PL81112B1 - Sulphonyl-ureas [gb1313539a] - Google Patents
Sulphonyl-ureas [gb1313539a] Download PDFInfo
- Publication number
- PL81112B1 PL81112B1 PL1970141708A PL14170870A PL81112B1 PL 81112 B1 PL81112 B1 PL 81112B1 PL 1970141708 A PL1970141708 A PL 1970141708A PL 14170870 A PL14170870 A PL 14170870A PL 81112 B1 PL81112 B1 PL 81112B1
- Authority
- PL
- Poland
- Prior art keywords
- group
- formula
- compound
- tetrahydroisoquinoline
- sulfonamide
- Prior art date
Links
- -1 α - naphthyl Chemical group 0.000 claims abstract description 62
- 150000001875 compounds Chemical class 0.000 claims abstract description 35
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 11
- 150000003839 salts Chemical class 0.000 claims abstract description 8
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims abstract description 6
- 125000001931 aliphatic group Chemical group 0.000 claims abstract description 4
- 239000004305 biphenyl Substances 0.000 claims abstract description 4
- 235000010290 biphenyl Nutrition 0.000 claims abstract description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims abstract 3
- 239000007795 chemical reaction product Substances 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 16
- 238000006243 chemical reaction Methods 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 229940100389 Sulfonylurea Drugs 0.000 claims description 11
- 239000002253 acid Substances 0.000 claims description 11
- 125000003277 amino group Chemical group 0.000 claims description 10
- 239000012948 isocyanate Substances 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 claims description 6
- 150000002148 esters Chemical class 0.000 claims description 5
- 150000002513 isocyanates Chemical class 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 239000003701 inert diluent Substances 0.000 claims description 4
- 239000012442 inert solvent Substances 0.000 claims description 4
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 claims description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 4
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbamic acid group Chemical group C(N)(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 claims description 3
- 239000011203 carbon fibre reinforced carbon Substances 0.000 claims description 3
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 125000005415 substituted alkoxy group Chemical group 0.000 claims description 3
- 125000006267 biphenyl group Chemical group 0.000 claims description 2
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 4
- 229910052783 alkali metal Inorganic materials 0.000 claims 3
- 229910052801 chlorine Inorganic materials 0.000 claims 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims 2
- 125000000547 substituted alkyl group Chemical group 0.000 claims 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- 239000002585 base Substances 0.000 claims 1
- CREMABGTGYGIQB-UHFFFAOYSA-N carbon carbon Chemical compound C.C CREMABGTGYGIQB-UHFFFAOYSA-N 0.000 claims 1
- 239000000460 chlorine Chemical group 0.000 claims 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- 229910052751 metal Chemical class 0.000 claims 1
- 239000002184 metal Chemical class 0.000 claims 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 claims 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 abstract description 3
- 239000000825 pharmaceutical preparation Substances 0.000 abstract description 2
- 239000004480 active ingredient Substances 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 abstract 1
- TXQDTCFYVNDVJK-UHFFFAOYSA-N ethyl N-ethoxycarbonyl-N-[[2-(3-phenylpropanoyl)-3,4-dihydro-1H-isoquinolin-7-yl]sulfonyl]carbamate Chemical compound C(=O)(OCC)N(S(=O)(=O)C1=CC=C2CCN(CC2=C1)C(CCC1=CC=CC=C1)=O)C(=O)OCC TXQDTCFYVNDVJK-UHFFFAOYSA-N 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 230000002218 hypoglycaemic effect Effects 0.000 abstract 1
- 238000010561 standard procedure Methods 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 79
- 159000000000 sodium salts Chemical class 0.000 description 60
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 48
- 229940124530 sulfonamide Drugs 0.000 description 42
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 40
- KQWGXHWJMSMDJJ-UHFFFAOYSA-N cyclohexyl isocyanate Chemical compound O=C=NC1CCCCC1 KQWGXHWJMSMDJJ-UHFFFAOYSA-N 0.000 description 37
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 36
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 33
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 32
- 239000000243 solution Substances 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 26
- 238000000354 decomposition reaction Methods 0.000 description 25
- 238000002844 melting Methods 0.000 description 23
- 230000008018 melting Effects 0.000 description 23
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 22
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- 239000002244 precipitate Substances 0.000 description 19
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 150000003456 sulfonamides Chemical class 0.000 description 17
- 239000000203 mixture Substances 0.000 description 16
- 238000001704 evaporation Methods 0.000 description 15
- 230000008020 evaporation Effects 0.000 description 14
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 13
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 10
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 10
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 9
- 229960000583 acetic acid Drugs 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- 235000019439 ethyl acetate Nutrition 0.000 description 8
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 7
- 239000012670 alkaline solution Substances 0.000 description 7
- 150000002168 ethanoic acid esters Chemical class 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical class OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 229910021529 ammonia Inorganic materials 0.000 description 6
- 239000004202 carbamide Substances 0.000 description 6
- 238000001035 drying Methods 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical class OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- 229910052799 carbon Inorganic materials 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 238000002425 crystallisation Methods 0.000 description 5
- 230000008025 crystallization Effects 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 238000001665 trituration Methods 0.000 description 4
- HFODCIWEQMGWCT-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline-7-sulfonamide;hydrochloride Chemical compound Cl.C1CNCC2=CC(S(=O)(=O)N)=CC=C21 HFODCIWEQMGWCT-UHFFFAOYSA-N 0.000 description 3
- AAFGZKYAEMJTLZ-UHFFFAOYSA-N 2-(2-phenylpropanoyl)-3,4-dihydro-1H-isoquinoline-7-sulfonamide Chemical compound C1(=CC=CC=C1)C(C(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N)C AAFGZKYAEMJTLZ-UHFFFAOYSA-N 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 239000002026 chloroform extract Substances 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 3
- 125000004494 ethyl ester group Chemical group 0.000 description 3
- AOCYHPQXGJBAQQ-UHFFFAOYSA-N ethyl n-sulfonylcarbamate Chemical compound CCOC(=O)N=S(=O)=O AOCYHPQXGJBAQQ-UHFFFAOYSA-N 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000006260 foam Substances 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 150000007530 organic bases Chemical group 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- UGLLZXSYRBMNOS-UHFFFAOYSA-N 1,2,3,4-tetrahydro-isoquinoline-7-sulfonic acid amide Chemical compound C1CNCC2=CC(S(=O)(=O)N)=CC=C21 UGLLZXSYRBMNOS-UHFFFAOYSA-N 0.000 description 2
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical compound CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- XWVFMJLNNGXNSG-UHFFFAOYSA-N 1-(7-amino-3,4-dihydro-1h-isoquinolin-2-yl)ethanone Chemical compound C1=C(N)C=C2CN(C(=O)C)CCC2=C1 XWVFMJLNNGXNSG-UHFFFAOYSA-N 0.000 description 2
- IRUXSKJXJFMZPQ-UHFFFAOYSA-N 2,3,4,5-tetrahydro-1h-3-benzazepine-7-sulfonamide Chemical compound C1CNCCC2=CC(S(=O)(=O)N)=CC=C21 IRUXSKJXJFMZPQ-UHFFFAOYSA-N 0.000 description 2
- PFDBEACWLCHWRZ-UHFFFAOYSA-N 2-(4-bromophenyl)propanoic acid Chemical compound OC(=O)C(C)C1=CC=C(Br)C=C1 PFDBEACWLCHWRZ-UHFFFAOYSA-N 0.000 description 2
- KSMVBYPXNKCPAJ-UHFFFAOYSA-N 4-Methylcyclohexylamine Chemical class CC1CCC(N)CC1 KSMVBYPXNKCPAJ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 239000001828 Gelatine Substances 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- 241001274216 Naso Species 0.000 description 2
- 238000000297 Sandmeyer reaction Methods 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- WBJINCZRORDGAQ-UHFFFAOYSA-N ethyl formate Chemical compound CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000012907 honey Nutrition 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 235000015320 potassium carbonate Nutrition 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 150000003222 pyridines Chemical class 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 2
- WZHRJGWXUCLILI-UHFFFAOYSA-N sulfonylcarbamic acid Chemical class OC(=O)N=S(=O)=O WZHRJGWXUCLILI-UHFFFAOYSA-N 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 1
- UWYZHKAOTLEWKK-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline Chemical compound C1=CC=C2CNCCC2=C1 UWYZHKAOTLEWKK-UHFFFAOYSA-N 0.000 description 1
- NABUFFLEHQEQPH-UHFFFAOYSA-N 1-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)ethanone Chemical compound C1CN(C(=O)C)CCC2=CC=CC=C21 NABUFFLEHQEQPH-UHFFFAOYSA-N 0.000 description 1
- JBPPSLURCSFQDH-UHFFFAOYSA-N 1-(3,4-dihydro-1h-isoquinolin-2-yl)ethanone Chemical compound C1=CC=C2CN(C(=O)C)CCC2=C1 JBPPSLURCSFQDH-UHFFFAOYSA-N 0.000 description 1
- FSYWMPRUEBTSIZ-UHFFFAOYSA-N 1-cyclohexyl-3-[[2-(4-methylbenzoyl)-3,4-dihydro-1H-isoquinolin-7-yl]sulfonyl]urea Chemical compound CC1=CC=C(C(=O)N2CC3=CC(=CC=C3CC2)S(=O)(=O)NC(=O)NC2CCCCC2)C=C1 FSYWMPRUEBTSIZ-UHFFFAOYSA-N 0.000 description 1
- OTVSGUXUQHZGNR-UHFFFAOYSA-N 2-(4-bromophenyl)propanoyl chloride Chemical compound ClC(=O)C(C)C1=CC=C(Br)C=C1 OTVSGUXUQHZGNR-UHFFFAOYSA-N 0.000 description 1
- MOMFXATYAINJML-UHFFFAOYSA-N 2-Acetylthiazole Chemical group CC(=O)C1=NC=CS1 MOMFXATYAINJML-UHFFFAOYSA-N 0.000 description 1
- ILJBSAAGDQNOHZ-UHFFFAOYSA-N 2-[2-(4-chlorophenyl)propanoyl]-3,4-dihydro-1H-isoquinoline-7-sulfonamide Chemical compound ClC1=CC=C(C=C1)C(C(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N)C ILJBSAAGDQNOHZ-UHFFFAOYSA-N 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- MAUSSGMKFIPNAQ-UHFFFAOYSA-N 3-acetyl-1,2,4,5-tetrahydro-3-benzazepine-7-sulfonamide Chemical compound C(C)(=O)N1CCC2=C(CC1)C=CC(=C2)S(=O)(=O)N MAUSSGMKFIPNAQ-UHFFFAOYSA-N 0.000 description 1
- MFEILWXBDBCWKF-UHFFFAOYSA-N 3-phenylpropanoyl chloride Chemical compound ClC(=O)CCC1=CC=CC=C1 MFEILWXBDBCWKF-UHFFFAOYSA-N 0.000 description 1
- 125000001999 4-Methoxybenzoyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1OC([H])([H])[H])C(*)=O 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- 125000004199 4-trifluoromethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C(F)(F)F 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 238000006418 Brown reaction Methods 0.000 description 1
- ATAAGXSCUHYATC-UHFFFAOYSA-N C(C1=CC=CC=C1)(=O)CC(=O)C1NCCC2=CC=C(C=C12)S(=O)(=O)N Chemical compound C(C1=CC=CC=C1)(=O)CC(=O)C1NCCC2=CC=C(C=C12)S(=O)(=O)N ATAAGXSCUHYATC-UHFFFAOYSA-N 0.000 description 1
- NASKLOJEFRXNCN-UHFFFAOYSA-N C(CC(C)C)(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N Chemical compound C(CC(C)C)(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N NASKLOJEFRXNCN-UHFFFAOYSA-N 0.000 description 1
- RSPVHMRCRNKTOA-UHFFFAOYSA-N C(CCC)(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N Chemical compound C(CCC)(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N RSPVHMRCRNKTOA-UHFFFAOYSA-N 0.000 description 1
- DBESOTBONSCZLF-UHFFFAOYSA-N C1(=CC=CC=C1)C(CC(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)NC(OCC)=O)C Chemical compound C1(=CC=CC=C1)C(CC(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)NC(OCC)=O)C DBESOTBONSCZLF-UHFFFAOYSA-N 0.000 description 1
- MQSYDXZBYUDTTJ-UHFFFAOYSA-N CC(C(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N)CC1=CC=CC=C1 Chemical compound CC(C(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N)CC1=CC=CC=C1 MQSYDXZBYUDTTJ-UHFFFAOYSA-N 0.000 description 1
- DDWXRIGLFMUEHQ-UHFFFAOYSA-N CCOC(=O)NS(=O)(=O)C1=CC2=C(CCN(C2)C(=O)C(C)C3=CC=C(C=C3)Cl)C=C1 Chemical compound CCOC(=O)NS(=O)(=O)C1=CC2=C(CCN(C2)C(=O)C(C)C3=CC=C(C=C3)Cl)C=C1 DDWXRIGLFMUEHQ-UHFFFAOYSA-N 0.000 description 1
- GRALOFCMPMMESQ-UHFFFAOYSA-N COC1=C(C=CC=C1)CCC(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N Chemical compound COC1=C(C=CC=C1)CCC(=O)N1CC2=CC(=CC=C2CC1)S(=O)(=O)N GRALOFCMPMMESQ-UHFFFAOYSA-N 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 229910006124 SOCl2 Inorganic materials 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000002036 chloroform fraction Substances 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 1
- VXVVUHQULXCUPF-UHFFFAOYSA-N cycloheptanamine Chemical compound NC1CCCCCC1 VXVVUHQULXCUPF-UHFFFAOYSA-N 0.000 description 1
- XYZMOVWWVXBHDP-UHFFFAOYSA-N cyclohexyl isocyanide Chemical compound [C-]#[N+]C1CCCCC1 XYZMOVWWVXBHDP-UHFFFAOYSA-N 0.000 description 1
- HSOHBWMXECKEKV-UHFFFAOYSA-N cyclooctanamine Chemical compound NC1CCCCCCC1 HSOHBWMXECKEKV-UHFFFAOYSA-N 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- JUVJQIPDVWOVNP-UHFFFAOYSA-N hexylurea Chemical compound CCCCCCNC(N)=O JUVJQIPDVWOVNP-UHFFFAOYSA-N 0.000 description 1
- 230000003165 hydrotropic effect Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- AGVKXDPPPSLISR-UHFFFAOYSA-N n-ethylcyclohexanamine Chemical compound CCNC1CCCCC1 AGVKXDPPPSLISR-UHFFFAOYSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- CUQOHAYJWVTKDE-UHFFFAOYSA-N potassium;butan-1-olate Chemical group [K+].CCCC[O-] CUQOHAYJWVTKDE-UHFFFAOYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000001256 steam distillation Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D223/00—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom
- C07D223/14—Heterocyclic compounds containing seven-membered rings having one nitrogen atom as the only ring hetero atom condensed with carbocyclic rings or ring systems
- C07D223/16—Benzazepines; Hydrogenated benzazepines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
- C07D217/06—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines with the ring nitrogen atom acylated by carboxylic or carbonic acids, or with sulfur or nitrogen analogues thereof, e.g. carbamates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691933388 DE1933388A1 (de) | 1969-07-01 | 1969-07-01 | Neue Sulfonylharnstoffe und Verfahren zu ihrer Herstellung |
| DE19702027436 DE2027436A1 (en) | 1970-06-04 | 1970-06-04 | Sulphenylurea cpds, hypoglycaemics |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL81112B1 true PL81112B1 (en) | 1975-08-30 |
Family
ID=25757577
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1970141708A PL81112B1 (en) | 1969-07-01 | 1970-06-30 | Sulphonyl-ureas [gb1313539a] |
Country Status (16)
| Country | Link |
|---|---|
| AT (1) | AT301568B (member.php) |
| BE (1) | BE752760A (member.php) |
| BG (1) | BG18181A1 (member.php) |
| CH (1) | CH536842A (member.php) |
| DK (1) | DK127928B (member.php) |
| ES (2) | ES381248A1 (member.php) |
| FI (1) | FI49828C (member.php) |
| FR (1) | FR2059465B1 (member.php) |
| GB (1) | GB1313539A (member.php) |
| IE (1) | IE34359B1 (member.php) |
| IL (1) | IL34820A (member.php) |
| NL (1) | NL7009704A (member.php) |
| NO (1) | NO132094C (member.php) |
| PL (1) | PL81112B1 (member.php) |
| RO (1) | RO56857A (member.php) |
| SE (1) | SE357745B (member.php) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU2001256733A1 (en) * | 2000-05-16 | 2001-11-26 | Takeda Chemical Industries Ltd. | Melanin-concentrating hormone antagonist |
-
1970
- 1970-06-17 FI FI701712A patent/FI49828C/fi active
- 1970-06-24 SE SE08771/70A patent/SE357745B/xx unknown
- 1970-06-25 RO RO63739A patent/RO56857A/ro unknown
- 1970-06-26 BG BG16831A patent/BG18181A1/xx unknown
- 1970-06-27 ES ES381248A patent/ES381248A1/es not_active Expired
- 1970-06-29 CH CH982470A patent/CH536842A/de not_active IP Right Cessation
- 1970-06-30 BE BE752760D patent/BE752760A/xx unknown
- 1970-06-30 GB GB3172270A patent/GB1313539A/en not_active Expired
- 1970-06-30 NO NO2575/70A patent/NO132094C/no unknown
- 1970-06-30 AT AT586870A patent/AT301568B/de not_active IP Right Cessation
- 1970-06-30 IL IL34820A patent/IL34820A/en unknown
- 1970-06-30 IE IE856/70A patent/IE34359B1/xx unknown
- 1970-06-30 PL PL1970141708A patent/PL81112B1/pl unknown
- 1970-06-30 DK DK338970AA patent/DK127928B/da unknown
- 1970-07-01 NL NL7009704A patent/NL7009704A/xx unknown
- 1970-07-01 FR FR7024368A patent/FR2059465B1/fr not_active Expired
-
1971
- 1971-07-19 ES ES393416A patent/ES393416A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FI49828C (fi) | 1975-10-10 |
| IL34820A0 (en) | 1970-09-17 |
| NO132094C (member.php) | 1975-09-17 |
| NL7009704A (member.php) | 1971-01-05 |
| FI49828B (member.php) | 1975-06-30 |
| IE34359L (en) | 1971-01-01 |
| DK127928B (da) | 1974-02-04 |
| ES393416A1 (es) | 1974-06-01 |
| RO56857A (member.php) | 1974-12-15 |
| CH536842A (de) | 1973-05-15 |
| AT301568B (de) | 1972-09-11 |
| ES381248A1 (es) | 1972-11-01 |
| BE752760A (fr) | 1970-12-30 |
| IE34359B1 (en) | 1975-04-16 |
| BG18181A1 (member.php) | 1974-09-02 |
| FR2059465B1 (member.php) | 1974-03-22 |
| GB1313539A (en) | 1973-04-11 |
| NO132094B (member.php) | 1975-06-09 |
| SE357745B (member.php) | 1973-07-09 |
| IL34820A (en) | 1973-08-29 |
| FR2059465A1 (member.php) | 1971-06-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU602542B2 (en) | Phenylsulfonyl derivatives as herbicide intermediates | |
| NO167947B (no) | Lagringsanordning for baand- eller plate-registreringsmedier | |
| CA1151652A (en) | 3-(alkylthio, alkylsulphinyl or alkylsulphonyl)-4- quinolones | |
| AU600992B2 (en) | Tetrahydroisoquinolin-2-yl derivatives of carboxylic acids | |
| PL165653B1 (pl) | Sposób wytwarzania nowych pochodnych azaoksindolu PL PL PL | |
| CA1184910A (en) | Tricyclic cytosine derivatives for combatting circulatory illnesses | |
| AU608873B2 (en) | Alkylaminoalkoxyphenyl derivatives, process of preparation and compositions containing the same | |
| US4289879A (en) | Synthetic method and intermediate for piroxicam | |
| NO151837B (no) | Anordning ved fagverk for bruk under bygging av bygninger og andre konstruksjoner | |
| US3706747A (en) | Benzothieno(3,2-d)- and benzofuro(3,2-d)pyrimidines | |
| US3969358A (en) | Process for the preparation of thieno [3,2-c] pyridine and thieno [2,3-c] py | |
| SK20998A3 (en) | Chromane derivatives, a drug containing same, and their use | |
| PL81112B1 (en) | Sulphonyl-ureas [gb1313539a] | |
| NO144528B (no) | Analogifremgangsmaate til fremstilling av thiazolidinderivater med diuretisk og saluretisk virkning | |
| CS236876B2 (en) | Processing of new dibenzoxazine | |
| CA1086728A (en) | Manufacture of 2,1,3-thiadiazin-4-one-2,2-dioxide derivatives | |
| EP1716141B1 (en) | Benzopyran derivatives, method of production and use thereof | |
| SU1729293A3 (ru) | Способ получени производных 5-галоидтиеноизотиазол-3(2Н)-он-1,1-диоксидов | |
| PL145873B1 (en) | Method of obtaining novel 2-oxindole-1-carbonamides | |
| US4968680A (en) | 1-acyl-2,3-dihydro-4(1H)-quinolinone-4-oxime derivatives, process for producing them and use thereof | |
| US3301859A (en) | Cinchoninic acids and use in process for quinolinols | |
| US4161533A (en) | 5-Sulfamoyl-orthanilic acids and process for their preparation | |
| US3696122A (en) | Thiophene derivatives | |
| JPS6110548A (ja) | スルホンアミド類 | |
| FI69461B (fi) | Analogifoerfarande foer framstaellning av nya saosom laekemedelsaktivaemnen anvaendbara bensotiofen-2-on-3-karboxamider |