PL96538B1 - Sposob wytwarzania nowych aminofenyloetanoloamin - Google Patents
Sposob wytwarzania nowych aminofenyloetanoloamin Download PDFInfo
- Publication number
- PL96538B1 PL96538B1 PL18240673A PL18240673A PL96538B1 PL 96538 B1 PL96538 B1 PL 96538B1 PL 18240673 A PL18240673 A PL 18240673A PL 18240673 A PL18240673 A PL 18240673A PL 96538 B1 PL96538 B1 PL 96538B1
- Authority
- PL
- Poland
- Prior art keywords
- hydrogen
- general formula
- compound
- carbon atoms
- amino
- Prior art date
Links
- IKNLHBCWJCVJDZ-UHFFFAOYSA-N 1,2-diamino-1-phenylethanol Chemical compound NCC(N)(O)C1=CC=CC=C1 IKNLHBCWJCVJDZ-UHFFFAOYSA-N 0.000 title claims description 4
- 238000004519 manufacturing process Methods 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 27
- 238000000034 method Methods 0.000 claims description 22
- 150000002431 hydrogen Chemical group 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 12
- 239000003054 catalyst Substances 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 7
- 238000005695 dehalogenation reaction Methods 0.000 claims description 7
- 238000005984 hydrogenation reaction Methods 0.000 claims description 7
- 150000007524 organic acids Chemical class 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 6
- -1 cyano, carboxy, carboxy Chemical group 0.000 claims description 6
- 229910052740 iodine Inorganic materials 0.000 claims description 6
- 150000007522 mineralic acids Chemical class 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 239000002904 solvent Substances 0.000 claims description 5
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000001153 fluoro group Chemical group F* 0.000 claims description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 235000005985 organic acids Nutrition 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000000304 alkynyl group Chemical group 0.000 claims description 2
- 125000004103 aminoalkyl group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 2
- 238000004440 column chromatography Methods 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 2
- 125000004985 dialkyl amino alkyl group Chemical group 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 3
- 239000011630 iodine Substances 0.000 claims 3
- 238000002360 preparation method Methods 0.000 claims 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 2
- YONLFQNRGZXBBF-ZIAGYGMSSA-N (2r,3r)-2,3-dibenzoyloxybutanedioic acid Chemical compound O([C@@H](C(=O)O)[C@@H](OC(=O)C=1C=CC=CC=1)C(O)=O)C(=O)C1=CC=CC=C1 YONLFQNRGZXBBF-ZIAGYGMSSA-N 0.000 claims 1
- OCQAXYHNMWVLRH-ROUUACIJSA-N (2s,3s)-2,3-dibenzoyl-2,3-dihydroxybutanedioic acid Chemical compound O=C([C@](O)(C(=O)O)[C@@](O)(C(O)=O)C(=O)C=1C=CC=CC=1)C1=CC=CC=C1 OCQAXYHNMWVLRH-ROUUACIJSA-N 0.000 claims 1
- DSSYKIVIOFKYAU-XCBNKYQSSA-N (R)-camphor Chemical compound C1C[C@@]2(C)C(=O)C[C@@H]1C2(C)C DSSYKIVIOFKYAU-XCBNKYQSSA-N 0.000 claims 1
- 229930007886 (R)-camphor Natural products 0.000 claims 1
- 235000011002 L(+)-tartaric acid Nutrition 0.000 claims 1
- 239000001358 L(+)-tartaric acid Substances 0.000 claims 1
- FEWJPZIEWOKRBE-LWMBPPNESA-N L-(+)-Tartaric acid Natural products OC(=O)[C@@H](O)[C@H](O)C(O)=O FEWJPZIEWOKRBE-LWMBPPNESA-N 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 238000002425 crystallisation Methods 0.000 claims 1
- 230000008025 crystallization Effects 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- AUONNNVJUCSETH-UHFFFAOYSA-N icosanoyl icosanoate Chemical compound CCCCCCCCCCCCCCCCCCCC(=O)OC(=O)CCCCCCCCCCCCCCCCCCC AUONNNVJUCSETH-UHFFFAOYSA-N 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- ITHPEWAHFNDNIO-UHFFFAOYSA-N triphosphane Chemical compound PPP ITHPEWAHFNDNIO-UHFFFAOYSA-N 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 16
- 238000002844 melting Methods 0.000 description 16
- 230000008018 melting Effects 0.000 description 16
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 238000000354 decomposition reaction Methods 0.000 description 9
- 230000000694 effects Effects 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 5
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- NPFVNFAXZKBDCE-UHFFFAOYSA-N 1-(pentylamino)ethanol Chemical compound CCCCCNC(C)O NPFVNFAXZKBDCE-UHFFFAOYSA-N 0.000 description 4
- 230000000202 analgesic effect Effects 0.000 description 4
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 4
- 230000000144 pharmacologic effect Effects 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- ZUYWFUUNQDJUKG-UHFFFAOYSA-N 1-(butylamino)ethanol Chemical compound CCCCNC(C)O ZUYWFUUNQDJUKG-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 208000009079 Bronchial Spasm Diseases 0.000 description 3
- 208000014181 Bronchial disease Diseases 0.000 description 3
- 206010006482 Bronchospasm Diseases 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000001813 broncholytic effect Effects 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- 238000006467 substitution reaction Methods 0.000 description 3
- JWZZKOKVBUJMES-UHFFFAOYSA-N (+-)-Isoprenaline Chemical compound CC(C)NCC(O)C1=CC=C(O)C(O)=C1 JWZZKOKVBUJMES-UHFFFAOYSA-N 0.000 description 2
- NEPOREXZZHXGPN-UHFFFAOYSA-N 2-amino-5-[2-(cyclopropylamino)-1-hydroxyethyl]benzonitrile Chemical compound C1=C(C#N)C(N)=CC=C1C(O)CNC1CC1 NEPOREXZZHXGPN-UHFFFAOYSA-N 0.000 description 2
- 241000700198 Cavia Species 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 208000036029 Uterine contractions during pregnancy Diseases 0.000 description 2
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 2
- 229960004373 acetylcholine Drugs 0.000 description 2
- 239000005557 antagonist Substances 0.000 description 2
- 230000002921 anti-spasmodic effect Effects 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 230000000903 blocking effect Effects 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229910052681 coesite Inorganic materials 0.000 description 2
- 229910052906 cristobalite Inorganic materials 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 238000013213 extrapolation Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 229910003445 palladium oxide Inorganic materials 0.000 description 2
- JQPTYAILLJKUCY-UHFFFAOYSA-N palladium(ii) oxide Chemical compound [O-2].[Pd+2] JQPTYAILLJKUCY-UHFFFAOYSA-N 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 229910052682 stishovite Inorganic materials 0.000 description 2
- 210000003699 striated muscle Anatomy 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 229910052905 tridymite Inorganic materials 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- VXFVGOZFUSMXBQ-UHFFFAOYSA-N 1-(3-amino-4-bromophenyl)-2-(cyclopropylamino)ethanol Chemical compound C1=C(Br)C(N)=CC(C(O)CNC2CC2)=C1 VXFVGOZFUSMXBQ-UHFFFAOYSA-N 0.000 description 1
- ZGTOOFRSOGZQHS-UHFFFAOYSA-N 1-(4-amino-3-bromo-5-fluorophenyl)-2-(tert-butylamino)ethanol;hydrochloride Chemical compound [Cl-].CC(C)(C)[NH2+]CC(O)C1=CC(F)=C(N)C(Br)=C1 ZGTOOFRSOGZQHS-UHFFFAOYSA-N 0.000 description 1
- UHONSIGNJGRAPO-UHFFFAOYSA-N 1-(pentylamino)ethanol;hydrobromide Chemical compound Br.CCCCCNC(C)O UHONSIGNJGRAPO-UHFFFAOYSA-N 0.000 description 1
- ULNZJNQJNMNGEH-UHFFFAOYSA-N 1-[4-amino-3-(trifluoromethyl)phenyl]-2-(cyclopropylamino)ethanol;dihydrochloride Chemical compound Cl.Cl.C1=C(C(F)(F)F)C(N)=CC=C1C(O)CNC1CC1 ULNZJNQJNMNGEH-UHFFFAOYSA-N 0.000 description 1
- KBCYWAQGRIPFPB-UHFFFAOYSA-N 1-[4-amino-3-(trifluoromethyl)phenyl]-2-(cyclopropylmethylamino)ethanol Chemical compound NC1=C(C=C(C=C1)C(CNCC1CC1)O)C(F)(F)F KBCYWAQGRIPFPB-UHFFFAOYSA-N 0.000 description 1
- AJMZUWWNRXUORC-UHFFFAOYSA-N 1-[4-amino-3-(trifluoromethyl)phenyl]-2-(dimethylamino)ethanol Chemical compound NC1=C(C=C(C=C1)C(CN(C)C)O)C(F)(F)F AJMZUWWNRXUORC-UHFFFAOYSA-N 0.000 description 1
- YSVIUJOMJFLQBB-UHFFFAOYSA-N 1-[4-amino-3-(trifluoromethyl)phenyl]-2-(propan-2-ylamino)ethanol Chemical compound CC(C)NCC(O)C1=CC=C(N)C(C(F)(F)F)=C1 YSVIUJOMJFLQBB-UHFFFAOYSA-N 0.000 description 1
- DCXVJZIGAUPQPB-UHFFFAOYSA-N 1-[4-amino-3-(trifluoromethyl)phenyl]-2-(tert-butylamino)ethanol Chemical compound CC(C)(C)NCC(O)C1=CC=C(N)C(C(F)(F)F)=C1 DCXVJZIGAUPQPB-UHFFFAOYSA-N 0.000 description 1
- OQKQCZKWDZTXPQ-UHFFFAOYSA-N 1-[4-amino-3-bromo-5-(trifluoromethyl)phenyl]-2-(cyclopropylamino)ethanol Chemical compound C1=C(C(F)(F)F)C(N)=C(Br)C=C1C(O)CNC1CC1 OQKQCZKWDZTXPQ-UHFFFAOYSA-N 0.000 description 1
- AGCWKEHGEJENPO-UHFFFAOYSA-N 1-[4-amino-3-bromo-5-(trifluoromethyl)phenyl]-2-(cyclopropylmethylamino)ethanol Chemical compound NC1=C(C=C(C=C1C(F)(F)F)C(CNCC1CC1)O)Br AGCWKEHGEJENPO-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- LTBNPJVAOXHZIG-UHFFFAOYSA-N 2-amino-1-(4-amino-3-bromo-5-chlorophenyl)ethanol Chemical class NCC(O)C1=CC(Cl)=C(N)C(Br)=C1 LTBNPJVAOXHZIG-UHFFFAOYSA-N 0.000 description 1
- HZHXEUNZSLFYKK-UHFFFAOYSA-N 2-amino-3-bromo-5-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzonitrile Chemical compound CC(C)NCC(O)C1=CC(Br)=C(N)C(C#N)=C1 HZHXEUNZSLFYKK-UHFFFAOYSA-N 0.000 description 1
- CYQCDCAKVWRDQU-UHFFFAOYSA-N 2-amino-3-bromo-5-[2-(cyclobutylamino)-1-hydroxyethyl]benzonitrile Chemical compound C1=C(C#N)C(N)=C(Br)C=C1C(O)CNC1CCC1 CYQCDCAKVWRDQU-UHFFFAOYSA-N 0.000 description 1
- SGQICXAMNZOMBD-UHFFFAOYSA-N 2-amino-3-bromo-5-[2-(cyclopentylamino)-1-hydroxyethyl]benzonitrile Chemical compound C1=C(C#N)C(N)=C(Br)C=C1C(O)CNC1CCCC1 SGQICXAMNZOMBD-UHFFFAOYSA-N 0.000 description 1
- SJCKUQRYGWLROW-UHFFFAOYSA-N 2-amino-3-bromo-5-[2-(cyclopropylamino)-1-hydroxyethyl]benzonitrile Chemical compound C1=C(C#N)C(N)=C(Br)C=C1C(O)CNC1CC1 SJCKUQRYGWLROW-UHFFFAOYSA-N 0.000 description 1
- QRWOYHAGXSTGFM-UHFFFAOYSA-N 2-amino-3-bromo-5-[2-(diethylamino)-1-hydroxyethyl]benzonitrile Chemical compound NC1=C(C=C(C=C1C#N)C(CN(CC)CC)O)Br QRWOYHAGXSTGFM-UHFFFAOYSA-N 0.000 description 1
- HDYIOMSKGZXJJX-UHFFFAOYSA-N 2-amino-5-[2-(cyclobutylamino)-1-hydroxyethyl]benzonitrile Chemical compound C1=C(C#N)C(N)=CC=C1C(O)CNC1CCC1 HDYIOMSKGZXJJX-UHFFFAOYSA-N 0.000 description 1
- MKYVGPFLFZQOAM-UHFFFAOYSA-N 2-amino-5-[2-(cyclobutylamino)-1-hydroxyethyl]benzonitrile;hydrobromide Chemical compound Br.C1=C(C#N)C(N)=CC=C1C(O)CNC1CCC1 MKYVGPFLFZQOAM-UHFFFAOYSA-N 0.000 description 1
- XNKDMGQNPMRLFI-UHFFFAOYSA-N 2-amino-5-[2-(diethylamino)-1-hydroxyethyl]benzonitrile Chemical compound NC1=C(C=C(C=C1)C(CN(CC)CC)O)C#N XNKDMGQNPMRLFI-UHFFFAOYSA-N 0.000 description 1
- 229940013085 2-diethylaminoethanol Drugs 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- ZOLBALGTFCCTJF-UHFFFAOYSA-N 4-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol;sulfuric acid Chemical compound OS(O)(=O)=O.CC(C)NCC(O)C1=CC=C(O)C(O)=C1.CC(C)NCC(O)C1=CC=C(O)C(O)=C1 ZOLBALGTFCCTJF-UHFFFAOYSA-N 0.000 description 1
- 102000009346 Adenosine receptors Human genes 0.000 description 1
- 108050000203 Adenosine receptors Proteins 0.000 description 1
- 101150041968 CDC13 gene Proteins 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- YQCALTOAPFZEJE-UHFFFAOYSA-N Cl.NC1=C(C=C(C=C1C(F)(F)F)C(CN(C)C)O)Br Chemical compound Cl.NC1=C(C=C(C=C1C(F)(F)F)C(CN(C)C)O)Br YQCALTOAPFZEJE-UHFFFAOYSA-N 0.000 description 1
- 206010011224 Cough Diseases 0.000 description 1
- 241000353790 Doru Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 102000010909 Monoamine Oxidase Human genes 0.000 description 1
- 108010062431 Monoamine oxidase Proteins 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 208000001871 Tachycardia Diseases 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 230000003042 antagnostic effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229940124630 bronchodilator Drugs 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- XEKAUTDWPYQNFU-UHFFFAOYSA-N chlorane Chemical compound Cl.Cl.Cl XEKAUTDWPYQNFU-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 238000012790 confirmation Methods 0.000 description 1
- 229960002887 deanol Drugs 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 230000006794 tachycardia Effects 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/04—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
- C07D317/58—Radicals substituted by nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2261914A DE2261914C3 (de) | 1972-12-18 | 1972-12-18 | Amino-phenyl-äthanolamine und deren Säureadditionssalze, Verfahren zu deren Herstellung und Arzneimittel |
| DE19732345442 DE2345442C2 (de) | 1973-09-08 | 1973-09-08 | d- und l-Phenyläthanolamine und deren Salze, Herstellungsverfahren und Arzneimittel auf deren Basis |
| DE19732351281 DE2351281C3 (de) | 1973-10-12 | 1973-10-12 | Aminophenyl-äthanolamin-Derivate, deren Herstellung und Verwendung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL96538B1 true PL96538B1 (pl) | 1977-12-31 |
Family
ID=27184904
Family Applications (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL18240673A PL96538B1 (pl) | 1972-12-18 | 1973-12-17 | Sposob wytwarzania nowych aminofenyloetanoloamin |
| PL18241073A PL96535B1 (pl) | 1972-12-18 | 1973-12-17 | Sposob wytwarzania nowych aminofenyloetanoloamin |
| PL16739973A PL96221B1 (pl) | 1972-12-18 | 1973-12-17 | Sposob wytwarzania nowych aminofenyloetanoloamin |
Family Applications After (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL18241073A PL96535B1 (pl) | 1972-12-18 | 1973-12-17 | Sposob wytwarzania nowych aminofenyloetanoloamin |
| PL16739973A PL96221B1 (pl) | 1972-12-18 | 1973-12-17 | Sposob wytwarzania nowych aminofenyloetanoloamin |
Country Status (5)
| Country | Link |
|---|---|
| AT (1) | AT333251B (de) |
| CH (2) | CH605656A5 (de) |
| ES (4) | ES421350A1 (de) |
| PH (2) | PH20591A (de) |
| PL (3) | PL96538B1 (de) |
-
1973
- 1973-12-10 AT AT1028573A patent/AT333251B/de not_active IP Right Cessation
- 1973-12-11 ES ES421350A patent/ES421350A1/es not_active Expired
- 1973-12-14 CH CH1179077A patent/CH605656A5/xx not_active IP Right Cessation
- 1973-12-14 CH CH1178877A patent/CH605623A5/de not_active IP Right Cessation
- 1973-12-17 PL PL18240673A patent/PL96538B1/pl unknown
- 1973-12-17 PL PL18241073A patent/PL96535B1/pl unknown
- 1973-12-17 PL PL16739973A patent/PL96221B1/pl unknown
- 1973-12-18 PH PH15328A patent/PH20591A/en unknown
-
1974
- 1974-04-30 ES ES425792A patent/ES425792A1/es not_active Expired
- 1974-04-30 ES ES425793A patent/ES425793A1/es not_active Expired
- 1974-04-30 ES ES425791A patent/ES425791A1/es not_active Expired
-
1982
- 1982-03-28 PH PH27074A patent/PH19317A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| PH20591A (en) | 1987-02-20 |
| PH19317A (en) | 1986-03-18 |
| ES425791A1 (es) | 1976-06-16 |
| CH605623A5 (en) | 1978-10-13 |
| ES425793A1 (es) | 1977-07-01 |
| ES421350A1 (es) | 1976-12-01 |
| ATA1028573A (de) | 1976-03-15 |
| CH605656A5 (de) | 1978-10-13 |
| PL96535B1 (pl) | 1977-12-31 |
| PL96221B1 (pl) | 1977-12-31 |
| AT333251B (de) | 1976-11-10 |
| ES425792A1 (es) | 1976-06-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0110372B1 (de) | 1-Phenylisochinolinderivate und Verfahren zu ihrer Herstellung, diese Verbindung enthaltende pharmazeutische Präparate und deren Anwendung | |
| US4119710A (en) | Bronchospasmolytic 1-(p-amino-phenyl)-2-amino-ethanols-(1) and salts | |
| FI72714B (fi) | Foerfarande foer framstaellning av farmakologiskt vaerdefulla 4-acylamino-fenyl-etanolaminer. | |
| US3574211A (en) | 1-(amino-monohalo-phenyl)-2-amino-alkanols and salts | |
| US4730042A (en) | Compounds 1 or 3-hydroxy-4-benzyl-6-methyl-7-(4-isopropylamino-butoxy)-1,3-dihydro[3,4-C]pyridine and 2-methyl-3-(4-isopropyl-aminobutoxy)-4-(1'-morphilinomethyl)-5-hydroxymethyl-6-benzyl pyridine, useful for treating cardiac arrhythmias | |
| DE2639718A1 (de) | Neue phenylaethylamine | |
| PL97194B1 (pl) | Sposob wytwarzania nowych aminofenyloetanoloamin | |
| US4782058A (en) | 1,3,4,6,7,11b-Hexahydro-6-phenyl-2H-pyrazino-(2,1-a)isoquinolines, for anti-histamine or anti-depression treatment | |
| US4224332A (en) | 1-Aza-[2,2,2]-bicyclooctanes and anti-depressant and anti-parkinsonian compositions thereof | |
| DD202867A5 (de) | Verfahren zur herstellung von phenylalkylaminen | |
| DE2333847A1 (de) | Tetrahydronaphthole, ihre salze und diese verbindungen enthaltende arzneimittel | |
| US3256289A (en) | Carbocyclic substituted piperidyl dioxanes | |
| EP0000395B1 (de) | 2-Piperazinotetraline, ihre Herstellung und Verwendung als Arzneimittel | |
| NO141160B (no) | Analogifremgangsmaate til fremstilling av terapeutisk virksomme 3,4-dihydro-2(1h)-isokinolinkarboksamider | |
| SK16896A3 (en) | 1-£2-(substituted vinyl)|-3,4-dihydro-5h-2,3-benzodiazepine derivatives | |
| US3910915A (en) | 1-Aryl-2-{8 (substituted amino)alkanoyl{9 -1,2,3,4-tetrahydroisoquinolines | |
| JPS6011901B2 (ja) | 新規の脂肪族置換された４−フエニル−ピペリジン | |
| US3217007A (en) | Halo- and nitro-substituted phenethyl-z- methyl tetrahydroisoquinolsnes | |
| US4393226A (en) | Compounds and methods for changing calcium metabolism within the cells of a mammal | |
| Counsell et al. | Esters of Bicyclic Aminoalcohols II: The Synthesis of the Hydroxyquinolizidines and Some of Their Esters as Potential Therapeutic Agents | |
| US3998965A (en) | 4-Aminoalkyl-4-cyano-4-phenyl-butanoic acid esters | |
| Kador et al. | Synthesis and biological evaluation of a tetrahydroisoquinoline derivative possessing selective. beta. 2-adrenergic agonist activity | |
| US2878254A (en) | N, n'-alkylene-bis-(3-hydroxypiperidine) compounds and preparation thereof | |
| DD251289A5 (de) | Verfahren zur herstellung einer neuartigen racemischen oder optisch aktiven verbindung | |
| FI58326C (fi) | Foerfarande foer framstaellning av som beta-adrenergiskt stimulerande medel anvaendbara alfa-aminometyl-4-hydroksi-3-metylsulfonyl-metylbensylalkoholer |