PL82784B1 - - Google Patents
Download PDFInfo
- Publication number
- PL82784B1 PL82784B1 PL15032671A PL15032671A PL82784B1 PL 82784 B1 PL82784 B1 PL 82784B1 PL 15032671 A PL15032671 A PL 15032671A PL 15032671 A PL15032671 A PL 15032671A PL 82784 B1 PL82784 B1 PL 82784B1
- Authority
- PL
- Poland
- Prior art keywords
- benzo
- cyclohepta
- methyl
- formula
- thiophen
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 54
- -1 alkyl radical Chemical class 0.000 claims description 43
- 239000002253 acid Substances 0.000 claims description 20
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 16
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 13
- 239000007864 aqueous solution Substances 0.000 claims description 11
- 239000005977 Ethylene Substances 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 150000007513 acids Chemical class 0.000 claims description 8
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 8
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 4
- 230000001590 oxidative effect Effects 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 150000002391 heterocyclic compounds Chemical class 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims 1
- 239000002585 base Substances 0.000 description 82
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 76
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 48
- 239000000243 solution Substances 0.000 description 44
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 40
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical group C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 39
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 33
- 239000000203 mixture Substances 0.000 description 33
- 238000002844 melting Methods 0.000 description 30
- 230000008018 melting Effects 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 30
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 26
- 238000006243 chemical reaction Methods 0.000 description 22
- 229930192474 thiophene Natural products 0.000 description 20
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 19
- 229910052938 sodium sulfate Inorganic materials 0.000 description 19
- 235000011152 sodium sulphate Nutrition 0.000 description 19
- 238000004452 microanalysis Methods 0.000 description 18
- 238000010438 heat treatment Methods 0.000 description 17
- 239000000047 product Substances 0.000 description 17
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical class Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- 238000001704 evaporation Methods 0.000 description 16
- 230000008020 evaporation Effects 0.000 description 15
- 239000000155 melt Substances 0.000 description 15
- 238000001816 cooling Methods 0.000 description 14
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 14
- 239000011541 reaction mixture Substances 0.000 description 13
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 13
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 12
- VOBWLFNYOWWARN-UHFFFAOYSA-N thiophen-3-one Chemical compound O=C1CSC=C1 VOBWLFNYOWWARN-UHFFFAOYSA-N 0.000 description 12
- 238000010992 reflux Methods 0.000 description 11
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 229910052739 hydrogen Inorganic materials 0.000 description 8
- 239000001257 hydrogen Substances 0.000 description 8
- 238000002329 infrared spectrum Methods 0.000 description 8
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 7
- 238000009835 boiling Methods 0.000 description 7
- 239000000284 extract Substances 0.000 description 7
- 150000002431 hydrogen Chemical group 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 6
- 229910021529 ammonia Inorganic materials 0.000 description 6
- 229910052736 halogen Inorganic materials 0.000 description 6
- 150000002367 halogens Chemical class 0.000 description 6
- 239000013067 intermediate product Substances 0.000 description 6
- 229910052740 iodine Inorganic materials 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- 235000019270 ammonium chloride Nutrition 0.000 description 5
- 239000011630 iodine Substances 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 4
- 238000003747 Grignard reaction Methods 0.000 description 4
- ZCVMWBYGMWKGHF-UHFFFAOYSA-N Ketotifene Chemical compound C1CN(C)CCC1=C1C2=CC=CC=C2CC(=O)C2=C1C=CS2 ZCVMWBYGMWKGHF-UHFFFAOYSA-N 0.000 description 4
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 4
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 239000002026 chloroform extract Substances 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 230000001558 histaminolytic effect Effects 0.000 description 4
- 239000011777 magnesium Substances 0.000 description 4
- 229910052749 magnesium Inorganic materials 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- SABRAZLAGGKSND-UHFFFAOYSA-N 8-bromo-2-(1-methylpiperidin-4-yl)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,8,10,12-hexaen-2-ol Chemical compound CN1CCC(CC1)C1(O)c2ccsc2C(Br)=Cc2ccccc12 SABRAZLAGGKSND-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 239000012458 free base Substances 0.000 description 3
- 238000004949 mass spectrometry Methods 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- CLVNTYZKUHNUEF-UHFFFAOYSA-N 2-(2-chloroethyl)-1-methylpyrrolidine Chemical compound CN1CCCC1CCCl CLVNTYZKUHNUEF-UHFFFAOYSA-N 0.000 description 2
- FWWOWPGPERBCNJ-UHFFFAOYSA-N 2-hydroxy-4-(2-hydroxyethoxy)-4-oxobutanoic acid Chemical compound OCCOC(=O)CC(O)C(O)=O FWWOWPGPERBCNJ-UHFFFAOYSA-N 0.000 description 2
- MMTTWQAQUZDXSB-UHFFFAOYSA-N 2H-cyclohepta[b]thiophen-4-ol Chemical compound S1C=2C(=CC1)C(=CC=CC2)O MMTTWQAQUZDXSB-UHFFFAOYSA-N 0.000 description 2
- FFOIFAAVWJZLFE-UHFFFAOYSA-N 3-(chloromethyl)-1-methylpiperidine Chemical compound CN1CCCC(CCl)C1 FFOIFAAVWJZLFE-UHFFFAOYSA-N 0.000 description 2
- NYYRRBOMNHUCLB-UHFFFAOYSA-N 3-chloro-n,n-dimethylpropan-1-amine Chemical compound CN(C)CCCCl NYYRRBOMNHUCLB-UHFFFAOYSA-N 0.000 description 2
- PSQJECDHWPFWSC-UHFFFAOYSA-N 4-(8-bromo-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,8,10,12-hexaen-2-ylidene)-1-methylpiperidine Chemical compound CN1CCC(CC1)=C1c2ccsc2C(Br)=Cc2ccccc12 PSQJECDHWPFWSC-UHFFFAOYSA-N 0.000 description 2
- JTYAUSWEFIWMHF-UHFFFAOYSA-N 4-bromobenzo[1,2]cyclohepta[3,4-b]thiophen-10-one Chemical compound BrC1=CC2=CC=CC=C2C(=O)C2=C1SC=C2 JTYAUSWEFIWMHF-UHFFFAOYSA-N 0.000 description 2
- MYGXGCCFTPKWIH-UHFFFAOYSA-N 4-chloro-1-methylpiperidine Chemical compound CN1CCC(Cl)CC1 MYGXGCCFTPKWIH-UHFFFAOYSA-N 0.000 description 2
- JSPBTTYBJKPESQ-UHFFFAOYSA-N 7-chloro-10-(1-methylpiperidin-4-ylidene)-5h-benzo[1,2]cyclohepta[2,4-b]thiophen-4-one Chemical compound C1CN(C)CCC1=C1C2=CC=C(Cl)C=C2CC(=O)C2=C1C=CS2 JSPBTTYBJKPESQ-UHFFFAOYSA-N 0.000 description 2
- QBGZNZROAMEYIE-UHFFFAOYSA-N 8,9-dibromo-13-chloro-6-thiatricyclo[8.4.0.03,7]tetradeca-1(10),3(7),4,11,13-pentaen-2-one Chemical compound ClC=1C=CC2=C(C(C3=C(SC=C3)C(C2Br)Br)=O)C1 QBGZNZROAMEYIE-UHFFFAOYSA-N 0.000 description 2
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 2
- NEZGEPPPHIDPML-UHFFFAOYSA-N BrC1=CC2=C(C(C3=C1SC=C3)=C3CCN(CC3)C)C=C(C=C2)Cl Chemical compound BrC1=CC2=C(C(C3=C1SC=C3)=C3CCN(CC3)C)C=C(C=C2)Cl NEZGEPPPHIDPML-UHFFFAOYSA-N 0.000 description 2
- 241000700198 Cavia Species 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- AKPUJVVHYUHGKY-UHFFFAOYSA-N hydron;propan-2-ol;chloride Chemical compound Cl.CC(C)O AKPUJVVHYUHGKY-UHFFFAOYSA-N 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 2
- 231100000820 toxicity test Toxicity 0.000 description 2
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 2
- KPZGRMZPZLOPBS-UHFFFAOYSA-N 1,3-dichloro-2,2-bis(chloromethyl)propane Chemical compound ClCC(CCl)(CCl)CCl KPZGRMZPZLOPBS-UHFFFAOYSA-N 0.000 description 1
- MHGBFEJHQLAUQM-UHFFFAOYSA-N 10h-benzo[1,2]cyclohepta[3,4-b]thiophene Chemical group C1=CC2=CC=CC=C2CC2=C1SC=C2 MHGBFEJHQLAUQM-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 1
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 description 1
- NFHHBIGYIAIGFH-UHFFFAOYSA-N 2h-cyclohepta[b]thiophene Chemical compound C1=CC=CC2=CCSC2=C1 NFHHBIGYIAIGFH-UHFFFAOYSA-N 0.000 description 1
- FMLHOINVMYQJPG-UHFFFAOYSA-N 4,5-dibromo-4,5-dihydrobenzo[1,2]cyclohepta[3,4-b]thiophen-10-one Chemical compound BrC1C(Br)C2=CC=CC=C2C(=O)C2=C1SC=C2 FMLHOINVMYQJPG-UHFFFAOYSA-N 0.000 description 1
- WGEWUSWVZVXBSF-UHFFFAOYSA-N 4-methoxy-2-(2-thiophen-2-ylethyl)benzoic acid Chemical compound COC1=CC(=C(C(=O)O)C=C1)CCC=1SC=CC1 WGEWUSWVZVXBSF-UHFFFAOYSA-N 0.000 description 1
- LLBZPESJRQGYMB-UHFFFAOYSA-N 4-one Natural products O1C(C(=O)CC)CC(C)C11C2(C)CCC(C3(C)C(C(C)(CO)C(OC4C(C(O)C(O)C(COC5C(C(O)C(O)CO5)OC5C(C(OC6C(C(O)C(O)C(CO)O6)O)C(O)C(CO)O5)OC5C(C(O)C(O)C(C)O5)O)O4)O)CC3)CC3)=C3C2(C)CC1 LLBZPESJRQGYMB-UHFFFAOYSA-N 0.000 description 1
- INRUAWNGDSCCFC-UHFFFAOYSA-N 7-chloro-4,5-dihydrobenzo[1,2]cyclohepta[2,4-b]thiophen-10-one Chemical compound C=1C(Cl)=CC=C(C2=O)C=1CCC1=C2C=CS1 INRUAWNGDSCCFC-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- CRMYGYDSPBLQGV-UHFFFAOYSA-N 8-bromo-10-(1-methylpiperidin-4-ylidene)-5h-benzo[3,4]cyclohepta[1,3-b]thiophen-4-one Chemical compound C1CN(C)CCC1=C1C2=CC(Br)=CC=C2CC(=O)C2=C1C=CS2 CRMYGYDSPBLQGV-UHFFFAOYSA-N 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 229910052776 Thorium Inorganic materials 0.000 description 1
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 1
- 229960004373 acetylcholine Drugs 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 230000000172 allergic effect Effects 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 230000001078 anti-cholinergic effect Effects 0.000 description 1
- 239000003420 antiserotonin agent Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- 238000005660 chlorination reaction Methods 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 210000004087 cornea Anatomy 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- ANCBHJKEYPZCTE-UHFFFAOYSA-N ethyl 5-carbamoyl-4-methyl-2-[(2,3,4,5,6-pentafluorobenzoyl)amino]thiophene-3-carboxylate Chemical compound CC1=C(C(N)=O)SC(NC(=O)C=2C(=C(F)C(F)=C(F)C=2F)F)=C1C(=O)OCC ANCBHJKEYPZCTE-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 229940076279 serotonin Drugs 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1412070A CH537404A (de) | 1970-09-24 | 1970-09-24 | Verfahren zur Herstellung neuer Thiophenderivate |
| CH163271 | 1971-02-04 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL82784B1 true PL82784B1 (en:Method) | 1975-10-31 |
Family
ID=25688218
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL15032671A PL82784B1 (en:Method) | 1970-09-24 | 1971-09-02 |
Country Status (13)
| Country | Link |
|---|---|
| JP (1) | JPS558984B1 (en:Method) |
| CS (1) | CS181213B2 (en:Method) |
| DD (1) | DD94823A5 (en:Method) |
| DK (1) | DK127429B (en:Method) |
| ES (1) | ES394742A1 (en:Method) |
| FI (1) | FI60009C (en:Method) |
| HU (1) | HU162650B (en:Method) |
| IE (1) | IE36493B1 (en:Method) |
| IL (1) | IL37621A (en:Method) |
| NO (1) | NO135364C (en:Method) |
| PL (1) | PL82784B1 (en:Method) |
| RO (1) | RO60524A (en:Method) |
| YU (1) | YU35252B (en:Method) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS60112084A (ja) * | 1983-11-24 | 1985-06-18 | Canon Inc | クリ−ニング装置 |
| BRPI0821909A2 (pt) | 2008-01-30 | 2018-07-17 | Nippon Zoki Pharmaceutical Co., Ltd. | derivado de piperidina |
-
1971
- 1971-08-31 FI FI243371A patent/FI60009C/fi active
- 1971-08-31 DD DD15743571A patent/DD94823A5/xx unknown
- 1971-08-31 CS CS622971A patent/CS181213B2/cs unknown
- 1971-08-31 IL IL37621A patent/IL37621A/xx unknown
- 1971-09-01 NO NO324971A patent/NO135364C/no unknown
- 1971-09-01 IE IE111271A patent/IE36493B1/xx unknown
- 1971-09-02 PL PL15032671A patent/PL82784B1/pl unknown
- 1971-09-02 ES ES394742A patent/ES394742A1/es not_active Expired
- 1971-09-02 YU YU224571A patent/YU35252B/xx unknown
- 1971-09-02 HU HUSA002232 patent/HU162650B/hu unknown
- 1971-09-03 JP JP6798071A patent/JPS558984B1/ja active Pending
- 1971-09-06 DK DK437071A patent/DK127429B/da not_active IP Right Cessation
- 1971-09-06 RO RO6814571A patent/RO60524A/ro unknown
Also Published As
| Publication number | Publication date |
|---|---|
| CS181213B2 (en) | 1978-03-31 |
| IE36493L (en) | 1972-03-24 |
| IE36493B1 (en) | 1976-11-24 |
| NO135364C (no) | 1977-03-30 |
| DD94823A5 (en:Method) | 1973-01-05 |
| NO135364B (en:Method) | 1976-12-20 |
| IL37621A0 (en) | 1971-11-29 |
| JPS558984B1 (en:Method) | 1980-03-07 |
| YU35252B (en) | 1980-10-31 |
| RO60524A (en:Method) | 1976-07-15 |
| ES394742A1 (es) | 1974-10-01 |
| HU162650B (en:Method) | 1973-03-28 |
| IL37621A (en) | 1975-05-22 |
| YU224571A (en) | 1980-04-30 |
| DK127429B (da) | 1973-11-05 |
| FI60009C (fi) | 1981-11-10 |
| FI60009B (fi) | 1981-07-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3770728A (en) | Substituted 4h-benzo(4,5)cyclohepta(1,2-b)thiophen-10(9h)-ones | |
| US6486153B1 (en) | Phenylindole derivatives as 5-HT2A receptor ligands | |
| AU679053B2 (en) | Indoletetralins having dopaminergic activity | |
| US20040138230A1 (en) | Heterocyclic substituted piperazines for the treatment of schizophrenia | |
| SU831077A3 (ru) | Способ получени 1,2-дигидрохино-ли-2-OHOB или иХ СОлЕй (ЕгО ВАРиАН-Ты) | |
| JPH054983A (ja) | イソキノリノン誘導体、その製造方法およびその誘導体を有効成分として含有する5−ht3 レセプター拮抗剤 | |
| JPH0559040A (ja) | 新規なベンゾ[5,6 シクロヘプタ[1,2−b ピリジン誘導体及びこれを含有する抗アレルギー剤 | |
| US4999355A (en) | Isoindolinone derivatives, processes for preparing them and medicines containing them | |
| CA1166245A (en) | Piperidylidene derivatives, their production and pharmaceutical compositions containing them | |
| FI96858B (fi) | Menetelmä valmistaa farmakologisesti käyttökelpoinen 6,11-dihydro-11-(4-piperidylideeni)-5H-bentso/1,2b/pyridiini | |
| JPH09501171A (ja) | 5ht1d受容体アンタゴニストとしてのアミド誘導体 | |
| US5147881A (en) | 4-(1,2-benzisoxazolyl)piperidine antipsychotic agents | |
| NO162414B (no) | Fleksibel beholder for transport og lagring av massegods. | |
| US3862156A (en) | 4h-benzo{8 4,5{9 cyclohepta{8 1,2-6{9 thiophenes | |
| NO121337B (en:Method) | ||
| PL82784B1 (en:Method) | ||
| WO1993013105A1 (en) | Condensed thiophene compound and pharmaceutical use thereof | |
| US4144337A (en) | 1,4-Substituted piperazinyl derivatives useful as psychostimulants | |
| JPH0770135A (ja) | 縮合型チオフェン化合物およびその医薬用途 | |
| US3306897A (en) | Thieno-benzothiopyran derivatives | |
| US5948798A (en) | Pyridiniminyl-1,2-benzisoxazoles and -benzisothiazoles | |
| EP0364091B1 (en) | Antipsychotic 4-(4-(3-benzisothiazolyl)-1-piperazinyl)butyl bridged bicyclic imides | |
| KR20020027502A (ko) | 피페리딘 알콜 | |
| Lowrie | 3-Phenylcinnolines. II. 1 The Preparation of 4-Amino Derivatives | |
| PL84248B1 (en:Method) |