PL94683B1 - Sposob wytwarzania nowych dwupierscieniowych imidazoli i pirymidyn - Google Patents
Sposob wytwarzania nowych dwupierscieniowych imidazoli i pirymidyn Download PDFInfo
- Publication number
- PL94683B1 PL94683B1 PL1973167158A PL16715873A PL94683B1 PL 94683 B1 PL94683 B1 PL 94683B1 PL 1973167158 A PL1973167158 A PL 1973167158A PL 16715873 A PL16715873 A PL 16715873A PL 94683 B1 PL94683 B1 PL 94683B1
- Authority
- PL
- Poland
- Prior art keywords
- group
- formula
- general formula
- ring
- zero
- Prior art date
Links
- 150000003230 pyrimidines Chemical class 0.000 title claims description 11
- 150000002460 imidazoles Chemical class 0.000 title claims description 10
- 238000004519 manufacturing process Methods 0.000 title claims 7
- 150000001875 compounds Chemical class 0.000 claims abstract description 59
- 238000000034 method Methods 0.000 claims description 48
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 32
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 claims description 32
- -1 ethylbenzyl Chemical group 0.000 claims description 29
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 20
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 239000002253 acid Substances 0.000 claims description 17
- 238000002360 preparation method Methods 0.000 claims description 16
- 150000003839 salts Chemical class 0.000 claims description 16
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 14
- 238000006798 ring closing metathesis reaction Methods 0.000 claims description 13
- 230000008569 process Effects 0.000 claims description 12
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 11
- 239000002904 solvent Substances 0.000 claims description 9
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 8
- 239000002585 base Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 6
- 125000003158 alcohol group Chemical group 0.000 claims description 5
- VVLJQSJNPKNTAT-UHFFFAOYSA-N imafen Chemical compound C1N=C2NCCN2C1C1=CC=CC=C1 VVLJQSJNPKNTAT-UHFFFAOYSA-N 0.000 claims description 5
- 239000011734 sodium Substances 0.000 claims description 5
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 4
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 claims description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 239000011230 binding agent Substances 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical class C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 claims description 2
- 125000005425 toluyl group Chemical group 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims 2
- NIXNFAPFVGJDHJ-UHFFFAOYSA-N 1-(2-chloroethyl)-5-(2-chlorophenyl)-4,5-dihydroimidazol-2-amine Chemical compound ClCCN1C(N)=NCC1C1=CC=CC=C1Cl NIXNFAPFVGJDHJ-UHFFFAOYSA-N 0.000 claims 1
- BFCNHSPKXDISLP-UHFFFAOYSA-N 5-(4-methylphenyl)-2,3,5,6-tetrahydro-1h-imidazo[1,2-a]imidazole Chemical compound C1=CC(C)=CC=C1C1N2CCNC2=NC1 BFCNHSPKXDISLP-UHFFFAOYSA-N 0.000 claims 1
- QCZVSTFZLSDXNY-UHFFFAOYSA-N 5-phenyl-1,2,3,5,6,7-hexahydroimidazo[1,2-a]pyrimidine Chemical compound C1CNC2=NCCN2C1C1=CC=CC=C1 QCZVSTFZLSDXNY-UHFFFAOYSA-N 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- WBLIXGSTEMXDSM-UHFFFAOYSA-N chloromethane Chemical compound Cl[CH2] WBLIXGSTEMXDSM-UHFFFAOYSA-N 0.000 claims 1
- YWOITFUKFOYODT-UHFFFAOYSA-N methanol;sodium Chemical compound [Na].OC YWOITFUKFOYODT-UHFFFAOYSA-N 0.000 claims 1
- 230000009466 transformation Effects 0.000 claims 1
- 239000000935 antidepressant agent Substances 0.000 abstract description 5
- 210000003169 central nervous system Anatomy 0.000 abstract description 5
- 229940005513 antidepressants Drugs 0.000 abstract description 4
- 239000002243 precursor Substances 0.000 abstract description 2
- YSYSCJKUUFTREM-UHFFFAOYSA-N 6h-pyrimido[1,2-a]pyrimidine Chemical class N1=CC=CN2CC=CN=C21 YSYSCJKUUFTREM-UHFFFAOYSA-N 0.000 abstract 1
- 159000000027 imidazo[1,2-a]imidazoles Chemical class 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 66
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 29
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 28
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 28
- 239000000243 solution Substances 0.000 description 23
- 239000000047 product Substances 0.000 description 22
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 18
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 239000000203 mixture Substances 0.000 description 18
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 10
- 239000000284 extract Substances 0.000 description 9
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 235000019445 benzyl alcohol Nutrition 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- SFLSHLFXELFNJZ-QMMMGPOBSA-N (-)-norepinephrine Chemical compound NC[C@H](O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-QMMMGPOBSA-N 0.000 description 5
- KWTSXDURSIMDCE-QMMMGPOBSA-N (S)-amphetamine Chemical compound C[C@H](N)CC1=CC=CC=C1 KWTSXDURSIMDCE-QMMMGPOBSA-N 0.000 description 5
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 5
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 5
- 229940025084 amphetamine Drugs 0.000 description 5
- 229960002748 norepinephrine Drugs 0.000 description 5
- SFLSHLFXELFNJZ-UHFFFAOYSA-N norepinephrine Natural products NCC(O)C1=CC=C(O)C(O)=C1 SFLSHLFXELFNJZ-UHFFFAOYSA-N 0.000 description 5
- 239000008096 xylene Substances 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- ULSIYEODSMZIPX-UHFFFAOYSA-N phenylethanolamine Chemical compound NCC(O)C1=CC=CC=C1 ULSIYEODSMZIPX-UHFFFAOYSA-N 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- 150000001414 amino alcohols Chemical class 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 210000000744 eyelid Anatomy 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 210000001177 vas deferen Anatomy 0.000 description 3
- LISZRJWLHUJWQA-UHFFFAOYSA-N 1-(2-chloroethyl)-5-(2-chlorophenyl)-4,5-dihydroimidazol-2-amine;hydrochloride Chemical compound Cl.ClCCN1C(N)=NCC1C1=CC=CC=C1Cl LISZRJWLHUJWQA-UHFFFAOYSA-N 0.000 description 2
- JDIIGWSSTNUWGK-UHFFFAOYSA-N 1h-imidazol-3-ium;chloride Chemical compound [Cl-].[NH2+]1C=CN=C1 JDIIGWSSTNUWGK-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 239000008121 dextrose Substances 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- DJZWNSRUEJSEEB-UHFFFAOYSA-N n-(4,5-dihydro-1h-imidazol-2-yl)nitramide Chemical class [O-][N+](=O)NC1=NCCN1 DJZWNSRUEJSEEB-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 239000012279 sodium borohydride Substances 0.000 description 2
- 229910000033 sodium borohydride Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- ZKCDKNXGVQKSPP-UHFFFAOYSA-N 1-aminopropan-2-ol;dihydrochloride Chemical compound Cl.Cl.CC(O)CN ZKCDKNXGVQKSPP-UHFFFAOYSA-N 0.000 description 1
- FFEWHFZDYFAOQT-UHFFFAOYSA-N 1-chloro-2-(1-nitroethenyl)benzene Chemical compound [O-][N+](=O)C(=C)C1=CC=CC=C1Cl FFEWHFZDYFAOQT-UHFFFAOYSA-N 0.000 description 1
- FUHNOQPROBGLRM-UHFFFAOYSA-N 1-phenyl-3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)propan-1-ol Chemical compound C=1C=CC=CC=1C(O)CCNC1=NCCCN1 FUHNOQPROBGLRM-UHFFFAOYSA-N 0.000 description 1
- JMVNRFDRVKBQFN-UHFFFAOYSA-N 2,3-dihydroxybutanedioic acid;5-phenyl-2,3,5,6-tetrahydro-1h-imidazo[1,2-a]imidazole Chemical compound OC(=O)C(O)C(O)C(O)=O.C1N=C2NCCN2C1C1=CC=CC=C1 JMVNRFDRVKBQFN-UHFFFAOYSA-N 0.000 description 1
- LLVCMHDFMXAXMV-UHFFFAOYSA-N 2-(4,5-dihydro-1h-imidazol-2-ylamino)-1-phenylethanol Chemical compound C=1C=CC=CC=1C(O)CNC1=NCCN1 LLVCMHDFMXAXMV-UHFFFAOYSA-N 0.000 description 1
- CNSIYFHLDVSFRV-UHFFFAOYSA-N 2-[2-amino-5-(2-chlorophenyl)-4,5-dihydroimidazol-1-yl]ethanol;hydrochloride Chemical compound Cl.OCCN1C(N)=NCC1C1=CC=CC=C1Cl CNSIYFHLDVSFRV-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- FKJSFKCZZIXQIP-UHFFFAOYSA-N 2-bromo-1-(4-bromophenyl)ethanone Chemical compound BrCC(=O)C1=CC=C(Br)C=C1 FKJSFKCZZIXQIP-UHFFFAOYSA-N 0.000 description 1
- JRFZWDKXKIRUDM-UHFFFAOYSA-N 2-methylsulfanyl-1,2,3,4-tetrahydropyrimidine Chemical class CSC1NCC=CN1 JRFZWDKXKIRUDM-UHFFFAOYSA-N 0.000 description 1
- HJKFMARMANEJDG-UHFFFAOYSA-N 2-methylsulfanyl-2,5-dihydro-1h-imidazole Chemical compound CSC1NCC=N1 HJKFMARMANEJDG-UHFFFAOYSA-N 0.000 description 1
- MTIMDGQILFWMJI-UHFFFAOYSA-N 2-methylsulfanyl-4,5-dihydro-1h-imidazole Chemical compound CSC1=NCCN1 MTIMDGQILFWMJI-UHFFFAOYSA-N 0.000 description 1
- PIAOLBVUVDXHHL-UHFFFAOYSA-N 2-nitroethenylbenzene Chemical compound [O-][N+](=O)C=CC1=CC=CC=C1 PIAOLBVUVDXHHL-UHFFFAOYSA-N 0.000 description 1
- BDDAFJDJGSPEIV-UHFFFAOYSA-N 3-(4-methylphenyl)-2,3,5,6,7,8-hexahydroimidazo[1,2-a]pyrimidine Chemical compound C1=CC(C)=CC=C1C1N2CCCNC2=NC1 BDDAFJDJGSPEIV-UHFFFAOYSA-N 0.000 description 1
- PHIYHIOQVWTXII-UHFFFAOYSA-N 3-amino-1-phenylpropan-1-ol Chemical compound NCCC(O)C1=CC=CC=C1 PHIYHIOQVWTXII-UHFFFAOYSA-N 0.000 description 1
- XKTONDZDILVOOL-UHFFFAOYSA-N 3-phenylimidazo[1,2-a]pyrimidine Chemical compound C=1N=C2N=CC=CN2C=1C1=CC=CC=C1 XKTONDZDILVOOL-UHFFFAOYSA-N 0.000 description 1
- 125000004860 4-ethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- HCYGNJYWSONOFF-UHFFFAOYSA-N 5-(2-chlorophenyl)-2,3,5,6-tetrahydro-1h-imidazo[1,2-a]imidazole;hydrochloride Chemical compound Cl.ClC1=CC=CC=C1C1N2CCNC2=NC1 HCYGNJYWSONOFF-UHFFFAOYSA-N 0.000 description 1
- YRGHLBARIOIIFT-UHFFFAOYSA-N 5-(3,4-dichlorophenyl)-2,3,5,6-tetrahydro-1h-imidazo[1,2-a]imidazole;hydrochloride Chemical compound Cl.C1=C(Cl)C(Cl)=CC=C1C1N2CCNC2=NC1 YRGHLBARIOIIFT-UHFFFAOYSA-N 0.000 description 1
- HKATYXUZLOZQAJ-UHFFFAOYSA-N 5-(4-methylphenyl)-2,3,5,6-tetrahydro-1h-imidazo[1,2-a]imidazole;hydrochloride Chemical compound Cl.C1=CC(C)=CC=C1C1N2CCN=C2NC1 HKATYXUZLOZQAJ-UHFFFAOYSA-N 0.000 description 1
- TZMGMCKCSNWOSD-UHFFFAOYSA-N 7-benzyl-5-(4-bromophenyl)-2,3,5,6-tetrahydroimidazo[1,2-a]imidazole;oxalic acid Chemical compound OC(=O)C(O)=O.C1=CC(Br)=CC=C1C1N2CCN=C2N(CC=2C=CC=CC=2)C1 TZMGMCKCSNWOSD-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-LWMBPPNESA-L D-tartrate(2-) Chemical compound [O-]C(=O)[C@@H](O)[C@H](O)C([O-])=O FEWJPZIEWOKRBE-LWMBPPNESA-L 0.000 description 1
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- FEWJPZIEWOKRBE-XIXRPRMCSA-N Mesotartaric acid Chemical compound OC(=O)[C@@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-XIXRPRMCSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 208000005392 Spasm Diseases 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 230000037007 arousal Effects 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- OEERIBPGRSLGEK-UHFFFAOYSA-N carbon dioxide;methanol Chemical compound OC.O=C=O OEERIBPGRSLGEK-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000001055 chewing effect Effects 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 238000006264 debenzylation reaction Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 230000010339 dilation Effects 0.000 description 1
- 230000000857 drug effect Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 208000001936 exophthalmos Diseases 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- HEGFSNNUZBZCMO-UHFFFAOYSA-N n-(1,2,3,4-tetrahydropyrimidin-2-yl)nitramide Chemical class [O-][N+](=O)NC1NCC=CN1 HEGFSNNUZBZCMO-UHFFFAOYSA-N 0.000 description 1
- QCUYQFCGLUFRPG-UHFFFAOYSA-N n-(1,4,5,6-tetrahydropyrimidin-2-yl)nitramide Chemical compound [O-][N+](=O)NC1=NCCCN1 QCUYQFCGLUFRPG-UHFFFAOYSA-N 0.000 description 1
- PTNWKQXEYUQQCU-UHFFFAOYSA-N n-benzyl-1h-imidazol-2-amine Chemical compound C=1C=CC=CC=1CNC1=NC=CN1 PTNWKQXEYUQQCU-UHFFFAOYSA-N 0.000 description 1
- SDROEWZZAHSJDT-UHFFFAOYSA-N n-benzyl-4,5-dihydro-1h-imidazol-2-amine Chemical compound C=1C=CC=CC=1CNC1=NCCN1 SDROEWZZAHSJDT-UHFFFAOYSA-N 0.000 description 1
- XLWNLCSWRLEMJR-UHFFFAOYSA-N n-benzylpyrimidin-2-amine Chemical class C=1C=CC=CC=1CNC1=NC=CC=N1 XLWNLCSWRLEMJR-UHFFFAOYSA-N 0.000 description 1
- ANORDWOIBSUYBN-UHFFFAOYSA-N n-chloro-1-phenylmethanamine Chemical compound ClNCC1=CC=CC=C1 ANORDWOIBSUYBN-UHFFFAOYSA-N 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 229910003446 platinum oxide Inorganic materials 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 238000003419 tautomerization reaction Methods 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/28—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/30—Oxygen or sulfur atoms
- C07D233/42—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/28—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/44—Nitrogen atoms not forming part of a nitro radical
- C07D233/48—Nitrogen atoms not forming part of a nitro radical with acyclic hydrocarbon or substituted acyclic hydrocarbon radicals, attached to said nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/06—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D239/08—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with hetero atoms directly attached in position 2
- C07D239/12—Nitrogen atoms not forming part of a nitro radical
- C07D239/14—Nitrogen atoms not forming part of a nitro radical with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, attached to said nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US313285A US3865836A (en) | 1972-12-08 | 1972-12-08 | Bicyclic imidazoles |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL94683B1 true PL94683B1 (pl) | 1977-08-31 |
Family
ID=23215116
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1973167158A PL94683B1 (pl) | 1972-12-08 | 1973-12-08 | Sposob wytwarzania nowych dwupierscieniowych imidazoli i pirymidyn |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US3865836A (show.php) |
| JP (1) | JPS4994694A (show.php) |
| AT (1) | AT333770B (show.php) |
| BE (1) | BE808416A (show.php) |
| BG (1) | BG21608A3 (show.php) |
| CA (1) | CA1010864A (show.php) |
| CH (1) | CH593975A5 (show.php) |
| DE (1) | DE2361188A1 (show.php) |
| DK (1) | DK141289B (show.php) |
| FI (1) | FI54711C (show.php) |
| FR (1) | FR2209576B1 (show.php) |
| GB (1) | GB1446482A (show.php) |
| HU (1) | HU168638B (show.php) |
| IE (1) | IE38618B1 (show.php) |
| IL (1) | IL43770A (show.php) |
| NL (1) | NL7316778A (show.php) |
| NO (1) | NO139087C (show.php) |
| PH (1) | PH10417A (show.php) |
| PL (1) | PL94683B1 (show.php) |
| RO (1) | RO63263A (show.php) |
| SE (1) | SE411627B (show.php) |
| SU (1) | SU578003A3 (show.php) |
| ZA (1) | ZA739343B (show.php) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU181927B (en) * | 1977-07-06 | 1983-11-28 | Iso Pharmachim | Process for producing r,s-2,3,5,6-tetrahydro-6-phenyl-imidazo-bracket-2,1-b-bracket closed thiazol /tetramizol/ |
| BG25138A1 (en) * | 1977-07-06 | 1978-08-10 | Georgiev | A method of obtaining of rs-(+/-)-2,3,5,6-tetrahydro-6-phenylimidazo-(2,1-b)-thiazol(tetramizol) |
| DE2827617A1 (de) * | 1978-06-23 | 1980-01-10 | Boehringer Sohn Ingelheim | Neue imidazo eckige klammer auf 1,2- alpha eckige klammer zu imidazole, deren saeureadditionssalze, diese enthaltende arzneimittel und verfahren zu deren herstellung |
| US4370500A (en) * | 1978-11-06 | 1983-01-25 | American Cyanamid Company | Compound: d-N-(2-amino-2-phenethyl)-2-methoxyethylamine and process for preparing the same by selective crystallization |
| DE3042636A1 (de) * | 1980-11-12 | 1982-06-16 | C.H. Boehringer Sohn, 6507 Ingelheim | Neue 7-(2,6-dibrom-4-methylphenyl)-2,3-dihydro-imidazo(1,2-a)imidazole, deren saeureadditionssalze, diese enhthaltende arzneimittel und verfahren zu deren herstellung |
| GB8509531D0 (en) * | 1985-04-13 | 1985-05-15 | Bp Chem Int Ltd | Preparation of guanidines |
| US6359144B1 (en) * | 1997-02-04 | 2002-03-19 | Lion Bioscience Ag | Combinatorial libraries of bicyclic guanidine derivatives and compounds therein |
| RU2003126188A (ru) * | 2001-01-26 | 2005-03-27 | Бристол-Маерс Сквибб Компани (Us) | Имидазолильные производные как ингибиторы кортикотропин-рилизинг фактора |
| IL160397A0 (en) * | 2001-09-21 | 2004-07-25 | Sanofi Synthelabo | Substituted 2-pyrimidinyl-6,7,8,9-tetrahydropyrimido{1,2-a} pyrimidin-4-one and 7-pyrimidinyl-2,3-dihydroimidazo {1,2-a} pyrimidin-5 (1h) one derivatives for neurodegenerative disorders |
| JP2008543840A (ja) * | 2005-06-14 | 2008-12-04 | シェーリング コーポレイション | アスパルチルプロテアーゼインヒビター |
| US8563560B2 (en) * | 2011-02-25 | 2013-10-22 | Ppg Industries Ohio, Inc. | Preparation of bicyclic guanidine salts in an aqueous media |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB796996A (en) * | 1956-03-29 | 1958-06-25 | Monsanto Canada Ltd | Imidazole derivatives |
| GB805877A (en) * | 1957-01-28 | 1958-12-17 | Monsanto Canada Ltd | Process for the production of 2, 3, 5, 6-tetrahydro-1-imidaz (1, 2-a) imidazole |
-
1972
- 1972-12-08 US US313285A patent/US3865836A/en not_active Expired - Lifetime
-
1973
- 1973-11-28 PH PH15267A patent/PH10417A/en unknown
- 1973-12-04 SE SE7316354A patent/SE411627B/xx unknown
- 1973-12-05 FI FI3729/73A patent/FI54711C/fi active
- 1973-12-06 NO NO734672A patent/NO139087C/no unknown
- 1973-12-06 GB GB5655073A patent/GB1446482A/en not_active Expired
- 1973-12-07 DE DE2361188A patent/DE2361188A1/de not_active Ceased
- 1973-12-07 RO RO7300076930A patent/RO63263A/ro unknown
- 1973-12-07 IL IL43770A patent/IL43770A/en unknown
- 1973-12-07 FR FR7343834A patent/FR2209576B1/fr not_active Expired
- 1973-12-07 NL NL7316778A patent/NL7316778A/xx not_active Application Discontinuation
- 1973-12-07 IE IE2221/73A patent/IE38618B1/xx unknown
- 1973-12-07 CH CH1720673A patent/CH593975A5/xx not_active IP Right Cessation
- 1973-12-07 HU HUJA693A patent/HU168638B/hu unknown
- 1973-12-07 CA CA187,628A patent/CA1010864A/en not_active Expired
- 1973-12-07 ZA ZA00739343A patent/ZA739343B/xx unknown
- 1973-12-07 DK DK665873AA patent/DK141289B/da unknown
- 1973-12-07 AT AT1026573A patent/AT333770B/de not_active IP Right Cessation
- 1973-12-07 SU SU7301981312A patent/SU578003A3/ru active
- 1973-12-07 JP JP48136280A patent/JPS4994694A/ja active Pending
- 1973-12-08 BG BG25191A patent/BG21608A3/xx unknown
- 1973-12-08 PL PL1973167158A patent/PL94683B1/pl unknown
- 1973-12-10 BE BE138675A patent/BE808416A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SU578003A3 (ru) | 1977-10-25 |
| NO139087B (no) | 1978-09-25 |
| IE38618L (en) | 1974-06-08 |
| CH593975A5 (show.php) | 1977-12-30 |
| ZA739343B (en) | 1975-07-30 |
| FI54711C (fi) | 1979-02-12 |
| JPS4994694A (show.php) | 1974-09-09 |
| IL43770A (en) | 1976-08-31 |
| HU168638B (show.php) | 1976-06-28 |
| AU6337173A (en) | 1975-06-12 |
| DK141289C (show.php) | 1980-08-11 |
| DE2361188A1 (de) | 1974-06-12 |
| FR2209576A1 (show.php) | 1974-07-05 |
| GB1446482A (en) | 1976-08-18 |
| PH10417A (en) | 1977-03-16 |
| BG21608A3 (show.php) | 1976-07-20 |
| IL43770A0 (en) | 1974-03-14 |
| RO63263A (fr) | 1978-08-15 |
| CA1010864A (en) | 1977-05-24 |
| AT333770B (de) | 1976-12-10 |
| US3865836A (en) | 1975-02-11 |
| NL7316778A (show.php) | 1974-06-11 |
| FI54711B (fi) | 1978-10-31 |
| DK141289B (da) | 1980-02-18 |
| SE411627B (sv) | 1980-01-21 |
| IE38618B1 (en) | 1978-04-26 |
| BE808416A (fr) | 1974-06-10 |
| ATA1026573A (de) | 1976-04-15 |
| FR2209576B1 (show.php) | 1977-01-28 |
| NO139087C (no) | 1979-01-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL94683B1 (pl) | Sposob wytwarzania nowych dwupierscieniowych imidazoli i pirymidyn | |
| FI89265C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara substituerade piperazinylpyridiner eller piperazinylimidazoler | |
| US3666767A (en) | 2-amino-1-(2-imidazolin-2-yl)-2-imidazolines | |
| DK154299B (da) | Analogifremgangsmaade til fremstilling af dibenzoimidazo-azepiner, -oxazepiner og -thiazepiner | |
| CA1338908C (en) | Aminoalkylthio derivatives of triazolopyridine or triazoloquinoline, the processes for their preparation, and drugs, useful especially as analgesics in which they are present | |
| PL98705B1 (pl) | Sposob wytwarzania n,n'-heterocyklo-podstawionych guanidyn | |
| GB2038822A (en) | Thiazole derivatives | |
| CA2108941A1 (en) | Pyrazolo¬4,3-c|pyridines, a process for their preparation and their use as serotonin reuptake inhibitors | |
| NZ503486A (en) | Serotonin antagonists 3-substituted tetrahydropyridopyrimidinone derivatives for treating 5HT, depression and related disorders | |
| US3314963A (en) | Azabenzocycloalkane-n-carboxamidines | |
| US5214047A (en) | Tetracyclic quinazoline derivatives, effective as antiarrythmic agents | |
| EP0690845B1 (en) | Piperazine derivatives as 5-ht1a ligands | |
| Short et al. | Sympathetic nervous system blocking agents. V. Derivatives of isobutyl-, tert-butyl-, and neopentylguanidine | |
| PL146668B1 (en) | Method of obtaining derivatives of 1,6-naphthyridine | |
| HU199835B (en) | Process for producing benzoquinolizine derivatives and pharmaceutical compositions comprising such compounds | |
| PL141127B1 (en) | Method of obtaining bis-/piperazinylo or homopiperazinylo/-alkanes | |
| Durant et al. | Potential histamine H2-receptor antagonists. 1. Aminoethylimidazo [1, 2-a] pyridines and-imidazo [1, 5-a] pyridines | |
| US3252983A (en) | Aralkyl compounds | |
| US3297696A (en) | 6-amino-8, 9-dihydro-13bh-isoquinolo-[2, 1-c] quinazolines and intermediates therefor | |
| US3983133A (en) | 2-Substituted imidazolines | |
| US3923808A (en) | Bicyclic imidazoles and pyrimidines | |
| CA1194869A (en) | [2-[(nitropyridinyl) amino] phenyl] arylmethanones in a process for preparing pyrido [1,4] benzodiazepines | |
| CA1064497A (en) | Basically substituted 3,4-dihydro-2h-isoquinolin-1-thiones and process for preparing them | |
| US3963718A (en) | Tetrahydropyrimidines | |
| DK170043B1 (da) | 5-phenyl-1,4,5,6-tetrahydropyrimidinderivater, fremgangsmåde til fremstilling heraf, farmaceutisk middel indeholdende disse samt anvendelse af derivaterne til fremstilling af et farmaceutisk middel |