SE405968B - Kontinuerligt forfarande for framstellning av (2-cyanetyl)-ketoner - Google Patents
Kontinuerligt forfarande for framstellning av (2-cyanetyl)-ketonerInfo
- Publication number
- SE405968B SE405968B SE7212671A SE1267172A SE405968B SE 405968 B SE405968 B SE 405968B SE 7212671 A SE7212671 A SE 7212671A SE 1267172 A SE1267172 A SE 1267172A SE 405968 B SE405968 B SE 405968B
- Authority
- SE
- Sweden
- Prior art keywords
- reaction mixture
- ketone
- acrylonitrile
- reaction
- weight
- Prior art date
Links
- 150000002576 ketones Chemical class 0.000 title claims description 11
- 238000000034 method Methods 0.000 title claims description 9
- 239000011541 reaction mixture Substances 0.000 claims description 27
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 claims description 24
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 24
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 23
- 238000006243 chemical reaction Methods 0.000 claims description 23
- 239000001301 oxygen Substances 0.000 claims description 23
- 229910052760 oxygen Inorganic materials 0.000 claims description 23
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 22
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 claims description 20
- 239000003054 catalyst Substances 0.000 claims description 9
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N 3-Methylbutan-2-one Chemical compound CC(C)C(C)=O SYBYTAAJFKOIEJ-UHFFFAOYSA-N 0.000 claims description 4
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 4
- XNLICIUVMPYHGG-UHFFFAOYSA-N pentan-2-one Chemical compound CCCC(C)=O XNLICIUVMPYHGG-UHFFFAOYSA-N 0.000 claims description 4
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 3
- 239000011261 inert gas Substances 0.000 claims description 3
- LFSAPCRASZRSKS-UHFFFAOYSA-N 2-methylcyclohexan-1-one Chemical compound CC1CCCCC1=O LFSAPCRASZRSKS-UHFFFAOYSA-N 0.000 claims description 2
- 239000002253 acid Substances 0.000 claims description 2
- -1 alkyl amide Chemical class 0.000 claims description 2
- 239000007788 liquid Substances 0.000 claims description 2
- RFFXUIKJDDUCGI-UHFFFAOYSA-N 4-oxoheptanedinitrile Chemical compound N#CCCC(=O)CCC#N RFFXUIKJDDUCGI-UHFFFAOYSA-N 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 238000010924 continuous production Methods 0.000 claims 1
- 239000007791 liquid phase Substances 0.000 claims 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 8
- 239000007787 solid Substances 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 5
- 239000003112 inhibitor Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 239000005711 Benzoic acid Substances 0.000 description 4
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 4
- 235000010233 benzoic acid Nutrition 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 230000008021 deposition Effects 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- KDSNLYIMUZNERS-UHFFFAOYSA-N 2-methylpropanamine Chemical compound CC(C)CN KDSNLYIMUZNERS-UHFFFAOYSA-N 0.000 description 2
- SPTVCXKSSRBTMN-UHFFFAOYSA-N 3-(2-oxocyclohexyl)propanenitrile Chemical compound O=C1CCCCC1CCC#N SPTVCXKSSRBTMN-UHFFFAOYSA-N 0.000 description 2
- ZUEOZCBPTFMWGI-UHFFFAOYSA-N 4-oxohexanenitrile Chemical compound CCC(=O)CCC#N ZUEOZCBPTFMWGI-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000002262 Schiff base Substances 0.000 description 2
- 150000004753 Schiff bases Chemical class 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- DPBLXKKOBLCELK-UHFFFAOYSA-N pentan-1-amine Chemical group CCCCCN DPBLXKKOBLCELK-UHFFFAOYSA-N 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- RBTBFTRPCNLSDE-UHFFFAOYSA-N 3,7-bis(dimethylamino)phenothiazin-5-ium Chemical compound C1=CC(N(C)C)=CC2=[S+]C3=CC(N(C)C)=CC=C3N=C21 RBTBFTRPCNLSDE-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- UBAZGMLMVVQSCD-UHFFFAOYSA-N carbon dioxide;molecular oxygen Chemical compound O=O.O=C=O UBAZGMLMVVQSCD-UHFFFAOYSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 235000011167 hydrochloric acid Nutrition 0.000 description 1
- 229960000907 methylthioninium chloride Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 229940100684 pentylamine Drugs 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- BHRZNVHARXXAHW-UHFFFAOYSA-N sec-butylamine Chemical compound CCC(C)N BHRZNVHARXXAHW-UHFFFAOYSA-N 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NLAANVRAGE7113332,A NL169876C (nl) | 1971-09-29 | 1971-09-29 | Werkwijze voor de bereiding van cyanogeethyleerde ketonen. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SE405968B true SE405968B (sv) | 1979-01-15 |
Family
ID=19814128
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7212671A SE405968B (sv) | 1971-09-29 | 1972-09-29 | Kontinuerligt forfarande for framstellning av (2-cyanetyl)-ketoner |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3816503A (enExample) |
| JP (1) | JPS506452B2 (enExample) |
| BE (1) | BE789235A (enExample) |
| CA (1) | CA973893A (enExample) |
| CH (1) | CH582656A5 (enExample) |
| DE (1) | DE2246284C2 (enExample) |
| FR (1) | FR2158834A5 (enExample) |
| GB (1) | GB1368506A (enExample) |
| IT (1) | IT972356B (enExample) |
| NL (1) | NL169876C (enExample) |
| SE (1) | SE405968B (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2329923C3 (de) * | 1973-06-13 | 1980-01-17 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von 5-Oxohexannitri! |
| NL7609478A (nl) * | 1976-08-26 | 1978-02-28 | Stamicarbon | Werkwijze voor de bereiding van 4-oxocaproni- tril. |
| JPS5494956U (enExample) * | 1977-12-14 | 1979-07-05 | ||
| NL7808605A (nl) * | 1978-08-19 | 1980-02-21 | Stamicarbon | Werkwijze voor de bereiding van delta-ketozuren en derivaten hiervan. |
| US4331549A (en) * | 1980-04-21 | 1982-05-25 | The Dow Chemical Company | Hydraulic fluids containing cyano derivatives of ketones |
| US5254712A (en) * | 1990-01-06 | 1993-10-19 | Stamicarbon B.V. | Process for the preparation of 5-oxohexane nitriles and the compound 2,4-dimethyl-5-oxohexane nitrile |
| NL9000034A (nl) * | 1990-01-06 | 1991-08-01 | Stamicarbon | Werkwijze voor de bereiding van 5-oxohexaannitrillen alsmede de stof 2,4-dimethyl-5-oxohexaannitril. |
| US6310032B1 (en) | 2000-03-02 | 2001-10-30 | International Flavors & Fragrances Inc. | α-Oxygen-substituted cyclohexane propionitriles, perfumery uses thereof and processes for preparing same |
-
0
- BE BE789235D patent/BE789235A/xx not_active IP Right Cessation
-
1971
- 1971-09-29 NL NLAANVRAGE7113332,A patent/NL169876C/xx not_active IP Right Cessation
-
1972
- 1972-09-18 GB GB4316672A patent/GB1368506A/en not_active Expired
- 1972-09-19 US US00290360A patent/US3816503A/en not_active Expired - Lifetime
- 1972-09-19 CA CA152,044A patent/CA973893A/en not_active Expired
- 1972-09-20 CH CH1375572A patent/CH582656A5/xx not_active IP Right Cessation
- 1972-09-21 DE DE2246284A patent/DE2246284C2/de not_active Expired
- 1972-09-25 JP JP47096069A patent/JPS506452B2/ja not_active Expired
- 1972-09-28 IT IT53039/72A patent/IT972356B/it active
- 1972-09-28 FR FR7234364A patent/FR2158834A5/fr not_active Expired
- 1972-09-29 SE SE7212671A patent/SE405968B/sv unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE2246284C2 (de) | 1986-12-04 |
| NL169876B (nl) | 1982-04-01 |
| JPS506452B2 (enExample) | 1975-03-14 |
| BE789235A (fr) | 1973-03-26 |
| GB1368506A (en) | 1974-09-25 |
| CH582656A5 (enExample) | 1976-12-15 |
| FR2158834A5 (enExample) | 1973-06-15 |
| DE2246284A1 (de) | 1973-04-05 |
| NL7113332A (enExample) | 1973-04-02 |
| CA973893A (en) | 1975-09-02 |
| NL169876C (nl) | 1982-09-01 |
| JPS4840718A (enExample) | 1973-06-15 |
| US3816503A (en) | 1974-06-11 |
| IT972356B (it) | 1974-05-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4045464A (en) | Process for the preparation of aromatic carbonates | |
| SE405968B (sv) | Kontinuerligt forfarande for framstellning av (2-cyanetyl)-ketoner | |
| KR100271775B1 (ko) | 2-알킬-6-메틸-n-(1'-메톡시-2'-프로필)-아날린의 제조방법 및 이들의 클로르아세트아닐리드의 제조방법 | |
| US2422013A (en) | Preparation of imines | |
| DK145295B (da) | Fremgangsmaade til fremstilling af aromatiske urethaner | |
| US2540736A (en) | Addition products of acetylene and their preparation | |
| GB2078748A (en) | Preparation of 2-methylenealdehydes | |
| SE445638B (sv) | Sett att framstella karboxylsyror genom katalytisk oxidation av aldehyder | |
| US4001232A (en) | Process for preparing 1-substituted 2-methyl-tetrahydropyrimidines | |
| US4308216A (en) | Process for the preparation of aromatic dicarboxylic acid dichlorides | |
| US3342853A (en) | Method for the preparation of acrylate dimers and trimers | |
| US2765340A (en) | Method for preparing aldimines | |
| US3013064A (en) | Preparation of lower alkyl carbamates | |
| JPS6340176B2 (enExample) | ||
| PL85136B1 (enExample) | ||
| US2731499A (en) | Process for preparing oximinoacetone | |
| US2462221A (en) | Process for the production of acetarylamides | |
| CN114409572A (zh) | 一种十二烷基异氰酸酯的制备、提纯方法及提纯装置 | |
| US2213204A (en) | Catalytic production of arylnaphthyl amines | |
| JPS6052694B2 (ja) | 4‐オキソカプロニトリルの製造方法 | |
| US3375279A (en) | Dialkynyl amines | |
| JPH03392B2 (enExample) | ||
| US2745865A (en) | Preparation of cyanohydrins | |
| US4288625A (en) | Dinitriles, diamines, and polyamides | |
| US2766280A (en) | Preparation of phthalic acids |