PL81273B1 - Quinazolinone derivatives[us3712892a] - Google Patents
Quinazolinone derivatives[us3712892a] Download PDFInfo
- Publication number
- PL81273B1 PL81273B1 PL1970142437A PL14243770A PL81273B1 PL 81273 B1 PL81273 B1 PL 81273B1 PL 1970142437 A PL1970142437 A PL 1970142437A PL 14243770 A PL14243770 A PL 14243770A PL 81273 B1 PL81273 B1 PL 81273B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- carbon atoms
- compound
- group
- hydrogen
- Prior art date
Links
- AVRPFRMDMNDIDH-UHFFFAOYSA-N 1h-quinazolin-2-one Chemical class C1=CC=CC2=NC(O)=NC=C21 AVRPFRMDMNDIDH-UHFFFAOYSA-N 0.000 title abstract description 11
- 150000001875 compounds Chemical class 0.000 claims abstract description 86
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims abstract description 77
- 238000006243 chemical reaction Methods 0.000 claims abstract description 34
- -1 carboxy, carbamoyl Chemical group 0.000 claims abstract description 32
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims abstract description 25
- 239000002253 acid Substances 0.000 claims abstract description 23
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims abstract description 15
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 14
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 12
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract description 12
- 229910021529 ammonia Inorganic materials 0.000 claims abstract description 12
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 12
- 150000003839 salts Chemical class 0.000 claims abstract description 12
- 125000005843 halogen group Chemical group 0.000 claims abstract description 11
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 8
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims abstract description 6
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims abstract description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 4
- 238000006460 hydrolysis reaction Methods 0.000 claims abstract description 4
- 125000001841 imino group Chemical group [H]N=* 0.000 claims abstract description 4
- 125000004430 oxygen atom Chemical group O* 0.000 claims abstract description 4
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 4
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims abstract description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims abstract description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims abstract description 3
- 230000007062 hydrolysis Effects 0.000 claims abstract description 3
- CYQAYERJWZKYML-UHFFFAOYSA-N phosphorus pentasulfide Chemical compound S1P(S2)(=S)SP3(=S)SP1(=S)SP2(=S)S3 CYQAYERJWZKYML-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract 25
- 239000001257 hydrogen Substances 0.000 claims abstract 25
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 51
- 238000000034 method Methods 0.000 claims description 47
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 45
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 24
- 150000002148 esters Chemical class 0.000 claims description 17
- 239000007800 oxidant agent Substances 0.000 claims description 15
- 238000002360 preparation method Methods 0.000 claims description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 13
- 239000007858 starting material Substances 0.000 claims description 13
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 10
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 9
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N thiocyanic acid Chemical compound SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 claims description 9
- XLJMAIOERFSOGZ-UHFFFAOYSA-N cyanic acid Chemical compound OC#N XLJMAIOERFSOGZ-UHFFFAOYSA-N 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 7
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical group [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 6
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 5
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 229910052740 iodine Inorganic materials 0.000 claims description 5
- 229910052700 potassium Inorganic materials 0.000 claims description 5
- 239000011591 potassium Substances 0.000 claims description 5
- 239000003513 alkali Substances 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 4
- 239000011734 sodium Substances 0.000 claims description 4
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 claims description 3
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 claims description 3
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 claims description 3
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 3
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 claims description 3
- 150000002475 indoles Chemical class 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- KJAMZCVTJDTESW-UHFFFAOYSA-N tiracizine Chemical compound C1CC2=CC=CC=C2N(C(=O)CN(C)C)C2=CC(NC(=O)OCC)=CC=C21 KJAMZCVTJDTESW-UHFFFAOYSA-N 0.000 claims description 3
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims description 3
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 claims description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 2
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 claims description 2
- 150000008064 anhydrides Chemical class 0.000 claims description 2
- 150000001714 carbamic acid halides Chemical class 0.000 claims description 2
- 230000003301 hydrolyzing effect Effects 0.000 claims description 2
- 239000012286 potassium permanganate Substances 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims 17
- 150000002367 halogens Chemical group 0.000 claims 17
- 125000002294 quinazolinyl group Chemical class N1=C(N=CC2=CC=CC=C12)* 0.000 claims 8
- 125000001424 substituent group Chemical group 0.000 claims 4
- 239000003153 chemical reaction reagent Substances 0.000 claims 2
- MAOBFOXLCJIFLV-UHFFFAOYSA-N (2-aminophenyl)-phenylmethanone Chemical class NC1=CC=CC=C1C(=O)C1=CC=CC=C1 MAOBFOXLCJIFLV-UHFFFAOYSA-N 0.000 claims 1
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical compound NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 claims 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims 1
- 150000001356 alkyl thiols Chemical class 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 150000008366 benzophenones Chemical class 0.000 claims 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims 1
- ZVCDLGYNFYZZOK-UHFFFAOYSA-M sodium cyanate Chemical compound [Na]OC#N ZVCDLGYNFYZZOK-UHFFFAOYSA-M 0.000 claims 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 abstract description 15
- 150000003246 quinazolines Chemical class 0.000 abstract description 14
- MHBPJMUAIOKJNL-UHFFFAOYSA-N 1h-quinazoline-2-thione Chemical class C1=CC=CC2=NC(S)=NC=C21 MHBPJMUAIOKJNL-UHFFFAOYSA-N 0.000 abstract description 6
- 238000007254 oxidation reaction Methods 0.000 abstract description 4
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 abstract description 3
- 239000005695 Ammonium acetate Substances 0.000 abstract description 3
- 229940043376 ammonium acetate Drugs 0.000 abstract description 3
- 235000019257 ammonium acetate Nutrition 0.000 abstract description 3
- 230000003110 anti-inflammatory effect Effects 0.000 abstract description 3
- 230000003647 oxidation Effects 0.000 abstract description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 abstract 4
- 150000001448 anilines Chemical class 0.000 abstract 4
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 abstract 2
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- 150000001408 amides Chemical class 0.000 abstract 1
- 230000000202 analgesic effect Effects 0.000 abstract 1
- 239000003937 drug carrier Substances 0.000 abstract 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 abstract 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 239000000126 substance Substances 0.000 abstract 1
- 239000000203 mixture Substances 0.000 description 47
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 46
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 36
- 238000002844 melting Methods 0.000 description 30
- 230000008018 melting Effects 0.000 description 30
- 239000002904 solvent Substances 0.000 description 29
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 22
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 20
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 19
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 17
- 229910052938 sodium sulfate Inorganic materials 0.000 description 16
- 235000011152 sodium sulphate Nutrition 0.000 description 16
- 239000013078 crystal Substances 0.000 description 15
- 239000011541 reaction mixture Substances 0.000 description 15
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 239000000047 product Substances 0.000 description 12
- 238000001953 recrystallisation Methods 0.000 description 11
- DBKIXSRJBMRMMF-UHFFFAOYSA-N 6-chloro-4-phenyl-1h-quinazolin-2-one Chemical compound C12=CC(Cl)=CC=C2NC(=O)N=C1C1=CC=CC=C1 DBKIXSRJBMRMMF-UHFFFAOYSA-N 0.000 description 10
- 229960000583 acetic acid Drugs 0.000 description 10
- 238000001816 cooling Methods 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 8
- WCRKZICZCPHVAB-UHFFFAOYSA-N [5-chloro-2-(cyclopropylmethylamino)phenyl]-phenylmethanone Chemical compound C=1C=CC=CC=1C(=O)C1=CC(Cl)=CC=C1NCC1CC1 WCRKZICZCPHVAB-UHFFFAOYSA-N 0.000 description 8
- AEILLAXRDHDKDY-UHFFFAOYSA-N bromomethylcyclopropane Chemical compound BrCC1CC1 AEILLAXRDHDKDY-UHFFFAOYSA-N 0.000 description 8
- 239000012362 glacial acetic acid Substances 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 239000002026 chloroform extract Substances 0.000 description 7
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 229910000104 sodium hydride Inorganic materials 0.000 description 6
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- UVEZKNJPYKHGCF-UHFFFAOYSA-N 1-(cyclopropylmethyl)-4-phenylquinazolin-2-one Chemical compound C12=CC=CC=C2N(CC2CC2)C(=O)N=C1C1=CC=CC=C1 UVEZKNJPYKHGCF-UHFFFAOYSA-N 0.000 description 4
- IXVBNJRBXHFFPQ-UHFFFAOYSA-N 6-chloro-1-(cyclopropylmethyl)-4-phenylquinazolin-2-one Chemical compound O=C1N=C(C=2C=CC=CC=2)C2=CC(Cl)=CC=C2N1CC1CC1 IXVBNJRBXHFFPQ-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- VAFNJIFAZJWWNI-UHFFFAOYSA-N 1-(cyclopropylmethyl)-6-methoxy-4-phenylquinazolin-2-one Chemical compound O=C1N=C(C=2C=CC=CC=2)C2=CC(OC)=CC=C2N1CC1CC1 VAFNJIFAZJWWNI-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 3
- FOTIXXPQQHZZGJ-UHFFFAOYSA-N 6,7-dichloro-1-(cyclopropylmethyl)-4-phenylquinazolin-2-one Chemical compound C1=2C=C(Cl)C(Cl)=CC=2C(C=2C=CC=CC=2)=NC(=O)N1CC1CC1 FOTIXXPQQHZZGJ-UHFFFAOYSA-N 0.000 description 3
- FPCMUNFMVCWNTR-UHFFFAOYSA-N 6-chloro-1-(cyclobutylmethyl)-4-phenylquinazolin-2-one Chemical compound O=C1N=C(C=2C=CC=CC=2)C2=CC(Cl)=CC=C2N1CC1CCC1 FPCMUNFMVCWNTR-UHFFFAOYSA-N 0.000 description 3
- SVCGJDVYXKJRHX-UHFFFAOYSA-N 6-chloro-1-cyclohexyl-4-phenylquinazolin-2-one Chemical compound O=C1N=C(C=2C=CC=CC=2)C2=CC(Cl)=CC=C2N1C1CCCCC1 SVCGJDVYXKJRHX-UHFFFAOYSA-N 0.000 description 3
- MKBSFUYZLQSDOM-UHFFFAOYSA-N 6-chloro-4-(2-chlorophenyl)-1-(cyclopropylmethyl)quinazolin-2-one Chemical compound C1(CC1)CN1C(N=C(C2=CC(=CC=C12)Cl)C1=C(C=CC=C1)Cl)=O MKBSFUYZLQSDOM-UHFFFAOYSA-N 0.000 description 3
- OQBDAQQKVBUXKR-UHFFFAOYSA-N 6-nitro-4-phenyl-1h-quinazolin-2-one Chemical compound C12=CC([N+](=O)[O-])=CC=C2NC(=O)N=C1C1=CC=CC=C1 OQBDAQQKVBUXKR-UHFFFAOYSA-N 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- NTURVSFTOYPGON-UHFFFAOYSA-N Dihydroquinazoline Chemical compound C1=CC=C2C=NCNC2=C1 NTURVSFTOYPGON-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- ISJQNMLYURQSQM-UHFFFAOYSA-N ethyl 2-[2-benzoyl-4-chloro-N-(cyclopropylmethyl)anilino]-2-oxoacetate Chemical compound C1(CC1)CN(C1=C(C(=O)C2=CC=CC=C2)C=C(C=C1)Cl)C(=O)C(=O)OCC ISJQNMLYURQSQM-UHFFFAOYSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- PVFOMCVHYWHZJE-UHFFFAOYSA-N trichloroacetyl chloride Chemical compound ClC(=O)C(Cl)(Cl)Cl PVFOMCVHYWHZJE-UHFFFAOYSA-N 0.000 description 3
- LOKAHOZNNXGVKK-UHFFFAOYSA-N 1-(cyclopropylmethyl)-4-phenyl-6-(trifluoromethyl)quinazolin-2-one Chemical compound O=C1N=C(C=2C=CC=CC=2)C2=CC(C(F)(F)F)=CC=C2N1CC1CC1 LOKAHOZNNXGVKK-UHFFFAOYSA-N 0.000 description 2
- LIPSPKBSSANKCY-UHFFFAOYSA-N 1-(cyclopropylmethyl)-6-fluoro-4-phenylquinazolin-2-one Chemical compound O=C1N=C(C=2C=CC=CC=2)C2=CC(F)=CC=C2N1CC1CC1 LIPSPKBSSANKCY-UHFFFAOYSA-N 0.000 description 2
- DOZCBTHHFJNFKO-UHFFFAOYSA-N 1-(cyclopropylmethyl)-6-nitro-4-phenylquinazolin-2-one Chemical compound O=C1N=C(C=2C=CC=CC=2)C2=CC([N+](=O)[O-])=CC=C2N1CC1CC1 DOZCBTHHFJNFKO-UHFFFAOYSA-N 0.000 description 2
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 2
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 2
- YFRZROIZOHWZNR-UHFFFAOYSA-N 6-bromo-4-phenyl-1h-quinazolin-2-one Chemical compound C12=CC(Br)=CC=C2NC(=O)N=C1C1=CC=CC=C1 YFRZROIZOHWZNR-UHFFFAOYSA-N 0.000 description 2
- HKOOFQWBQATOSD-UHFFFAOYSA-N 6-chloro-4-(2-fluorophenyl)-1h-quinazolin-2-one Chemical compound FC1=CC=CC=C1C1=NC(=O)NC2=CC=C(Cl)C=C12 HKOOFQWBQATOSD-UHFFFAOYSA-N 0.000 description 2
- MNRGLFQJSZLBHF-UHFFFAOYSA-N 6-methoxy-4-phenyl-1h-quinazolin-2-one Chemical compound C12=CC(OC)=CC=C2NC(=O)N=C1C1=CC=CC=C1 MNRGLFQJSZLBHF-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 206010030113 Oedema Diseases 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- DYPCUFPBQVPVPV-UHFFFAOYSA-N [2-(cyclopropylmethylamino)-5-(trifluoromethyl)phenyl]-phenylmethanone Chemical compound C=1C=CC=CC=1C(=O)C1=CC(C(F)(F)F)=CC=C1NCC1CC1 DYPCUFPBQVPVPV-UHFFFAOYSA-N 0.000 description 2
- 238000000862 absorption spectrum Methods 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 229940054051 antipsychotic indole derivative Drugs 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- USIUVYZYUHIAEV-UHFFFAOYSA-N diphenyl ether Chemical compound C=1C=CC=CC=1OC1=CC=CC=C1 USIUVYZYUHIAEV-UHFFFAOYSA-N 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- XHKHRIWVSSVZIL-UHFFFAOYSA-N n-(2-benzoyl-4-nitrophenyl)-2,2,2-trichloroacetamide Chemical compound [O-][N+](=O)C1=CC=C(NC(=O)C(Cl)(Cl)Cl)C(C(=O)C=2C=CC=CC=2)=C1 XHKHRIWVSSVZIL-UHFFFAOYSA-N 0.000 description 2
- 150000007530 organic bases Chemical group 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 229960002895 phenylbutazone Drugs 0.000 description 2
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 description 2
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- ZUWXHHBROGLWNH-UHFFFAOYSA-N (2-amino-5-chlorophenyl)-phenylmethanone Chemical compound NC1=CC=C(Cl)C=C1C(=O)C1=CC=CC=C1 ZUWXHHBROGLWNH-UHFFFAOYSA-N 0.000 description 1
- PZPZDEIASIKHPY-UHFFFAOYSA-N (2-amino-5-nitrophenyl)-phenylmethanone Chemical compound NC1=CC=C([N+]([O-])=O)C=C1C(=O)C1=CC=CC=C1 PZPZDEIASIKHPY-UHFFFAOYSA-N 0.000 description 1
- HFVMEOPYDLEHBR-UHFFFAOYSA-N (2-fluorophenyl)-phenylmethanol Chemical compound C=1C=CC=C(F)C=1C(O)C1=CC=CC=C1 HFVMEOPYDLEHBR-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- PBPBRPFGQMBDGR-UHFFFAOYSA-N 1-(cyclopropylmethyl)-4-(4-methylphenyl)quinazolin-2-one Chemical compound C1=CC(C)=CC=C1C(C1=CC=CC=C11)=NC(=O)N1CC1CC1 PBPBRPFGQMBDGR-UHFFFAOYSA-N 0.000 description 1
- QGPVVLCQTQYYNJ-UHFFFAOYSA-N 1-(cyclopropylmethyl)-6-methyl-4-phenylquinazolin-2-one Chemical compound O=C1N=C(C=2C=CC=CC=2)C2=CC(C)=CC=C2N1CC1CC1 QGPVVLCQTQYYNJ-UHFFFAOYSA-N 0.000 description 1
- JISZFLNTQKRDRD-UHFFFAOYSA-N 1-(cyclopropylmethyl)-6-methylsulfanyl-4-phenylquinazolin-2-one Chemical compound O=C1N=C(C=2C=CC=CC=2)C2=CC(SC)=CC=C2N1CC1CC1 JISZFLNTQKRDRD-UHFFFAOYSA-N 0.000 description 1
- KVGXZOAVLQWIFK-UHFFFAOYSA-N 1-(cyclopropylmethyl)-6-methylsulfinyl-4-phenylquinazolin-2-one Chemical compound C1(CC1)CN1C(N=C(C2=CC(=CC=C12)S(=O)C)C1=CC=CC=C1)=O KVGXZOAVLQWIFK-UHFFFAOYSA-N 0.000 description 1
- OSCJNCWKJPGCKI-UHFFFAOYSA-N 1-(cyclopropylmethyl)-6-methylsulfonyl-4-phenylquinazolin-2-one Chemical compound O=C1N=C(C=2C=CC=CC=2)C2=CC(S(=O)(=O)C)=CC=C2N1CC1CC1 OSCJNCWKJPGCKI-UHFFFAOYSA-N 0.000 description 1
- UPQQXPKAYZYUKO-UHFFFAOYSA-N 2,2,2-trichloroacetamide Chemical class OC(=N)C(Cl)(Cl)Cl UPQQXPKAYZYUKO-UHFFFAOYSA-N 0.000 description 1
- DZRDSCHXFDYLLT-UHFFFAOYSA-N 2-(cyclopropylmethoxy)-4-phenylquinazoline Chemical compound C1(CC1)COC1=NC2=CC=CC=C2C(=N1)C1=CC=CC=C1 DZRDSCHXFDYLLT-UHFFFAOYSA-N 0.000 description 1
- DDWNCYJSEPGIBA-UHFFFAOYSA-N 2-(cyclopropylmethoxy)-6-fluoro-4-phenylquinazoline Chemical compound C1(CC1)COC1=NC2=CC=C(C=C2C(=N1)C1=CC=CC=C1)F DDWNCYJSEPGIBA-UHFFFAOYSA-N 0.000 description 1
- BEOSEWMATUFHLQ-UHFFFAOYSA-N 2-(cyclopropylmethoxy)-6-methoxy-4-phenylquinazoline Chemical compound C1(CC1)COC1=NC2=CC=C(C=C2C(=N1)C1=CC=CC=C1)OC BEOSEWMATUFHLQ-UHFFFAOYSA-N 0.000 description 1
- DIVJTLSXQPJPAK-UHFFFAOYSA-N 2-(cyclopropylmethoxy)-6-methyl-4-phenylquinazoline Chemical compound C1(CC1)COC1=NC2=CC=C(C=C2C(=N1)C1=CC=CC=C1)C DIVJTLSXQPJPAK-UHFFFAOYSA-N 0.000 description 1
- LMHOFGOSERGFOF-UHFFFAOYSA-N 2-(cyclopropylmethoxy)-6-nitro-4-phenylquinazoline Chemical compound C1(CC1)COC1=NC2=CC=C(C=C2C(=N1)C1=CC=CC=C1)[N+](=O)[O-] LMHOFGOSERGFOF-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- QISOBCMNUJQOJU-UHFFFAOYSA-N 4-bromo-1h-pyrazole-5-carboxylic acid Chemical compound OC(=O)C=1NN=CC=1Br QISOBCMNUJQOJU-UHFFFAOYSA-N 0.000 description 1
- UZFMOKQJFYMBGY-UHFFFAOYSA-N 4-hydroxy-TEMPO Chemical compound CC1(C)CC(O)CC(C)(C)N1[O] UZFMOKQJFYMBGY-UHFFFAOYSA-N 0.000 description 1
- FHUBTSLLILWICW-UHFFFAOYSA-N 4-phenyl-1h-quinazolin-2-one Chemical compound C12=CC=CC=C2NC(=O)N=C1C1=CC=CC=C1 FHUBTSLLILWICW-UHFFFAOYSA-N 0.000 description 1
- PMEYGNLXZWUKMC-UHFFFAOYSA-N 5-chloro-1-(cyclopropylmethyl)-3-phenylindole-2-carbonitrile Chemical compound C1(CC1)CN1C(=C(C2=CC(=CC=C12)Cl)C1=CC=CC=C1)C#N PMEYGNLXZWUKMC-UHFFFAOYSA-N 0.000 description 1
- GMHKIKWLDDUDHU-UHFFFAOYSA-N 5-chloro-1-(cyclopropylmethyl)-3-phenylindole-2-carboxylic acid Chemical compound C1(CC1)CN1C(=C(C2=CC(=CC=C12)Cl)C1=CC=CC=C1)C(=O)O GMHKIKWLDDUDHU-UHFFFAOYSA-N 0.000 description 1
- JZKIZUWKUMVDIP-UHFFFAOYSA-N 6,7-dichloro-4-phenyl-1H-quinazolin-2-one Chemical compound C1(=CC=CC=C1)C1=NC(NC2=CC(=C(C=C12)Cl)Cl)=O JZKIZUWKUMVDIP-UHFFFAOYSA-N 0.000 description 1
- GKSMPQBWGVIPAR-UHFFFAOYSA-N 6,8-dichloro-1-(cyclopropylmethyl)-4-phenylquinazolin-2-one Chemical compound O=C1N=C(C=2C=CC=CC=2)C2=CC(Cl)=CC(Cl)=C2N1CC1CC1 GKSMPQBWGVIPAR-UHFFFAOYSA-N 0.000 description 1
- VBLPVYUNPGIAJN-UHFFFAOYSA-N 6-bromo-1-(cyclopropylmethyl)-4-phenylquinazolin-2-one Chemical compound O=C1N=C(C=2C=CC=CC=2)C2=CC(Br)=CC=C2N1CC1CC1 VBLPVYUNPGIAJN-UHFFFAOYSA-N 0.000 description 1
- KOAIAIMGNGNDPT-UHFFFAOYSA-N 6-chloro-1-(1-cyclohexylethyl)-4-phenylquinazolin-2-one Chemical compound C12=CC=C(Cl)C=C2C(C=2C=CC=CC=2)=NC(=O)N1C(C)C1CCCCC1 KOAIAIMGNGNDPT-UHFFFAOYSA-N 0.000 description 1
- OELMMDOLCBRQCO-UHFFFAOYSA-N 6-chloro-1-(cyclopentylmethyl)-4-phenylquinazolin-2-one Chemical compound O=C1N=C(C=2C=CC=CC=2)C2=CC(Cl)=CC=C2N1CC1CCCC1 OELMMDOLCBRQCO-UHFFFAOYSA-N 0.000 description 1
- BNKCXNPOUSPLHT-UHFFFAOYSA-N 6-chloro-1-(cyclopropylmethyl)-4-phenylquinazoline-2-thione Chemical compound S=C1N=C(C=2C=CC=CC=2)C2=CC(Cl)=CC=C2N1CC1CC1 BNKCXNPOUSPLHT-UHFFFAOYSA-N 0.000 description 1
- MYAYNEHAOOHLGD-UHFFFAOYSA-N 6-chloro-2-(cyclobutylmethoxy)-4-phenylquinazoline Chemical compound C1(CCC1)COC1=NC2=CC=C(C=C2C(=N1)C1=CC=CC=C1)Cl MYAYNEHAOOHLGD-UHFFFAOYSA-N 0.000 description 1
- YZPIEQPAKXTKJO-UHFFFAOYSA-N 6-chloro-2-(cyclopropylmethoxy)-4-(2-fluorophenyl)quinazoline Chemical compound C1(CC1)COC1=NC2=CC=C(C=C2C(=N1)C1=C(C=CC=C1)F)Cl YZPIEQPAKXTKJO-UHFFFAOYSA-N 0.000 description 1
- PDVBMNDBLYNSIS-UHFFFAOYSA-N 6-chloro-4-phenylquinazoline Chemical compound C12=CC(Cl)=CC=C2N=CN=C1C1=CC=CC=C1 PDVBMNDBLYNSIS-UHFFFAOYSA-N 0.000 description 1
- QBCQYKDVGXOEDG-UHFFFAOYSA-N 6-fluoro-4-phenyl-1h-quinazolin-2-one Chemical compound C12=CC(F)=CC=C2NC(=O)N=C1C1=CC=CC=C1 QBCQYKDVGXOEDG-UHFFFAOYSA-N 0.000 description 1
- ULRSRGDZNASHQP-UHFFFAOYSA-N 6-methyl-4-phenyl-1h-quinazolin-2-one Chemical compound C12=CC(C)=CC=C2NC(=O)N=C1C1=CC=CC=C1 ULRSRGDZNASHQP-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- BMTAFVWTTFSTOG-UHFFFAOYSA-N Butylate Chemical group CCSC(=O)N(CC(C)C)CC(C)C BMTAFVWTTFSTOG-UHFFFAOYSA-N 0.000 description 1
- OOHHEVQUFINEDN-UHFFFAOYSA-N C1(CC1)CN1C(N=C(C2=CC(=CC(=C12)C)Cl)C1=CC=CC=C1)=O Chemical compound C1(CC1)CN1C(N=C(C2=CC(=CC(=C12)C)Cl)C1=CC=CC=C1)=O OOHHEVQUFINEDN-UHFFFAOYSA-N 0.000 description 1
- IIHJHUXSTHBVCK-UHFFFAOYSA-N CCOC(C(N(CC1CC1)C1=CC=C(C(F)(F)F)C=C11)=C1C1=CC=CC=C1)=O Chemical compound CCOC(C(N(CC1CC1)C1=CC=C(C(F)(F)F)C=C11)=C1C1=CC=CC=C1)=O IIHJHUXSTHBVCK-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Natural products OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 208000032843 Hemorrhage Diseases 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- RUHWKRONEGUEGW-UHFFFAOYSA-N N-(2-benzoyl-4-chlorophenyl)-1-cyano-N-(cyclopropylmethyl)formamide Chemical compound C1(CC1)CN(C1=C(C(=O)C2=CC=CC=C2)C=C(C=C1)Cl)C(=O)C#N RUHWKRONEGUEGW-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- XNPOFXIBHOVFFH-UHFFFAOYSA-N N-cyclohexyl-N'-(2-(4-morpholinyl)ethyl)carbodiimide Chemical compound C1CCCCC1N=C=NCCN1CCOCC1 XNPOFXIBHOVFFH-UHFFFAOYSA-N 0.000 description 1
- UJIYDRYNLWMQME-UHFFFAOYSA-N O=C1N=C(C(C=C2)=CC=C2F)C2=CC(Cl)=CC=C2N1CC1CC1 Chemical compound O=C1N=C(C(C=C2)=CC=C2F)C2=CC(Cl)=CC=C2N1CC1CC1 UJIYDRYNLWMQME-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- ORLBWHUNAXPZNT-UHFFFAOYSA-N [5-chloro-2-(2-cyclohexylethylamino)phenyl]-phenylmethanone Chemical compound C=1C=CC=CC=1C(=O)C1=CC(Cl)=CC=C1NCCC1CCCCC1 ORLBWHUNAXPZNT-UHFFFAOYSA-N 0.000 description 1
- AZTBMNWUFYUKAU-UHFFFAOYSA-N [5-chloro-2-(cyclohexylamino)phenyl]-phenylmethanone Chemical compound C=1C=CC=CC=1C(=O)C1=CC(Cl)=CC=C1NC1CCCCC1 AZTBMNWUFYUKAU-UHFFFAOYSA-N 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 150000008359 benzonitriles Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- FLHFTXCMKFVKRP-UHFFFAOYSA-N bromomethylcyclobutane Chemical compound BrCC1CCC1 FLHFTXCMKFVKRP-UHFFFAOYSA-N 0.000 description 1
- UUWSLBWDFJMSFP-UHFFFAOYSA-N bromomethylcyclohexane Chemical compound BrCC1CCCCC1 UUWSLBWDFJMSFP-UHFFFAOYSA-N 0.000 description 1
- XYZUWOHEILWUID-UHFFFAOYSA-N bromomethylcyclopentane Chemical compound BrCC1CCCC1 XYZUWOHEILWUID-UHFFFAOYSA-N 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 239000000679 carrageenan Substances 0.000 description 1
- 229940113118 carrageenan Drugs 0.000 description 1
- 235000010418 carrageenan Nutrition 0.000 description 1
- 229920001525 carrageenan Polymers 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 231100000085 chronic toxic effect Toxicity 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- NBPKRJBMUYIDPP-UHFFFAOYSA-N ethyl 2-[2-benzoyl-N-(cyclopropylmethyl)-4-(trifluoromethyl)anilino]-2-oxoacetate Chemical compound C1(CC1)CN(C1=C(C(=O)C2=CC=CC=C2)C=C(C=C1)C(F)(F)F)C(=O)C(=O)OCC NBPKRJBMUYIDPP-UHFFFAOYSA-N 0.000 description 1
- JMWSFMSTZWHBCS-UHFFFAOYSA-N ethyl 5-chloro-1-(cyclopropylmethyl)-3-phenylindole-2-carboxylate Chemical compound C1(CC1)CN1C(=C(C2=CC(=CC=C12)Cl)C1=CC=CC=C1)C(=O)OCC JMWSFMSTZWHBCS-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000003193 general anesthetic agent Substances 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 231100000566 intoxication Toxicity 0.000 description 1
- 230000035987 intoxication Effects 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- AFRJJFRNGGLMDW-UHFFFAOYSA-N lithium amide Chemical compound [Li+].[NH2-] AFRJJFRNGGLMDW-UHFFFAOYSA-N 0.000 description 1
- 229910000103 lithium hydride Inorganic materials 0.000 description 1
- SIAPCJWMELPYOE-UHFFFAOYSA-N lithium hydride Chemical compound [LiH] SIAPCJWMELPYOE-UHFFFAOYSA-N 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical class COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 1
- 125000006431 methyl cyclopropyl group Chemical group 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- YDNQWVQHOZJNLQ-UHFFFAOYSA-N n-(2-benzoyl-4-chlorophenyl)-2,2,2-trichloroacetamide Chemical compound ClC1=CC=C(NC(=O)C(Cl)(Cl)Cl)C(C(=O)C=2C=CC=CC=2)=C1 YDNQWVQHOZJNLQ-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 1
- 229940116357 potassium thiocyanate Drugs 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- VGTPCRGMBIAPIM-UHFFFAOYSA-M sodium thiocyanate Chemical compound [Na+].[S-]C#N VGTPCRGMBIAPIM-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 239000011593 sulfur Chemical group 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- VYGSFTVYZHNGBU-UHFFFAOYSA-N trichloromethanesulfonic acid Chemical compound OS(=O)(=O)C(Cl)(Cl)Cl VYGSFTVYZHNGBU-UHFFFAOYSA-N 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- UHVMMEOXYDMDKI-JKYCWFKZSA-L zinc;1-(5-cyanopyridin-2-yl)-3-[(1s,2s)-2-(6-fluoro-2-hydroxy-3-propanoylphenyl)cyclopropyl]urea;diacetate Chemical compound [Zn+2].CC([O-])=O.CC([O-])=O.CCC(=O)C1=CC=C(F)C([C@H]2[C@H](C2)NC(=O)NC=2N=CC(=CC=2)C#N)=C1O UHVMMEOXYDMDKI-JKYCWFKZSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/78—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 2
- C07D239/80—Oxygen atoms
- C07D239/82—Oxygen atoms with an aryl radical attached in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (9)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP6122269 | 1969-08-02 | ||
| JP6187269 | 1969-08-04 | ||
| JP7045369 | 1969-09-04 | ||
| JP9883669 | 1969-12-08 | ||
| JP9919669 | 1969-12-09 | ||
| JP10281069 | 1969-12-19 | ||
| JP653170A JPS5138714B1 (show.php) | 1970-01-23 | 1970-01-23 | |
| JP662870 | 1970-01-24 | ||
| JP1406970 | 1970-02-17 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL81273B1 true PL81273B1 (en) | 1975-08-30 |
Family
ID=27576527
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1970142437A PL81273B1 (en) | 1969-08-02 | 1970-08-01 | Quinazolinone derivatives[us3712892a] |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3712892A (show.php) |
| CH (3) | CH553190A (show.php) |
| DE (1) | DE2037693C3 (show.php) |
| DK (1) | DK127556B (show.php) |
| FI (1) | FI54301C (show.php) |
| FR (1) | FR2060075B1 (show.php) |
| GB (1) | GB1313789A (show.php) |
| IL (1) | IL35035A (show.php) |
| NL (1) | NL151704B (show.php) |
| NO (1) | NO128277B (show.php) |
| PL (1) | PL81273B1 (show.php) |
| YU (1) | YU3277A (show.php) |
Families Citing this family (29)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3929766A (en) * | 1967-03-30 | 1975-12-30 | Hoffmann La Roche | Novel 2{8 2-(1,3-diazacycloalk-2-enyl){9 benzophenone derivatives and novel 1,3-diazacycloalkenyl{8 2,1-A{9 isoindole derivatives |
| US3925359A (en) * | 1967-03-30 | 1975-12-09 | Hoffmann La Roche | Novel 2{8 2-(1,3-diazacycloalk-2-enyl){9 benzophenone derivatives and novel 1,3-diazacycloalkenyl{8 2,1-1{9 isoindole derivatives |
| DE2118315C3 (de) * | 1970-04-20 | 1975-04-03 | Sumitomo Chemical Co., Ltd., Osaka (Japan) | 2-(1H)-Chinazolinonderivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel |
| DK129348B (da) * | 1970-07-13 | 1974-09-30 | Sumitomo Chemical Co | Analogifremgangsmåde til fremstilling af 1-substituerede 3,4-dihydro-2(1H)-quinazolinonderivater. |
| DE2050640A1 (de) * | 1970-10-15 | 1972-04-20 | Cassella Farbwerke Mainkur Ag, 6000 Frankfurt | Basisch substituierte Derivate des (lH,3H)-Chinazolin-2-thion-4-ons |
| AU438472B2 (en) * | 1970-12-23 | 1973-08-09 | Sumitomo Chemical Company, Limited | Quinazolinone derivatives anda process for production thereof |
| DK135044B (da) * | 1971-05-06 | 1977-02-28 | Sandoz Ag | Analogifremgangsmåde til fremstilling af 4-phenyl- eller 4-(2'-thienyl)-6,7-methylendioxy-2(1H)-quinazolinoner eller -2(1H)-quinazolinthioner. |
| US4202895A (en) * | 1971-06-04 | 1980-05-13 | Sumitomo Chemical Company, Limited | 1-Polyhaloalkyl-2(1H)-quinazolinone derivatives |
| BE795519A (fr) * | 1972-02-18 | 1973-06-18 | Sumitomo Chemical Co | Procede de preparation d'un agent uricosurique |
| JPS5426556B2 (show.php) * | 1972-03-24 | 1979-09-04 | ||
| JPS5427356B2 (show.php) * | 1972-03-31 | 1979-09-10 | ||
| DE2225218C2 (de) * | 1972-05-24 | 1983-01-13 | Morishita Pharmaceutical Co., Ltd., Osaka | 2-Alkyl-4-äthoxy-5-morpholino-3(2H)-pyridazinone und Verfahren zu deren Herstellung |
| JPS5418269B2 (show.php) * | 1972-07-20 | 1979-07-06 | ||
| JPS5537554B2 (show.php) * | 1972-07-24 | 1980-09-29 | ||
| JPS555506B2 (show.php) * | 1972-09-07 | 1980-02-07 | ||
| US4067868A (en) * | 1973-04-17 | 1978-01-10 | Sumitomo Chemical Company, Limited | Production of quinazolinone compounds |
| US3927011A (en) * | 1973-05-10 | 1975-12-16 | Yoshitomi Pharmaceutical | 2-Aminoalkyl-1-(pyridylcarbonylphenyl)imidazole compounds |
| JPS5724789B2 (show.php) * | 1973-08-14 | 1982-05-26 | ||
| JPS5046680A (show.php) * | 1973-08-20 | 1975-04-25 | ||
| GB1494340A (en) * | 1974-12-03 | 1977-12-07 | Wyeth John & Brother Ltd | Process for preparation of substituted n-phenylcarbamate esters |
| JPS521036A (en) | 1975-06-23 | 1977-01-06 | Sumitomo Chem Co Ltd | Antiphlogistic with extremely low reaction to digestive canals |
| US4247554A (en) * | 1977-05-11 | 1981-01-27 | Sumitomo Chemical Company, Limited | Method for the prevention of gastro-intestinal ulcer caused by a non-steroidal anti-inflammatory agent |
| AR038658A1 (es) * | 2001-06-15 | 2005-01-26 | Novartis Ag | Derivados de 4-aril-2(1h) quinazolinona y 4-aril-quinazolina 2-sustituidas, un proceso para su preparacion, composiciones farmaceuticas y el uso de dichos derivados para la preparacion de un medicamento |
| GB0230015D0 (en) | 2002-12-23 | 2003-01-29 | Novartis Ag | Organic compounds |
| JP2007510642A (ja) * | 2003-11-03 | 2007-04-26 | ワーナー−ランバート カンパニー リミテッド ライアビリティー カンパニー | 中枢神経系障害の治療のための新規ノルエピネフリン再取込み阻害薬 |
| US20070111906A1 (en) * | 2005-11-12 | 2007-05-17 | Milner Jeffrey L | Relatively low viscosity transmission fluids |
| US7682491B2 (en) * | 2007-03-26 | 2010-03-23 | Nalco Company | Antifoulant for hydrocarbon processing equipment |
| BR112022022338A2 (pt) | 2020-05-04 | 2023-01-10 | Amgen Inc | Compostos heterocíclicos como receptor desencadeador expresso em agonistas de células mieloides 2 e métodos de uso |
| TW202208355A (zh) | 2020-05-04 | 2022-03-01 | 美商安進公司 | 作為骨髓細胞觸發受體2促效劑之雜環化合物及使用方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RO56665A (show.php) * | 1968-07-01 | 1974-06-01 |
-
1970
- 1970-07-29 DE DE2037693A patent/DE2037693C3/de not_active Expired
- 1970-07-29 US US00059337A patent/US3712892A/en not_active Expired - Lifetime
- 1970-07-31 IL IL35035A patent/IL35035A/xx unknown
- 1970-07-31 CH CH1200473A patent/CH553190A/xx not_active IP Right Cessation
- 1970-07-31 FI FI2123/70A patent/FI54301C/fi active
- 1970-07-31 FR FR7028417*A patent/FR2060075B1/fr not_active Expired
- 1970-07-31 NL NL707011359A patent/NL151704B/xx not_active IP Right Cessation
- 1970-07-31 CH CH1200373A patent/CH553791A/xx not_active IP Right Cessation
- 1970-07-31 CH CH1160370A patent/CH554877A/xx not_active IP Right Cessation
- 1970-07-31 GB GB3716770A patent/GB1313789A/en not_active Expired
- 1970-07-31 DK DK397770AA patent/DK127556B/da not_active IP Right Cessation
- 1970-08-01 PL PL1970142437A patent/PL81273B1/pl unknown
- 1970-08-01 NO NO02977/70A patent/NO128277B/no unknown
-
1977
- 1977-01-06 YU YU00032/77A patent/YU3277A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL7011359A (show.php) | 1971-02-04 |
| GB1313789A (en) | 1973-04-18 |
| DK127556B (da) | 1973-11-26 |
| CH553190A (de) | 1974-08-30 |
| NL151704B (nl) | 1976-12-15 |
| CH554877A (de) | 1974-10-15 |
| DE2037693B2 (de) | 1974-05-22 |
| NO128277B (show.php) | 1973-10-22 |
| IL35035A0 (en) | 1970-09-17 |
| DE2037693C3 (de) | 1975-01-16 |
| YU3277A (en) | 1982-06-30 |
| FI54301C (fi) | 1978-11-10 |
| DE2037693A1 (de) | 1971-02-25 |
| FR2060075A1 (show.php) | 1971-06-11 |
| CH553791A (de) | 1974-09-13 |
| FR2060075B1 (show.php) | 1974-08-30 |
| FI54301B (fi) | 1978-07-31 |
| IL35035A (en) | 1973-01-30 |
| US3712892A (en) | 1973-01-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL81273B1 (en) | Quinazolinone derivatives[us3712892a] | |
| US4822805A (en) | Pyridyl-imidazole compounds which have useful pharmaceutical activity | |
| US5470867A (en) | Imidazoles and their salts having antagonistic activity to angiotesin II recetors | |
| EP0004279B1 (de) | Verfahren zur Herstellung von 4-Pyridon-3-carbonsäuren, 1-Cyclopropyl-4-Pyridon-3-Carbonsäurederivate und diese enthaltende Arzneimittel | |
| CA1107286A (en) | Anti-inflammatory 1-substituted-4,5-diaryl-2- (substituted-thio) imidazoles and their corresponding sulfoxides and sulfones | |
| PT94568B (pt) | Quinazolinonas substituidas como antagonistas da angiotensina ii | |
| EP0028834A1 (en) | Imidazole-5-acetic acid derivatives, their production and use | |
| CH679397A5 (show.php) | ||
| US4782055A (en) | Imidazopyridine compounds useful in the treatment of ulcers | |
| US3621025A (en) | Imidazo and pyrimido{8 2,1-{11 {9 quinazoline compounds | |
| DE2323149C3 (de) | Thienopyrimidine, Verfahren zu deren Herstellung und diese Verbindungen enthaltende Arzneipräparate | |
| US4914104A (en) | Imidazo [1,5-a]pyrimidine derivatives and process for their preparation | |
| US4202895A (en) | 1-Polyhaloalkyl-2(1H)-quinazolinone derivatives | |
| DE3146599A1 (de) | Neue triazolochinazoline, verfahren zu ihrer herstellung und diese enthaltende pharmazeutische zubereitungen | |
| Yamamoto et al. | Synthetic studies on quinazoline derivatives. II.: the reactions of 2-trichloro-and 2-trifluoroacetamidobenzophenones with primary amines | |
| US3767797A (en) | Novel quinazolinone derivatives as antiinflammatory and analgesic agents | |
| Vega et al. | Thiophene isosteres: synthesis and pharmacological study of 3-(azol-1-yl) thieno isothiazole-1, 1-dioxides | |
| US3859237A (en) | Quinazoline derivatives | |
| US3950526A (en) | Quinazoline derivatives in pharmaceutical compositions for treating pain and inflammation | |
| CH625231A5 (show.php) | ||
| US3895395A (en) | Quinazoline compounds | |
| PL91618B1 (show.php) | ||
| CH498857A (de) | Verfahren zur Herstellung von neuen Furazanderivaten | |
| US3923803A (en) | 2(1H)-Quinozalinones and process therefor | |
| US3991191A (en) | Antiprotozoal (1-alkyl-5-nitro-imidazolyl-2-alkyl)-pyrimidines |