PL91721B1 - - Google Patents
Download PDFInfo
- Publication number
- PL91721B1 PL91721B1 PL17413769A PL17413769A PL91721B1 PL 91721 B1 PL91721 B1 PL 91721B1 PL 17413769 A PL17413769 A PL 17413769A PL 17413769 A PL17413769 A PL 17413769A PL 91721 B1 PL91721 B1 PL 91721B1
- Authority
- PL
- Poland
- Prior art keywords
- phenyl
- solution
- cyclohexenyl
- acid
- water
- Prior art date
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 119
- -1 p-phenylene radical Chemical class 0.000 claims description 117
- 239000000203 mixture Substances 0.000 claims description 79
- 150000001875 compounds Chemical class 0.000 claims description 54
- 150000003839 salts Chemical class 0.000 claims description 38
- 239000002253 acid Substances 0.000 claims description 37
- 238000000034 method Methods 0.000 claims description 28
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 26
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 24
- 150000002825 nitriles Chemical class 0.000 claims description 22
- 229910052740 iodine Inorganic materials 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 238000006460 hydrolysis reaction Methods 0.000 claims description 10
- 230000007062 hydrolysis Effects 0.000 claims description 9
- 150000003254 radicals Chemical class 0.000 claims description 9
- 235000019260 propionic acid Nutrition 0.000 claims description 8
- 125000000304 alkynyl group Chemical group 0.000 claims description 7
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 7
- 239000000194 fatty acid Substances 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 claims description 7
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 6
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 6
- 229930195729 fatty acid Natural products 0.000 claims description 6
- 125000000468 ketone group Chemical group 0.000 claims description 6
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 claims description 6
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 claims description 5
- 150000007513 acids Chemical class 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- CVBPQTZKZQWEFX-UHFFFAOYSA-N 2-[4-(cyclohexen-1-yl)phenyl]propanoic acid Chemical compound C1=CC(C(C(O)=O)C)=CC=C1C1=CCCCC1 CVBPQTZKZQWEFX-UHFFFAOYSA-N 0.000 claims description 4
- 125000002030 1,2-phenylene group Chemical group [H]C1=C([H])C([*:1])=C([*:2])C([H])=C1[H] 0.000 claims description 3
- 125000005323 thioketone group Chemical group 0.000 claims description 3
- PGBJOUBKSBMKOA-UHFFFAOYSA-N 2-[4-(cyclohepten-1-yl)phenyl]propanoic acid Chemical compound C1=CC(C(C(O)=O)C)=CC=C1C1=CCCCCC1 PGBJOUBKSBMKOA-UHFFFAOYSA-N 0.000 claims description 2
- 150000001735 carboxylic acids Chemical class 0.000 claims 2
- CCGKOQOJPYTBIH-UHFFFAOYSA-N ethenone Chemical compound C=C=O CCGKOQOJPYTBIH-UHFFFAOYSA-N 0.000 claims 1
- 125000001183 hydrocarbyl group Chemical group 0.000 claims 1
- 230000001131 transforming effect Effects 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 231
- 239000000243 solution Substances 0.000 description 155
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 114
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 101
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 88
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 79
- 229910052938 sodium sulfate Inorganic materials 0.000 description 61
- 235000011152 sodium sulphate Nutrition 0.000 description 61
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 60
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 53
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 50
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 41
- 239000003208 petroleum Substances 0.000 description 40
- 238000003756 stirring Methods 0.000 description 40
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 39
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 36
- 238000006243 chemical reaction Methods 0.000 description 29
- 235000002639 sodium chloride Nutrition 0.000 description 29
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 28
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 28
- 238000009835 boiling Methods 0.000 description 26
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 25
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 22
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical class [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 20
- 239000000725 suspension Substances 0.000 description 20
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 19
- 239000007858 starting material Substances 0.000 description 19
- 238000010992 reflux Methods 0.000 description 18
- 239000013078 crystal Substances 0.000 description 16
- 239000012259 ether extract Substances 0.000 description 16
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 15
- 238000001704 evaporation Methods 0.000 description 15
- 238000001953 recrystallisation Methods 0.000 description 15
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 14
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 14
- 229960000583 acetic acid Drugs 0.000 description 14
- 239000012362 glacial acetic acid Substances 0.000 description 14
- 239000000284 extract Substances 0.000 description 13
- 239000003921 oil Substances 0.000 description 13
- 235000019198 oils Nutrition 0.000 description 13
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 12
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 12
- 238000001816 cooling Methods 0.000 description 12
- 230000007935 neutral effect Effects 0.000 description 12
- 239000012074 organic phase Substances 0.000 description 11
- 159000000000 sodium salts Chemical class 0.000 description 11
- 239000007787 solid Substances 0.000 description 11
- 230000008020 evaporation Effects 0.000 description 10
- 239000011777 magnesium Substances 0.000 description 10
- 229910052749 magnesium Inorganic materials 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 8
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 8
- 125000003545 alkoxy group Chemical group 0.000 description 8
- 239000007864 aqueous solution Substances 0.000 description 8
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 8
- 238000010438 heat treatment Methods 0.000 description 8
- 150000002576 ketones Chemical class 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 229910000029 sodium carbonate Inorganic materials 0.000 description 8
- 235000019270 ammonium chloride Nutrition 0.000 description 7
- 239000002585 base Substances 0.000 description 7
- 239000011630 iodine Substances 0.000 description 7
- 239000010410 layer Substances 0.000 description 7
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- 235000019341 magnesium sulphate Nutrition 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 125000005843 halogen group Chemical group 0.000 description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 6
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 6
- 229920006395 saturated elastomer Polymers 0.000 description 6
- 239000012279 sodium borohydride Substances 0.000 description 6
- 229910000033 sodium borohydride Inorganic materials 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 5
- 229920002472 Starch Polymers 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 230000003110 anti-inflammatory effect Effects 0.000 description 5
- KMPWYEUPVWOPIM-KODHJQJWSA-N cinchonidine Chemical compound C1=CC=C2C([C@H]([C@H]3[N@]4CC[C@H]([C@H](C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-KODHJQJWSA-N 0.000 description 5
- 238000002425 crystallisation Methods 0.000 description 5
- 230000008025 crystallization Effects 0.000 description 5
- 238000004821 distillation Methods 0.000 description 5
- 150000002440 hydroxy compounds Chemical class 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- GFOGBVQXIQGBKG-UHFFFAOYSA-N 2-(4-bromophenyl)-2-methyl-1,3-dioxolane Chemical compound C=1C=C(Br)C=CC=1C1(C)OCCO1 GFOGBVQXIQGBKG-UHFFFAOYSA-N 0.000 description 4
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- MOOAHMCRPCTRLV-UHFFFAOYSA-N boron sodium Chemical compound [B].[Na] MOOAHMCRPCTRLV-UHFFFAOYSA-N 0.000 description 4
- 235000011089 carbon dioxide Nutrition 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 239000000543 intermediate Substances 0.000 description 4
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 229940100445 wheat starch Drugs 0.000 description 4
- DXMHQXJHPJNEIL-UHFFFAOYSA-N 1-[4-(cyclohexen-1-yl)phenyl]ethanone Chemical compound C1=CC(C(=O)C)=CC=C1C1=CCCCC1 DXMHQXJHPJNEIL-UHFFFAOYSA-N 0.000 description 3
- SOHNRXSZQAZPNI-UHFFFAOYSA-N 2-[4-(cyclohexen-1-yl)phenyl]acetic acid Chemical compound C1=CC(CC(=O)O)=CC=C1C1=CCCCC1 SOHNRXSZQAZPNI-UHFFFAOYSA-N 0.000 description 3
- HZSSHMGNCSHLFS-UHFFFAOYSA-N 2-[4-(cyclohexen-1-yl)phenyl]butanoic acid Chemical compound C1=CC(C(C(O)=O)CC)=CC=C1C1=CCCCC1 HZSSHMGNCSHLFS-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 229930194542 Keto Natural products 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Natural products C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 235000019445 benzyl alcohol Nutrition 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- SSVFMICWXDVRQN-UHFFFAOYSA-N ethanol;sodium Chemical compound [Na].CCO SSVFMICWXDVRQN-UHFFFAOYSA-N 0.000 description 3
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000000825 pharmaceutical preparation Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 239000012047 saturated solution Substances 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- OVYTZAASVAZITK-UHFFFAOYSA-M sodium;ethanol;hydroxide Chemical compound [OH-].[Na+].CCO OVYTZAASVAZITK-UHFFFAOYSA-M 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 239000000758 substrate Substances 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- 235000012222 talc Nutrition 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- ISODRHQFKANYIX-UHFFFAOYSA-N 1-bromo-4-(cyclohexen-1-yl)benzene Chemical compound C1=CC(Br)=CC=C1C1=CCCCC1 ISODRHQFKANYIX-UHFFFAOYSA-N 0.000 description 2
- ZXTGBIPFQOCXJV-UHFFFAOYSA-N 2-[4-(cyclopenten-1-yl)phenyl]propanoic acid Chemical compound C1=CC(C(C(O)=O)C)=CC=C1C1=CCCC1 ZXTGBIPFQOCXJV-UHFFFAOYSA-N 0.000 description 2
- ZROINSWMCSEKMA-UHFFFAOYSA-N 4-(cyclohexen-1-yl)benzaldehyde Chemical compound C1=CC(C=O)=CC=C1C1=CCCCC1 ZROINSWMCSEKMA-UHFFFAOYSA-N 0.000 description 2
- NWBXIGBKXBWIEE-UHFFFAOYSA-N 4-bromo-3-methoxybenzoyl chloride Chemical compound COC1=CC(C(Cl)=O)=CC=C1Br NWBXIGBKXBWIEE-UHFFFAOYSA-N 0.000 description 2
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 230000000202 analgesic effect Effects 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- YKYOUMDCQGMQQO-UHFFFAOYSA-L cadmium dichloride Chemical compound Cl[Cd]Cl YKYOUMDCQGMQQO-UHFFFAOYSA-L 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- XXTZHYXQVWRADW-UHFFFAOYSA-N diazomethanone Chemical compound [N]N=C=O XXTZHYXQVWRADW-UHFFFAOYSA-N 0.000 description 2
- 125000001033 ether group Chemical group 0.000 description 2
- DLLJVQNYBYOKGS-UHFFFAOYSA-N ethoxyethane;pentane Chemical compound CCCCC.CCOCC DLLJVQNYBYOKGS-UHFFFAOYSA-N 0.000 description 2
- HWJHWSBFPPPIPD-UHFFFAOYSA-N ethoxyethane;propan-2-one Chemical compound CC(C)=O.CCOCC HWJHWSBFPPPIPD-UHFFFAOYSA-N 0.000 description 2
- LUUJKNWQVLEAPY-UHFFFAOYSA-N ethyl 2-[4-(cyclohexen-1-yl)phenyl]acetate Chemical compound C1=CC(CC(=O)OCC)=CC=C1C1=CCCCC1 LUUJKNWQVLEAPY-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical compound CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 210000000929 nociceptor Anatomy 0.000 description 2
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 2
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- RQEUFEKYXDPUSK-SSDOTTSWSA-N (1R)-1-phenylethanamine Chemical compound C[C@@H](N)C1=CC=CC=C1 RQEUFEKYXDPUSK-SSDOTTSWSA-N 0.000 description 1
- AAWZDTNXLSGCEK-LNVDRNJUSA-N (3r,5r)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid Chemical compound O[C@@H]1CC(O)(C(O)=O)C[C@@H](O)C1O AAWZDTNXLSGCEK-LNVDRNJUSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- VDFVNEFVBPFDSB-UHFFFAOYSA-N 1,3-dioxane Chemical compound C1COCOC1 VDFVNEFVBPFDSB-UHFFFAOYSA-N 0.000 description 1
- ZXBPQWDOOILJKL-UHFFFAOYSA-N 1-(1-chloroethyl)-4-(2-methylcyclohexen-1-yl)benzene Chemical compound C1=CC(C(Cl)C)=CC=C1C1=C(C)CCCC1 ZXBPQWDOOILJKL-UHFFFAOYSA-N 0.000 description 1
- SPCNVWMJQSOLFQ-UHFFFAOYSA-N 1-(1-chloropropyl)-4-(cyclohexen-1-yl)benzene Chemical compound C1=CC(C(Cl)CC)=CC=C1C1=CCCCC1 SPCNVWMJQSOLFQ-UHFFFAOYSA-N 0.000 description 1
- UOMOSYFPKGQIKI-UHFFFAOYSA-N 1-(4-bromophenyl)propan-1-one Chemical compound CCC(=O)C1=CC=C(Br)C=C1 UOMOSYFPKGQIKI-UHFFFAOYSA-N 0.000 description 1
- YUVSJMVRSZUNNE-UHFFFAOYSA-N 1-(chloromethyl)-4-(cyclohexen-1-yl)benzene Chemical compound C1=CC(CCl)=CC=C1C1=CCCCC1 YUVSJMVRSZUNNE-UHFFFAOYSA-N 0.000 description 1
- PJULAWBZUCDTRO-UHFFFAOYSA-N 1-(cyclohexen-1-yl)cyclohexa-2,4-diene-1-carbaldehyde Chemical compound C=1CCCCC=1C1(C=O)CC=CC=C1 PJULAWBZUCDTRO-UHFFFAOYSA-N 0.000 description 1
- YSYYVIZYHRUPAF-UHFFFAOYSA-N 1-[2-chloro-4-(2-methyl-1,3-dioxolan-2-yl)phenyl]cyclohexan-1-ol Chemical compound C=1C=C(C2(O)CCCCC2)C(Cl)=CC=1C1(C)OCCO1 YSYYVIZYHRUPAF-UHFFFAOYSA-N 0.000 description 1
- VAVWCMLXYRTELW-UHFFFAOYSA-N 1-[3-chloro-4-(cyclohexen-1-yl)phenyl]ethanol Chemical group ClC1=CC(C(O)C)=CC=C1C1=CCCCC1 VAVWCMLXYRTELW-UHFFFAOYSA-N 0.000 description 1
- BIBPIWZALIZPDM-UHFFFAOYSA-N 1-[4-(2-methylcyclohexen-1-yl)phenyl]ethanol Chemical compound C1=CC(C(O)C)=CC=C1C1=C(C)CCCC1 BIBPIWZALIZPDM-UHFFFAOYSA-N 0.000 description 1
- VCJHUFVIXCANTN-UHFFFAOYSA-N 1-[4-(4-methoxycyclohexen-1-yl)phenyl]ethanol Chemical compound C1C(OC)CCC(C=2C=CC(=CC=2)C(C)O)=C1 VCJHUFVIXCANTN-UHFFFAOYSA-N 0.000 description 1
- KGIMOTQZBVIJNV-UHFFFAOYSA-N 1-[4-(4-methoxycyclohexen-1-yl)phenyl]ethanone Chemical compound C1C(OC)CCC(C=2C=CC(=CC=2)C(C)=O)=C1 KGIMOTQZBVIJNV-UHFFFAOYSA-N 0.000 description 1
- MQGCWFCWIGNSNG-UHFFFAOYSA-N 1-[4-(6-methylcyclohexen-1-yl)phenyl]ethanol Chemical compound C1=CC(C(O)C)=CC=C1C1=CCCCC1C MQGCWFCWIGNSNG-UHFFFAOYSA-N 0.000 description 1
- PNXXMVCYDWQEBD-UHFFFAOYSA-N 1-[4-(6-methylcyclohexen-1-yl)phenyl]ethanone Chemical compound CC1CCCC=C1C1=CC=C(C(C)=O)C=C1 PNXXMVCYDWQEBD-UHFFFAOYSA-N 0.000 description 1
- MAKIBQJCGRKIAN-UHFFFAOYSA-N 1-[4-(cyclohexen-1-yl)phenyl]ethanol Chemical compound C1=CC(C(O)C)=CC=C1C1=CCCCC1 MAKIBQJCGRKIAN-UHFFFAOYSA-N 0.000 description 1
- JNVOCLKTSMFQNL-UHFFFAOYSA-N 1-[4-(cyclopenten-1-yl)phenyl]ethanone Chemical compound C1=CC(C(=O)C)=CC=C1C1=CCCC1 JNVOCLKTSMFQNL-UHFFFAOYSA-N 0.000 description 1
- GQDQFDNNZJHHDE-UHFFFAOYSA-N 2-(4-bromo-3-chlorophenyl)-2-methyl-1,3-dioxolane Chemical compound C=1C=C(Br)C(Cl)=CC=1C1(C)OCCO1 GQDQFDNNZJHHDE-UHFFFAOYSA-N 0.000 description 1
- ZYIMHOWVWWHLDN-UHFFFAOYSA-N 2-(4-bromophenyl)-1,3-dioxolane Chemical compound C1=CC(Br)=CC=C1C1OCCO1 ZYIMHOWVWWHLDN-UHFFFAOYSA-N 0.000 description 1
- IRPYKPHNGZFMBX-UHFFFAOYSA-N 2-(4-bromophenyl)-2-ethyl-1,3-dioxolane Chemical compound C=1C=C(Br)C=CC=1C1(CC)OCCO1 IRPYKPHNGZFMBX-UHFFFAOYSA-N 0.000 description 1
- GYQIJFRUNFAPEJ-UHFFFAOYSA-N 2-[3-chloro-4-(cyclohexen-1-yl)phenyl]propanoic acid Chemical compound ClC1=CC(C(C(O)=O)C)=CC=C1C1=CCCCC1 GYQIJFRUNFAPEJ-UHFFFAOYSA-N 0.000 description 1
- UITYCKJSKUUNPB-UHFFFAOYSA-N 2-[4-(4-methoxycyclohexen-1-yl)phenyl]propanoic acid Chemical compound C1C(OC)CCC(C=2C=CC(=CC=2)C(C)C(O)=O)=C1 UITYCKJSKUUNPB-UHFFFAOYSA-N 0.000 description 1
- OMTJYAQNYZEZRQ-UHFFFAOYSA-N 2-[4-(6-methylcyclohexen-1-yl)phenyl]propanoic acid Chemical compound C1=CC(C(C(O)=O)C)=CC=C1C1=CCCCC1C OMTJYAQNYZEZRQ-UHFFFAOYSA-N 0.000 description 1
- PDXMUKPMODPPCP-UHFFFAOYSA-N 2-[4-(cyclohexen-1-yl)phenyl]acetonitrile Chemical compound C1=CC(CC#N)=CC=C1C1=CCCCC1 PDXMUKPMODPPCP-UHFFFAOYSA-N 0.000 description 1
- HPKFSGDJNCDONQ-UHFFFAOYSA-N 2-[4-(cycloocten-1-yl)phenyl]propanoic acid Chemical compound C1=CC(C(C(O)=O)C)=CC=C1C1=CCCCCCC1 HPKFSGDJNCDONQ-UHFFFAOYSA-N 0.000 description 1
- FNZREIMKSGEYGD-UHFFFAOYSA-N 2-chloro-4-(1-chloroethyl)-1-(cyclohexen-1-yl)benzene Chemical group ClC1=CC(C(Cl)C)=CC=C1C1=CCCCC1 FNZREIMKSGEYGD-UHFFFAOYSA-N 0.000 description 1
- GAOQAPRPYXWTFK-UHFFFAOYSA-N 2-methyl-2-phenyl-1,3-dioxolane Chemical compound C=1C=CC=CC=1C1(C)OCCO1 GAOQAPRPYXWTFK-UHFFFAOYSA-N 0.000 description 1
- LFSAPCRASZRSKS-UHFFFAOYSA-N 2-methylcyclohexan-1-one Chemical compound CC1CCCCC1=O LFSAPCRASZRSKS-UHFFFAOYSA-N 0.000 description 1
- RLQZIECDMISZHS-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=CC(=O)C(C=2C=CC=CC=2)=C1 RLQZIECDMISZHS-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- XKTYXVDYIKIYJP-UHFFFAOYSA-N 3h-dioxole Chemical compound C1OOC=C1 XKTYXVDYIKIYJP-UHFFFAOYSA-N 0.000 description 1
- CVGYWJHGWOZOMS-UHFFFAOYSA-N 4-(cyclohexen-1-yl)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1=CCCCC1 CVGYWJHGWOZOMS-UHFFFAOYSA-N 0.000 description 1
- UEVXVBKBOFGKIN-UHFFFAOYSA-N 4-bromo-3-methoxybenzoic acid Chemical compound COC1=CC(C(O)=O)=CC=C1Br UEVXVBKBOFGKIN-UHFFFAOYSA-N 0.000 description 1
- BNULXDWVTBXMON-UHFFFAOYSA-N 4-methoxy-1-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]cyclohexan-1-ol Chemical compound C1CC(OC)CCC1(O)C1=CC=C(C2(C)OCCO2)C=C1 BNULXDWVTBXMON-UHFFFAOYSA-N 0.000 description 1
- XADCKKKOYZJNAR-UHFFFAOYSA-N 4-methoxycyclohexan-1-one Chemical compound COC1CCC(=O)CC1 XADCKKKOYZJNAR-UHFFFAOYSA-N 0.000 description 1
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Natural products CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- NAENYRPBSUABMF-UHFFFAOYSA-N C1CCC(=CC1)C2=CC=C(C=C2)C(C(=O)O)C(=O)O Chemical compound C1CCC(=CC1)C2=CC=C(C=C2)C(C(=O)O)C(=O)O NAENYRPBSUABMF-UHFFFAOYSA-N 0.000 description 1
- DSOFAJKSONSXKI-UHFFFAOYSA-N CCC1(C2=CC=C(C3(CCCCC3)O)C=C2)OCCO1 Chemical compound CCC1(C2=CC=C(C3(CCCCC3)O)C=C2)OCCO1 DSOFAJKSONSXKI-UHFFFAOYSA-N 0.000 description 1
- HNUALPPJLMYHDK-UHFFFAOYSA-N C[CH]C Chemical compound C[CH]C HNUALPPJLMYHDK-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- AAWZDTNXLSGCEK-UHFFFAOYSA-N Cordycepinsaeure Natural products OC1CC(O)(C(O)=O)CC(O)C1O AAWZDTNXLSGCEK-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical class CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 1
- AAWZDTNXLSGCEK-ZHQZDSKASA-N Quinic acid Natural products O[C@H]1CC(O)(C(O)=O)C[C@H](O)C1O AAWZDTNXLSGCEK-ZHQZDSKASA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 150000008062 acetophenones Chemical class 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000003302 alkenyloxy group Chemical group 0.000 description 1
- 125000001118 alkylidene group Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 230000001760 anti-analgesic effect Effects 0.000 description 1
- 125000005018 aryl alkenyl group Chemical group 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 150000003938 benzyl alcohols Chemical class 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- MIOPJNTWMNEORI-UHFFFAOYSA-N camphorsulfonic acid Chemical compound C1CC2(CS(O)(=O)=O)C(=O)CC1C2(C)C MIOPJNTWMNEORI-UHFFFAOYSA-N 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 238000006473 carboxylation reaction Methods 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 150000001804 chlorine Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- KMPWYEUPVWOPIM-UHFFFAOYSA-N cinchonidine Natural products C1=CC=C2C(C(C3N4CCC(C(C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-UHFFFAOYSA-N 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000010779 crude oil Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- WZHCOOQXZCIUNC-UHFFFAOYSA-N cyclandelate Chemical compound C1C(C)(C)CC(C)CC1OC(=O)C(O)C1=CC=CC=C1 WZHCOOQXZCIUNC-UHFFFAOYSA-N 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- CGZZMOTZOONQIA-UHFFFAOYSA-N cycloheptanone Chemical compound O=C1CCCCCC1 CGZZMOTZOONQIA-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000000773 effect on pain Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 230000035876 healing Effects 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical class N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- HVENHVMWDAPFTH-UHFFFAOYSA-N iron(3+) trinitrate hexahydrate Chemical compound O.O.O.O.O.O.[Fe+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O HVENHVMWDAPFTH-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- XPSMACVUTPKIST-UHFFFAOYSA-N methyl 2-[4-(cyclohexen-1-yl)phenyl]-2-methylpropanoate Chemical compound C1=CC(C(C)(C)C(=O)OC)=CC=C1C1=CCCCC1 XPSMACVUTPKIST-UHFFFAOYSA-N 0.000 description 1
- STDUJCWZHKJUOW-UHFFFAOYSA-N methyl 2-[4-(cyclohexen-1-yl)phenyl]propanoate Chemical compound C1=CC(C(C)C(=O)OC)=CC=C1C1=CCCCC1 STDUJCWZHKJUOW-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N n-heptadecyl alcohol Natural products CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- JIKUXBYRTXDNIY-UHFFFAOYSA-N n-methyl-n-phenylformamide Chemical compound O=CN(C)C1=CC=CC=C1 JIKUXBYRTXDNIY-UHFFFAOYSA-N 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 125000003884 phenylalkyl group Chemical group 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- DITHIFQMPPCBCU-UHFFFAOYSA-N propa-1,2-diene Chemical compound [CH]=C=C DITHIFQMPPCBCU-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 235000013772 propylene glycol Nutrition 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- XYHPCPRPHCVTGF-UHFFFAOYSA-N s-benzyl morpholine-4-carbothioate Chemical compound C1COCCN1C(=O)SCC1=CC=CC=C1 XYHPCPRPHCVTGF-UHFFFAOYSA-N 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 238000010583 slow cooling Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- MNWBNISUBARLIT-UHFFFAOYSA-N sodium cyanide Chemical compound [Na+].N#[C-] MNWBNISUBARLIT-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- BXBUVIPNRGDTNE-UHFFFAOYSA-N sodium;hydrobromide Chemical compound [Na].Br BXBUVIPNRGDTNE-UHFFFAOYSA-N 0.000 description 1
- HIEHAIZHJZLEPQ-UHFFFAOYSA-M sodium;naphthalene-1-sulfonate Chemical compound [Na+].C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 HIEHAIZHJZLEPQ-UHFFFAOYSA-M 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 125000001302 tertiary amino group Chemical group 0.000 description 1
- 150000003556 thioamides Chemical class 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
CH1524068A CH529086A (de) | 1968-10-11 | 1968-10-11 | Verfahren zur Herstellung neuer a-Phenylcarbonsäuren |
CH1656968A CH559159A5 (en) | 1968-11-06 | 1968-11-06 | Analgesic anti-inflammatory alpha-phenyl fatty acids |
CH1270769A CH563345A5 (en) | 1969-08-21 | 1969-08-21 | Alpha-((1-cycloalkenyl)phenyl) aliphatic acids and esters - useful as antiinflam-matory and analgetic agents |
Publications (1)
Publication Number | Publication Date |
---|---|
PL91721B1 true PL91721B1 (enrdf_load_html_response) | 1977-03-31 |
Family
ID=27176891
Family Applications (5)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
PL17413269A PL91716B1 (enrdf_load_html_response) | 1968-10-11 | 1969-10-09 | |
PL17413569A PL86929B1 (enrdf_load_html_response) | 1968-10-11 | 1969-10-09 | |
PL17413669A PL86930B1 (enrdf_load_html_response) | 1968-10-11 | 1969-10-09 | |
PL17413769A PL91721B1 (enrdf_load_html_response) | 1968-10-11 | 1969-10-09 | |
PL17413369A PL91724B1 (enrdf_load_html_response) | 1968-10-11 | 1969-10-09 |
Family Applications Before (3)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
PL17413269A PL91716B1 (enrdf_load_html_response) | 1968-10-11 | 1969-10-09 | |
PL17413569A PL86929B1 (enrdf_load_html_response) | 1968-10-11 | 1969-10-09 | |
PL17413669A PL86930B1 (enrdf_load_html_response) | 1968-10-11 | 1969-10-09 |
Family Applications After (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
PL17413369A PL91724B1 (enrdf_load_html_response) | 1968-10-11 | 1969-10-09 |
Country Status (1)
Country | Link |
---|---|
PL (5) | PL91716B1 (enrdf_load_html_response) |
-
1969
- 1969-10-09 PL PL17413269A patent/PL91716B1/pl unknown
- 1969-10-09 PL PL17413569A patent/PL86929B1/pl unknown
- 1969-10-09 PL PL17413669A patent/PL86930B1/pl unknown
- 1969-10-09 PL PL17413769A patent/PL91721B1/pl unknown
- 1969-10-09 PL PL17413369A patent/PL91724B1/pl unknown
Also Published As
Publication number | Publication date |
---|---|
PL86929B1 (enrdf_load_html_response) | 1976-06-30 |
PL91724B1 (enrdf_load_html_response) | 1977-03-31 |
PL86930B1 (enrdf_load_html_response) | 1976-06-30 |
PL91716B1 (enrdf_load_html_response) | 1977-03-31 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
DE69510203T2 (de) | Retinoesäure x-rezeptor liganden | |
DE3219244A1 (de) | Sulfonatderivate, verfahren zu ihrer herstellung und diese derivate enthaltende arzneimittel | |
DE2229035A1 (de) | Cyclopentanderivate | |
US4112236A (en) | Interphenylene 8-aza-9-dioxothia-11,12-secoprostaglandins | |
US4085222A (en) | Pharmaceutical compositions containing 1,3-dioxanes | |
Schultz et al. | 2, 5-Cyclohexadien-1-one to bicyclo [3.1. 0] hexenone photorearrangement. Development of the reaction for use in organic synthesis | |
US4175203A (en) | Interphenylene 11,12-secoprostaglandins | |
US4150235A (en) | Interphenylene 11,12-secoprostaglandins | |
CH632740A5 (de) | Verfahren zur herstellung neuer alpha-thio-alkanoylsaeure-derivate. | |
PL91721B1 (enrdf_load_html_response) | ||
PL80268B1 (enrdf_load_html_response) | ||
Takeda et al. | A new synthesis of pyrocin and related compounds. | |
US3732299A (en) | Acenaphthene carboxamides | |
PL141501B1 (en) | Method of obtaining novel derivatives of quinoline and indene | |
Fuson et al. | Extension of the reformatsky reaction to new types of compounds | |
US3352901A (en) | Phenylacetic acids, esters, and amides | |
US3822309A (en) | Alpha-phenyl-fatty acid compounds | |
CH630887A5 (de) | Verfahren zur herstellung von 2-hydroxy-4-(2-naphthyl)-butan- oder -but-3-en-derivaten. | |
HINO et al. | Nonsteroidal Antiinflammatory Agents. III.: Synthesis of the Metabolites of 10, 11-Dihydro-8, α-dimethyl-11-oxodibenz [b, f] oxepin-2-acetic Acid (Bermoprofen) | |
Palazzo et al. | A new class of hypocholesteremic agents: arylalkyl hydrogen succinates and glutarates | |
Hirao et al. | Fluoroalkylnorbornadienes and their corresponding valence isomer quadricyclanes—a light energy storage system | |
FI56671C (fi) | Foerfarande foer framstaellning av indan-1-karboxylsyraderivat | |
DE2847644A1 (de) | Fluornaphthalin-derivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende pharmazeutische praeparate | |
FI59788C (fi) | Foerfarande foer framstaellning av som febernedsaettande smaertstillande och inflammation motverkande medel anvaendbara 4-bensoyl-indan-1-karboxylsyrafoereningar | |
DE1793802A1 (de) | Organische verbindungen mit 2 bis 4 dicyanacetatgruppen |