PL91170B1 - - Google Patents
Download PDFInfo
- Publication number
- PL91170B1 PL91170B1 PL1973166457A PL16645773A PL91170B1 PL 91170 B1 PL91170 B1 PL 91170B1 PL 1973166457 A PL1973166457 A PL 1973166457A PL 16645773 A PL16645773 A PL 16645773A PL 91170 B1 PL91170 B1 PL 91170B1
- Authority
- PL
- Poland
- Prior art keywords
- piperazinyl
- tetramethyl
- group
- phenyl
- compound
- Prior art date
Links
- -1 methylenedioxy group Chemical group 0.000 claims description 113
- 150000001875 compounds Chemical class 0.000 claims description 47
- 230000007062 hydrolysis Effects 0.000 claims description 24
- 238000006460 hydrolysis reaction Methods 0.000 claims description 24
- 125000004432 carbon atom Chemical group C* 0.000 claims description 23
- 238000006243 chemical reaction Methods 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 19
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 125000004423 acyloxy group Chemical group 0.000 claims description 10
- 239000000203 mixture Substances 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000005843 halogen group Chemical group 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 239000002585 base Substances 0.000 claims description 6
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 239000002904 solvent Substances 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 5
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 5
- 229910052744 lithium Inorganic materials 0.000 claims description 5
- 125000006239 protecting group Chemical group 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical group 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- 150000007522 mineralic acids Chemical class 0.000 claims description 4
- 150000007524 organic acids Chemical class 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 150000001340 alkali metals Chemical group 0.000 claims description 3
- 125000001995 cyclobutyl group Chemical class [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 3
- 239000011777 magnesium Substances 0.000 claims description 3
- 229910052749 magnesium Inorganic materials 0.000 claims description 3
- 230000001681 protective effect Effects 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 239000007789 gas Substances 0.000 claims description 2
- 235000017274 Diospyros sandwicensis Nutrition 0.000 claims 2
- 241000282838 Lama Species 0.000 claims 2
- 125000002252 acyl group Chemical group 0.000 claims 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims 2
- 241000238631 Hexapoda Species 0.000 claims 1
- 101001077374 Oryza sativa subsp. japonica UMP-CMP kinase 3 Proteins 0.000 claims 1
- 229940125904 compound 1 Drugs 0.000 claims 1
- 238000006073 displacement reaction Methods 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 239000011261 inert gas Substances 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 138
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 110
- 238000003747 Grignard reaction Methods 0.000 description 94
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 78
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 69
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 54
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 52
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 46
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 46
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 38
- 238000002844 melting Methods 0.000 description 33
- 230000008018 melting Effects 0.000 description 33
- HWKPTBHJWBSOOP-UHFFFAOYSA-N (4-bromophenoxy)-trimethylsilane Chemical compound C[Si](C)(C)OC1=CC=C(Br)C=C1 HWKPTBHJWBSOOP-UHFFFAOYSA-N 0.000 description 25
- 150000002168 ethanoic acid esters Chemical class 0.000 description 23
- BHZVJYBWDHLVBD-UHFFFAOYSA-N 2,2,4,4-tetramethyl-3-(4-pyridin-2-ylpiperazin-1-yl)cyclobutan-1-one Chemical compound CC1(C)C(=O)C(C)(C)C1N1CCN(C=2N=CC=CC=2)CC1 BHZVJYBWDHLVBD-UHFFFAOYSA-N 0.000 description 22
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 19
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- 239000003208 petroleum Substances 0.000 description 17
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 16
- 125000004193 piperazinyl group Chemical group 0.000 description 14
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- OVTHBMGKVYBULL-UHFFFAOYSA-N 2,2,4,4-tetramethyl-3-(4-phenylpiperazin-1-yl)cyclobutan-1-one Chemical compound CC1(C)C(=O)C(C)(C)C1N1CCN(C=2C=CC=CC=2)CC1 OVTHBMGKVYBULL-UHFFFAOYSA-N 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 8
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 8
- 241000699670 Mus sp. Species 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- 238000000354 decomposition reaction Methods 0.000 description 8
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- SHQSVMDWKBRBGB-UHFFFAOYSA-N cyclobutanone Chemical compound O=C1CCC1 SHQSVMDWKBRBGB-UHFFFAOYSA-N 0.000 description 7
- 125000004861 4-isopropyl phenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 6
- 238000009835 boiling Methods 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- KBTMGSMZIKLAHN-UHFFFAOYSA-N 4-bromo-1,2-dimethoxybenzene Chemical compound COC1=CC=C(Br)C=C1OC KBTMGSMZIKLAHN-UHFFFAOYSA-N 0.000 description 5
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 5
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 5
- 238000004440 column chromatography Methods 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000013078 crystal Substances 0.000 description 5
- 238000005984 hydrogenation reaction Methods 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 4
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 4
- 241001465754 Metazoa Species 0.000 description 4
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000001632 sodium acetate Substances 0.000 description 4
- 235000017281 sodium acetate Nutrition 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- DGMOBVGABMBZSB-UHFFFAOYSA-N 2-methylpropanoyl chloride Chemical compound CC(C)C(Cl)=O DGMOBVGABMBZSB-UHFFFAOYSA-N 0.000 description 3
- MLRMRAGAKGTSRB-UHFFFAOYSA-N 3-[4-(4-methoxyphenyl)piperazin-1-yl]-2,2,4,4-tetramethylcyclobutan-1-one Chemical compound C1=CC(OC)=CC=C1N1CCN(C2C(C(=O)C2(C)C)(C)C)CC1 MLRMRAGAKGTSRB-UHFFFAOYSA-N 0.000 description 3
- QJPJQTDYNZXKQF-UHFFFAOYSA-N 4-bromoanisole Chemical compound COC1=CC=C(Br)C=C1 QJPJQTDYNZXKQF-UHFFFAOYSA-N 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 239000003158 myorelaxant agent Substances 0.000 description 3
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- HKCQJLVIFMFOTG-UHFFFAOYSA-N 1-bromo-2,3,4-trimethoxybenzene Chemical compound COC1=CC=C(Br)C(OC)=C1OC HKCQJLVIFMFOTG-UHFFFAOYSA-N 0.000 description 2
- WLVSTXWBNDJBBG-UHFFFAOYSA-N 1-bromo-3-butylbenzene Chemical compound CCCCC1=CC=CC(Br)=C1 WLVSTXWBNDJBBG-UHFFFAOYSA-N 0.000 description 2
- BVBHVVRVSMBCPW-UHFFFAOYSA-N 1-bromo-4-(2-methylpropyl)benzene Chemical compound CC(C)CC1=CC=C(Br)C=C1 BVBHVVRVSMBCPW-UHFFFAOYSA-N 0.000 description 2
- XLQSXGGDTHANLN-UHFFFAOYSA-N 1-bromo-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(Br)C=C1 XLQSXGGDTHANLN-UHFFFAOYSA-N 0.000 description 2
- BRGVKVZXDWGJBX-UHFFFAOYSA-N 1-bromo-4-butylbenzene Chemical compound CCCCC1=CC=C(Br)C=C1 BRGVKVZXDWGJBX-UHFFFAOYSA-N 0.000 description 2
- LVIJLEREXMVRAN-UHFFFAOYSA-N 1-bromo-4-cyclohexylbenzene Chemical compound C1=CC(Br)=CC=C1C1CCCCC1 LVIJLEREXMVRAN-UHFFFAOYSA-N 0.000 description 2
- URFPRAHGGBYNPW-UHFFFAOYSA-N 1-bromo-4-ethylbenzene Chemical compound CCC1=CC=C(Br)C=C1 URFPRAHGGBYNPW-UHFFFAOYSA-N 0.000 description 2
- AITNMTXHTIIIBB-UHFFFAOYSA-N 1-bromo-4-fluorobenzene Chemical compound FC1=CC=C(Br)C=C1 AITNMTXHTIIIBB-UHFFFAOYSA-N 0.000 description 2
- ZBTMRBYMKUEVEU-UHFFFAOYSA-N 1-bromo-4-methylbenzene Chemical compound CC1=CC=C(Br)C=C1 ZBTMRBYMKUEVEU-UHFFFAOYSA-N 0.000 description 2
- SGCJPYYTVBHQGE-UHFFFAOYSA-N 1-bromo-4-pentylbenzene Chemical compound CCCCCC1=CC=C(Br)C=C1 SGCJPYYTVBHQGE-UHFFFAOYSA-N 0.000 description 2
- MPAOOLLBWUEXOM-UHFFFAOYSA-N 1-bromo-4-propan-2-yloxybenzene Chemical compound CC(C)OC1=CC=C(Br)C=C1 MPAOOLLBWUEXOM-UHFFFAOYSA-N 0.000 description 2
- RIVXPBSRMVGBJE-UHFFFAOYSA-N 2,2,4,4-tetramethyl-3-[4-(6-methylpyridin-2-yl)piperazin-1-yl]cyclobutan-1-one Chemical compound CC1=CC=CC(N2CCN(CC2)C2C(C(=O)C2(C)C)(C)C)=N1 RIVXPBSRMVGBJE-UHFFFAOYSA-N 0.000 description 2
- CRPGKQOUFIVNBF-UHFFFAOYSA-N 2,2-dimethyl-3-(4-phenylpiperazin-1-yl)cyclobutan-1-one Chemical compound C1C(=O)C(C)(C)C1N1CCN(C=2C=CC=CC=2)CC1 CRPGKQOUFIVNBF-UHFFFAOYSA-N 0.000 description 2
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 2
- BHGQWZWCEFNYLL-UHFFFAOYSA-N 3-[4-(2-methoxyphenyl)piperazin-1-yl]-2,2,4,4-tetramethylcyclobutan-1-one Chemical compound COC1=CC=CC=C1N1CCN(C2C(C(=O)C2(C)C)(C)C)CC1 BHGQWZWCEFNYLL-UHFFFAOYSA-N 0.000 description 2
- IULGQAZGZTXHAP-UHFFFAOYSA-N 3-[4-(4-bromophenyl)piperazin-1-yl]-2,2,4,4-tetramethylcyclobutan-1-one Chemical compound CC1(C)C(=O)C(C)(C)C1N1CCN(C=2C=CC(Br)=CC=2)CC1 IULGQAZGZTXHAP-UHFFFAOYSA-N 0.000 description 2
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 2
- 125000004208 3-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C([H])C(*)=C1[H] 0.000 description 2
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 2
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 2
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000007059 acute toxicity Effects 0.000 description 2
- 231100000403 acute toxicity Toxicity 0.000 description 2
- 238000009395 breeding Methods 0.000 description 2
- 230000001488 breeding effect Effects 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 229940093915 gynecological organic acid Drugs 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- SFDJOSRHYKHMOK-UHFFFAOYSA-N nitramide Chemical group N[N+]([O-])=O SFDJOSRHYKHMOK-UHFFFAOYSA-N 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 230000001624 sedative effect Effects 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 230000002269 spontaneous effect Effects 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- PCTMTFRHKVHKIS-BMFZQQSSSA-N (1s,3r,4e,6e,8e,10e,12e,14e,16e,18s,19r,20r,21s,25r,27r,30r,31r,33s,35r,37s,38r)-3-[(2r,3s,4s,5s,6r)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-19,25,27,30,31,33,35,37-octahydroxy-18,20,21-trimethyl-23-oxo-22,39-dioxabicyclo[33.3.1]nonatriaconta-4,6,8,10 Chemical compound C1C=C2C[C@@H](OS(O)(=O)=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2.O[C@H]1[C@@H](N)[C@H](O)[C@@H](C)O[C@H]1O[C@H]1/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC(=O)C[C@H](O)C[C@H](O)CC[C@@H](O)[C@H](O)C[C@H](O)C[C@](O)(C[C@H](O)[C@H]2C(O)=O)O[C@H]2C1 PCTMTFRHKVHKIS-BMFZQQSSSA-N 0.000 description 1
- PJAOJOJIEFORFP-UHFFFAOYSA-N (3-bromophenoxy)-trimethylsilane Chemical compound C[Si](C)(C)OC1=CC=CC(Br)=C1 PJAOJOJIEFORFP-UHFFFAOYSA-N 0.000 description 1
- QBQLACYYLXYOJP-UHFFFAOYSA-N (4-bromophenoxy)-triethylsilane Chemical compound CC[Si](CC)(CC)OC1=CC=C(Br)C=C1 QBQLACYYLXYOJP-UHFFFAOYSA-N 0.000 description 1
- QENIALCDPFDFHX-UHFFFAOYSA-N 1,4-dibromo-2,5-dimethylbenzene Chemical compound CC1=CC(Br)=C(C)C=C1Br QENIALCDPFDFHX-UHFFFAOYSA-N 0.000 description 1
- SWJPEBQEEAHIGZ-UHFFFAOYSA-N 1,4-dibromobenzene Chemical compound BrC1=CC=C(Br)C=C1 SWJPEBQEEAHIGZ-UHFFFAOYSA-N 0.000 description 1
- UEVKWTASYVIROP-UHFFFAOYSA-N 1-bromo-2-butylbenzene Chemical compound CCCCC1=CC=CC=C1Br UEVKWTASYVIROP-UHFFFAOYSA-N 0.000 description 1
- QBELEDRHMPMKHP-UHFFFAOYSA-N 1-bromo-2-chlorobenzene Chemical compound ClC1=CC=CC=C1Br QBELEDRHMPMKHP-UHFFFAOYSA-N 0.000 description 1
- HTDQSWDEWGSAMN-UHFFFAOYSA-N 1-bromo-2-methoxybenzene Chemical compound COC1=CC=CC=C1Br HTDQSWDEWGSAMN-UHFFFAOYSA-N 0.000 description 1
- QSSXJPIWXQTSIX-UHFFFAOYSA-N 1-bromo-2-methylbenzene Chemical compound CC1=CC=CC=C1Br QSSXJPIWXQTSIX-UHFFFAOYSA-N 0.000 description 1
- BKAWGQVKUSRASX-UHFFFAOYSA-N 1-bromo-2-pentylbenzene Chemical compound CCCCCC1=CC=CC=C1Br BKAWGQVKUSRASX-UHFFFAOYSA-N 0.000 description 1
- JRGGUPZKKTVKOV-UHFFFAOYSA-N 1-bromo-3-chlorobenzene Chemical compound ClC1=CC=CC(Br)=C1 JRGGUPZKKTVKOV-UHFFFAOYSA-N 0.000 description 1
- PLDWAJLZAAHOGG-UHFFFAOYSA-N 1-bromo-3-methoxybenzene Chemical compound COC1=CC=CC(Br)=C1 PLDWAJLZAAHOGG-UHFFFAOYSA-N 0.000 description 1
- WJIFKOVZNJTSGO-UHFFFAOYSA-N 1-bromo-3-methylbenzene Chemical compound CC1=CC=CC(Br)=C1 WJIFKOVZNJTSGO-UHFFFAOYSA-N 0.000 description 1
- HVWZMGZBJCJDOX-UHFFFAOYSA-N 1-bromo-3-phenylmethoxybenzene Chemical compound BrC1=CC=CC(OCC=2C=CC=CC=2)=C1 HVWZMGZBJCJDOX-UHFFFAOYSA-N 0.000 description 1
- NHDODQWIKUYWMW-UHFFFAOYSA-N 1-bromo-4-chlorobenzene Chemical compound ClC1=CC=C(Br)C=C1 NHDODQWIKUYWMW-UHFFFAOYSA-N 0.000 description 1
- OUQSGILAXUXMGI-UHFFFAOYSA-N 1-bromo-4-phenylmethoxybenzene Chemical compound C1=CC(Br)=CC=C1OCC1=CC=CC=C1 OUQSGILAXUXMGI-UHFFFAOYSA-N 0.000 description 1
- MOZHUOIQYVYEPN-UHFFFAOYSA-N 1-bromo-4-propan-2-ylbenzene Chemical compound CC(C)C1=CC=C(Br)C=C1 MOZHUOIQYVYEPN-UHFFFAOYSA-N 0.000 description 1
- NUPWGLKBGVNSJX-UHFFFAOYSA-N 1-bromo-4-propylbenzene Chemical compound CCCC1=CC=C(Br)C=C1 NUPWGLKBGVNSJX-UHFFFAOYSA-N 0.000 description 1
- XHCAGOVGSDHHNP-UHFFFAOYSA-N 1-bromo-4-tert-butylbenzene Chemical compound CC(C)(C)C1=CC=C(Br)C=C1 XHCAGOVGSDHHNP-UHFFFAOYSA-N 0.000 description 1
- RMSGQZDGSZOJMU-UHFFFAOYSA-N 1-butyl-2-phenylbenzene Chemical group CCCCC1=CC=CC=C1C1=CC=CC=C1 RMSGQZDGSZOJMU-UHFFFAOYSA-N 0.000 description 1
- JUBXZQSFMYWVHZ-UHFFFAOYSA-N 2,2,4,4-tetramethyl-3-[4-(2-methylphenyl)piperazin-1-yl]cyclobutan-1-one Chemical compound CC1=CC=CC=C1N1CCN(C2C(C(=O)C2(C)C)(C)C)CC1 JUBXZQSFMYWVHZ-UHFFFAOYSA-N 0.000 description 1
- DWCXZQSPNPELJF-UHFFFAOYSA-N 2,2,4,4-tetramethyl-3-[4-(4-methylsulfanylphenyl)piperazin-1-yl]cyclobutan-1-one Chemical compound C1=CC(SC)=CC=C1N1CCN(C2C(C(=O)C2(C)C)(C)C)CC1 DWCXZQSPNPELJF-UHFFFAOYSA-N 0.000 description 1
- URXSXKHRIOZACC-UHFFFAOYSA-N 2,2,4,4-tetramethyl-3-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]cyclobutan-1-one Chemical compound CC1(C)C(=O)C(C)(C)C1N1CCN(C=2C=CC(OCC=3C=CC=CC=3)=CC=2)CC1 URXSXKHRIOZACC-UHFFFAOYSA-N 0.000 description 1
- OMPHUFFCVHMSGT-UHFFFAOYSA-N 2,2,4,4-tetramethyl-3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]cyclobutan-1-one Chemical compound CC1(C)C(=O)C(C)(C)C1N1CCN(C=2C=C(C=CC=2)C(F)(F)F)CC1 OMPHUFFCVHMSGT-UHFFFAOYSA-N 0.000 description 1
- BAWFGZCWSIUGNZ-UHFFFAOYSA-N 2,2-dimethyl-3-(4-pyridin-2-ylpiperazin-1-yl)cyclobutan-1-one Chemical compound C1C(=O)C(C)(C)C1N1CCN(C=2N=CC=CC=2)CC1 BAWFGZCWSIUGNZ-UHFFFAOYSA-N 0.000 description 1
- RRTLQRYOJOSPEA-UHFFFAOYSA-N 2-bromo-1,3,5-trimethylbenzene Chemical compound CC1=CC(C)=C(Br)C(C)=C1 RRTLQRYOJOSPEA-UHFFFAOYSA-N 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- GNTSSUHNVJSUNN-UHFFFAOYSA-N 3-[3-(2-ethylphenyl)piperazin-1-yl]-2,2,4,4-tetramethylcyclobutan-1-one Chemical compound CCC1=CC=CC=C1C1NCCN(C2C(C(=O)C2(C)C)(C)C)C1 GNTSSUHNVJSUNN-UHFFFAOYSA-N 0.000 description 1
- ZAZLXTIOFREQTC-UHFFFAOYSA-N 3-[4-(2-bromophenyl)piperazin-1-yl]-2,2,4,4-tetramethylcyclobutan-1-one Chemical compound CC1(C)C(=O)C(C)(C)C1N1CCN(C=2C(=CC=CC=2)Br)CC1 ZAZLXTIOFREQTC-UHFFFAOYSA-N 0.000 description 1
- FDGLQWLQLVHAIN-UHFFFAOYSA-N 3-[4-(3,4-dichlorophenyl)piperazin-1-yl]-2,2,4,4-tetramethylcyclobutan-1-one Chemical compound CC1(C)C(=O)C(C)(C)C1N1CCN(C=2C=C(Cl)C(Cl)=CC=2)CC1 FDGLQWLQLVHAIN-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000004860 4-ethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])C([H])([H])[H] 0.000 description 1
- FBOYMIDCHINJKC-UHFFFAOYSA-N 5-bromo-1,3-benzodioxole Chemical compound BrC1=CC=C2OCOC2=C1 FBOYMIDCHINJKC-UHFFFAOYSA-N 0.000 description 1
- SORFNYWLKDSNNF-UHFFFAOYSA-N 6-(2,6-dimethylpyridin-4-yl)-5-phenyl-1,2,4-triazin-3-amine Chemical compound CC1=NC(C)=CC(C=2C(=NC(N)=NN=2)C=2C=CC=CC=2)=C1 SORFNYWLKDSNNF-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 244000248349 Citrus limon Species 0.000 description 1
- 235000005979 Citrus limon Nutrition 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ZRKWMRDKSOPRRS-UHFFFAOYSA-N N-Methyl-N-nitrosourea Chemical compound O=NN(C)C(N)=O ZRKWMRDKSOPRRS-UHFFFAOYSA-N 0.000 description 1
- 238000011785 NMRI mouse Methods 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 101000650578 Salmonella phage P22 Regulatory protein C3 Proteins 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 241000906446 Theraps Species 0.000 description 1
- 101001040920 Triticum aestivum Alpha-amylase inhibitor 0.28 Proteins 0.000 description 1
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 230000001914 calming effect Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- UXTMROKLAAOEQO-UHFFFAOYSA-N chloroform;ethanol Chemical compound CCO.ClC(Cl)Cl UXTMROKLAAOEQO-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000006352 cycloaddition reaction Methods 0.000 description 1
- 150000001930 cyclobutanes Chemical class 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- CCGKOQOJPYTBIH-UHFFFAOYSA-N ethenone Chemical compound C=C=O CCGKOQOJPYTBIH-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000013213 extrapolation Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- YLGXILFCIXHCMC-JHGZEJCSSA-N methyl cellulose Chemical compound COC1C(OC)C(OC)C(COC)O[C@H]1O[C@H]1C(OC)C(OC)C(OC)OC1COC YLGXILFCIXHCMC-JHGZEJCSSA-N 0.000 description 1
- 230000004899 motility Effects 0.000 description 1
- 238000013421 nuclear magnetic resonance imaging Methods 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- ZLMJMSJWJFRBEC-OUBTZVSYSA-N potassium-40 Chemical compound [40K] ZLMJMSJWJFRBEC-OUBTZVSYSA-N 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000002040 relaxant effect Effects 0.000 description 1
- 239000000932 sedative agent Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/096—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/135—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyridine Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19722255439 DE2255439A1 (de) | 1972-11-11 | 1972-11-11 | Neue cyclobutan-derivate |
| DE19732349639 DE2349639A1 (de) | 1973-10-03 | 1973-10-03 | Neue cyclobutan-derivate und verfahren zu ihrer herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL91170B1 true PL91170B1 (enExample) | 1977-02-28 |
Family
ID=25764071
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1973182639A PL92386B1 (enExample) | 1972-11-11 | 1973-11-10 | |
| PL1973166457A PL91170B1 (enExample) | 1972-11-11 | 1973-11-10 |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1973182639A PL92386B1 (enExample) | 1972-11-11 | 1973-11-10 |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3931185A (enExample) |
| JP (1) | JPS49133383A (enExample) |
| AT (1) | AT334903B (enExample) |
| BG (1) | BG23007A3 (enExample) |
| CA (1) | CA999297A (enExample) |
| CH (2) | CH587253A5 (enExample) |
| DD (1) | DD110271A5 (enExample) |
| ES (1) | ES427559A1 (enExample) |
| FR (1) | FR2206094B1 (enExample) |
| GB (1) | GB1410303A (enExample) |
| HU (1) | HU167390B (enExample) |
| IE (1) | IE38868B1 (enExample) |
| NL (1) | NL7314672A (enExample) |
| PH (1) | PH10668A (enExample) |
| PL (2) | PL92386B1 (enExample) |
| RO (1) | RO64593A (enExample) |
| SU (2) | SU524516A3 (enExample) |
| ZA (1) | ZA738606B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ZA929008B (en) * | 1991-12-13 | 1993-05-21 | Bristol Myers Squibb Co | Piperazinyl- and piperidinyl-cyclohexanols. |
| GB9300194D0 (en) * | 1993-01-06 | 1993-03-03 | Wyeth John & Brother Ltd | Piperazine derivatives |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL265724A (enExample) | 1960-06-09 |
-
1973
- 1973-10-25 NL NL7314672A patent/NL7314672A/xx not_active Application Discontinuation
- 1973-11-06 SU SU1967687A patent/SU524516A3/ru active
- 1973-11-06 US US05/413,233 patent/US3931185A/en not_active Expired - Lifetime
- 1973-11-07 PH PH15192A patent/PH10668A/en unknown
- 1973-11-07 CH CH1563373A patent/CH587253A5/xx not_active IP Right Cessation
- 1973-11-07 CH CH1470976A patent/CH602669A5/xx not_active IP Right Cessation
- 1973-11-08 BG BG024952A patent/BG23007A3/xx unknown
- 1973-11-09 CA CA185,407A patent/CA999297A/en not_active Expired
- 1973-11-09 JP JP48126150A patent/JPS49133383A/ja active Pending
- 1973-11-09 FR FR7339898A patent/FR2206094B1/fr not_active Expired
- 1973-11-09 HU HUTO941A patent/HU167390B/hu unknown
- 1973-11-09 AT AT943373A patent/AT334903B/de not_active IP Right Cessation
- 1973-11-09 ZA ZA738606A patent/ZA738606B/xx unknown
- 1973-11-09 IE IE02021/73A patent/IE38868B1/xx unknown
- 1973-11-09 DD DD174561A patent/DD110271A5/xx unknown
- 1973-11-09 GB GB5219273A patent/GB1410303A/en not_active Expired
- 1973-11-10 RO RO7376608A patent/RO64593A/ro unknown
- 1973-11-10 PL PL1973182639A patent/PL92386B1/pl unknown
- 1973-11-10 PL PL1973166457A patent/PL91170B1/pl unknown
-
1974
- 1974-06-22 ES ES427559A patent/ES427559A1/es not_active Expired
- 1974-10-23 SU SU2069584A patent/SU561513A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| ZA738606B (en) | 1974-11-27 |
| ATA943373A (de) | 1976-06-15 |
| PH10668A (en) | 1977-08-02 |
| JPS49133383A (enExample) | 1974-12-21 |
| AT334903B (de) | 1977-02-10 |
| GB1410303A (en) | 1975-10-15 |
| NL7314672A (enExample) | 1974-05-14 |
| AU6235773A (en) | 1975-05-15 |
| IE38868L (en) | 1974-05-11 |
| CA999297A (en) | 1976-11-02 |
| ES427559A1 (es) | 1976-08-01 |
| US3931185A (en) | 1976-01-06 |
| IE38868B1 (en) | 1978-06-21 |
| PL92386B1 (enExample) | 1977-04-30 |
| FR2206094B1 (enExample) | 1976-10-22 |
| CH602669A5 (enExample) | 1978-07-31 |
| HU167390B (enExample) | 1975-09-27 |
| BG23007A3 (bg) | 1977-05-20 |
| SU524516A3 (ru) | 1976-08-05 |
| DD110271A5 (enExample) | 1974-12-12 |
| SU561513A3 (ru) | 1977-06-05 |
| CH587253A5 (enExample) | 1977-04-29 |
| FR2206094A1 (enExample) | 1974-06-07 |
| RO64593A (ro) | 1980-06-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2739968A (en) | Substituted piperidines | |
| DK172103B1 (da) | Hidtil ukendte 3,3-difenylpropylaminer, farmaceutiske præparater indeholdende disse, deres anvendelse til fremstilling af et anticholinergt lægemiddel samt fremgangsmåde til deres fremstilling | |
| FI77448B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara 1-fenyl-2-piperidinopropanolderivat. | |
| AU660067B2 (en) | Benzopyranone derivatives and analogues | |
| LT3658B (en) | Method for preparing aromatase inhibiting 4(5)-imidazole derivatives | |
| NO154294B (no) | Doseinhalator. | |
| HU196058B (en) | Process for producing new piperidine-methanol derivatives | |
| NZ315318A (en) | Diphenylmethylene piperidine derivatives | |
| NZ277373A (en) | Iso(thio)chroman-1-ylethylpiperazine and -piperidine derivatives (analogues) | |
| PL84240B1 (enExample) | ||
| CA1301174C (en) | Substituted 1h-imidazoles | |
| US2820817A (en) | Oxygenated indan compounds and method of making the same | |
| US5596101A (en) | N-substituted trifluoromethylphenyltetrahydropyridines, process for the preparation thereof, intermediates in said process and pharmaceutical compositions containing them | |
| PL91170B1 (enExample) | ||
| NO164899B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive imidazolylindolforbindelser. | |
| EP0074130B1 (en) | New imidazole compounds, process for the preparation thereof and pharmaceutical compositions containing them | |
| JPS60120865A (ja) | 新規カルボスチリル誘導体 | |
| PL116688B1 (en) | Process for the preparation of trinuclear compounds with nitrogen atom in nodal position | |
| PL111792B1 (en) | Method of manufacture of novel,base substituted o-propyloximes | |
| HU194846B (en) | Process for the production of derivatives of piperidine | |
| PL112249B1 (en) | Process for preparing novel derivatives of 1-/3-/3,4,5-trimethoxyphenoxy/-2-hydroxypropyl/-4-arylpiperazine | |
| US5109006A (en) | Certain pharmaceutically active 6H-imidazo[1,2-a]pyridine-5-ones | |
| FI68226B (fi) | Foerfarande foer framstaellning av 6,7-benzomorfanderivat vilka aer anvaendbara som analgetiska aemnen antagonister foer narkotiska medel och inhibitorer foer sekretion av luteiniseringshormon | |
| PL81553B1 (enExample) | ||
| EP0360324B1 (en) | Tricyclic aromatase inhibitors |