PL88676B1 - - Google Patents
Download PDFInfo
- Publication number
- PL88676B1 PL88676B1 PL1974169634A PL16963474A PL88676B1 PL 88676 B1 PL88676 B1 PL 88676B1 PL 1974169634 A PL1974169634 A PL 1974169634A PL 16963474 A PL16963474 A PL 16963474A PL 88676 B1 PL88676 B1 PL 88676B1
- Authority
- PL
- Poland
- Prior art keywords
- phenyl
- formula
- dichloro
- triazinetrione
- methyl
- Prior art date
Links
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 34
- 150000001875 compounds Chemical class 0.000 claims description 30
- -1 suLphonyl residue Chemical group 0.000 claims description 22
- 125000000217 alkyl group Chemical group 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 9
- 150000002431 hydrogen Chemical class 0.000 claims description 7
- 229910052740 iodine Inorganic materials 0.000 claims description 7
- 238000000034 method Methods 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 5
- 125000002252 acyl group Chemical group 0.000 claims description 5
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 239000011593 sulfur Substances 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 4
- ZNPKAOCQMDJBIK-UHFFFAOYSA-N nitrocyanamide Chemical compound [O-][N+](=O)NC#N ZNPKAOCQMDJBIK-UHFFFAOYSA-N 0.000 claims description 4
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims description 4
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 4
- 125000004442 acylamino group Chemical group 0.000 claims description 3
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 claims description 3
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 125000005252 haloacyl group Chemical group 0.000 claims description 3
- 125000001188 haloalkyl group Chemical group 0.000 claims description 3
- 125000004995 haloalkylthio group Chemical group 0.000 claims description 3
- 239000007800 oxidant agent Substances 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 239000002168 alkylating agent Substances 0.000 claims description 2
- 229940100198 alkylating agent Drugs 0.000 claims description 2
- 150000001450 anions Chemical class 0.000 claims description 2
- YNKDRTCJDFVUTJ-UHFFFAOYSA-N carbonyl diisocyanate Chemical class O=C=NC(=O)N=C=O YNKDRTCJDFVUTJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 2
- 125000005543 phthalimide group Chemical group 0.000 claims 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims 1
- 125000004104 aryloxy group Chemical group 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 description 98
- 238000002844 melting Methods 0.000 description 22
- 230000008018 melting Effects 0.000 description 21
- 208000003495 Coccidiosis Diseases 0.000 description 20
- 206010023076 Isosporiasis Diseases 0.000 description 20
- 208000015181 infectious disease Diseases 0.000 description 12
- 229910052757 nitrogen Inorganic materials 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 10
- XGEGHDBEHXKFPX-UHFFFAOYSA-N N-methylthiourea Natural products CNC(N)=O XGEGHDBEHXKFPX-UHFFFAOYSA-N 0.000 description 9
- 241001465754 Metazoa Species 0.000 description 8
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- RYECOJGRJDOGPP-UHFFFAOYSA-N Ethylurea Chemical compound CCNC(N)=O RYECOJGRJDOGPP-UHFFFAOYSA-N 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 7
- 241000223932 Eimeria tenella Species 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000004202 carbamide Substances 0.000 description 6
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 6
- 229910052759 nickel Inorganic materials 0.000 description 6
- 210000003250 oocyst Anatomy 0.000 description 6
- 244000144977 poultry Species 0.000 description 6
- 235000013594 poultry meat Nutrition 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 5
- 235000013877 carbamide Nutrition 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000003826 tablet Substances 0.000 description 5
- 238000011282 treatment Methods 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 241000287828 Gallus gallus Species 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 235000013330 chicken meat Nutrition 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 230000028327 secretion Effects 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 241000124008 Mammalia Species 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 239000012948 isocyanate Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- 150000000182 1,3,5-triazines Chemical class 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- LUBJCRLGQSPQNN-UHFFFAOYSA-N 1-Phenylurea Chemical compound NC(=O)NC1=CC=CC=C1 LUBJCRLGQSPQNN-UHFFFAOYSA-N 0.000 description 2
- 241000283690 Bos taurus Species 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 241000282472 Canis lupus familiaris Species 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- 241000699666 Mus <mouse, genus> Species 0.000 description 2
- 241000699670 Mus sp. Species 0.000 description 2
- 241000283973 Oryctolagus cuniculus Species 0.000 description 2
- 241001494479 Pecora Species 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000008298 dragée Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 241000894007 species Species 0.000 description 2
- 150000003462 sulfoxides Chemical class 0.000 description 2
- 239000006188 syrup Substances 0.000 description 2
- 235000020357 syrup Nutrition 0.000 description 2
- 150000003585 thioureas Chemical class 0.000 description 2
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- 150000003672 ureas Chemical class 0.000 description 2
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- WHEQVHAIRSPYDK-UHFFFAOYSA-N 4,6-dimethyl-1h-pyrimidin-2-one Chemical class CC1=CC(C)=NC(O)=N1 WHEQVHAIRSPYDK-UHFFFAOYSA-N 0.000 description 1
- QWACMYQUZVOEOZ-UHFFFAOYSA-N 4-(4-amino-4-nitrocyclohexa-1,5-dien-1-yl)sulfanyl-1-nitrocyclohexa-2,4-dien-1-amine Chemical compound C1=CC(N)([N+]([O-])=O)CC=C1SC1=CCC(N)([N+]([O-])=O)C=C1 QWACMYQUZVOEOZ-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 206010003011 Appendicitis Diseases 0.000 description 1
- 241000271566 Aves Species 0.000 description 1
- 101100172628 Caenorhabditis elegans eri-1 gene Proteins 0.000 description 1
- 241000224483 Coccidia Species 0.000 description 1
- 206010012735 Diarrhoea Diseases 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- ZEFNOZRLAWVAQF-UHFFFAOYSA-N Dinitolmide Chemical compound CC1=C(C(N)=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O ZEFNOZRLAWVAQF-UHFFFAOYSA-N 0.000 description 1
- 241001662550 Eimeria falciformis Species 0.000 description 1
- 241000221513 Eimeria irresidua Species 0.000 description 1
- 241001485852 Eimeria magna Species 0.000 description 1
- 241001485868 Eimeria media Species 0.000 description 1
- 241000499563 Eimeria necatrix Species 0.000 description 1
- 241001485873 Eimeria stiedai Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000237502 Ostreidae Species 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 229910006130 SO4 Inorganic materials 0.000 description 1
- 244000000231 Sesamum indicum Species 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 239000000370 acceptor Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000001165 anti-coccidial effect Effects 0.000 description 1
- 230000000842 anti-protozoal effect Effects 0.000 description 1
- 229940124536 anticoccidial agent Drugs 0.000 description 1
- 229940036589 antiprotozoals Drugs 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000000740 bleeding effect Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000009395 breeding Methods 0.000 description 1
- 230000001488 breeding effect Effects 0.000 description 1
- CNWSQCLBDWYLAN-UHFFFAOYSA-N butylurea Chemical compound CCCCNC(N)=O CNWSQCLBDWYLAN-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- 239000003224 coccidiostatic agent Substances 0.000 description 1
- 230000002354 daily effect Effects 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000003651 drinking water Substances 0.000 description 1
- 235000020188 drinking water Nutrition 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 125000004441 haloalkylsulfonyl group Chemical group 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 230000002458 infectious effect Effects 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 238000007689 inspection Methods 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 208000020442 loss of weight Diseases 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- XGEGHDBEHXKFPX-NJFSPNSNSA-N methylurea Chemical compound [14CH3]NC(N)=O XGEGHDBEHXKFPX-NJFSPNSNSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- VBBUFMFZDHLELS-UHFFFAOYSA-N n-(oxomethylidene)carbamoyl chloride Chemical compound ClC(=O)N=C=O VBBUFMFZDHLELS-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 210000000287 oocyte Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical group 0.000 description 1
- 235000020636 oyster Nutrition 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 231100000915 pathological change Toxicity 0.000 description 1
- 230000036285 pathological change Effects 0.000 description 1
- 230000008807 pathological lesion Effects 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- VPJDULFXCAQHRC-UHFFFAOYSA-N prop-2-enylurea Chemical compound NC(=O)NCC=C VPJDULFXCAQHRC-UHFFFAOYSA-N 0.000 description 1
- LZMATGARSSLFMQ-UHFFFAOYSA-N propan-2-ylurea Chemical compound CC(C)NC(N)=O LZMATGARSSLFMQ-UHFFFAOYSA-N 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- ZQZJKHIIQFPZCS-UHFFFAOYSA-N propylurea Chemical compound CCCNC(N)=O ZQZJKHIIQFPZCS-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 210000000813 small intestine Anatomy 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 229940055764 triaz Drugs 0.000 description 1
- NKCIVLISTXOILK-UHFFFAOYSA-N triazinane-4,5,6-trione Chemical compound OC1=NN=NC(O)=C1O NKCIVLISTXOILK-UHFFFAOYSA-N 0.000 description 1
- 125000005034 trifluormethylthio group Chemical group FC(S*)(F)F 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23K—FODDER
- A23K20/00—Accessory food factors for animal feeding-stuffs
- A23K20/10—Organic substances
- A23K20/116—Heterocyclic compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/26—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C317/32—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C317/34—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having sulfone or sulfoxide groups and amino groups bound to carbon atoms of six-membered aromatic rings being part of the same non-condensed ring or of a condensed ring system containing that ring
- C07C317/38—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton having sulfone or sulfoxide groups and amino groups bound to carbon atoms of six-membered aromatic rings being part of the same non-condensed ring or of a condensed ring system containing that ring with the nitrogen atom of at least one amino group being part of any of the groups, X being a hetero atom, Y being any atom, e.g. N-acylaminosulfones
- C07C317/42—Y being a hetero atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/39—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton at least one of the nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom
- C07C323/43—Y being a hetero atom
- C07C323/44—X or Y being nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/64—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and sulfur atoms, not being part of thio groups, bound to the same carbon skeleton
- C07C323/66—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and sulfur atoms, not being part of thio groups, bound to the same carbon skeleton containing sulfur atoms of sulfo, esterified sulfo or halosulfonyl groups, bound to the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Polymers & Plastics (AREA)
- Animal Husbandry (AREA)
- Zoology (AREA)
- Engineering & Computer Science (AREA)
- Food Science & Technology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Fodder In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2313721A DE2313721A1 (de) | 1973-03-20 | 1973-03-20 | Neue 1-phenylsubstituierte 1,3,5triazine, verfahren zu ihrer herstellung, sowie ihre verwendung als arzneimittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL88676B1 true PL88676B1 (cg-RX-API-DMAC7.html) | 1976-09-30 |
Family
ID=5875270
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1974169634A PL88676B1 (cg-RX-API-DMAC7.html) | 1973-03-20 | 1974-03-18 |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3948893A (cg-RX-API-DMAC7.html) |
| JP (2) | JPS49125382A (cg-RX-API-DMAC7.html) |
| AU (1) | AU475802B2 (cg-RX-API-DMAC7.html) |
| BE (1) | BE812549A (cg-RX-API-DMAC7.html) |
| BR (1) | BR7402174D0 (cg-RX-API-DMAC7.html) |
| CA (1) | CA1008860A (cg-RX-API-DMAC7.html) |
| CH (1) | CH605848A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2313721A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2230354B1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1425789A (cg-RX-API-DMAC7.html) |
| HU (1) | HU168729B (cg-RX-API-DMAC7.html) |
| IE (1) | IE39078B1 (cg-RX-API-DMAC7.html) |
| IL (2) | IL44433A0 (cg-RX-API-DMAC7.html) |
| LU (1) | LU69647A1 (cg-RX-API-DMAC7.html) |
| NL (1) | NL7403613A (cg-RX-API-DMAC7.html) |
| PL (1) | PL88676B1 (cg-RX-API-DMAC7.html) |
| SU (1) | SU531487A3 (cg-RX-API-DMAC7.html) |
| ZA (1) | ZA741772B (cg-RX-API-DMAC7.html) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2718799A1 (de) * | 1977-04-27 | 1978-11-09 | Bayer Ag | 1-(4-phenoxy-phenyl)-1,3,5-triazin- derivate, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel und wachstumsfoerderer |
| EP0071138A3 (de) * | 1981-07-29 | 1983-09-14 | Bayer Ag | Neue aromatische und aliphatische, schwefelhaltige primäre Amine, ein Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von Polyurethanen |
| DE3314739A1 (de) * | 1983-04-23 | 1984-10-25 | Bayer Ag, 5090 Leverkusen | 1-(4-(4-(fluoralkylmethylthio- oder -sulfinyl- oder -sulfonyl-)phenoxy) phenyl)-1,3,5-triazin-2,4,6(1h,3h,5h)-trione, verfahren zu ihrer herstellung und ihre verwendung als coccidiosemittel |
| JPS6178774A (ja) * | 1984-09-25 | 1986-04-22 | Sumitomo Chem Co Ltd | 6−アルキルチオ−1,3,5−トリアジン−2,4(1h,3h)−ジオン誘導体の製造法 |
| DE3618662A1 (de) * | 1986-06-03 | 1987-12-10 | Bayer Ag | Trisubstituierte 1,3,5-triazin-2,4,6-trione |
| DE3703103A1 (de) * | 1987-02-03 | 1988-08-11 | Bayer Ag | Mittel gegen fischparsiten |
| DE3703105A1 (de) * | 1987-02-03 | 1988-08-11 | Bayer Ag | Mittel gegen protozoen bei insekten |
| US4897424A (en) * | 1987-06-18 | 1990-01-30 | Ciba-Geigy Corporation | Aryloxyphenylthioureas, aryloxyphenylisothioureas and aryloxyphenylcarbodiimides and pesticidal compositions containing them |
| US5026730A (en) * | 1987-08-21 | 1991-06-25 | Ciba-Geigy Corporation | Anilinophenylthioureas, compositions containing them, and the use thereof in pest control |
| JPH06308549A (ja) * | 1993-04-19 | 1994-11-04 | Hoechst Japan Ltd | 分子性結晶体及びそれを用いた波長変換デバイス |
| US5883095A (en) * | 1997-08-07 | 1999-03-16 | University Of Kentucky Research Foundation | Formulations and methods to treat and prevent equine protozoal myeloencephalitis |
| US6194408B1 (en) * | 1998-12-22 | 2001-02-27 | Bayer Corporation | Triazineone compounds for treating diseases due to Sarcocystis, Neospora and Toxoplasma |
| US6867203B2 (en) | 1998-12-29 | 2005-03-15 | Abbott Laboratories | Cell adhesion-inhibiting antiinflammatory and immune-suppressive compounds |
| EE200100514A (et) * | 1999-04-02 | 2002-12-16 | Icos Corporation | LFA-1 ICAM-idega seondumise inhibiitorid ja nendekasutamine |
| MY122278A (en) | 1999-07-19 | 2006-04-29 | Upjohn Co | 1,2,3,4,5,6-hexahydroazepino[4,5-b]indoles containing arylsulfones at the 9-position |
| US7030109B2 (en) | 1999-07-19 | 2006-04-18 | Pharmacia & Upjohn Company | 1,2,3,4,5,6-Hexahydroazepino[4,5-b]indoles containing arylsulfones at the 9-position |
| CA2414461A1 (en) | 2000-06-29 | 2002-01-10 | Abbott Laboratories | Aryl phenylheterocyclyl sulfide derivatives and their use as cell adhesion-inhibiting anti-inflammatory and immune-suppressive agents |
| US7291616B2 (en) * | 2001-10-31 | 2007-11-06 | Cell Therapeutics, Inc. | Aryl triazines as LPAAT-β inhibitors and uses thereof |
| US7419984B2 (en) * | 2002-10-17 | 2008-09-02 | Cell Therapeutics, Inc. | Pyrimidines and uses thereof |
| DE10258168B4 (de) * | 2002-12-12 | 2005-07-07 | Infineon Technologies Ag | Integrierter DRAM-Halbleiterspeicher und Verfahren zum Betrieb desselben |
| US6875781B2 (en) * | 2003-04-04 | 2005-04-05 | Cell Therapeutics, Inc. | Pyridines and uses thereof |
| HUE061751T2 (hu) | 2018-02-26 | 2023-08-28 | AlzeCure Pharma AB | Triazinszármazékok neurotrofinokhoz kapcsolódó betegségek kezelésére |
| GB201810668D0 (en) | 2018-06-28 | 2018-08-15 | Stiftelsen Alzecure | New compounds |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3179626A (en) * | 1961-01-17 | 1965-04-20 | Air Prod & Chem | Preparation of polymers of polyisocyanates and polyurethane polymers using diazabicyclo-ocatane and aldehydes as co-catalysts |
| IL33143A (en) | 1968-10-16 | 1973-04-30 | Pfizer | Substituted as-triazine-3,5(2h,4h)-diones,their preparation and use against coccidiosis |
| DE1927921A1 (de) | 1969-05-31 | 1970-12-03 | Bayer Ag | s-Triazinderivate |
| DE2149645A1 (de) | 1970-10-07 | 1972-09-14 | Pfizer | 2-Phenyl-as-triazin-3.5-(2H,4H)-dione und die Verwendung dieser Verbindungen zur Bekaempfung der Coccidiose |
-
1973
- 1973-03-20 DE DE2313721A patent/DE2313721A1/de active Pending
-
1974
- 1974-03-13 HU HUBA3047A patent/HU168729B/hu unknown
- 1974-03-18 JP JP49030160A patent/JPS49125382A/ja active Pending
- 1974-03-18 LU LU69647A patent/LU69647A1/xx unknown
- 1974-03-18 SU SU2005607A patent/SU531487A3/ru active
- 1974-03-18 US US05/452,140 patent/US3948893A/en not_active Expired - Lifetime
- 1974-03-18 JP JP49030161A patent/JPS49125511A/ja active Pending
- 1974-03-18 IL IL7444433A patent/IL44433A0/xx unknown
- 1974-03-18 PL PL1974169634A patent/PL88676B1/pl unknown
- 1974-03-18 CH CH373074A patent/CH605848A5/xx not_active IP Right Cessation
- 1974-03-18 NL NL7403613A patent/NL7403613A/xx not_active Application Discontinuation
- 1974-03-19 CA CA195,335A patent/CA1008860A/en not_active Expired
- 1974-03-19 IE IE579/74A patent/IE39078B1/xx unknown
- 1974-03-19 AU AU66811/74A patent/AU475802B2/en not_active Expired
- 1974-03-19 GB GB1209774A patent/GB1425789A/en not_active Expired
- 1974-03-19 ZA ZA00741772A patent/ZA741772B/xx unknown
- 1974-03-20 BE BE142203A patent/BE812549A/xx unknown
- 1974-03-20 FR FR7409479A patent/FR2230354B1/fr not_active Expired
- 1974-03-20 BR BR2174/74A patent/BR7402174D0/pt unknown
-
1977
- 1977-03-18 IL IL7744433A patent/IL44433A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BR7402174D0 (pt) | 1974-11-05 |
| AU6681174A (en) | 1975-09-25 |
| FR2230354A1 (cg-RX-API-DMAC7.html) | 1974-12-20 |
| CA1008860A (en) | 1977-04-19 |
| CH605848A5 (cg-RX-API-DMAC7.html) | 1978-10-13 |
| JPS49125382A (cg-RX-API-DMAC7.html) | 1974-11-30 |
| IL44433A (en) | 1977-08-31 |
| GB1425789A (en) | 1976-02-18 |
| FR2230354B1 (cg-RX-API-DMAC7.html) | 1977-11-10 |
| BE812549A (fr) | 1974-09-20 |
| SU531487A3 (ru) | 1976-10-05 |
| IE39078B1 (en) | 1978-08-02 |
| US3948893A (en) | 1976-04-06 |
| JPS49125511A (cg-RX-API-DMAC7.html) | 1974-12-02 |
| IE39078L (en) | 1974-09-20 |
| AU475802B2 (en) | 1976-09-02 |
| IL44433A0 (en) | 1974-07-31 |
| HU168729B (cg-RX-API-DMAC7.html) | 1976-07-28 |
| NL7403613A (cg-RX-API-DMAC7.html) | 1974-09-24 |
| ZA741772B (en) | 1975-01-29 |
| LU69647A1 (cg-RX-API-DMAC7.html) | 1974-10-17 |
| DE2313721A1 (de) | 1974-10-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL88676B1 (cg-RX-API-DMAC7.html) | ||
| EP0547035A1 (en) | Pyridinecarboxamides | |
| US4219552A (en) | 1-(4-Phenoxy-phenyl)-1,3,5-triazines, their use as growth promoters | |
| FI59094B (fi) | Foerfarande foer framstaellning av nya kockidiostatiskt aktiva 1-(4-fenoxifenyl)-1,3,5-triazin-2,4,6(1h,3h,5h)-trioner | |
| FI63020C (fi) | Foerfarande foer framstaellning av substituerade fenylguanidiner anvaendbara som maskmedel | |
| DK144943B (da) | Analogifremgangsmaade til fremstilling af 1-(4-phenoxyphenyl)-1,3,5-triazin-derivater | |
| AU598270B2 (en) | Imidazolesulfonamide derivatives and herbicides | |
| FI81095C (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara 1-/4-(benzotiazol-, benzoxazol-2-yltio- eller -2-yloxi)-fenyl/-1,3,5-triazin-2,4,6- (1h,3h,5h)-trioner. | |
| EP0628034B1 (de) | Herbizide n- (1,3,5-triazin-2-yl)aminocarbonyl]benzolsulfonamide | |
| US3681376A (en) | -n-hydroxy-2-trifluoromethyl benzimidazoles and carbamic esters thereof | |
| US3970752A (en) | Coccidiocidal compositions utilizing 1-phenyl-substituted 1,3,5-triazine | |
| US3097241A (en) | Nu-cyclohexane-sulphonyl-n'-(beta-phenylethyl)-urea | |
| HU218974B (hu) | N-(2-Pirimidinil-karbamoil)-benzolszulfonamid-származékok, ezeket tartalmazó herbicid készítmények, eljárás előállításukra és gyomok irtására | |
| US4618610A (en) | Triazine derivatives, and pharmaceutical compositions comprising the same | |
| CA1263120A (en) | Process for the preparation of n-sulfamyl-3-(2- guanidino-thiazol-4-yl-methylthio)-propionamidine | |
| BG107013A (bg) | Il-8 рецепторни антагонисти | |
| CZ38296A3 (en) | Substituted benzenesulfonylureas and benzenesulfonylthioureas, process of their preparation and their use for preparing pharmaceutical preparations, as well as pharmaceutical preparations in which they are comprised | |
| US3097240A (en) | Novel sulfonyl-ureas | |
| US3345374A (en) | Certain oxathiazole and dithiazole derivatives | |
| CZ433298A3 (cs) | Deriváty methylesteru kyseliny 4-jod-2-[N-alkyl-aminokarbonyl)-aminosulfonyl]-benzoové, způsob jejich výroby a jejich použití pro výrobu herbicidních sulfonylmočovin | |
| ES2207325T3 (es) | ((aminoiminomethil) amino) alcanocarboxamidas y sus aplicaciones terapeuticas. | |
| CA1036604A (en) | 1-aryl-uracils | |
| Tomé et al. | Chlorosulfonation of N-arylmaleimides | |
| CA1221968A (en) | Process for the preparation of sulphonyliso(thio)ureas | |
| SU556726A3 (ru) | Способ получени производных сульфониламинопиримидина или их солей |