PL81223B1 - - Google Patents
Download PDFInfo
- Publication number
- PL81223B1 PL81223B1 PL1970144588A PL14458870A PL81223B1 PL 81223 B1 PL81223 B1 PL 81223B1 PL 1970144588 A PL1970144588 A PL 1970144588A PL 14458870 A PL14458870 A PL 14458870A PL 81223 B1 PL81223 B1 PL 81223B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- group
- acid
- compound
- compounds
- Prior art date
Links
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 78
- 150000001875 compounds Chemical class 0.000 claims description 50
- 238000000034 method Methods 0.000 claims description 40
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 36
- -1 5- (1H) -tetrazolyl group Chemical group 0.000 claims description 32
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 29
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 19
- 238000002360 preparation method Methods 0.000 claims description 17
- 150000002825 nitriles Chemical class 0.000 claims description 16
- 238000006243 chemical reaction Methods 0.000 claims description 12
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 claims description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 10
- 229920000137 polyphosphoric acid Polymers 0.000 claims description 10
- 229910052740 iodine Inorganic materials 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 8
- 229910021595 Copper(I) iodide Inorganic materials 0.000 claims description 8
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 claims description 8
- 238000010438 heat treatment Methods 0.000 claims description 8
- 125000002560 nitrile group Chemical group 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- JNELGWHKGNBSMD-UHFFFAOYSA-N xanthone Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3OC2=C1 JNELGWHKGNBSMD-UHFFFAOYSA-N 0.000 claims description 8
- 150000007964 xanthones Chemical class 0.000 claims description 8
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- 230000007062 hydrolysis Effects 0.000 claims description 6
- 238000006460 hydrolysis reaction Methods 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- 238000007363 ring formation reaction Methods 0.000 claims description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 claims description 3
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 239000012312 sodium hydride Substances 0.000 claims description 3
- 229910000104 sodium hydride Inorganic materials 0.000 claims description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 125000003282 alkyl amino group Chemical group 0.000 claims description 2
- 230000029936 alkylation Effects 0.000 claims description 2
- 238000005804 alkylation reaction Methods 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 230000009467 reduction Effects 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims 3
- 239000001257 hydrogen Substances 0.000 claims 3
- 238000009833 condensation Methods 0.000 claims 2
- 230000005494 condensation Effects 0.000 claims 2
- 239000007858 starting material Substances 0.000 claims 2
- 150000001350 alkyl halides Chemical class 0.000 claims 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- 239000000758 substrate Substances 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 102
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 74
- 239000002253 acid Substances 0.000 description 68
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 58
- 239000000243 solution Substances 0.000 description 45
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 40
- 239000002244 precipitate Substances 0.000 description 35
- 239000000203 mixture Substances 0.000 description 33
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 30
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 27
- 229960000583 acetic acid Drugs 0.000 description 22
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 20
- 238000002844 melting Methods 0.000 description 19
- 230000008018 melting Effects 0.000 description 19
- 238000001953 recrystallisation Methods 0.000 description 19
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 14
- 239000007787 solid Substances 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- 238000010992 reflux Methods 0.000 description 12
- 239000000047 product Substances 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 10
- 229910000027 potassium carbonate Inorganic materials 0.000 description 10
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 8
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 8
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 8
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- 229910052708 sodium Inorganic materials 0.000 description 8
- 239000012362 glacial acetic acid Substances 0.000 description 7
- 239000000155 melt Substances 0.000 description 7
- 229910000029 sodium carbonate Inorganic materials 0.000 description 7
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 6
- 150000001408 amides Chemical class 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 6
- 239000000284 extract Substances 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- 239000008096 xylene Substances 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 5
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 5
- 159000000000 sodium salts Chemical class 0.000 description 5
- CVNOWLNNPYYEOH-UHFFFAOYSA-N 4-cyanophenol Chemical compound OC1=CC=C(C#N)C=C1 CVNOWLNNPYYEOH-UHFFFAOYSA-N 0.000 description 4
- 239000005711 Benzoic acid Substances 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 4
- 235000019270 ammonium chloride Nutrition 0.000 description 4
- 239000000427 antigen Substances 0.000 description 4
- 102000036639 antigens Human genes 0.000 description 4
- 108091007433 antigens Proteins 0.000 description 4
- 235000010233 benzoic acid Nutrition 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 150000004702 methyl esters Chemical class 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 3
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 3
- 229910000906 Bronze Inorganic materials 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 125000003368 amide group Chemical group 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 239000010974 bronze Substances 0.000 description 3
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 3
- 125000004494 ethyl ester group Chemical group 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000012265 solid product Substances 0.000 description 3
- 239000001119 stannous chloride Substances 0.000 description 3
- 235000011150 stannous chloride Nutrition 0.000 description 3
- ATJQWMBNMAOYDQ-UHFFFAOYSA-N 2-(2-methoxyphenoxy)-5-methylbenzoic acid Chemical compound COC1=CC=CC=C1OC1=CC=C(C)C=C1C(O)=O ATJQWMBNMAOYDQ-UHFFFAOYSA-N 0.000 description 2
- AZWVHAYEMGWPMK-UHFFFAOYSA-N 2-(4-methylphenoxy)-5-nitrobenzoic acid Chemical compound C1=CC(C)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1C(O)=O AZWVHAYEMGWPMK-UHFFFAOYSA-N 0.000 description 2
- WDHCRWZNSBIWKL-UHFFFAOYSA-N 2-chloro-4-methoxy-5-nitrobenzoic acid Chemical compound COC1=CC(Cl)=C(C(O)=O)C=C1[N+]([O-])=O WDHCRWZNSBIWKL-UHFFFAOYSA-N 0.000 description 2
- LEBWXJZAWTVKFL-UHFFFAOYSA-N 2-chloro-5-methylbenzoic acid Chemical compound CC1=CC=C(Cl)C(C(O)=O)=C1 LEBWXJZAWTVKFL-UHFFFAOYSA-N 0.000 description 2
- QUEKGYQTRJVEQC-UHFFFAOYSA-N 2516-96-3 Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1Cl QUEKGYQTRJVEQC-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 2
- 241000700159 Rattus Species 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- 229960002887 deanol Drugs 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 2
- LHGVFZTZFXWLCP-UHFFFAOYSA-N guaiacol Chemical compound COC1=CC=CC=C1O LHGVFZTZFXWLCP-UHFFFAOYSA-N 0.000 description 2
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 150000003141 primary amines Chemical class 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 230000003033 spasmogenic effect Effects 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 150000003536 tetrazoles Chemical class 0.000 description 2
- HPGGPRDJHPYFRM-UHFFFAOYSA-J tin(iv) chloride Chemical compound Cl[Sn](Cl)(Cl)Cl HPGGPRDJHPYFRM-UHFFFAOYSA-J 0.000 description 2
- YCIHPQHVWDULOY-FMZCEJRJSA-N (4s,4as,5as,6s,12ar)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride Chemical compound Cl.C1=CC=C2[C@](O)(C)[C@H]3C[C@H]4[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C3=C(O)C2=C1O YCIHPQHVWDULOY-FMZCEJRJSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- LMZMQXGQDGYBIS-UHFFFAOYSA-N 1-nitroxanthen-9-one Chemical compound O1C2=CC=CC=C2C(=O)C2=C1C=CC=C2[N+](=O)[O-] LMZMQXGQDGYBIS-UHFFFAOYSA-N 0.000 description 1
- QVTQYSFCFOGITD-UHFFFAOYSA-N 2,5-dichlorobenzoic acid Chemical compound OC(=O)C1=CC(Cl)=CC=C1Cl QVTQYSFCFOGITD-UHFFFAOYSA-N 0.000 description 1
- OEJYXLGGLKTIQG-UHFFFAOYSA-N 2-(4-cyanophenoxy)-4-nitrobenzoic acid Chemical compound OC(=O)C1=CC=C([N+]([O-])=O)C=C1OC1=CC=C(C#N)C=C1 OEJYXLGGLKTIQG-UHFFFAOYSA-N 0.000 description 1
- GEVAPOOKLDQPPR-UHFFFAOYSA-N 2-(4-cyanophenoxy)-5-methoxybenzoic acid Chemical compound OC(=O)C1=CC(OC)=CC=C1OC1=CC=C(C#N)C=C1 GEVAPOOKLDQPPR-UHFFFAOYSA-N 0.000 description 1
- WGBQSDWPKNFOHJ-UHFFFAOYSA-N 2-(4-cyanophenoxy)-5-nitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=CC=C1OC1=CC=C(C#N)C=C1 WGBQSDWPKNFOHJ-UHFFFAOYSA-N 0.000 description 1
- QRZWQIKFHYAHFP-UHFFFAOYSA-N 2-(4-methoxyphenoxy)-5-nitrobenzoic acid Chemical compound C1=CC(OC)=CC=C1OC1=CC=C([N+]([O-])=O)C=C1C(O)=O QRZWQIKFHYAHFP-UHFFFAOYSA-N 0.000 description 1
- QHOHOOCXVFEPQA-UHFFFAOYSA-N 2-amino-7-methoxyxanthen-9-one Chemical compound COC1=CC=C2OC=3C=CC(=CC3C(C2=C1)=O)N QHOHOOCXVFEPQA-UHFFFAOYSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- 125000003635 2-dimethylaminoethoxy group Chemical group [H]C([H])([H])N(C([H])([H])[H])C([H])([H])C([H])([H])O* 0.000 description 1
- CHZCERSEMVWNHL-UHFFFAOYSA-N 2-hydroxybenzonitrile Chemical compound OC1=CC=CC=C1C#N CHZCERSEMVWNHL-UHFFFAOYSA-N 0.000 description 1
- 125000005975 2-phenylethyloxy group Chemical group 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- 125000001137 3-hydroxypropoxy group Chemical group [H]OC([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- MGQHZZZXJQJBQY-UHFFFAOYSA-N 4-(2-methoxyphenoxy)benzene-1,3-dicarboxylic acid Chemical compound COC1=C(OC2=C(C=C(C(=O)O)C=C2)C(=O)O)C=CC=C1 MGQHZZZXJQJBQY-UHFFFAOYSA-N 0.000 description 1
- ANXBDAFDZSXOPQ-UHFFFAOYSA-N 4-methoxy-3-nitrobenzoic acid Chemical compound COC1=CC=C(C(O)=O)C=C1[N+]([O-])=O ANXBDAFDZSXOPQ-UHFFFAOYSA-N 0.000 description 1
- NQZZMMVWNJYZIE-UHFFFAOYSA-N 6,7-dimethoxy-9-oxoxanthene-2-carboxylic acid Chemical compound O1C2=CC=C(C(O)=O)C=C2C(=O)C2=C1C=C(OC)C(OC)=C2 NQZZMMVWNJYZIE-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QAYNSPOKTRVZRC-UHFFFAOYSA-N 99-60-5 Chemical compound OC(=O)C1=CC=C([N+]([O-])=O)C=C1Cl QAYNSPOKTRVZRC-UHFFFAOYSA-N 0.000 description 1
- 206010002198 Anaphylactic reaction Diseases 0.000 description 1
- 208000019901 Anxiety disease Diseases 0.000 description 1
- 206010003645 Atopy Diseases 0.000 description 1
- IVRMZWNICZWHMI-UHFFFAOYSA-N Azide Chemical compound [N-]=[N+]=[N-] IVRMZWNICZWHMI-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- RZZPDXZPRHQOCG-OJAKKHQRSA-O CDP-choline(1+) Chemical compound O[C@@H]1[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OCC[N+](C)(C)C)O[C@H]1N1C(=O)N=C(N)C=C1 RZZPDXZPRHQOCG-OJAKKHQRSA-O 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 201000004624 Dermatitis Diseases 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- 229910021627 Tin(IV) chloride Inorganic materials 0.000 description 1
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 1
- 208000024780 Urticaria Diseases 0.000 description 1
- 241001461246 Viridiraptoridae Species 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000004703 alkoxides Chemical group 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 201000009961 allergic asthma Diseases 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 230000036783 anaphylactic response Effects 0.000 description 1
- 208000003455 anaphylaxis Diseases 0.000 description 1
- 230000003266 anti-allergic effect Effects 0.000 description 1
- 230000036506 anxiety Effects 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229940124630 bronchodilator Drugs 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229910000423 chromium oxide Inorganic materials 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 229960001867 guaiacol Drugs 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- YWOITFUKFOYODT-UHFFFAOYSA-N methanol;sodium Chemical compound [Na].OC YWOITFUKFOYODT-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- HTSUNNKYWHVURG-UHFFFAOYSA-N methyl 7-amino-9-oxoxanthene-2-carboxylate Chemical compound COC(=O)C1=CC=2C(C3=CC(=CC=C3OC2C=C1)N)=O HTSUNNKYWHVURG-UHFFFAOYSA-N 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 150000002780 morpholines Chemical class 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- LAIZPRYFQUWUBN-UHFFFAOYSA-L nickel chloride hexahydrate Chemical compound O.O.O.O.O.O.[Cl-].[Cl-].[Ni+2] LAIZPRYFQUWUBN-UHFFFAOYSA-L 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- NWVVVBRKAWDGAB-UHFFFAOYSA-N p-methoxyphenol Chemical compound COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- SSOLNOMRVKKSON-UHFFFAOYSA-N proguanil Chemical compound CC(C)\N=C(/N)N=C(N)NC1=CC=C(Cl)C=C1 SSOLNOMRVKKSON-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- PAYGMRRPBHYIMA-UHFFFAOYSA-N sodium;trihydrate Chemical compound O.O.O.[Na] PAYGMRRPBHYIMA-UHFFFAOYSA-N 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 235000013547 stew Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 238000009966 trimming Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/78—Ring systems having three or more relevant rings
- C07D311/80—Dibenzopyrans; Hydrogenated dibenzopyrans
- C07D311/82—Xanthenes
- C07D311/84—Xanthenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 9
- C07D311/86—Oxygen atoms, e.g. xanthones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5812169 | 1969-11-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL81223B1 true PL81223B1 (forum.php) | 1975-08-30 |
Family
ID=10480814
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1970144588A PL81223B1 (forum.php) | 1969-11-27 | 1970-11-23 |
Country Status (21)
| Country | Link |
|---|---|
| US (2) | US3706768A (forum.php) |
| AT (1) | AT304547B (forum.php) |
| BE (1) | BE759292A (forum.php) |
| CA (1) | CA930743A (forum.php) |
| CH (1) | CH557347A (forum.php) |
| CS (1) | CS172918B4 (forum.php) |
| DE (1) | DE2058295C3 (forum.php) |
| DK (1) | DK130740B (forum.php) |
| ES (1) | ES385927A1 (forum.php) |
| FI (1) | FI56005C (forum.php) |
| FR (1) | FR2073425B1 (forum.php) |
| GB (1) | GB1312620A (forum.php) |
| HU (1) | HU162579B (forum.php) |
| IE (1) | IE34720B1 (forum.php) |
| IL (1) | IL35668A (forum.php) |
| NL (1) | NL7017336A (forum.php) |
| NO (1) | NO133367C (forum.php) |
| PH (1) | PH11097A (forum.php) |
| PL (1) | PL81223B1 (forum.php) |
| SE (1) | SE382459B (forum.php) |
| ZA (1) | ZA707727B (forum.php) |
Families Citing this family (67)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1362782A (en) * | 1970-08-26 | 1974-08-07 | Fisons Ltd | Tetrazole derivatives |
| US4064256A (en) * | 1970-08-26 | 1977-12-20 | Fisons Limited | Benzopyranyltetrazoles as antiasthma agents |
| US3873714A (en) * | 1971-07-14 | 1975-03-25 | Syntex Inc | Xanthone carboxylic acids and derivatives |
| US3818042A (en) * | 1972-01-12 | 1974-06-18 | Syntex Inc | Xanthone carboxylic acids and derivatives |
| GB1389827A (en) * | 1971-07-23 | 1975-04-09 | Fisons Ltd | Tetrazolyl benzopyrans |
| US3879411A (en) * | 1971-07-23 | 1975-04-22 | Fisons Ltd | Ditetrazolyl-benzodipyrans |
| US3859442A (en) * | 1971-08-23 | 1975-01-07 | Syntex Inc | A method of inhibiting symptoms of asthma |
| US3867407A (en) * | 1971-08-23 | 1975-02-18 | Jurg R Pfister | Substituted xanthone carboxylic acid compounds |
| US3885038A (en) * | 1971-08-23 | 1975-05-20 | Syntex Inc | Method of using substituted xanthone carboxylic acid |
| BE787843A (fr) * | 1971-08-23 | 1973-02-22 | Syntex Corp | Nouveaux composes d'acides xanthone-carboxyliques substitues |
| US4061768A (en) * | 1971-09-08 | 1977-12-06 | Burroughs Wellcome Co. | Certain cyclic carbonyl compounds used in the prophylaxis of allergic conditions |
| US3950342A (en) * | 1971-09-08 | 1976-04-13 | Burroughs Wellcome Co. | Acridone-dicarboxylic acids |
| US3959482A (en) * | 1971-09-08 | 1976-05-25 | Burroughs Wellcome Co. | Fluorenone carboxylic acids for the prevention of the symptoms of asthma and allergin rhinitis |
| BE789822A (fr) * | 1971-10-08 | 1973-04-06 | Allen & Hanburys Ltd | Nouveaux composes heterocycliques |
| BE793749A (fr) * | 1972-01-12 | 1973-07-09 | Syntex Corp | Nouveaux composes d'acides xanthone-carboxyliques disubstitues |
| CA967581A (en) * | 1972-01-12 | 1975-05-13 | Syntex Corporation | Preparation of xanthone-2-carboxylic acid compounds |
| US3886181A (en) * | 1972-01-12 | 1975-05-27 | Syntex Inc | Disubstituted xanthone carboxylic acid compounds |
| BE793751A (fr) * | 1972-01-12 | 1973-07-09 | Syntex Corp | Nouveaux composes d'acides xanthone-carboxyliques disubstitues |
| US3894049A (en) * | 1972-06-05 | 1975-07-08 | Syntex Inc | Disubstituted xanthone carboxylic acid compounds |
| US4250182A (en) * | 1972-02-24 | 1981-02-10 | Burroughs Wellcome Co. | Pharmaceutical composition containing acridone compounds and method of using same |
| US3949084A (en) * | 1972-03-03 | 1976-04-06 | Syntex (U.S.A.) Inc. | Novel substituted xanthone carboxylic acid compounds |
| US3928379A (en) * | 1972-03-03 | 1975-12-23 | Mead Johnson & Co | N-phenyl amidines |
| US3835157A (en) * | 1972-05-17 | 1974-09-10 | Syntex Inc | Heterocyclic substituted xanthone carboxylic acid compounds |
| US3835158A (en) * | 1972-05-17 | 1974-09-10 | Syntex Inc | Heterocyclic substituted xanthone carboxylic acid compounds |
| US4012499A (en) * | 1972-05-19 | 1977-03-15 | Burroughs Wellcome Co. | Cyclic sulphur compounds |
| GB1447031A (en) * | 1972-05-19 | 1976-08-25 | Wellcome Found | Tricyclic sulphones and pharmaceutical compositions containing them |
| US3910957A (en) * | 1972-06-05 | 1975-10-07 | Syntex Inc | Xanthone carboxylic acids and derivatives |
| BE793954A (fr) * | 1972-07-19 | 1973-07-12 | Syntex Corp | Acides thioxanthone-carboxyliques et leurs derives |
| US3835139A (en) * | 1972-07-19 | 1974-09-10 | Syntex Inc | N-substituted acridone carboxylic acids and derivatives |
| US4127573A (en) * | 1972-09-06 | 1978-11-28 | Burroughs Wellcome Co. | Ditetrazole substituted acridone compounds |
| US4039556A (en) * | 1972-09-06 | 1977-08-02 | Burroughs Wellcome Co. | Substituted carbonyl compounds |
| US4094968A (en) * | 1972-09-06 | 1978-06-13 | Burroughs Wellcome Co. | Treatment for allergy and method of composition thereof |
| US4025635A (en) * | 1972-09-06 | 1977-05-24 | Burroughs Wellcome Co. | Cyclic sulphur compounds |
| GB1452891A (en) * | 1972-09-06 | 1976-10-20 | Wellcome Found | Tricyclic tetrazole derivatives their synthesis and compositions containing them |
| US3939276A (en) * | 1972-09-07 | 1976-02-17 | Burroughs Wellcome Co. | Cyclic carbonyl compounds |
| BE793864A (fr) * | 1972-09-25 | 1973-07-10 | Syntex Corp | Derives d'acide xanthone-carboxylique substitues par un groupement ether non sature |
| BE793865A (fr) * | 1972-09-25 | 1973-07-10 | Syntex Corp | Composes d'acides xanthone-carboxyliques substitues par des groupes alcenyles et alcynyles |
| US3919211A (en) * | 1973-02-12 | 1975-11-11 | American Home Prod | 9-Oxoxanthene-N,N{40 -bis(substituted)-2,7-disulfonamides |
| NL7403583A (forum.php) * | 1973-03-19 | 1974-09-23 | ||
| US3963752A (en) * | 1974-01-08 | 1976-06-15 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3965115A (en) * | 1974-01-08 | 1976-06-22 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3963753A (en) * | 1974-01-08 | 1976-06-15 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US4107172A (en) * | 1974-03-01 | 1978-08-15 | Abbott Laboratories | Uricosuric diuretic composition |
| US3951618A (en) * | 1974-03-12 | 1976-04-20 | Syntex (U.S.A.) Inc. | Method of use of, and compositions containing, disubstituted xanthone carboxylic acid compounds |
| JPS5516432B2 (forum.php) * | 1974-05-28 | 1980-05-01 | ||
| US3920826A (en) * | 1974-07-01 | 1975-11-18 | American Home Prod | Method of treating antiarrhythmic activity with bis(2-(dialkylamino)ethoxy)xanthen-9-one antiarrhythmic agents |
| US3989721A (en) * | 1975-03-13 | 1976-11-02 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3989720A (en) * | 1975-03-13 | 1976-11-02 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3979414A (en) * | 1975-03-13 | 1976-09-07 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3988352A (en) * | 1975-03-13 | 1976-10-26 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US4035368A (en) * | 1975-04-02 | 1977-07-12 | Riker Laboratories, Inc. | Substituted 3-(1H-tetrazol-5-yl)-quinoline compounds |
| US4103015A (en) * | 1975-06-12 | 1978-07-25 | Burroughs Wellcome Co. | Antiallergic cyclic sulphur compounds |
| US4007205A (en) * | 1976-03-16 | 1977-02-08 | Warner-Lambert Company | 7-Substituted-9-oxoxanthene-2-carboxaldehydes |
| US4221800A (en) * | 1977-12-23 | 1980-09-09 | Miles Laboratories, Inc. | Cycloalkenochromone |
| US4232040A (en) * | 1978-03-08 | 1980-11-04 | Syntex (U.S.A.) Inc. | Compositions for and a method of preventing diabetic complications |
| US4217361A (en) * | 1978-05-22 | 1980-08-12 | Syntex (U.S.A.) Inc. | Disubstituted xanthone-2-carboxylic acid antiallergy agents |
| US4282365A (en) * | 1978-11-24 | 1981-08-04 | Merck & Co., Inc. | Dibenz[b,e]oxepin compounds |
| JPS5576873A (en) * | 1978-11-30 | 1980-06-10 | Kaken Pharmaceut Co Ltd | Coumarin derivative, its preparation, and antiallergic drugs containing it as active constituent |
| SE441449B (sv) * | 1979-02-09 | 1985-10-07 | Roussel Uclaf | Heterocykliska derivat och farmaceutiska kompositioner innehallande dessa derivat |
| FR2492372A1 (fr) * | 1980-10-21 | 1982-04-23 | Cird | Dihydroxy-1,8 anthrones-9 substituees en position 10 et leur utilisation en medecine humaine ou veterinaire et en cosmetique |
| EP0093381B1 (en) * | 1982-04-27 | 1986-07-23 | The Wellcome Foundation Limited | Tricyclic compounds, preparation, use and intermediates |
| US4544557A (en) * | 1982-07-29 | 1985-10-01 | Merck & Co., Inc. | 6-(1-Hydroxyethyl)-2-(2-aminoethylthio)-3-tetrazoly-1-carbadethiapen-2-em |
| GB8328495D0 (en) * | 1983-10-25 | 1983-11-23 | Wellcome Found | Pharmacologically active ketones |
| EP0430881A3 (en) * | 1989-11-29 | 1991-10-23 | Ciba-Geigy Ag | Photochromic compounds, process for their preparation and their use |
| CN102180858A (zh) * | 2011-04-08 | 2011-09-14 | 华东师范大学 | 一取代或二取代呫吨酮化合物及合成方法 |
| CN110139852A (zh) | 2016-11-04 | 2019-08-16 | 奥克兰联合服务有限公司 | 三环杂环衍生物及其用途 |
| US11970505B1 (en) | 2023-11-07 | 2024-04-30 | King Faisal University | Pyridino-2,16-dioxapentacyclo[7.7.5.01,21.03,8.010,15]henicosa3(8),10,12,14-tetraene-7,20-dione as an antimicrobial compound |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB708917A (en) * | 1951-01-29 | 1954-05-12 | Ward Blenkinsop & Co Ltd | Xanthones and process for the production thereof |
| FR1417961A (fr) * | 1961-01-19 | 1965-11-19 | Cassella Farbwerke Mainkur Ag | Procédé de préparation de dérivés d'hydroxy-xanthones |
-
0
- BE BE759292D patent/BE759292A/xx unknown
-
1969
- 1969-11-27 GB GB5812169A patent/GB1312620A/en not_active Expired
-
1970
- 1970-11-12 IE IE1448/70A patent/IE34720B1/xx unknown
- 1970-11-16 IL IL35668A patent/IL35668A/xx unknown
- 1970-11-16 ZA ZA707727A patent/ZA707727B/xx unknown
- 1970-11-16 AT AT1028170A patent/AT304547B/de not_active IP Right Cessation
- 1970-11-17 US US90444A patent/US3706768A/en not_active Expired - Lifetime
- 1970-11-18 FI FI3099/70A patent/FI56005C/fi active
- 1970-11-19 CA CA098544A patent/CA930743A/en not_active Expired
- 1970-11-23 PL PL1970144588A patent/PL81223B1/pl unknown
- 1970-11-25 CS CS7950A patent/CS172918B4/cs unknown
- 1970-11-26 PH PH11987A patent/PH11097A/en unknown
- 1970-11-26 ES ES385927A patent/ES385927A1/es not_active Expired
- 1970-11-26 NO NO4538/70A patent/NO133367C/no unknown
- 1970-11-26 DE DE2058295A patent/DE2058295C3/de not_active Expired
- 1970-11-26 NL NL7017336A patent/NL7017336A/xx not_active Application Discontinuation
- 1970-11-26 SE SE7016049A patent/SE382459B/xx unknown
- 1970-11-27 HU HUHA902A patent/HU162579B/hu unknown
- 1970-11-27 DK DK607370AA patent/DK130740B/da unknown
- 1970-11-27 CH CH1760070A patent/CH557347A/xx not_active IP Right Cessation
- 1970-11-27 FR FR707042706A patent/FR2073425B1/fr not_active Expired
-
1972
- 1972-03-08 US US00232954A patent/US3755319A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| NO133367C (forum.php) | 1976-04-21 |
| FR2073425B1 (forum.php) | 1974-06-21 |
| DE2058295C3 (de) | 1980-06-19 |
| ZA707727B (en) | 1971-08-25 |
| PH11097A (en) | 1977-10-25 |
| CH557347A (de) | 1974-12-31 |
| IL35668A0 (en) | 1971-01-28 |
| FR2073425A1 (forum.php) | 1971-10-01 |
| CA930743A (en) | 1973-07-24 |
| IL35668A (en) | 1973-08-29 |
| HU162579B (forum.php) | 1973-03-28 |
| AT304547B (de) | 1973-01-10 |
| DK130740C (forum.php) | 1975-09-08 |
| ES385927A1 (es) | 1973-12-01 |
| US3706768A (en) | 1972-12-19 |
| DE2058295B2 (de) | 1979-10-04 |
| SE382459B (sv) | 1976-02-02 |
| IE34720B1 (en) | 1975-07-23 |
| DE2058295A1 (de) | 1971-06-03 |
| GB1312620A (en) | 1973-04-04 |
| US3755319A (en) | 1973-08-28 |
| FI56005C (fi) | 1979-11-12 |
| BE759292A (fr) | 1971-05-24 |
| FI56005B (fi) | 1979-07-31 |
| IE34720L (en) | 1971-05-27 |
| DK130740B (da) | 1975-04-07 |
| CS172918B4 (forum.php) | 1977-01-28 |
| NL7017336A (forum.php) | 1971-06-01 |
| NO133367B (forum.php) | 1976-01-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL81223B1 (forum.php) | ||
| EP0092786B1 (en) | 1,8-naphthyridine and 1,5,8-azanaphthyridine derivatives | |
| DE69132519T2 (de) | Chinolinderivate | |
| NZ248583A (en) | (iso) quinoline derivatives, preparation and pharmaceutical compositions therof | |
| HU183087B (en) | Process for producing substituted pyrano- and thiopyrano-quinolines | |
| CA1191140A (en) | 2-quinolone derivatives | |
| PL122965B1 (en) | Process for preparing novel, condensed derivatives of pyrimidine | |
| US4013665A (en) | Antiviral, substituted 1,3-dimethyl-1h-pyrazolo(3,4b)quinolines | |
| CA1244420A (en) | Quinolone derivatives | |
| CS202082B2 (en) | Method of producing novel derivatives of benzopyran | |
| DK149808B (da) | Analogifremgangsmaade til fremstilling af quinoloncarboxylsyrederivater | |
| JPS6023112B2 (ja) | 新規なベンゾ〔c〕キノリン類製造用中間体 | |
| US4255576A (en) | 1-Azaxanthone derivatives | |
| FI71733B (fi) | Foerfarande foer framstaellning av farmaceutiskt aktiva 3,6-substituerade 2-vinyl-kromoner | |
| US4302458A (en) | Phthalidyl-isoquinoline derivatives | |
| US4617392A (en) | 4-alkyl-5,6-methylenedioxy-2-1[H]-quinazolinones useful as cardiotonic agents | |
| US3948955A (en) | 4'-Carboxy-flavone | |
| CA1297106C (en) | Antiallergic agents and process for their preparation | |
| GB1593645A (en) | Carbocyclic fused thiophen-2-oxaminic acid derivatives | |
| JPH04128288A (ja) | キノロンカルボン酸誘導体及びその製造方法 | |
| US2773064A (en) | Y-substituted amino-benz | |
| EP0072070B1 (en) | N1-acyl-3-amino-1,2,3,4-tetrahydroquinoline compounds | |
| US3974161A (en) | Fused pyrimidin-4(3H)-ones as antiallergy agents | |
| PL166695B1 (pl) | Sposób wytwarzania nowych pochodnych izochinoliny PL PL PL | |
| PL145081B1 (en) | Method of obtaining novel /2-/1-aminopyridilo/amino phenyl/aryl-methanones |