SE443363B - Forfarande for framstellning av cyanursyra - Google Patents
Forfarande for framstellning av cyanursyraInfo
- Publication number
- SE443363B SE443363B SE7809944A SE7809944A SE443363B SE 443363 B SE443363 B SE 443363B SE 7809944 A SE7809944 A SE 7809944A SE 7809944 A SE7809944 A SE 7809944A SE 443363 B SE443363 B SE 443363B
- Authority
- SE
- Sweden
- Prior art keywords
- urea
- biuret
- sulfolane
- temperature
- reactor
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 21
- 239000002253 acid Substances 0.000 title 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 97
- 239000004202 carbamide Substances 0.000 claims description 97
- OHJMTUPIZMNBFR-UHFFFAOYSA-N biuret Chemical compound NC(=O)NC(N)=O OHJMTUPIZMNBFR-UHFFFAOYSA-N 0.000 claims description 91
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical group O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 claims description 57
- 239000000203 mixture Substances 0.000 claims description 23
- 230000008569 process Effects 0.000 claims description 18
- 239000012442 inert solvent Substances 0.000 claims description 14
- -1 alkyl sulfone Chemical class 0.000 claims description 8
- 150000001875 compounds Chemical class 0.000 claims description 7
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 239000007795 chemical reaction product Substances 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 239000011541 reaction mixture Substances 0.000 claims 4
- 125000004429 atom Chemical group 0.000 claims 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 42
- 238000004821 distillation Methods 0.000 description 27
- 230000000694 effects Effects 0.000 description 19
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 18
- 239000002002 slurry Substances 0.000 description 18
- 239000000047 product Substances 0.000 description 17
- OWIKHYCFFJSOEH-UHFFFAOYSA-N Isocyanic acid Chemical compound N=C=O OWIKHYCFFJSOEH-UHFFFAOYSA-N 0.000 description 16
- 238000012546 transfer Methods 0.000 description 16
- 238000001321 HNCO Methods 0.000 description 14
- 238000004458 analytical method Methods 0.000 description 12
- 238000011065 in-situ storage Methods 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 8
- 235000011007 phosphoric acid Nutrition 0.000 description 7
- 238000011084 recovery Methods 0.000 description 7
- 239000010802 sludge Substances 0.000 description 7
- 238000002474 experimental method Methods 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 239000012066 reaction slurry Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 3
- QYTOONVFPBUIJG-UHFFFAOYSA-N azane;cyanic acid Chemical compound [NH4+].[O-]C#N QYTOONVFPBUIJG-UHFFFAOYSA-N 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- FAXWFCTVSHEODL-UHFFFAOYSA-N 2,4-dibromophenol Chemical compound OC1=CC=C(Br)C=C1Br FAXWFCTVSHEODL-UHFFFAOYSA-N 0.000 description 2
- CFKMVGJGLGKFKI-UHFFFAOYSA-N 4-chloro-m-cresol Chemical compound CC1=CC(O)=CC=C1Cl CFKMVGJGLGKFKI-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- XLJMAIOERFSOGZ-UHFFFAOYSA-N anhydrous cyanic acid Natural products OC#N XLJMAIOERFSOGZ-UHFFFAOYSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 230000007246 mechanism Effects 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- HBRXQSHUXIJOKV-UHFFFAOYSA-N 5-methyl-1,3-oxazolidin-2-one Chemical compound CC1CNC(=O)O1 HBRXQSHUXIJOKV-UHFFFAOYSA-N 0.000 description 1
- LEHOTFFKMJEONL-UHFFFAOYSA-M 6,8-dioxo-6,7,8,9-tetrahydro-1H-purin-2-olate Chemical compound [N-]1C(=O)N=C2NC(=O)NC2=C1O LEHOTFFKMJEONL-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 238000011001 backwashing Methods 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000001896 cresols Chemical class 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000012527 feed solution Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000005215 recombination Methods 0.000 description 1
- 230000006798 recombination Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000005070 sampling Methods 0.000 description 1
- 230000002000 scavenging effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 238000010408 sweeping Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/30—Only oxygen atoms
- C07D251/32—Cyanuric acid; Isocyanuric acid
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/835,653 US4187376A (en) | 1977-09-22 | 1977-09-22 | Removal of contaminants from cyanuric acid reaction product |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7809944L SE7809944L (sv) | 1979-03-23 |
| SE443363B true SE443363B (sv) | 1986-02-24 |
Family
ID=25270098
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7809944A SE443363B (sv) | 1977-09-22 | 1978-09-21 | Forfarande for framstellning av cyanursyra |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4187376A (cs) |
| JP (1) | JPS5914462B2 (cs) |
| AU (1) | AU521884B2 (cs) |
| BE (1) | BE870703A (cs) |
| BR (1) | BR7806224A (cs) |
| CA (1) | CA1090342A (cs) |
| CH (1) | CH637645A5 (cs) |
| DE (1) | DE2841430A1 (cs) |
| ES (1) | ES473497A1 (cs) |
| FR (1) | FR2404000A1 (cs) |
| GB (1) | GB2005675B (cs) |
| IT (1) | IT1099140B (cs) |
| MX (1) | MX150295A (cs) |
| NL (1) | NL189761C (cs) |
| NO (1) | NO153531C (cs) |
| SE (1) | SE443363B (cs) |
| ZA (1) | ZA785232B (cs) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4282359A (en) * | 1980-03-31 | 1981-08-04 | Fmc Corporation | Purification of cyanuric acid |
| JPS62135263U (cs) * | 1986-02-19 | 1987-08-26 | ||
| AT403475B (de) * | 1994-07-22 | 1998-02-25 | Chemie Linz Gmbh | Verfahren zur herstellung von cyanursäure |
| DE4431811A1 (de) * | 1994-09-07 | 1996-03-14 | Chemie Linz Deutschland | Verfahren zur Herstellung von Cyanursäure durch Abscheidung aus einem Isocyansäure-Ammoniak Gasgemisch |
| KR100798109B1 (ko) * | 2006-08-11 | 2008-01-28 | 주식회사 제이앤드제이 캐미칼 | 뷰렛 및 시아누르산의 제조 방법 및 그 제조 장치 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3117963A (en) * | 1964-01-14 | A-phenylbenzyl | ||
| US3065233A (en) * | 1962-11-20 | |||
| US3164591A (en) * | 1965-01-05 | Preparation of cyanuric acid | ||
| US2368597A (en) * | 1943-02-08 | 1945-01-30 | Shell Dev | Solvent extraction process |
| US2357028A (en) * | 1943-08-04 | 1944-08-29 | Shell Dev | Solvent extraction process |
| GB950826A (en) * | 1959-06-24 | 1964-02-26 | Whiffen & Sons Ltd | Cyanuric acid production |
| DE1770827C3 (de) * | 1968-07-09 | 1975-02-06 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Cyanursäure |
| US3563987A (en) * | 1969-04-01 | 1971-02-16 | Fmc Corp | Preparation of cyanuric acid |
| DE2300037A1 (de) * | 1973-01-02 | 1974-07-04 | Basf Ag | Verfahren zur kontinuierlichen herstellung von cyanursaeure |
| NL180419C (nl) * | 1974-11-12 | 1987-02-16 | Stamicarbon | Werkwijze voor het zuiveren van cyanuurzuur. |
-
1977
- 1977-09-22 US US05/835,653 patent/US4187376A/en not_active Expired - Lifetime
-
1978
- 1978-08-25 CA CA310,070A patent/CA1090342A/en not_active Expired
- 1978-09-06 MX MX174790A patent/MX150295A/es unknown
- 1978-09-14 ZA ZA00785232A patent/ZA785232B/xx unknown
- 1978-09-15 AU AU39913/78A patent/AU521884B2/en not_active Expired
- 1978-09-18 NL NLAANVRAGE7809473,A patent/NL189761C/xx not_active IP Right Cessation
- 1978-09-20 ES ES473497A patent/ES473497A1/es not_active Expired
- 1978-09-21 BR BR7806224A patent/BR7806224A/pt unknown
- 1978-09-21 SE SE7809944A patent/SE443363B/sv not_active IP Right Cessation
- 1978-09-21 JP JP53115231A patent/JPS5914462B2/ja not_active Expired
- 1978-09-21 IT IT27946/78A patent/IT1099140B/it active
- 1978-09-21 NO NO783210A patent/NO153531C/no unknown
- 1978-09-22 GB GB7837732A patent/GB2005675B/en not_active Expired
- 1978-09-22 CH CH994778A patent/CH637645A5/de not_active IP Right Cessation
- 1978-09-22 FR FR7827155A patent/FR2404000A1/fr active Granted
- 1978-09-22 DE DE19782841430 patent/DE2841430A1/de active Granted
- 1978-09-22 BE BE190666A patent/BE870703A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5914462B2 (ja) | 1984-04-04 |
| ZA785232B (en) | 1979-08-29 |
| NL189761C (nl) | 1993-07-16 |
| NL189761B (nl) | 1993-02-16 |
| NO153531C (no) | 1986-05-14 |
| MX150295A (es) | 1984-04-11 |
| AU521884B2 (en) | 1982-05-06 |
| AU3991378A (en) | 1980-03-20 |
| SE7809944L (sv) | 1979-03-23 |
| JPS5455589A (en) | 1979-05-02 |
| CH637645A5 (de) | 1983-08-15 |
| ES473497A1 (es) | 1979-04-16 |
| BR7806224A (pt) | 1979-04-17 |
| NO783210L (no) | 1979-03-23 |
| IT1099140B (it) | 1985-09-18 |
| DE2841430C2 (cs) | 1988-09-15 |
| US4187376A (en) | 1980-02-05 |
| IT7827946A0 (it) | 1978-09-21 |
| FR2404000B1 (cs) | 1983-01-21 |
| GB2005675A (en) | 1979-04-25 |
| NO153531B (no) | 1985-12-30 |
| CA1090342A (en) | 1980-11-25 |
| DE2841430A1 (de) | 1986-10-02 |
| GB2005675B (en) | 1982-04-07 |
| FR2404000A1 (fr) | 1979-04-20 |
| NL7809473A (nl) | 1979-03-26 |
| BE870703A (fr) | 1979-03-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CN101743236B (zh) | 4-氟-1,3-二氧戊环-2-酮的制造方法 | |
| KR20120026042A (ko) | 트리알릴 이소시아누레이트의 저장방법 | |
| WO2008016401A1 (en) | Process for scrubbing ammonia from acid gases comprising ammonia and hydrogen sulfide | |
| EP0891342A1 (en) | Process for the preparation of cyclic perfluoroalkanebis(sulfonyl)imides and such novel four-membered imides | |
| JPH0321023B2 (cs) | ||
| SE443363B (sv) | Forfarande for framstellning av cyanursyra | |
| KR20060046471A (ko) | 고순도 트리메틸알루미늄 및 조-트리메틸알루미늄의 정제방법 | |
| CN111630093A (zh) | 用于回收基于酰胺的化合物的方法 | |
| US3379510A (en) | Phosphonitrilic chloride process | |
| CN102757026B (zh) | 一种氟代磷腈化合物的制备方法 | |
| CN113474329B (zh) | 制备4,4′-二氯二苯亚砜的方法 | |
| Challenger et al. | IV.—Organo-derivatives of bismuth. Part II. The stability of derivatives of quinquevalent bismuth | |
| US3284466A (en) | Preparation of monomeric disulfides | |
| US5932762A (en) | Process for the production of aryl cyanates | |
| US3092637A (en) | Process for the preparation of acetals and ketals of nu, nu-disubstituted carboxamides | |
| WO1998031691A1 (en) | Recovery of n-hydrocarbyl(thio)phosphoric triamides from reaction mixtures | |
| US3101344A (en) | Process for preparing tetracyano-1,4-dithiin | |
| US4224256A (en) | Method of preparing ether adducts of organic-alkali metal-boron salts | |
| JPH05230015A (ja) | カプロラクタムの精製法 | |
| US2777847A (en) | Products | |
| US3116309A (en) | Heterocyclic compounds containing ring carbon, nitrogen and phosphorus or arsenic atoms and their preparation | |
| CA1307492C (en) | Gas and alcohol recovery process | |
| Davies | XXXVII.—Synthetical experiments with ββ′-dichloroethyl sulphide | |
| US20090274604A1 (en) | Production Method of High Purity Silver Tetrafluoroborate | |
| US4150103A (en) | Foam prevention during the regeneration of waste sulfuric acid with aromatic nitro compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 7809944-7 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 7809944-7 Format of ref document f/p: F |