PT100083A - Novos derivados de tiazolo-{2,3-a}-isoindol e sua utilizacao como produtos farmaceuticos anti-viricos e processo para a preparacao desses derivados - Google Patents
Novos derivados de tiazolo-{2,3-a}-isoindol e sua utilizacao como produtos farmaceuticos anti-viricos e processo para a preparacao desses derivados Download PDFInfo
- Publication number
- PT100083A PT100083A PT100083A PT10008392A PT100083A PT 100083 A PT100083 A PT 100083A PT 100083 A PT100083 A PT 100083A PT 10008392 A PT10008392 A PT 10008392A PT 100083 A PT100083 A PT 100083A
- Authority
- PT
- Portugal
- Prior art keywords
- alkyl
- alkoxycarbonyl
- radical
- alkoxy
- phenyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 26
- 238000002360 preparation method Methods 0.000 title claims description 10
- 230000002155 anti-virotic effect Effects 0.000 title description 2
- 239000000825 pharmaceutical preparation Substances 0.000 title 1
- 229940127557 pharmaceutical product Drugs 0.000 title 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 25
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 11
- 239000001301 oxygen Substances 0.000 claims abstract description 11
- 125000000623 heterocyclic group Chemical group 0.000 claims abstract description 10
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 claims abstract description 9
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 8
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 8
- 150000003839 salts Chemical class 0.000 claims abstract description 7
- 230000000840 anti-viral effect Effects 0.000 claims abstract description 6
- 125000000904 isoindolyl group Chemical class C=1(NC=C2C=CC=CC12)* 0.000 claims abstract 6
- -1 benzyloxy, phenyl-mercapto, phenyl-oxy Chemical group 0.000 claims description 83
- 150000003254 radicals Chemical class 0.000 claims description 59
- 150000001875 compounds Chemical class 0.000 claims description 48
- UFULAYFCSOUIOV-UHFFFAOYSA-N cysteamine Chemical class NCCS UFULAYFCSOUIOV-UHFFFAOYSA-N 0.000 claims description 37
- 229960003151 mercaptamine Drugs 0.000 claims description 37
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 20
- 125000004432 carbon atom Chemical group C* 0.000 claims description 16
- 229910052736 halogen Inorganic materials 0.000 claims description 16
- 150000002367 halogens Chemical class 0.000 claims description 16
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 15
- 125000005843 halogen group Chemical group 0.000 claims description 13
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims description 12
- 229910052717 sulfur Inorganic materials 0.000 claims description 12
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 10
- 125000005842 heteroatom Chemical group 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 9
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 9
- 125000004122 cyclic group Chemical group 0.000 claims description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 9
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 8
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 8
- 239000011593 sulfur Substances 0.000 claims description 8
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 7
- 125000001931 aliphatic group Chemical group 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000003282 alkyl amino group Chemical group 0.000 claims description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 7
- 229920006395 saturated elastomer Polymers 0.000 claims description 7
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 claims description 6
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical compound C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 claims description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 claims description 6
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 claims description 6
- KAESVJOAVNADME-UHFFFAOYSA-N Pyrrole Chemical compound C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 claims description 6
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 claims description 6
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 claims description 6
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 claims description 6
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 claims description 6
- 125000001624 naphthyl group Chemical group 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- QXTLRWKQOGZBLF-UHFFFAOYSA-N [1,3]thiazolo[2,3-a]isoindole Chemical class C1=C2C=CC=CC2=C2N1C=CS2 QXTLRWKQOGZBLF-UHFFFAOYSA-N 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 5
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 5
- 239000008194 pharmaceutical composition Substances 0.000 claims description 5
- 125000004076 pyridyl group Chemical group 0.000 claims description 5
- 125000006413 ring segment Chemical group 0.000 claims description 5
- 125000004434 sulfur atom Chemical group 0.000 claims description 5
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical compound N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims description 4
- 125000004062 acenaphthenyl group Chemical group C1(CC2=CC=CC3=CC=CC1=C23)* 0.000 claims description 4
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 claims description 4
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 claims description 4
- 125000006518 morpholino carbonyl group Chemical group [H]C1([H])OC([H])([H])C([H])([H])N(C(*)=O)C1([H])[H] 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 4
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 3
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 claims description 3
- WJFKNYWRSNBZNX-UHFFFAOYSA-N 10H-phenothiazine Chemical compound C1=CC=C2NC3=CC=CC=C3SC2=C1 WJFKNYWRSNBZNX-UHFFFAOYSA-N 0.000 claims description 3
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 claims description 3
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 claims description 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 3
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Natural products C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 claims description 3
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 3
- 125000004457 alkyl amino carbonyl group Chemical group 0.000 claims description 3
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 claims description 3
- 150000001558 benzoic acid derivatives Chemical class 0.000 claims description 3
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 claims description 3
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 claims description 3
- 125000002541 furyl group Chemical group 0.000 claims description 3
- 125000005226 heteroaryloxycarbonyl group Chemical group 0.000 claims description 3
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 3
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 claims description 3
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 claims description 3
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 claims description 3
- 125000001041 indolyl group Chemical group 0.000 claims description 3
- 239000012442 inert solvent Substances 0.000 claims description 3
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 claims description 3
- 125000001792 phenanthrenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3C=CC12)* 0.000 claims description 3
- 229950000688 phenothiazine Drugs 0.000 claims description 3
- 238000010992 reflux Methods 0.000 claims description 3
- 229940124530 sulfonamide Drugs 0.000 claims description 3
- 150000003456 sulfonamides Chemical class 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- 229930192474 thiophene Natural products 0.000 claims description 3
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 claims description 2
- TZMSYXZUNZXBOL-UHFFFAOYSA-N 10H-phenoxazine Chemical compound C1=CC=C2NC3=CC=CC=C3OC2=C1 TZMSYXZUNZXBOL-UHFFFAOYSA-N 0.000 claims description 2
- BAXOFTOLAUCFNW-UHFFFAOYSA-N 1H-indazole Chemical compound C1=CC=C2C=NNC2=C1 BAXOFTOLAUCFNW-UHFFFAOYSA-N 0.000 claims description 2
- VEPOHXYIFQMVHW-XOZOLZJESA-N 2,3-dihydroxybutanedioic acid (2S,3S)-3,4-dimethyl-2-phenylmorpholine Chemical compound OC(C(O)C(O)=O)C(O)=O.C[C@H]1[C@@H](OCCN1C)c1ccccc1 VEPOHXYIFQMVHW-XOZOLZJESA-N 0.000 claims description 2
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 claims description 2
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 claims description 2
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 2
- 230000003197 catalytic effect Effects 0.000 claims description 2
- 125000000392 cycloalkenyl group Chemical group 0.000 claims description 2
- JKFAIQOWCVVSKC-UHFFFAOYSA-N furazan Chemical compound C=1C=NON=1 JKFAIQOWCVVSKC-UHFFFAOYSA-N 0.000 claims description 2
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 claims description 2
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical compound C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 claims description 2
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical compound C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 claims description 2
- 125000001806 thionaphthenyl group Chemical group 0.000 claims description 2
- 150000003852 triazoles Chemical class 0.000 claims description 2
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 claims 7
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims 5
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims 4
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 claims 2
- 125000004738 (C1-C6) alkyl sulfinyl group Chemical group 0.000 claims 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 claims 2
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 claims 2
- HNKJADCVZUBCPG-UHFFFAOYSA-N thioanisole Chemical compound CSC1=CC=CC=C1 HNKJADCVZUBCPG-UHFFFAOYSA-N 0.000 claims 2
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 claims 1
- 125000006619 (C1-C6) dialkylamino group Chemical group 0.000 claims 1
- 125000003601 C2-C6 alkynyl group Chemical group 0.000 claims 1
- 125000005194 alkoxycarbonyloxy group Chemical group 0.000 claims 1
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 claims 1
- XJRPXNWUCVZVJP-UHFFFAOYSA-N formyl azide Chemical compound [N-]=[N+]=NC=O XJRPXNWUCVZVJP-UHFFFAOYSA-N 0.000 claims 1
- 150000002537 isoquinolines Chemical class 0.000 claims 1
- 238000011282 treatment Methods 0.000 abstract description 7
- 208000036142 Viral infection Diseases 0.000 abstract description 5
- 239000003814 drug Substances 0.000 abstract description 5
- 230000003612 virological effect Effects 0.000 abstract description 5
- 206010038997 Retroviral infections Diseases 0.000 abstract description 4
- 125000002837 carbocyclic group Chemical group 0.000 abstract description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 42
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 33
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- 238000001953 recrystallisation Methods 0.000 description 21
- 239000000243 solution Substances 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- AFABGHUZZDYHJO-UHFFFAOYSA-N 2-Methylpentane Chemical compound CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 12
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 9
- 150000002148 esters Chemical class 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 239000005711 Benzoic acid Substances 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- HBOMLICNUCNMMY-XLPZGREQSA-N zidovudine Chemical compound O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](CO)[C@@H](N=[N+]=[N-])C1 HBOMLICNUCNMMY-XLPZGREQSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 239000003480 eluent Substances 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 4
- 208000030507 AIDS Diseases 0.000 description 4
- 125000004399 C1-C4 alkenyl group Chemical group 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- NNLVGZFZQQXQNW-ADJNRHBOSA-N [(2r,3r,4s,5r,6s)-4,5-diacetyloxy-3-[(2s,3r,4s,5r,6r)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6s)-4,5,6-triacetyloxy-2-(acetyloxymethyl)oxan-3-yl]oxyoxan-2-yl]methyl acetate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](OC(C)=O)[C@H]1OC(C)=O)O[C@H]1[C@@H]([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1)OC(C)=O)COC(=O)C)[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O NNLVGZFZQQXQNW-ADJNRHBOSA-N 0.000 description 4
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 201000010099 disease Diseases 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- 230000005764 inhibitory process Effects 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- 229960002555 zidovudine Drugs 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 3
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 3
- 229920002284 Cellulose triacetate Polymers 0.000 description 3
- 241000450599 DNA viruses Species 0.000 description 3
- 102000004163 DNA-directed RNA polymerases Human genes 0.000 description 3
- 108090000626 DNA-directed RNA polymerases Proteins 0.000 description 3
- 241000725303 Human immunodeficiency virus Species 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 241000700605 Viruses Species 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 125000000304 alkynyl group Chemical group 0.000 description 3
- 125000001246 bromo group Chemical group Br* 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 208000015181 infectious disease Diseases 0.000 description 3
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000002243 precursor Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 241001430294 unidentified retrovirus Species 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- 125000006274 (C1-C3)alkoxy group Chemical group 0.000 description 2
- FTNJQNQLEGKTGD-UHFFFAOYSA-N 1,3-benzodioxole Chemical compound C1=CC=C2OCOC2=C1 FTNJQNQLEGKTGD-UHFFFAOYSA-N 0.000 description 2
- OXCYAVHGYGKEJY-UHFFFAOYSA-N 2-(naphthalene-1-carbonyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC=CC2=CC=CC=C12 OXCYAVHGYGKEJY-UHFFFAOYSA-N 0.000 description 2
- FGTYTUFKXYPTML-UHFFFAOYSA-N 2-benzoylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC=CC=C1 FGTYTUFKXYPTML-UHFFFAOYSA-N 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- FOGGIQCEMHFHGP-UHFFFAOYSA-N 8-chloro-9b-(3-chlorophenyl)-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindol-5-one Chemical compound C12=CC(Cl)=CC=C2C(=O)N2CCSC21C1=CC=CC(Cl)=C1 FOGGIQCEMHFHGP-UHFFFAOYSA-N 0.000 description 2
- RFXJYBWFFPVTFE-UHFFFAOYSA-N 9b-phenanthren-9-yl-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindol-5-one Chemical compound C1=CC=C2C(C34SCCN3C(C3=CC=CC=C34)=O)=CC3=CC=CC=C3C2=C1 RFXJYBWFFPVTFE-UHFFFAOYSA-N 0.000 description 2
- 206010001513 AIDS related complex Diseases 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 241000701022 Cytomegalovirus Species 0.000 description 2
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- 102100034343 Integrase Human genes 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 2
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 2
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical compound C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 2
- 108010092799 RNA-directed DNA polymerase Proteins 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- 239000012072 active phase Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000003302 alkenyloxy group Chemical group 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 239000002246 antineoplastic agent Substances 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical class CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 229940127089 cytotoxic agent Drugs 0.000 description 2
- 230000003111 delayed effect Effects 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 241001493065 dsRNA viruses Species 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 125000001072 heteroaryl group Chemical group 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- PTMBWNZJOQBTBK-UHFFFAOYSA-N pyridin-4-ylmethanol Chemical compound OCC1=CC=NC=C1 PTMBWNZJOQBTBK-UHFFFAOYSA-N 0.000 description 2
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 2
- 230000001177 retroviral effect Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 208000024891 symptom Diseases 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 238000013518 transcription Methods 0.000 description 2
- 230000035897 transcription Effects 0.000 description 2
- 230000009385 viral infection Effects 0.000 description 2
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 1
- 125000006559 (C1-C3) alkylamino group Chemical group 0.000 description 1
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 description 1
- 125000006592 (C2-C3) alkenyl group Chemical group 0.000 description 1
- 125000006593 (C2-C3) alkynyl group Chemical group 0.000 description 1
- 102000040650 (ribonucleotides)n+m Human genes 0.000 description 1
- 108091032973 (ribonucleotides)n+m Proteins 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- FCEHBMOGCRZNNI-UHFFFAOYSA-N 1-benzothiophene Chemical compound C1=CC=C2SC=CC2=C1 FCEHBMOGCRZNNI-UHFFFAOYSA-N 0.000 description 1
- 238000005160 1H NMR spectroscopy Methods 0.000 description 1
- GPTHYELPGWSIDR-UHFFFAOYSA-N 2-(1h-indole-3-carbonyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CNC2=CC=CC=C12 GPTHYELPGWSIDR-UHFFFAOYSA-N 0.000 description 1
- WUKHUSHZSYHGCN-UHFFFAOYSA-N 2-(2,3-dihydro-1h-indene-4-carbonyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC=CC2=C1CCC2 WUKHUSHZSYHGCN-UHFFFAOYSA-N 0.000 description 1
- KORKIRUGUNPQML-UHFFFAOYSA-N 2-(2-aminobenzoyl)benzoic acid Chemical compound NC1=CC=CC=C1C(=O)C1=CC=CC=C1C(O)=O KORKIRUGUNPQML-UHFFFAOYSA-N 0.000 description 1
- SQDUMZPMFYAAOC-UHFFFAOYSA-N 2-(3-nitrobenzoyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC=CC([N+]([O-])=O)=C1 SQDUMZPMFYAAOC-UHFFFAOYSA-N 0.000 description 1
- XAOHJLJMIDUPHF-UHFFFAOYSA-N 2-(4-aminobenzoyl)benzoic acid Chemical compound C1=CC(N)=CC=C1C(=O)C1=CC=CC=C1C(O)=O XAOHJLJMIDUPHF-UHFFFAOYSA-N 0.000 description 1
- AIHPNMHUYIBOFX-UHFFFAOYSA-N 2-(5-fluoronaphthalene-1-carbonyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC=CC2=C(F)C=CC=C12 AIHPNMHUYIBOFX-UHFFFAOYSA-N 0.000 description 1
- BCPFGSAFPNTLNN-UHFFFAOYSA-N 2-(5-methyl-2-nitrobenzoyl)benzoic acid Chemical compound CC1=CC=C([N+]([O-])=O)C(C(=O)C=2C(=CC=CC=2)C(O)=O)=C1 BCPFGSAFPNTLNN-UHFFFAOYSA-N 0.000 description 1
- MOQVWBBLSOWSJL-UHFFFAOYSA-N 2-(anthracene-9-carbonyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=C(C=CC=C2)C2=CC2=CC=CC=C12 MOQVWBBLSOWSJL-UHFFFAOYSA-N 0.000 description 1
- FYXKWXQSICFOIR-UHFFFAOYSA-N 2-(cyclohexanecarbonyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1CCCCC1 FYXKWXQSICFOIR-UHFFFAOYSA-N 0.000 description 1
- BGLNPRRTOGJLIE-UHFFFAOYSA-N 2-(naphthalene-2-carbonyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC=C(C=CC=C2)C2=C1 BGLNPRRTOGJLIE-UHFFFAOYSA-N 0.000 description 1
- LRTLAOGGSYAXAN-UHFFFAOYSA-N 2-(phenanthrene-9-carbonyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC2=CC=CC=C2C2=CC=CC=C12 LRTLAOGGSYAXAN-UHFFFAOYSA-N 0.000 description 1
- WTUKXPYMQWVXOB-UHFFFAOYSA-N 2-(pyridine-2-carbonyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC=CC=N1 WTUKXPYMQWVXOB-UHFFFAOYSA-N 0.000 description 1
- NGBNHFPEOOVGQM-UHFFFAOYSA-N 2-(pyridine-3-carbonyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC=CN=C1 NGBNHFPEOOVGQM-UHFFFAOYSA-N 0.000 description 1
- QYJXRNIDMQAUMA-UHFFFAOYSA-N 2-(pyridine-4-carbonyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC=NC=C1 QYJXRNIDMQAUMA-UHFFFAOYSA-N 0.000 description 1
- KPJANWLDEVDGEA-UHFFFAOYSA-N 2-(thiophene-2-carbonyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC=CS1 KPJANWLDEVDGEA-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- UANXQRUISIOKRY-UHFFFAOYSA-N 2-benzoyl-4,5-dichlorobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=C(Cl)C=C1C(=O)C1=CC=CC=C1 UANXQRUISIOKRY-UHFFFAOYSA-N 0.000 description 1
- SJBXMBRSTWBJRN-UHFFFAOYSA-N 2-benzoyl-4-chlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 SJBXMBRSTWBJRN-UHFFFAOYSA-N 0.000 description 1
- JEHVIWGDWHWPAL-UHFFFAOYSA-N 2-benzoyl-4-methylbenzoic acid Chemical compound CC1=CC=C(C(O)=O)C(C(=O)C=2C=CC=CC=2)=C1 JEHVIWGDWHWPAL-UHFFFAOYSA-N 0.000 description 1
- LSVPCSOPJGPTNA-UHFFFAOYSA-N 2-benzoyl-5-chlorobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1C(=O)C1=CC=CC=C1 LSVPCSOPJGPTNA-UHFFFAOYSA-N 0.000 description 1
- NTVAYOXZDORJJU-UHFFFAOYSA-N 2-benzoyl-5-methoxybenzoic acid Chemical compound OC(=O)C1=CC(OC)=CC=C1C(=O)C1=CC=CC=C1 NTVAYOXZDORJJU-UHFFFAOYSA-N 0.000 description 1
- KNMXCIDAUYVUCS-UHFFFAOYSA-N 2-benzoyl-5-methylbenzoic acid Chemical compound OC(=O)C1=CC(C)=CC=C1C(=O)C1=CC=CC=C1 KNMXCIDAUYVUCS-UHFFFAOYSA-N 0.000 description 1
- LYNYLZNRMMHIRL-UHFFFAOYSA-N 2-benzoyl-6-methoxybenzoic acid Chemical compound COC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1C(O)=O LYNYLZNRMMHIRL-UHFFFAOYSA-N 0.000 description 1
- MFOKQYMBBUNODK-UHFFFAOYSA-N 2-benzoyl-6-methylbenzoic acid Chemical compound CC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1C(O)=O MFOKQYMBBUNODK-UHFFFAOYSA-N 0.000 description 1
- RPRGWESZAIJLOZ-UHFFFAOYSA-N 2-cyclopentylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1C1CCCC1 RPRGWESZAIJLOZ-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- VHMICKWLTGFITH-UHFFFAOYSA-N 2H-isoindole Chemical compound C1=CC=CC2=CNC=C21 VHMICKWLTGFITH-UHFFFAOYSA-N 0.000 description 1
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical group NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- 125000003682 3-furyl group Chemical group O1C([H])=C([*])C([H])=C1[H] 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- UIUCGMLLTRXRBF-UHFFFAOYSA-N 4'-Methoxybenzophenone-2-carboxylic acid Chemical compound C1=CC(OC)=CC=C1C(=O)C1=CC=CC=C1C(O)=O UIUCGMLLTRXRBF-UHFFFAOYSA-N 0.000 description 1
- SWPJZLZDJFANLG-UHFFFAOYSA-N 4-chloro-2-(3-chlorobenzoyl)benzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1C(=O)C1=CC=CC(Cl)=C1 SWPJZLZDJFANLG-UHFFFAOYSA-N 0.000 description 1
- LFMGYBRXZQEYHR-UHFFFAOYSA-N 4-chloro-2-(3-methylbenzoyl)benzoic acid Chemical compound CC1=CC=CC(C(=O)C=2C(=CC=C(Cl)C=2)C(O)=O)=C1 LFMGYBRXZQEYHR-UHFFFAOYSA-N 0.000 description 1
- 125000000242 4-chlorobenzoyl group Chemical group ClC1=CC=C(C(=O)*)C=C1 0.000 description 1
- 125000004860 4-ethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 1
- VWSAZIMOTISWIJ-UHFFFAOYSA-N 5-chloro-2-(3-methylbenzoyl)benzoic acid Chemical compound CC1=CC=CC(C(=O)C=2C(=CC(Cl)=CC=2)C(O)=O)=C1 VWSAZIMOTISWIJ-UHFFFAOYSA-N 0.000 description 1
- YZEYMMJSFQYOET-UHFFFAOYSA-N 6-methoxy-9b-phenyl-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindol-5-one Chemical compound COC1=CC=CC2=C1C(=O)N1CCSC21C1=CC=CC=C1 YZEYMMJSFQYOET-UHFFFAOYSA-N 0.000 description 1
- HFHMTIRZGGSTAO-UHFFFAOYSA-N 7-chloro-9b-phenyl-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindol-5-one Chemical compound C=1C(Cl)=CC=C2C=1C(=O)N1CCSC21C1=CC=CC=C1 HFHMTIRZGGSTAO-UHFFFAOYSA-N 0.000 description 1
- ZLRMMZNBKHESFY-UHFFFAOYSA-N 7-methoxy-9b-phenyl-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindol-5-one Chemical compound C=1C(OC)=CC=C2C=1C(=O)N1CCSC21C1=CC=CC=C1 ZLRMMZNBKHESFY-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QIEKIIZIBLSLMB-UHFFFAOYSA-N 8-chloro-9b-(3-hydroxyphenyl)-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindol-5-one Chemical compound OC1=CC=CC(C23N(CCS2)C(=O)C=2C3=CC(Cl)=CC=2)=C1 QIEKIIZIBLSLMB-UHFFFAOYSA-N 0.000 description 1
- YDIYINSPNQZAEJ-UHFFFAOYSA-N 8-chloro-9b-(3-methylphenyl)-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindol-5-one Chemical compound CC1=CC=CC(C23N(CCS2)C(=O)C=2C3=CC(Cl)=CC=2)=C1 YDIYINSPNQZAEJ-UHFFFAOYSA-N 0.000 description 1
- RTNOCCMBORWWLT-UHFFFAOYSA-N 8-chloro-9b-phenyl-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindol-5-one Chemical compound C12=CC(Cl)=CC=C2C(=O)N2CCSC21C1=CC=CC=C1 RTNOCCMBORWWLT-UHFFFAOYSA-N 0.000 description 1
- IBBUEXMVGBWMMM-UHFFFAOYSA-N 9b-(1h-indol-3-yl)-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindol-5-one Chemical compound C1=CC=C2C(C34SCCN3C(C3=CC=CC=C34)=O)=CNC2=C1 IBBUEXMVGBWMMM-UHFFFAOYSA-N 0.000 description 1
- WUKCDDPZJHCDJK-UHFFFAOYSA-N 9b-(2-aminophenyl)-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindol-5-one Chemical compound NC1=CC=CC=C1C1(C2=CC=CC=C2C2=O)N2CCS1 WUKCDDPZJHCDJK-UHFFFAOYSA-N 0.000 description 1
- YQWLZTDSLZRUQP-UHFFFAOYSA-N 9b-(3-amino-4-chlorophenyl)-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindol-5-one Chemical compound C1=C(Cl)C(N)=CC(C23N(CCS2)C(=O)C=2C3=CC=CC=2)=C1 YQWLZTDSLZRUQP-UHFFFAOYSA-N 0.000 description 1
- PXFYCEMEIUFVCP-UHFFFAOYSA-N 9b-(3-azidophenyl)-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindol-5-one Chemical compound N(=[N+]=[N-])C=1C=C(C=CC1)C12N(C(C3=CC=CC=C13)=O)CCS2 PXFYCEMEIUFVCP-UHFFFAOYSA-N 0.000 description 1
- KIKNGMWNLLPEJJ-UHFFFAOYSA-N 9b-(3-nitrophenyl)-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindol-5-one Chemical compound [O-][N+](=O)C1=CC=CC(C23N(CCS2)C(=O)C=2C3=CC=CC=2)=C1 KIKNGMWNLLPEJJ-UHFFFAOYSA-N 0.000 description 1
- FHFJLKAFFWSSQS-UHFFFAOYSA-N 9b-(3h-inden-1-yl)-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindol-5-one Chemical compound C12=CC=CC=C2C(=O)N2C1(C=1C3=CC=CC=C3CC=1)SCC2 FHFJLKAFFWSSQS-UHFFFAOYSA-N 0.000 description 1
- LYOFTNFSJCQXQD-UHFFFAOYSA-N 9b-(4-aminophenyl)-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindol-5-one Chemical compound C1=CC(N)=CC=C1C1(C2=CC=CC=C2C2=O)N2CCS1 LYOFTNFSJCQXQD-UHFFFAOYSA-N 0.000 description 1
- GKYXMYDXAWIBDE-UHFFFAOYSA-N 9b-(4-chlorophenyl)-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindole-5-thione Chemical compound C1=CC(Cl)=CC=C1C1(C2=CC=CC=C2C2=S)N2CCS1 GKYXMYDXAWIBDE-UHFFFAOYSA-N 0.000 description 1
- XVSJAAVZQFEIFT-UHFFFAOYSA-N 9b-(4-methylpyridin-2-yl)-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindol-5-one Chemical compound CC1=CC=NC(C23N(CCS2)C(=O)C=2C3=CC=CC=2)=C1 XVSJAAVZQFEIFT-UHFFFAOYSA-N 0.000 description 1
- RTUHJGGFEHYPJI-UHFFFAOYSA-N 9b-(5-fluoronaphthalen-1-yl)-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindol-5-one Chemical compound S1CCN2C(=O)C3=CC=CC=C3C21C1=C2C=CC=C(F)C2=CC=C1 RTUHJGGFEHYPJI-UHFFFAOYSA-N 0.000 description 1
- XEPVLNOONYTSIM-UHFFFAOYSA-N 9b-isoquinolin-1-yl-8-methyl-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindole-5-thione Chemical compound CC1=CC=C2C(N3C(C2=C1)(SCC3)C3=NC=CC1=CC=CC=C31)=S XEPVLNOONYTSIM-UHFFFAOYSA-N 0.000 description 1
- CTGFADZNCCTVMP-UHFFFAOYSA-N 9b-phenyl-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindol-5-one Chemical class C12=CC=CC=C2C(=O)N2CCSC21C1=CC=CC=C1 CTGFADZNCCTVMP-UHFFFAOYSA-N 0.000 description 1
- WBMZBGYGDAPXDZ-UHFFFAOYSA-N 9b-pyridin-2-yl-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindol-5-one Chemical compound C12=CC=CC=C2C(=O)N2CCSC21C1=CC=CC=N1 WBMZBGYGDAPXDZ-UHFFFAOYSA-N 0.000 description 1
- VQGQQBQJHDBNDY-UHFFFAOYSA-N 9b-pyridin-3-yl-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindol-5-one Chemical compound C12=CC=CC=C2C(=O)N2CCSC21C1=CC=CN=C1 VQGQQBQJHDBNDY-UHFFFAOYSA-N 0.000 description 1
- UIDOWYXKSYJWBZ-UHFFFAOYSA-N 9b-pyridin-4-yl-2,3-dihydro-[1,3]thiazolo[2,3-a]isoindol-5-one Chemical compound C12=CC=CC=C2C(=O)N2CCSC21C1=CC=NC=C1 UIDOWYXKSYJWBZ-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- 241001120493 Arene Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 125000003830 C1- C4 alkylcarbonylamino group Chemical group 0.000 description 1
- 125000004648 C2-C8 alkenyl group Chemical group 0.000 description 1
- 229920000858 Cyclodextrin Polymers 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 208000007514 Herpes zoster Diseases 0.000 description 1
- 206010020460 Human T-cell lymphotropic virus type I infection Diseases 0.000 description 1
- 241000714260 Human T-lymphotropic virus 1 Species 0.000 description 1
- 241000714259 Human T-lymphotropic virus 2 Species 0.000 description 1
- 241000701044 Human gammaherpesvirus 4 Species 0.000 description 1
- 241000713772 Human immunodeficiency virus 1 Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- MCYHPZGUONZRGO-VKHMYHEASA-N L-cysteine methyl ester hydrochloride Natural products COC(=O)[C@@H](N)CS MCYHPZGUONZRGO-VKHMYHEASA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- WHOHXJZQBJXAKL-DFWYDOINSA-N Mecysteine hydrochloride Chemical compound Cl.COC(=O)[C@@H](N)CS WHOHXJZQBJXAKL-DFWYDOINSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- SATSPLVJJGWVGN-UHFFFAOYSA-N O1C(=CC=C1)C1CN2C(C3=CC=CC=C3C2=O)S1 Chemical compound O1C(=CC=C1)C1CN2C(C3=CC=CC=C3C2=O)S1 SATSPLVJJGWVGN-UHFFFAOYSA-N 0.000 description 1
- 108091034117 Oligonucleotide Proteins 0.000 description 1
- 241001631646 Papillomaviridae Species 0.000 description 1
- 206010049025 Persistent generalised lymphadenopathy Diseases 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 241000700584 Simplexvirus Species 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 241000713325 Visna/maedi virus Species 0.000 description 1
- PZIIGUMPOSVMSD-UHFFFAOYSA-M [Br-].C1=CC=C2C([Mg+])=CC=CC2=C1 Chemical compound [Br-].C1=CC=C2C([Mg+])=CC=CC2=C1 PZIIGUMPOSVMSD-UHFFFAOYSA-M 0.000 description 1
- VLYOVXGXOLXCMN-UHFFFAOYSA-N acetic acid;2-methylheptane Chemical compound CC(O)=O.CCCCCC(C)C VLYOVXGXOLXCMN-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 1
- 125000005133 alkynyloxy group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000001760 anti-analgesic effect Effects 0.000 description 1
- 230000002082 anti-convulsion Effects 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 229940054051 antipsychotic indole derivative Drugs 0.000 description 1
- 239000003443 antiviral agent Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 1
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 125000004327 carbazol-1-yl group Chemical group [H]N1C2=C(C([H])=C([H])C([H])=C2[H])C2=C1C(*)=C([H])C([H])=C2[H] 0.000 description 1
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- QZHPTGXQGDFGEN-UHFFFAOYSA-N chromene Chemical compound C1=CC=C2C=C[CH]OC2=C1 QZHPTGXQGDFGEN-UHFFFAOYSA-N 0.000 description 1
- 239000007979 citrate buffer Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000003983 crown ethers Chemical class 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 231100000433 cytotoxic Toxicity 0.000 description 1
- 230000001472 cytotoxic effect Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 229960001484 edetic acid Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000003818 flash chromatography Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 238000001033 granulometry Methods 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 230000003862 health status Effects 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 125000003114 inden-1-yl group Chemical group [H]C1=C([H])C([H])(*)C2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 description 1
- 150000002475 indoles Chemical class 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 150000002518 isoindoles Chemical class 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- CFHGBZLNZZVTAY-UHFFFAOYSA-N lawesson's reagent Chemical compound C1=CC(OC)=CC=C1P1(=S)SP(=S)(C=2C=CC(OC)=CC=2)S1 CFHGBZLNZZVTAY-UHFFFAOYSA-N 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 201000003450 persistent generalized lymphadenopathy Diseases 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000004330 phenothiazin-1-yl group Chemical group [H]N1C2=C(SC3=C1C(*)=C([H])C([H])=C3[H])C([H])=C([H])C([H])=C2[H] 0.000 description 1
- 125000001484 phenothiazinyl group Chemical group C1(=CC=CC=2SC3=CC=CC=C3NC12)* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- LFSXCDWNBUNEEM-UHFFFAOYSA-N phthalazine Chemical compound C1=NN=CC2=CC=CC=C21 LFSXCDWNBUNEEM-UHFFFAOYSA-N 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002568 propynyl group Chemical group [*]C#CC([H])([H])[H] 0.000 description 1
- SHNUBALDGXWUJI-UHFFFAOYSA-N pyridin-2-ylmethanol Chemical compound OCC1=CC=CC=N1 SHNUBALDGXWUJI-UHFFFAOYSA-N 0.000 description 1
- 125000004527 pyrimidin-4-yl group Chemical group N1=CN=C(C=C1)* 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229940064914 retrovir Drugs 0.000 description 1
- HFHDHCJBZVLPGP-UHFFFAOYSA-N schardinger α-dextrin Chemical compound O1C(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC(C(O)C2O)C(CO)OC2OC(C(C2O)O)C(CO)OC2OC2C(O)C(O)C1OC2CO HFHDHCJBZVLPGP-UHFFFAOYSA-N 0.000 description 1
- 238000007423 screening assay Methods 0.000 description 1
- 231100000004 severe toxicity Toxicity 0.000 description 1
- 125000005624 silicic acid group Chemical class 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- 125000004354 sulfur functional group Chemical group 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000000437 thiazol-2-yl group Chemical group [H]C1=C([H])N=C(*)S1 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 125000000165 tricyclic carbocycle group Chemical group 0.000 description 1
- 239000001226 triphosphate Substances 0.000 description 1
- 238000000825 ultraviolet detection Methods 0.000 description 1
- 241001529453 unidentified herpesvirus Species 0.000 description 1
- 241000712461 unidentified influenza virus Species 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/12—Antivirals
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Virology (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Communicable Diseases (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE4103177A DE4103177A1 (de) | 1991-02-02 | 1991-02-02 | Thiazolo-(2,3-a)isoindol-derivate und diese enthaltende arzneimittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PT100083A true PT100083A (pt) | 1994-05-31 |
Family
ID=6424264
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PT100083A PT100083A (pt) | 1991-02-02 | 1992-01-31 | Novos derivados de tiazolo-{2,3-a}-isoindol e sua utilizacao como produtos farmaceuticos anti-viricos e processo para a preparacao desses derivados |
Country Status (14)
| Country | Link |
|---|---|
| EP (1) | EP0569457B1 (cg-RX-API-DMAC7.html) |
| JP (1) | JPH06505229A (cg-RX-API-DMAC7.html) |
| AT (1) | ATE123779T1 (cg-RX-API-DMAC7.html) |
| AU (1) | AU1204892A (cg-RX-API-DMAC7.html) |
| CA (1) | CA2100366A1 (cg-RX-API-DMAC7.html) |
| DE (2) | DE4103177A1 (cg-RX-API-DMAC7.html) |
| ES (1) | ES2075684T3 (cg-RX-API-DMAC7.html) |
| IE (1) | IE920334A1 (cg-RX-API-DMAC7.html) |
| IL (1) | IL100818A0 (cg-RX-API-DMAC7.html) |
| MX (1) | MX9200446A (cg-RX-API-DMAC7.html) |
| PT (1) | PT100083A (cg-RX-API-DMAC7.html) |
| TW (1) | TW198037B (cg-RX-API-DMAC7.html) |
| WO (1) | WO1992013863A1 (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA92695B (cg-RX-API-DMAC7.html) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5527819A (en) * | 1991-09-06 | 1996-06-18 | Merck & Co., Inc. | Inhibitors of HIV reverse transcriptase |
| DE4129779A1 (de) * | 1991-09-07 | 1993-03-11 | Boehringer Mannheim Gmbh | Neue tricyclische thiazol- und oxazol-derivate und diese enthaltende arzneimittel |
| DE4214830A1 (de) * | 1992-05-10 | 1993-11-11 | Boehringer Mannheim Gmbh | Neue Tricyclische Thiazolo- und Thiazino-Derivate und diese enthaltende Arzneimittel |
| WO2002066479A1 (en) * | 2001-02-23 | 2002-08-29 | Banyu Pharmaceutical Co.,Ltd. | Novel isoindole derivatives |
| CA2551178C (en) | 2003-12-24 | 2012-11-06 | Biota Scientific Management Pty Ltd | Polycyclic agents for the treatment of respiratory syncytial virus infections |
| AR057623A1 (es) | 2005-11-28 | 2007-12-05 | Omega Bio Pharma H K Ltd | Materiales y metodos para el tratamiento de las infecciones virales |
| TWI423972B (zh) | 2006-09-28 | 2014-01-21 | Biota Scient Management | 治療呼吸系融合細胞病毒感染之多環劑 |
| TWI508968B (zh) | 2010-02-08 | 2015-11-21 | Biota Scient Management | 用於治療呼吸道融合性病毒感染的化合物 |
| US8796303B2 (en) | 2010-11-26 | 2014-08-05 | Biota Scientific Management Pty Ltd. | Imidazo[2,1-G][1,7]naphthyridines for treating respiratory syncytial virus infections |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH433321A (de) * | 1964-02-11 | 1967-04-15 | Geigy Ag J R | Verfahren zur Herstellung von neuen, kondensierten heterocyclischen Verbindungen |
| CH469733A (de) * | 1965-07-27 | 1969-03-15 | Geigy Ag J R | Verfahren zur Herstellung von neuen, kondensierten heterocyclischen Verbindungen |
-
1991
- 1991-02-02 DE DE4103177A patent/DE4103177A1/de not_active Withdrawn
-
1992
- 1992-01-28 ES ES92904272T patent/ES2075684T3/es not_active Expired - Lifetime
- 1992-01-28 WO PCT/EP1992/000172 patent/WO1992013863A1/de not_active Ceased
- 1992-01-28 AT AT92904272T patent/ATE123779T1/de active
- 1992-01-28 EP EP92904272A patent/EP0569457B1/de not_active Expired - Lifetime
- 1992-01-28 JP JP4503931A patent/JPH06505229A/ja active Pending
- 1992-01-28 AU AU12048/92A patent/AU1204892A/en not_active Abandoned
- 1992-01-28 DE DE59202551T patent/DE59202551D1/de not_active Expired - Fee Related
- 1992-01-28 CA CA002100366A patent/CA2100366A1/en not_active Abandoned
- 1992-01-30 IL IL100818A patent/IL100818A0/xx unknown
- 1992-01-30 TW TW081100700A patent/TW198037B/zh active
- 1992-01-31 IE IE033492A patent/IE920334A1/en not_active Application Discontinuation
- 1992-01-31 PT PT100083A patent/PT100083A/pt not_active Application Discontinuation
- 1992-01-31 MX MX9200446A patent/MX9200446A/es unknown
- 1992-01-31 ZA ZA92695A patent/ZA92695B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES2075684T3 (es) | 1995-10-01 |
| IL100818A0 (en) | 1992-09-06 |
| ZA92695B (en) | 1992-11-25 |
| EP0569457A1 (de) | 1993-11-18 |
| EP0569457B1 (de) | 1995-06-14 |
| IE920334A1 (en) | 1992-08-12 |
| WO1992013863A1 (de) | 1992-08-20 |
| DE59202551D1 (de) | 1995-07-20 |
| AU1204892A (en) | 1992-09-07 |
| TW198037B (cg-RX-API-DMAC7.html) | 1993-01-11 |
| JPH06505229A (ja) | 1994-06-16 |
| MX9200446A (es) | 1992-08-01 |
| CA2100366A1 (en) | 1992-08-03 |
| ATE123779T1 (de) | 1995-06-15 |
| DE4103177A1 (de) | 1992-08-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR20050087792A (ko) | 피리도피리미디논 화합물, 이의 제조 방법 및 이를함유하는 약제 조성물 | |
| PT100083A (pt) | Novos derivados de tiazolo-{2,3-a}-isoindol e sua utilizacao como produtos farmaceuticos anti-viricos e processo para a preparacao desses derivados | |
| KR20090024257A (ko) | 2-(치환된-아미노)-벤조티아졸 설폰아미드 hiv 프로테아제 저해제 | |
| US5512564A (en) | Tricyclic thiazole and oxazole derivatives and pharmaceutical agents containing them | |
| EP0575425B1 (de) | VERWENDUNG VON OXAZOLO- 2,3-a]ISOINDOL- UND IMIDAZO 2,1-a]ISOINDOL-DERIVATEN ALS ANTIVIRALE ARZNEIMITTEL SOWIE NEUE OXAZOLO 2,3-a]ISOINDOL-DERIVATEN | |
| PT99463A (pt) | Processo para a preparacao de composicoes farmaceuticas contendo derivados de triazoloisoindolinona | |
| US4049816A (en) | Antiviral 2-amino-5-[1-(indol-3-yl)alkyl]-2-thiazolin-4-ones | |
| SU1234401A1 (ru) | Производные бензо-aS-триазина,про вл ющие усиливающее наркоз действие | |
| US3426017A (en) | Sulfonylurea compounds | |
| JPH06505017A (ja) | 三環式イソインドリノンの抗ウイルス医薬としての使用、ならびに新規な光学活性イソインドリノン | |
| KR900006745B1 (ko) | 5-아미노-1,2-디티올-3-온 화합물 및 그의 제법 | |
| US4452982A (en) | Process for the preparation of nitrogen-bridgehead condensed pyrimidine compounds, and pharmaceutical compositions containing them | |
| JPS58162593A (ja) | イミダゾチアジアゾ−ルアルケンカルボキサミド類、それらの製造法及び薬剤としての用途 | |
| CA2134200A1 (en) | New tricyclic thiazolo and thiazino derivatives and pharmaceutical agents containing them | |
| PT99609A (pt) | Processo para a preparacao de composicoes farmaceuticas contendo derivados de tiazoloisoindolinonas | |
| BRPI0903803A2 (pt) | composto, isÈmero do composto, processo de sua preparação, composto intermediário, composição farmacêutica; medicamento, uso dos compostos e método de tratamento | |
| CA2021135A1 (en) | Pyrrolo[2,1-b]thiazole derivatives | |
| CA2134218A1 (en) | Tricyclic pyrimidine derivatives as antiviral therapeutic agents | |
| GB2063867A (en) | Benzylidene derivatives, their preparation and compositions containing them | |
| Reisner et al. | Synthesis and hypoglycemic activity of 2-(. omega.-substituted alkylamino)-2-imidazolines | |
| JPS63264458A (ja) | ラクタム誘導体 | |
| DE4311782A1 (de) | Indazol-Derivate und diese enthaltende Arzneimittel | |
| JPH01131161A (ja) | N−〔置換アルキリデン〕融合−ビシクロアルキリデン及びヘテロアルキリデンキノリンアミン | |
| WO1998047896A1 (en) | Sydononimine derivatives | |
| DE4117358A1 (de) | Verwendung von tricyclischen isoindolinonen als antivirale arzneimittel, sowie neue optisch aktive isoindolinone |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BB1A | Laying open of patent application |
Effective date: 19931027 |
|
| FC3A | Refusal |
Effective date: 19990317 |