PL85107B1 - Preparation of pyrimidylmethyl-pyridinium derivatives[gb1321361a] - Google Patents
Preparation of pyrimidylmethyl-pyridinium derivatives[gb1321361a] Download PDFInfo
- Publication number
- PL85107B1 PL85107B1 PL14745071A PL14745071A PL85107B1 PL 85107 B1 PL85107 B1 PL 85107B1 PL 14745071 A PL14745071 A PL 14745071A PL 14745071 A PL14745071 A PL 14745071A PL 85107 B1 PL85107 B1 PL 85107B1
- Authority
- PL
- Poland
- Prior art keywords
- general formula
- methyl
- alkyl
- pyrimidyl
- amino
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 5
- 150000001875 compounds Chemical class 0.000 claims abstract description 16
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 9
- 125000005843 halogen group Chemical group 0.000 claims abstract description 7
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 5
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical group CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 14
- 239000002253 acid Substances 0.000 claims description 5
- 238000006243 chemical reaction Methods 0.000 claims description 5
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 5
- 238000006114 decarboxylation reaction Methods 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 150000003222 pyridines Chemical class 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 3
- NRRCYZPJUABYHL-UHFFFAOYSA-N 2-Pyrimidine Acetic Acid Chemical class OC(=O)CC1=NC=CC=N1 NRRCYZPJUABYHL-UHFFFAOYSA-N 0.000 claims description 2
- 239000003960 organic solvent Substances 0.000 claims description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims 2
- 150000002148 esters Chemical class 0.000 claims 1
- ZZJXCWRVBNCAEG-UHFFFAOYSA-N pyridine;pyrimidine-2-carboxylic acid Chemical group C1=CC=NC=C1.OC(=O)C1=NC=CC=N1 ZZJXCWRVBNCAEG-UHFFFAOYSA-N 0.000 claims 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical class C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 abstract description 5
- -1 halogen anion Chemical class 0.000 abstract description 5
- 125000004185 ester group Chemical group 0.000 abstract description 3
- 230000000911 decarboxylating effect Effects 0.000 abstract 1
- 230000003301 hydrolyzing effect Effects 0.000 abstract 1
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 abstract 1
- 239000011541 reaction mixture Substances 0.000 description 15
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 230000026030 halogenation Effects 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- KWIUHFFTVRNATP-UHFFFAOYSA-N Betaine Natural products C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241000147123 Moorella group Species 0.000 description 1
- KWIUHFFTVRNATP-UHFFFAOYSA-O N,N,N-trimethylglycinium Chemical compound C[N+](C)(C)CC(O)=O KWIUHFFTVRNATP-UHFFFAOYSA-O 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229960004275 glycolic acid Drugs 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/42—One nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyridine Compounds (AREA)
- Cephalosporin Compounds (AREA)
- Solid-Sorbent Or Filter-Aiding Compositions (AREA)
- Phenolic Resins Or Amino Resins (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUCI000977 HU164879B (enExample) | 1970-04-10 | 1970-04-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL85107B1 true PL85107B1 (en) | 1976-04-30 |
Family
ID=10994377
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL14745071A PL85107B1 (en) | 1970-04-10 | 1971-04-09 | Preparation of pyrimidylmethyl-pyridinium derivatives[gb1321361a] |
Country Status (15)
| Country | Link |
|---|---|
| JP (1) | JPS5414110B1 (enExample) |
| AT (1) | AT303744B (enExample) |
| CA (1) | CA930363A (enExample) |
| CH (1) | CH550811A (enExample) |
| DE (1) | DE2111610C3 (enExample) |
| DK (1) | DK124685B (enExample) |
| ES (1) | ES385714A1 (enExample) |
| GB (1) | GB1321361A (enExample) |
| HU (1) | HU164879B (enExample) |
| NL (1) | NL7104664A (enExample) |
| NO (1) | NO130432B (enExample) |
| PL (1) | PL85107B1 (enExample) |
| SE (1) | SE395148B (enExample) |
| SU (1) | SU403178A3 (enExample) |
| YU (1) | YU34424B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2626495A1 (de) * | 1976-06-12 | 1977-12-29 | Bayer Ag | Quartaere reaktivverbindungen |
| DE3504440A1 (de) * | 1985-02-09 | 1986-08-14 | Grote & Hartmann Gmbh & Co Kg, 5600 Wuppertal | Entsorgungsvorrichtung fuer kabelkonfektionierautomaten |
-
1970
- 1970-04-10 HU HUCI000977 patent/HU164879B/hu unknown
- 1970-11-19 ES ES385714A patent/ES385714A1/es not_active Expired
-
1971
- 1971-03-11 DE DE19712111610 patent/DE2111610C3/de not_active Expired
- 1971-03-17 AT AT229171A patent/AT303744B/de not_active IP Right Cessation
- 1971-03-31 YU YU80371A patent/YU34424B/xx unknown
- 1971-04-05 SE SE441671A patent/SE395148B/xx unknown
- 1971-04-06 NO NO132071A patent/NO130432B/no unknown
- 1971-04-07 NL NL7104664A patent/NL7104664A/xx unknown
- 1971-04-07 CH CH509671A patent/CH550811A/xx not_active IP Right Cessation
- 1971-04-07 SU SU1644093A patent/SU403178A3/ru active
- 1971-04-07 DK DK166771A patent/DK124685B/da unknown
- 1971-04-08 CA CA109960A patent/CA930363A/en not_active Expired
- 1971-04-08 JP JP2202871A patent/JPS5414110B1/ja active Pending
- 1971-04-09 PL PL14745071A patent/PL85107B1/pl unknown
- 1971-04-19 GB GB2621671A patent/GB1321361A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| YU34424B (en) | 1979-07-10 |
| DE2111610C3 (de) | 1979-12-13 |
| YU80371A (en) | 1978-12-31 |
| JPS5414110B1 (enExample) | 1979-06-05 |
| NL7104664A (enExample) | 1971-10-12 |
| DE2111610B2 (de) | 1979-04-26 |
| GB1321361A (en) | 1973-06-27 |
| CA930363A (en) | 1973-07-17 |
| SE395148B (sv) | 1977-08-01 |
| DK124685B (da) | 1972-11-13 |
| CH550811A (de) | 1974-06-28 |
| HU164879B (enExample) | 1974-05-28 |
| SU403178A3 (enExample) | 1973-10-19 |
| ES385714A1 (es) | 1973-10-01 |
| DE2111610A1 (de) | 1971-12-16 |
| AT303744B (de) | 1972-12-11 |
| NO130432B (enExample) | 1974-09-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3182071A (en) | Acylated indole derivatives | |
| US2734904A (en) | Xcxnhxc-nh | |
| US2831027A (en) | Isocamphane compounds and processes for preparing the same | |
| DE2414751A1 (de) | Neue 4h-pyrido-eckige klammer auf 1,2a eckige klammer zu-pyrimidin-derivate und verfahren zur herstellung derselben | |
| US3072649A (en) | S-tmalkoxycinnamamide derivatives | |
| PL85107B1 (en) | Preparation of pyrimidylmethyl-pyridinium derivatives[gb1321361a] | |
| US2546159A (en) | Piperidyl ketones and process of | |
| DE2347015A1 (de) | Neue pyrazolyloxyessigsaeurederivate und verfahren zu ihrer herstellung | |
| US3743646A (en) | Amides of 3-(2-halophenyl-5-tetrazolyl)propionic acids | |
| DE1695702C3 (de) | Verfahren zur Herstellung von 1-Acyl-2-carboxy-3-indolylessigsäuren | |
| US2753345A (en) | Substituted mercaptobenzoic acids and methods of preparing the same | |
| US2485662A (en) | Alpha-(aminoalkyl)-stilbenes | |
| US3215699A (en) | Substituted acetylphenyl hydrazones of 2,3-piperidine diones | |
| US2498435A (en) | Production of 1,3 dimethyl-4-phenyl-4-hydroxy-piperidine | |
| DE1135921B (de) | Verfahren zur Herstellung von heterocyclisch substituierten Morphinanen und deren Salzen | |
| US3378592A (en) | Process for the production of 3, 4-dihydroxybenzyloxyaminehydrobromide | |
| US2834785A (en) | N-substituted-3-thiol piperidines and thioesters thereof | |
| NO132930B (enExample) | ||
| US3145212A (en) | Benzophenone-2-carboxylic acid addition salts of 1-methyl-3-(di-2-thienylmethylene) pperidine | |
| US3364224A (en) | Acylated derivatives of 1, 2, 3, 4-tetrahydro-1-oxo-beta-carbolines | |
| SU471711A3 (ru) | Способ получени производных -аминоакриловой кислоты | |
| US2897204A (en) | Substituted piperidines and methods for making same | |
| US3299070A (en) | Piperazine amides of 3-phenylcinnoline-4-carboxylic acids | |
| SU419033A3 (ru) | Способ получения производных гомопиримидазола | |
| US3202670A (en) | 9-methyl-3, 4-dihydroxy-9h-pyrido-[3, 4-b] indole methochloride |