Co | Process for the production of beta-2-p-chlorophenoxy-isobutyryloxy -ethyl nicotinate |
| US4067975A (en) * | 1975-08-04 | 1978-01-10 | Yu Ruey J | Treatment of psoriasis with 6-aminonicotinamide and thionicotinamide |
-
1981
- 1981-06-22 US US06/275,577 patent/US4375545A/en not_active Expired - Fee Related
-
1982
- 1982-05-25 AU AU84163/82A patent/AU551677B2/en not_active Ceased
- 1982-05-26 GR GR68264A patent/GR79491B/el unknown
- 1982-06-01 NZ NZ200815A patent/NZ200815A/en unknown
- 1982-06-03 FR FR8209650A patent/FR2508041B1/fr not_active Expired
- 1982-06-08 CA CA000404673A patent/CA1167852A/en not_active Expired
- 1982-06-17 FI FI822186A patent/FI77233C/fi not_active IP Right Cessation
- 1982-06-18 DK DK276182A patent/DK154969C/da not_active IP Right Cessation
- 1982-06-18 DE DE19823222780 patent/DE3222780A1/de active Granted
- 1982-06-21 CH CH3802/82A patent/CH648551A5/de not_active IP Right Cessation
- 1982-06-21 SE SE8203854A patent/SE445455B/sv not_active IP Right Cessation
- 1982-06-21 GB GB08217924A patent/GB2105709B/en not_active Expired
- 1982-06-21 IE IE1466/82A patent/IE53376B1/en unknown
- 1982-06-22 JP JP57106284A patent/JPS58964A/ja active Granted
- 1982-06-22 BE BE0/208414A patent/BE893603A/fr not_active IP Right Cessation
-
1988
- 1988-12-30 MY MY121/88A patent/MY8800121A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GR79491B (member.php) | 1984-10-30 |
| DK276182A (da) | 1982-12-23 |
| FI77233C (fi) | 1989-02-10 |
| FR2508041B1 (fr) | 1986-03-14 |
| SE8203854L (sv) | 1982-12-23 |
| CH648551A5 (de) | 1985-03-29 |
| CA1167852A (en) | 1984-05-22 |
| AU8416382A (en) | 1983-01-06 |
| FI77233B (fi) | 1988-10-31 |
| US4375545A (en) | 1983-03-01 |
| DK154969B (da) | 1989-01-16 |
| DK154969C (da) | 1989-06-05 |
| FR2508041A1 (fr) | 1982-12-24 |
| IE821466L (en) | 1982-12-22 |
| MY8800121A (en) | 1988-12-31 |
| SE8203854D0 (sv) | 1982-06-21 |
| DE3222780C2 (member.php) | 1989-12-28 |
| JPH0525876B2 (member.php) | 1993-04-14 |
| JPS58964A (ja) | 1983-01-06 |
| BE893603A (fr) | 1982-12-22 |
| DE3222780A1 (de) | 1983-01-05 |
| GB2105709B (en) | 1984-12-12 |
| FI822186L (fi) | 1982-12-23 |
| FI822186A0 (fi) | 1982-06-17 |
| NZ200815A (en) | 1985-02-28 |
| GB2105709A (en) | 1983-03-30 |
| IE53376B1 (en) | 1988-10-26 |
| AU551677B2 (en) | 1986-05-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69226590T2 (de) | Verfahren zur Herstellung von substituierten N-Aryl-1,2,4-Triazolopyrimidin-2-Sulfonamiden | |
| KR100210257B1 (ko) | 니트로구아니딘 유도체의 제조 방법 | |
| US4496736A (en) | Process for the preparation of carboxylic acids and N-tert.-alkylamines | |
| SE445455B (sv) | Forfarande for framstellning av nikotinylestern av 6-aminonikotinsyra | |
| CH674205A5 (member.php) | ||
| DE3438694A1 (de) | Neue amidoalkylmelamine und aminoalkylmelamine und verfahren zu ihrer herstellung | |
| US4900827A (en) | Process for the preparation of pyrimidine derivatives | |
| US3037977A (en) | Production of compounds of the pyrimidine series | |
| US4359428A (en) | Preparation of fluorinated anthranilic acid and anthranilonitrile | |
| RU2359963C2 (ru) | Производные нитросульфобензамида, способ их получения и их применение для получения производных сульфонилмочевины и их предшественников | |
| EP0182166B1 (en) | Process for preparing phenylisopropylurea compounds | |
| GB1595029A (en) | Manufacture of 2,1,3-thiadiazin-4-one-2,2-dioxide derivatives | |
| DE69221698T2 (de) | Verfahren zur Herstellung von Sulfonylharnstoffen | |
| DE2238042A1 (de) | Heterocyclische verbindungen und deren verwendung | |
| EP0478994B1 (de) | Verfahren zur Herstellung von 5-Hydroxy-3,4,5,6-tetrahydro-pyrimidin-Derivaten | |
| DE3829957A1 (de) | Verfahren zur herstellung von oxyguanidinen | |
| US5442072A (en) | Process for preparing chloromethylpyridines | |
| EP0339964B1 (en) | Improved synthesis of 4-methyl-3-thiosemicarbazide | |
| EP0114289B1 (de) | Verfahren zur Herstellung von 2-Alkylthiomethyl-4-hydroxypyrimidinen | |
| US3053827A (en) | 4-sulfanilamido-2, 6-dihalopyrimidine derivatives | |
| JPH09188662A (ja) | スルホン酸アミド化合物の製造方法 | |
| US4395555A (en) | Preparation of 2-aminopyridine derivatives | |
| EP0148500B1 (de) | Hydrazin-thiocarbonsäure-O-carbamoylmethylester | |
| US2740815A (en) | Production of amino carboxylic acid compounds | |
| KR0129550B1 (ko) | 아미노카르보닐 치환 피리딘술핀산 또는 그의 염 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NUG | Patent has lapsed |
Ref document number: 8203854-8 Effective date: 19920109 Format of ref document f/p: F |