PL90218B1 - Phenoxyphenyl phenylthiophenyl and phenylaminophenyl piperazinylthio-ureas[us3781290a] - Google Patents
Phenoxyphenyl phenylthiophenyl and phenylaminophenyl piperazinylthio-ureas[us3781290a] Download PDFInfo
- Publication number
- PL90218B1 PL90218B1 PL1971150294A PL15029471A PL90218B1 PL 90218 B1 PL90218 B1 PL 90218B1 PL 1971150294 A PL1971150294 A PL 1971150294A PL 15029471 A PL15029471 A PL 15029471A PL 90218 B1 PL90218 B1 PL 90218B1
- Authority
- PL
- Poland
- Prior art keywords
- phenyl
- formula
- group
- diethylthiocarbamide
- nitro
- Prior art date
Links
- -1 Phenoxyphenyl phenylthiophenyl Chemical group 0.000 title claims description 27
- 229910052757 nitrogen Inorganic materials 0.000 claims description 56
- 150000001875 compounds Chemical class 0.000 claims description 18
- 150000003839 salts Chemical class 0.000 claims description 17
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 16
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 13
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 13
- 239000001257 hydrogen Substances 0.000 claims description 13
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 12
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 11
- 229910052736 halogen Inorganic materials 0.000 claims description 11
- 125000003277 amino group Chemical group 0.000 claims description 10
- 150000002367 halogens Chemical class 0.000 claims description 10
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 150000001412 amines Chemical class 0.000 claims description 7
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 7
- 150000002540 isothiocyanates Chemical class 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 7
- 229910052717 sulfur Inorganic materials 0.000 claims description 7
- 150000003585 thioureas Chemical class 0.000 claims description 7
- 125000003282 alkyl amino group Chemical group 0.000 claims description 6
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 125000004442 acylamino group Chemical group 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 5
- 239000011593 sulfur Substances 0.000 claims description 5
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical group OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- 229910052760 oxygen Inorganic materials 0.000 claims description 4
- 239000001301 oxygen Substances 0.000 claims description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 3
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims description 3
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 3
- 230000007062 hydrolysis Effects 0.000 claims description 3
- 238000006460 hydrolysis reaction Methods 0.000 claims description 3
- 230000008018 melting Effects 0.000 claims description 3
- 238000002844 melting Methods 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 229930195733 hydrocarbon Natural products 0.000 claims description 2
- 230000015572 biosynthetic process Effects 0.000 claims 2
- 125000004434 sulfur atom Chemical group 0.000 claims 2
- 244000205754 Colocasia esculenta Species 0.000 claims 1
- 235000006481 Colocasia esculenta Nutrition 0.000 claims 1
- 239000005977 Ethylene Substances 0.000 claims 1
- VLCDUOXHFNUCKK-UHFFFAOYSA-N N,N'-Dimethylthiourea Chemical compound CNC(=S)NC VLCDUOXHFNUCKK-UHFFFAOYSA-N 0.000 claims 1
- FLVIGYVXZHLUHP-UHFFFAOYSA-N N,N'-diethylthiourea Chemical compound CCNC(=S)NCC FLVIGYVXZHLUHP-UHFFFAOYSA-N 0.000 claims 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 claims 1
- 229930002875 chlorophyll Natural products 0.000 claims 1
- 235000019804 chlorophyll Nutrition 0.000 claims 1
- ATNHDLDRLWWWCB-AENOIHSZSA-M chlorophyll a Chemical compound C1([C@@H](C(=O)OC)C(=O)C2=C3C)=C2N2C3=CC(C(CC)=C3C)=[N+]4C3=CC3=C(C=C)C(C)=C5N3[Mg-2]42[N+]2=C1[C@@H](CCC(=O)OC\C=C(/C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@H](C)C2=C5 ATNHDLDRLWWWCB-AENOIHSZSA-M 0.000 claims 1
- 238000003776 cleavage reaction Methods 0.000 claims 1
- 150000002430 hydrocarbons Chemical class 0.000 claims 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims 1
- 230000007017 scission Effects 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 241001465754 Metazoa Species 0.000 description 7
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000001450 anions Chemical class 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 206010012735 Diarrhoea Diseases 0.000 description 2
- 241000287828 Gallus gallus Species 0.000 description 2
- 241000244206 Nematoda Species 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 230000037396 body weight Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 235000013877 carbamide Nutrition 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 235000013330 chicken meat Nutrition 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- YZTJYBJCZXZGCT-UHFFFAOYSA-N phenylpiperazine Chemical compound C1CNCCN1C1=CC=CC=C1 YZTJYBJCZXZGCT-UHFFFAOYSA-N 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 231100000331 toxic Toxicity 0.000 description 2
- 230000002588 toxic effect Effects 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- LSBDFXRDZJMBSC-UHFFFAOYSA-N 2-phenylacetamide Chemical class NC(=O)CC1=CC=CC=C1 LSBDFXRDZJMBSC-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 241001465680 Ancylostomatidae Species 0.000 description 1
- 241000203989 Anoplocephalidae Species 0.000 description 1
- 241000204725 Ascaridia galli Species 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 241000283707 Capra Species 0.000 description 1
- 241000498255 Enterobius vermicularis Species 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- 241000244161 Taeniidae Species 0.000 description 1
- 241000243792 Trichostrongylidae Species 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 150000001356 alkyl thiols Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 244000144987 brood Species 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 229960004132 diethyl ether Drugs 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 206010014881 enterobiasis Diseases 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 244000000053 intestinal parasite Species 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 244000045947 parasite Species 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 244000144977 poultry Species 0.000 description 1
- 235000013594 poultry meat Nutrition 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000007711 solidification Methods 0.000 description 1
- 230000008023 solidification Effects 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/04—Derivatives of thiourea
- C07C335/16—Derivatives of thiourea having nitrogen atoms of thiourea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C335/20—Derivatives of thiourea having nitrogen atoms of thiourea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by nitrogen atoms, not being part of nitro or nitroso groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/04—Derivatives of thiourea
- C07C335/16—Derivatives of thiourea having nitrogen atoms of thiourea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/04—Derivatives of thiourea
- C07C335/16—Derivatives of thiourea having nitrogen atoms of thiourea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C335/18—Derivatives of thiourea having nitrogen atoms of thiourea groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton being further substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D203/00—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom
- C07D203/04—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D203/06—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D203/22—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with hetero atoms directly attached to the ring nitrogen atom
- C07D203/24—Sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1311170A CH542828A (de) | 1970-09-02 | 1970-09-02 | Verfahren zur Herstellung neuer Thioharnstoffe |
| CH1906570A CH558367A (de) | 1970-12-23 | 1970-12-23 | Verfahren zur herstellung neuer thioharnstoffe. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL90218B1 true PL90218B1 (en) | 1977-01-31 |
Family
ID=25711566
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971150294A PL90218B1 (en) | 1970-09-02 | 1971-09-01 | Phenoxyphenyl phenylthiophenyl and phenylaminophenyl piperazinylthio-ureas[us3781290a] |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US3781290A (ref) |
| AR (2) | AR195867A1 (ref) |
| AT (3) | AT315194B (ref) |
| BE (1) | BE772053A (ref) |
| BG (3) | BG19373A3 (ref) |
| BR (1) | BR7105771D0 (ref) |
| CA (1) | CA973185A (ref) |
| CS (1) | CS169824B2 (ref) |
| DD (1) | DD100858A5 (ref) |
| DE (1) | DE2143838A1 (ref) |
| DK (1) | DK129579B (ref) |
| ES (1) | ES394693A1 (ref) |
| FR (1) | FR2105184B1 (ref) |
| HU (1) | HU164555B (ref) |
| IE (1) | IE35835B1 (ref) |
| IL (1) | IL37626A (ref) |
| NL (1) | NL7112037A (ref) |
| PL (1) | PL90218B1 (ref) |
| RO (1) | RO61129A (ref) |
| SE (1) | SE380795B (ref) |
| SU (2) | SU470953A3 (ref) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3898337A (en) * | 1970-09-02 | 1975-08-05 | Ciba Geigy Corp | N-heterocyclic thioureas as anthelmintic agents |
| EP0025010B1 (de) * | 1979-07-03 | 1983-07-20 | Ciba-Geigy Ag | Thioharnstoffderivate und Isothioharnstoffderivate, Verfahren zu ihrer Herstellung, diese Verbindungen enthaltende Mittel und ihre Verwendung zur Bekämpfung von Schädlingen |
| US4328247A (en) * | 1979-09-19 | 1982-05-04 | Ciba-Geigy Corporation | Phenoxyphenylisothioureas, production thereof and use thereof in pest control, and phenoxyphenylthioureas as intermediates for the production of the phenoxyphenylisothioureas and use thereof in pest control |
| US5026730A (en) * | 1987-08-21 | 1991-06-25 | Ciba-Geigy Corporation | Anilinophenylthioureas, compositions containing them, and the use thereof in pest control |
| RU2471775C1 (ru) * | 2011-10-17 | 2013-01-10 | Федеральное государственное бюджетное образовательное учреждение высшего профессионального образования "Башкирский государственный университет", БашГУ | Способ получения производных этиленмочевины и этилентиомочевины |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1269407A (fr) * | 1959-08-05 | 1961-08-11 | Ciba Geigy | Nouveaux dérivés de l'acide carbamique, leur procédé de préparation et leur utilisation |
-
1971
- 1971-08-27 IE IE1090/71A patent/IE35835B1/xx unknown
- 1971-08-27 US US00175723A patent/US3781290A/en not_active Expired - Lifetime
- 1971-08-30 SE SE7110949A patent/SE380795B/xx unknown
- 1971-08-31 CA CA121,763A patent/CA973185A/en not_active Expired
- 1971-09-01 BG BG018472A patent/BG19373A3/xx unknown
- 1971-09-01 AT AT761271A patent/AT315194B/de not_active IP Right Cessation
- 1971-09-01 DE DE19712143838 patent/DE2143838A1/de active Pending
- 1971-09-01 FR FR7131602A patent/FR2105184B1/fr not_active Expired
- 1971-09-01 BR BR5771/71A patent/BR7105771D0/pt unknown
- 1971-09-01 BG BG020193A patent/BG20788A3/xx unknown
- 1971-09-01 DD DD162561A patent/DD100858A5/xx unknown
- 1971-09-01 ES ES394693A patent/ES394693A1/es not_active Expired
- 1971-09-01 HU HUAI197A patent/HU164555B/hu unknown
- 1971-09-01 IL IL37626A patent/IL37626A/xx unknown
- 1971-09-01 BG BG020194A patent/BG22388A3/xx unknown
- 1971-09-01 DK DK430471AA patent/DK129579B/da unknown
- 1971-09-01 AT AT868872A patent/AT321935B/de not_active IP Right Cessation
- 1971-09-01 NL NL7112037A patent/NL7112037A/xx unknown
- 1971-09-01 BE BE772053A patent/BE772053A/xx not_active IP Right Cessation
- 1971-09-01 RO RO7100068086A patent/RO61129A/ro unknown
- 1971-09-01 AT AT868972A patent/AT321936B/de not_active IP Right Cessation
- 1971-09-01 PL PL1971150294A patent/PL90218B1/pl unknown
- 1971-09-01 CS CS6267A patent/CS169824B2/cs unknown
- 1971-09-02 SU SU1839318A patent/SU470953A3/ru active
- 1971-09-02 SU SU1694851A patent/SU508184A3/ru active
-
1972
- 1972-05-22 AR AR242116A patent/AR195867A1/es active
- 1972-05-22 AR AR242115A patent/AR192783A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| AT315194B (de) | 1974-05-10 |
| AR195867A1 (es) | 1973-11-15 |
| NL7112037A (ref) | 1972-03-06 |
| DK129579C (ref) | 1975-03-24 |
| AT321936B (de) | 1975-04-25 |
| CA973185A (en) | 1975-08-19 |
| BG22388A3 (bg) | 1977-02-20 |
| DK129579B (da) | 1974-10-28 |
| BE772053A (ref) | 1972-03-01 |
| HU164555B (ref) | 1974-03-28 |
| AR192783A1 (es) | 1973-03-14 |
| IE35835B1 (en) | 1976-06-09 |
| SU508184A3 (ru) | 1976-03-25 |
| DE2143838A1 (de) | 1972-03-09 |
| IL37626A0 (en) | 1971-11-29 |
| US3781290A (en) | 1973-12-25 |
| BR7105771D0 (pt) | 1973-03-08 |
| FR2105184B1 (ref) | 1974-09-06 |
| DD100858A5 (ref) | 1973-10-12 |
| BG20788A3 (bg) | 1975-12-20 |
| SU470953A3 (ru) | 1975-05-15 |
| AT321935B (de) | 1975-04-25 |
| RO61129A (fr) | 1978-06-15 |
| SE380795B (sv) | 1975-11-17 |
| IE35835L (en) | 1972-03-02 |
| CS169824B2 (ref) | 1976-07-29 |
| IL37626A (en) | 1975-02-10 |
| BG19373A3 (bg) | 1975-06-15 |
| FR2105184A1 (ref) | 1972-04-28 |
| ES394693A1 (es) | 1975-03-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4018929A (en) | 3-Loweralkylcarbamylsulfonamido-4-phenylaminopyridine-N-oxides, derivatives thereof and pharmaceutical compositions containing same | |
| US5688795A (en) | 3-(4-phenylpiperazin-1-yl)propyl-amino, thio and oxy!-pyridine, pyrimidine and benzene derivatives as α1 -adrenoceptor antagonists | |
| NZ199650A (en) | 2-(4-(diphenylmethyl)-1-piperazinyl)-acetic acid derivatives | |
| DK174021B1 (da) | Benzimidazoler, farmaceutiske præparater som indeholder dem, deres anvendelse til fremstilling af sådanne præparater samt fremgangsmåde til deres fremstilling | |
| FI64144B (fi) | Foerfarande foer framstaellning av 2-arylamino-2-imidazolinderivat | |
| JPS5928535B2 (ja) | 原虫類防除用医薬組成物及び薬剤添加動物用飼料 | |
| CZ280182B6 (cs) | Terapeuticky účinné látky | |
| PL90218B1 (en) | Phenoxyphenyl phenylthiophenyl and phenylaminophenyl piperazinylthio-ureas[us3781290a] | |
| Pavia et al. | N, N-Disubstituted 6-alkoxy-2-pyridinamines as anticonvulsant agents | |
| US3573320A (en) | Certain 2-aminobenzothiazoles | |
| US4018830A (en) | Phenylthioaralkylamines | |
| US3717648A (en) | 1-phenyl-azacarbocyclic-2-imines | |
| Buschauer et al. | Synthesis and histamine H2 agonistic activity of arpromidine analogues: replacement of the pheniramine-like moiety by non-heterocyclic groups | |
| US4665083A (en) | Iminothiazolidine derivatives | |
| FI63937B (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara feylpiperaziner | |
| CZ325196A3 (en) | Derivatives of hydroximic acid, pharmaceutical compositions containing thereof, process of their preparation and intermediates used in the preparation process | |
| US4289765A (en) | 4-Aminopyridines and medicaments containing the same | |
| PL139429B1 (en) | Process for preparing novel,base-substituted 4-phenyl-4,5,6,7-tetrahydro-thieno/2,3-c/pyridines | |
| US3398146A (en) | Tetrahydro-1, 3, 5-thiadiazine-2-thiones | |
| US2490780A (en) | Para-aminobenzamides, acid addition salts thereof, and their production | |
| FI66872C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara tino(3,2-c)- och tieno(2,3-c)pyridinderivat | |
| FR2571723A1 (fr) | Derives de thieno et furo-(2,3-c) pyrroles, procedes de preparation et medicaments les contenant | |
| FI77238B (fi) | Foerfarande foer framstaellning av farmakologiskt vaerdefulla fenylalkyl(piperazinyl eller homopiperazinyl)alkyltioler eller tiokarbamater. | |
| US4194004A (en) | Substituted benzenesulphonic acid esters, processes for their preparation and their use as medicaments | |
| EP0223124B1 (en) | Substituted aminosulfonyl 6-nitrobenzoic-esters or amides, processes for their preparation and pharmaceutical compositions containing them |