PL97192B1 - Sposob wytwarzania nowych pochodnych chinoliny - Google Patents
Sposob wytwarzania nowych pochodnych chinoliny Download PDFInfo
- Publication number
- PL97192B1 PL97192B1 PL18726074A PL18726074A PL97192B1 PL 97192 B1 PL97192 B1 PL 97192B1 PL 18726074 A PL18726074 A PL 18726074A PL 18726074 A PL18726074 A PL 18726074A PL 97192 B1 PL97192 B1 PL 97192B1
- Authority
- PL
- Poland
- Prior art keywords
- chinoline
- new derivatives
- compounds
- making new
- general formula
- Prior art date
Links
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical class N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 5
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 229940027991 antiseptic and disinfectant quinoline derivative Drugs 0.000 claims description 2
- 125000002943 quinolinyl group Chemical class N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- -1 2-propyl-5-amino-5-pyrimidyl-methyl Chemical group 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 3
- 235000015497 potassium bicarbonate Nutrition 0.000 description 3
- 239000011736 potassium bicarbonate Substances 0.000 description 3
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- 238000009835 boiling Methods 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- JHAYEQICABJSTP-UHFFFAOYSA-N decoquinate Chemical compound N1C=C(C(=O)OCC)C(=O)C2=C1C=C(OCC)C(OCCCCCCCCCC)=C2 JHAYEQICABJSTP-UHFFFAOYSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- YSEYOMUPVMGJPP-UHFFFAOYSA-N 3-chloro-2-methylpyridine Chemical compound CC1=NC=CC=C1Cl YSEYOMUPVMGJPP-UHFFFAOYSA-N 0.000 description 1
- 150000004333 6-hydroxyquinolines Chemical class 0.000 description 1
- 102220480121 H/ACA ribonucleoprotein complex subunit DKC1_R10A_mutation Human genes 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 229960003683 amprolium Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 229960001878 decoquinate Drugs 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002085 enols Chemical class 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- GLUQMYQDGHKVIX-UHFFFAOYSA-N ethyl 7-ethoxy-6-hydroxy-4-oxo-1h-quinoline-3-carboxylate Chemical compound CCOC1=C(O)C=C2C(=O)C(C(=O)OCC)=CNC2=C1 GLUQMYQDGHKVIX-UHFFFAOYSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- PJBQYZZKGNOKNJ-UHFFFAOYSA-M hydron;5-[(2-methylpyridin-1-ium-1-yl)methyl]-2-propylpyrimidin-4-amine;dichloride Chemical compound Cl.[Cl-].NC1=NC(CCC)=NC=C1C[N+]1=CC=CC=C1C PJBQYZZKGNOKNJ-UHFFFAOYSA-M 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000003248 quinolines Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUCI001403 HU167572B (https=) | 1973-08-28 | 1973-08-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL97192B1 true PL97192B1 (pl) | 1978-02-28 |
Family
ID=10994490
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL18726074A PL97192B1 (pl) | 1973-08-28 | 1974-08-26 | Sposob wytwarzania nowych pochodnych chinoliny |
| PL17367974A PL99024B1 (pl) | 1973-08-28 | 1974-08-26 | Sposob wytwarzania nowych pochodnych chinoliny |
| PL18726274A PL97191B1 (pl) | 1973-08-28 | 1974-08-26 | Sposob wytwarzania nowych pochodnych chinoliny |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL17367974A PL99024B1 (pl) | 1973-08-28 | 1974-08-26 | Sposob wytwarzania nowych pochodnych chinoliny |
| PL18726274A PL97191B1 (pl) | 1973-08-28 | 1974-08-26 | Sposob wytwarzania nowych pochodnych chinoliny |
Country Status (3)
| Country | Link |
|---|---|
| JP (1) | JPS5843953A (https=) |
| HU (1) | HU167572B (https=) |
| PL (3) | PL97192B1 (https=) |
-
1973
- 1973-08-28 HU HUCI001403 patent/HU167572B/hu unknown
-
1974
- 1974-08-26 PL PL18726074A patent/PL97192B1/pl unknown
- 1974-08-26 PL PL17367974A patent/PL99024B1/pl unknown
- 1974-08-26 PL PL18726274A patent/PL97191B1/pl unknown
-
1982
- 1982-07-30 JP JP13360782A patent/JPS5843953A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| HU167572B (https=) | 1975-11-28 |
| PL97191B1 (pl) | 1978-02-28 |
| PL99024B1 (pl) | 1978-06-30 |
| JPS5843953A (ja) | 1983-03-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1087205A (en) | 2-amino-3-(5-and 6-)benzoylphenylacetic acids, esters and metal salts thereof | |
| JP6160621B2 (ja) | ピロロキノリンキノンテトラアルカリ塩及びその結晶、これらの製造方法、並びに、組成物 | |
| SU455535A3 (ru) | Способ получени производных изоиндолина или их солей | |
| US3830803A (en) | 5-loweralkyl-1-phenyl-1,3,4,6-tetrahydro-5h-benz(f)-2,5-oxazocines and 4-ones | |
| IE45962B1 (en) | 4-trifluoromethylbenzoic acid derivatives | |
| PL97192B1 (pl) | Sposob wytwarzania nowych pochodnych chinoliny | |
| EP0029602B1 (en) | 1,2-bis(nicotinamido)propane, process for preparing the same and pharmaceutical composition containing the same | |
| PL92578B1 (https=) | ||
| US3801644A (en) | Substituted-o-hydroxy-omega-(methylsulfinyl)acetophenones and process for producing same | |
| KR940003759B1 (ko) | 4-oh 퀴놀린 카르복실산 유도체의 제조방법 | |
| US3304304A (en) | Quinazolone derivatives | |
| Cohen et al. | 839. Synthetical experiments in the B group of vitamins. Part V. Novel derivatives of pyridoxine | |
| US2821531A (en) | Preparation of 3-acyl-6-substituted delta6-desoxymorphine | |
| NO136840B (no) | Analogifremgangsm}te til fremstilling av nye, terapeutisk aktive derivater av isoindolin. | |
| PL114677B1 (en) | Process for preparing novel derivatives of 6,7-dimethoxy-1,2,3,4-tetrahydro-1-isoquinolinoacetamide | |
| HU203535B (en) | Process for producing pyridine-2,3-dicarboxylic acids | |
| US2748121A (en) | 6-nitroaryl derivatives of 2-amino-4-pyrimidols | |
| EP0481891B1 (en) | Phenoxyacetic acid compounds, method for production thereof, and pharmaceutical preparations containing same | |
| US3470181A (en) | Fused 2-pyrimidinepropionic acid compounds,related compounds,and the process for their preparation | |
| US4237132A (en) | Morpholinone derivatives and method of use | |
| Greig et al. | Formation and reactions of 1, 4, 2-dithiazolium cations | |
| US3798212A (en) | Resolution of benzodiazepine derivatives | |
| US2657212A (en) | Diethanolaminopyridines | |
| US2189809A (en) | Alkyl esters of hydrohalides of methyl-hydrasteine and processes for producing the same | |
| US3637737A (en) | 3-aminomethylpyrazolinones |