PT91757B - Processo de preparacao de gama-butirobetaina - Google Patents
Processo de preparacao de gama-butirobetaina Download PDFInfo
- Publication number
- PT91757B PT91757B PT91757A PT9175789A PT91757B PT 91757 B PT91757 B PT 91757B PT 91757 A PT91757 A PT 91757A PT 9175789 A PT9175789 A PT 9175789A PT 91757 B PT91757 B PT 91757B
- Authority
- PT
- Portugal
- Prior art keywords
- acid
- reaction
- bars
- pressure
- chlorobutyric acid
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 18
- 238000002360 preparation method Methods 0.000 title claims description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 24
- 238000006243 chemical reaction Methods 0.000 claims description 19
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 claims description 19
- 239000002253 acid Substances 0.000 claims description 14
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 13
- RVBUZBPJAGZHSQ-UHFFFAOYSA-N 2-chlorobutanoic acid Chemical compound CCC(Cl)C(O)=O RVBUZBPJAGZHSQ-UHFFFAOYSA-N 0.000 claims description 6
- 150000002148 esters Chemical class 0.000 claims description 6
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 claims description 4
- 238000007127 saponification reaction Methods 0.000 claims description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 2
- IMKUQCXMPMOQOI-UHFFFAOYSA-N butanoic acid;n,n-dimethylmethanamine Chemical compound C[NH+](C)C.CCCC([O-])=O IMKUQCXMPMOQOI-UHFFFAOYSA-N 0.000 claims description 2
- 239000012467 final product Substances 0.000 claims description 2
- 125000005907 alkyl ester group Chemical group 0.000 claims 3
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 238000002955 isolation Methods 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- 239000000243 solution Substances 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 8
- YEJRWHAVMIAJKC-UHFFFAOYSA-N 4-Butyrolactone Chemical compound O=C1CCCO1 YEJRWHAVMIAJKC-UHFFFAOYSA-N 0.000 description 6
- 150000004702 methyl esters Chemical class 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 3
- 229930188620 butyrolactone Natural products 0.000 description 3
- 238000005886 esterification reaction Methods 0.000 description 3
- 125000004494 ethyl ester group Chemical group 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- PHIQHXFUZVPYII-ZCFIWIBFSA-N (R)-carnitine Chemical compound C[N+](C)(C)C[C@H](O)CC([O-])=O PHIQHXFUZVPYII-ZCFIWIBFSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- -1 aliphatic alcohols Chemical class 0.000 description 2
- 238000000909 electrodialysis Methods 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000002906 microbiologic effect Effects 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- HAIUIAZIUDPZIE-UHFFFAOYSA-N 3-bromobutanoic acid Chemical compound CC(Br)CC(O)=O HAIUIAZIUDPZIE-UHFFFAOYSA-N 0.000 description 1
- 241001214789 Basilea Species 0.000 description 1
- 101150071403 INP1 gene Proteins 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 229960004203 carnitine Drugs 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- QTEITWPJVHAOTN-UHFFFAOYSA-N ethyl 2-chlorobutanoate Chemical compound CCOC(=O)C(Cl)CC QTEITWPJVHAOTN-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C229/00—Compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C229/02—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C229/04—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C229/06—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one amino and one carboxyl group bound to the carbon skeleton
- C07C229/10—Compounds containing amino and carboxyl groups bound to the same carbon skeleton having amino and carboxyl groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being acyclic and saturated having only one amino and one carboxyl group bound to the carbon skeleton the nitrogen atom of the amino group being further bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C227/00—Preparation of compounds containing amino and carboxyl groups bound to the same carbon skeleton
- C07C227/04—Formation of amino groups in compounds containing carboxyl groups
- C07C227/06—Formation of amino groups in compounds containing carboxyl groups by addition or substitution reactions, without increasing the number of carbon atoms in the carbon skeleton of the acid
- C07C227/08—Formation of amino groups in compounds containing carboxyl groups by addition or substitution reactions, without increasing the number of carbon atoms in the carbon skeleton of the acid by reaction of ammonia or amines with acids containing functional groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Picture Signal Circuits (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Compounds Of Unknown Constitution (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Medicinal Preparation (AREA)
- Transforming Electric Information Into Light Information (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH351488 | 1988-09-21 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PT91757A PT91757A (pt) | 1990-03-30 |
| PT91757B true PT91757B (pt) | 1995-05-31 |
Family
ID=4257629
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PT91757A PT91757B (pt) | 1988-09-21 | 1989-09-20 | Processo de preparacao de gama-butirobetaina |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US5087745A (enExample) |
| EP (1) | EP0360222B1 (enExample) |
| JP (1) | JPH0291049A (enExample) |
| AT (1) | ATE86605T1 (enExample) |
| CA (1) | CA1297497C (enExample) |
| CZ (1) | CZ278975B6 (enExample) |
| DD (1) | DD284220A5 (enExample) |
| DE (1) | DE58903714D1 (enExample) |
| DK (1) | DK175100B1 (enExample) |
| ES (1) | ES2053899T3 (enExample) |
| FI (1) | FI94751C (enExample) |
| IL (1) | IL91607A0 (enExample) |
| MX (1) | MX170034B (enExample) |
| NO (1) | NO173603C (enExample) |
| PT (1) | PT91757B (enExample) |
| RU (1) | RU1836333C (enExample) |
| SK (1) | SK280453B6 (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1261230B (it) * | 1993-04-08 | 1996-05-09 | Sigma Tau Ind Farmaceuti | Procedimento migliorato per la preparazione di l-(-)-carnitina a partire da suoi precursori aventi opposta configurazione. |
| IT1261231B (it) * | 1993-04-08 | 1996-05-09 | Sigma Tau Ind Farmaceuti | Procedimento migliorato per la preparazione di l-(-)-carnitina a partire da un prodotto di scarto avente opposta configurazione. |
| DE19634640A1 (de) * | 1996-08-27 | 1998-03-05 | Basf Ag | Verfahren zur Reinigung von Lösungen, die Betain enthalten, durch Elektrodialyse und mittels eines Kationenaustauschermoduls |
| ATE356214T1 (de) * | 2001-01-31 | 2007-03-15 | Lonza Ag | Mikrobiologisches verfahren zur herstellung von l-carnitin |
| EP2069290B1 (en) * | 2006-09-04 | 2013-11-13 | Jorge Silva | Method for producing 3-(2,2,2-trimethylhydrazinium)propionate dihydrate |
| LV14345B (lv) * | 2009-10-22 | 2011-07-20 | Grindeks, A/S | 4-[Etil(dimetil)amonija]butanoāts un tā izmantošana kardiovaskulāro slimību ārstēšanai |
| RU2720985C1 (ru) * | 2019-07-04 | 2020-05-15 | Федеральное государственное унитарное предприятие "Научно-исследовательский институт гигиены, профпатологии и экологии человека" Федерального медико-биологического агентства | Способ получения гамма-бутиробетаина и его гидрохлорида |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2313573A (en) * | 1938-01-17 | 1943-03-09 | Gen Aniline & Film Corp | Capillary active compounds and process of preparing them |
| US2367878A (en) * | 1939-05-04 | 1945-01-23 | Hoffmann La Roche | Betaine esters |
| GB1100295A (en) * | 1964-11-30 | 1968-01-24 | Daiichi Seiyaku Company Ltd | Cosmetic preparations for hair-nourishing or hair-growing |
| FR1559839A (enExample) * | 1968-01-30 | 1969-03-14 | ||
| ES370147A1 (es) * | 1968-08-29 | 1971-04-01 | Gulf Research Development Co | Un procedimiento para fabricar ciclopropilamina. |
| US3711549A (en) * | 1970-05-19 | 1973-01-16 | Gulf Research Development Co | Process for manufacturing cyclopropylamine |
| US3796632A (en) * | 1971-12-10 | 1974-03-12 | Toray Industries | Process for racemizing alpha-amino-epsilon-caprolactam |
| BE795170A (fr) * | 1972-02-09 | 1973-08-08 | Procter & Gamble | Procede pour l'obtention de derives tensioactifs de betaine |
| JPS5136732A (ja) * | 1974-09-25 | 1976-03-27 | Katsutoshi Okamoto | Konkuriitodasetsuyotenjomenkariwakunotoritsuke torihazushisochi |
| JPS538684A (en) * | 1976-07-12 | 1978-01-26 | Nippon Foil Mfg | Heat adhesive alminium foil |
| DE2751134C2 (de) * | 1977-11-16 | 1986-04-17 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von γ-Chlorcarbonsäureestern |
| IT1142201B (it) * | 1980-06-24 | 1986-10-08 | Sigma Tau Ind Farmaceuti | Procedimento per la produzione enzimatica di l-carnitina |
| DE3214953A1 (de) * | 1982-04-22 | 1983-10-27 | Hoechst Ag, 6230 Frankfurt | Mikrobielle polysaccharide, verfahren zu ihrer herstellung, dafuer geeignete mikroorganismen und verwendung der polysaccharide |
| JPS59192095A (ja) * | 1983-04-13 | 1984-10-31 | Ajinomoto Co Inc | L−カルニチンの製造法 |
| JPS6165850A (ja) * | 1984-09-08 | 1986-04-04 | Junichi Iwamura | ベタイン類誘導体及びその製造方法並びにコリンエステラ−ゼ基質 |
| CH664374A5 (de) * | 1985-02-27 | 1988-02-29 | Lonza Ag | Verfahren zur herstellung von l-carnitin auf mikrobiologischem weg. |
| IT1190280B (it) * | 1986-04-24 | 1988-02-16 | Sigma Tau Ind Farmaceuti | Procedimento per la preparazione di gamma-butirrobetaina |
-
1989
- 1989-07-05 JP JP1173896A patent/JPH0291049A/ja active Granted
- 1989-08-18 FI FI893900A patent/FI94751C/fi active IP Right Grant
- 1989-09-11 IL IL91607A patent/IL91607A0/xx not_active IP Right Cessation
- 1989-09-11 CA CA000610959A patent/CA1297497C/en not_active Expired - Lifetime
- 1989-09-15 MX MX017568A patent/MX170034B/es unknown
- 1989-09-18 DD DD89332759A patent/DD284220A5/de not_active IP Right Cessation
- 1989-09-19 ES ES89117307T patent/ES2053899T3/es not_active Expired - Lifetime
- 1989-09-19 EP EP89117307A patent/EP0360222B1/de not_active Expired - Lifetime
- 1989-09-19 RU SU894614913A patent/RU1836333C/ru active
- 1989-09-19 DE DE8989117307T patent/DE58903714D1/de not_active Expired - Lifetime
- 1989-09-19 AT AT89117307T patent/ATE86605T1/de not_active IP Right Cessation
- 1989-09-20 PT PT91757A patent/PT91757B/pt not_active IP Right Cessation
- 1989-09-20 DK DK198904638A patent/DK175100B1/da not_active IP Right Cessation
- 1989-09-20 NO NO893740A patent/NO173603C/no not_active IP Right Cessation
- 1989-09-20 CZ CS895384A patent/CZ278975B6/cs not_active IP Right Cessation
- 1989-09-20 SK SK5384-89A patent/SK280453B6/sk unknown
-
1991
- 1991-03-12 US US07/667,367 patent/US5087745A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| NO173603C (no) | 1994-01-05 |
| CZ538489A3 (en) | 1994-04-13 |
| EP0360222A1 (de) | 1990-03-28 |
| RU1836333C (ru) | 1993-08-23 |
| DK463889A (da) | 1990-03-22 |
| EP0360222B1 (de) | 1993-03-10 |
| NO173603B (no) | 1993-09-27 |
| DD284220A5 (de) | 1990-11-07 |
| DK175100B1 (da) | 2004-06-01 |
| SK538489A3 (en) | 2000-02-14 |
| IL91607A0 (en) | 1990-04-29 |
| SK280453B6 (sk) | 2000-02-14 |
| FI893900L (fi) | 1990-03-22 |
| JPH0291049A (ja) | 1990-03-30 |
| FI893900A0 (fi) | 1989-08-18 |
| FI94751B (fi) | 1995-07-14 |
| ATE86605T1 (de) | 1993-03-15 |
| US5087745A (en) | 1992-02-11 |
| DE58903714D1 (de) | 1993-04-15 |
| FI94751C (fi) | 1995-10-25 |
| NO893740L (no) | 1990-03-22 |
| MX170034B (es) | 1993-08-04 |
| CA1297497C (en) | 1992-03-17 |
| NO893740D0 (no) | 1989-09-20 |
| PT91757A (pt) | 1990-03-30 |
| JPH0466859B2 (enExample) | 1992-10-26 |
| CZ278975B6 (en) | 1994-11-16 |
| ES2053899T3 (es) | 1994-08-01 |
| DK463889D0 (da) | 1989-09-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2528267A (en) | Eobeet j | |
| US5739365A (en) | Method for preparing ammonium hydroxyalkyl sulfonates and ammonium alkanoyl alkyl sulfonates produced therefrom | |
| PT91757B (pt) | Processo de preparacao de gama-butirobetaina | |
| US2970165A (en) | Sulfate compounds | |
| Wolfrom et al. | D-Xylosamine1 | |
| Ingersoll et al. | Solubility Relationships among Optically Isomeric Salts. IV. Salts of 6, 6'-Dinitrodiphenic Acid, a New Type of Resolving Agent | |
| RU2155186C1 (ru) | Способ получения бромистого дидецилдиметиламмония | |
| US3819689A (en) | Resolution of dl-camphor-10-sulfonic acid | |
| KR20020091077A (ko) | α-(2-4-디술포페닐)-N-tert-부틸니트론 및 제약상허용되는 그의 염의 신규 제조 방법 | |
| Huber | Mono-α-aminoacyl and mono-α-dipeptide triglycerides | |
| JP3407336B2 (ja) | アミノエタンスルホン酸類の精製方法 | |
| JP2907520B2 (ja) | 界面活性剤の製造方法 | |
| US2783274A (en) | Method of making serine | |
| EP0009290B1 (en) | 3-azabicyclo(3.1.0)hexane derivatives and process for their preparation | |
| JPS6174588A (ja) | 乳酸エステルの製法 | |
| NO814347L (no) | Fremgangsmaate til adskillelse av svovelsyre fra den ved sulfoksydasjon av parafiner dannede reaksjonsblanding | |
| US2883399A (en) | Method of preparing l(+)-glutamine | |
| DE940833C (de) | Verfahren zur Herstellung von 5, 6-Dimethylbenzimidazol-N-ª‰-d-ribofuranosid (ª‰-Ribazol) | |
| US3714242A (en) | Process for the preparation of l-dopa | |
| US3911015A (en) | Substituted alkanol-thio-alkylamines and salts thereof | |
| JP3735914B2 (ja) | アミノエステル化合物の製造方法 | |
| Stanfield et al. | Spiroaminobarbituric Acids. I1 | |
| US2017976A (en) | Complex compound of alkali- and alkaline earth-metal halides | |
| US1957461A (en) | Acetyl-choline salts, dimethylamino-ethyl acetate, and process for their production | |
| US3014068A (en) | Preparation of beta-resorcylic acids |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FG3A | Patent granted, date of granting |
Effective date: 19941114 |
|
| MM4A | Annulment/lapse due to non-payment of fees, searched and examined patent |
Free format text: MAXIMUM VALIDITY LIMIT REACHED Effective date: 20091114 |