PL80329B1 - - Google Patents
Download PDFInfo
- Publication number
- PL80329B1 PL80329B1 PL13655169A PL13655169A PL80329B1 PL 80329 B1 PL80329 B1 PL 80329B1 PL 13655169 A PL13655169 A PL 13655169A PL 13655169 A PL13655169 A PL 13655169A PL 80329 B1 PL80329 B1 PL 80329B1
- Authority
- PL
- Poland
- Prior art keywords
- parts
- dibromo
- dye
- bromine
- acid
- Prior art date
Links
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 20
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 20
- 229910052794 bromium Inorganic materials 0.000 claims description 20
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 19
- 238000000034 method Methods 0.000 claims description 9
- 125000002252 acyl group Chemical group 0.000 claims description 8
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 7
- 235000010338 boric acid Nutrition 0.000 claims description 7
- 229960002645 boric acid Drugs 0.000 claims description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 5
- 229940100198 alkylating agent Drugs 0.000 claims description 5
- 239000002168 alkylating agent Substances 0.000 claims description 5
- 239000000986 disperse dye Substances 0.000 claims description 4
- 125000001931 aliphatic group Chemical group 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 2
- KHUFHLFHOQVFGB-UHFFFAOYSA-N 1-aminoanthracene-9,10-dione Chemical class O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2N KHUFHLFHOQVFGB-UHFFFAOYSA-N 0.000 claims 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 150000001735 carboxylic acids Chemical class 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 150000002763 monocarboxylic acids Chemical class 0.000 claims 1
- 238000000926 separation method Methods 0.000 claims 1
- 239000000975 dye Substances 0.000 description 32
- 239000000835 fiber Substances 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- -1 for example Chemical group 0.000 description 11
- 239000000203 mixture Substances 0.000 description 11
- 239000003086 colorant Substances 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 239000001045 blue dye Substances 0.000 description 6
- ORFSSYGWXNGVFB-UHFFFAOYSA-N sodium 4-amino-6-[[4-[4-[(8-amino-1-hydroxy-5,7-disulfonaphthalen-2-yl)diazenyl]-3-methoxyphenyl]-2-methoxyphenyl]diazenyl]-5-hydroxynaphthalene-1,3-disulfonic acid Chemical compound COC1=C(C=CC(=C1)C2=CC(=C(C=C2)N=NC3=C(C4=C(C=C3)C(=CC(=C4N)S(=O)(=O)O)S(=O)(=O)O)O)OC)N=NC5=C(C6=C(C=C5)C(=CC(=C6N)S(=O)(=O)O)S(=O)(=O)O)O.[Na+] ORFSSYGWXNGVFB-UHFFFAOYSA-N 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 229920000728 polyester Polymers 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000007900 aqueous suspension Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000004952 Polyamide Substances 0.000 description 3
- 239000004698 Polyethylene Substances 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 238000004043 dyeing Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- SKKBQVLDRINRSW-UHFFFAOYSA-N n-(8-acetamido-4,5-dibromo-9,10-dioxoanthracen-1-yl)acetamide Chemical compound O=C1C2=C(Br)C=CC(NC(C)=O)=C2C(=O)C2=C1C(Br)=CC=C2NC(=O)C SKKBQVLDRINRSW-UHFFFAOYSA-N 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 229920002647 polyamide Polymers 0.000 description 3
- 229920000573 polyethylene Polymers 0.000 description 3
- 229920000139 polyethylene terephthalate Polymers 0.000 description 3
- 239000005020 polyethylene terephthalate Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- IYHIKYZDSVTAPF-UHFFFAOYSA-N 1,2-diamino-3,4-dihydroxyanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(N)=C(N)C(O)=C2O IYHIKYZDSVTAPF-UHFFFAOYSA-N 0.000 description 2
- HSYLKWSCFRLSKB-UHFFFAOYSA-N 1,5-diamino-4,8-dihydroxyanthracene-9,10-dione Chemical compound O=C1C2=C(N)C=CC(O)=C2C(=O)C2=C1C(O)=CC=C2N HSYLKWSCFRLSKB-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- BIAQMHFIWDFNOG-UHFFFAOYSA-N CC(NC(C=CC=C1C(C(C(NC(C)=O)=C2)=C3C(Br)=C2Br)=O)=C1C3=O)=O Chemical compound CC(NC(C=CC=C1C(C(C(NC(C)=O)=C2)=C3C(Br)=C2Br)=O)=C1C3=O)=O BIAQMHFIWDFNOG-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 150000004056 anthraquinones Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- 229920002301 cellulose acetate Polymers 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- DORCRAXPUWOWPM-UHFFFAOYSA-N n-(5-acetamido-4,8-dibromo-9,10-dioxoanthracen-1-yl)acetamide Chemical compound O=C1C2=C(NC(C)=O)C=CC(Br)=C2C(=O)C2=C1C(Br)=CC=C2NC(=O)C DORCRAXPUWOWPM-UHFFFAOYSA-N 0.000 description 2
- GLDOVTGHNKAZLK-UHFFFAOYSA-N octadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCO GLDOVTGHNKAZLK-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 238000010023 transfer printing Methods 0.000 description 2
- 210000002268 wool Anatomy 0.000 description 2
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 1
- LRMDXTVKVHKWEK-UHFFFAOYSA-N 1,2-diaminoanthracene-9,10-dione Chemical compound C1=CC=C2C(=O)C3=C(N)C(N)=CC=C3C(=O)C2=C1 LRMDXTVKVHKWEK-UHFFFAOYSA-N 0.000 description 1
- AQXYVFBSOOBBQV-UHFFFAOYSA-N 1-amino-4-hydroxyanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(O)=CC=C2N AQXYVFBSOOBBQV-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical class OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- NEHMKBQYUWJMIP-NJFSPNSNSA-N chloro(114C)methane Chemical compound [14CH3]Cl NEHMKBQYUWJMIP-NJFSPNSNSA-N 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- WOKZFJICKMOZLE-UHFFFAOYSA-N ethyl n-(9,10-dioxoanthracen-1-yl)carbamate Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)OCC WOKZFJICKMOZLE-UHFFFAOYSA-N 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 230000002209 hydrophobic effect Effects 0.000 description 1
- 125000005191 hydroxyalkylamino group Chemical group 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- FYVXLOSZAXJFQR-UHFFFAOYSA-N n-(5-benzamido-4,8-dibromo-9,10-dioxoanthracen-1-yl)benzamide Chemical compound C1=2C(=O)C3=C(Br)C=CC(NC(=O)C=4C=CC=CC=4)=C3C(=O)C=2C(Br)=CC=C1NC(=O)C1=CC=CC=C1 FYVXLOSZAXJFQR-UHFFFAOYSA-N 0.000 description 1
- MHIIKMFLEZGYPH-UHFFFAOYSA-N n-(8-benzamido-9,10-dioxoanthracen-1-yl)benzamide Chemical compound C=1C=CC=CC=1C(=O)NC(C=1C(=O)C2=3)=CC=CC=1C(=O)C2=CC=CC=3NC(=O)C1=CC=CC=C1 MHIIKMFLEZGYPH-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- XUXNAKZDHHEHPC-UHFFFAOYSA-M sodium bromate Chemical compound [Na+].[O-]Br(=O)=O XUXNAKZDHHEHPC-UHFFFAOYSA-M 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000001273 sulfonato group Chemical class [O-]S(*)(=O)=O 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- QDNCLIPKBNMUPP-UHFFFAOYSA-N trimethyloxidanium Chemical compound C[O+](C)C QDNCLIPKBNMUPP-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Landscapes
- Coloring (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1618168A CH510722A (de) | 1968-10-30 | 1968-10-30 | Verfahren zur Herstellung blauer Dispersionsfarbstoffe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL80329B1 true PL80329B1 (OSRAM) | 1975-08-30 |
Family
ID=4415095
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL13655169A PL80329B1 (OSRAM) | 1968-10-30 | 1969-10-28 |
Country Status (2)
| Country | Link |
|---|---|
| PL (1) | PL80329B1 (OSRAM) |
| SU (1) | SU393831A3 (OSRAM) |
-
1969
- 1969-10-28 SU SU1372349A patent/SU393831A3/ru active
- 1969-10-28 PL PL13655169A patent/PL80329B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| SU393831A3 (OSRAM) | 1973-08-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2572555B2 (ja) | 新規ジケトピロロピロール及び着色剤 | |
| PL80329B1 (OSRAM) | ||
| US2844594A (en) | 3-aryl-7-dialkylaminocoumarins | |
| US3147284A (en) | Anthraquinone dyestuffs | |
| DE1090355B (de) | Verfahren zur Herstellung von sauren Anthrachinonfarbstoffen | |
| DE652773C (de) | Verfahren zur Herstellung von Kuepenfarbstoffen der Anthrachinonacridonreihe | |
| US2025370A (en) | Amino-halogenanthraquinone sulphonic acids | |
| US2136133A (en) | Pyrazole-anthrones and process of making same | |
| US3714205A (en) | Process for the manufacture of blue dispersion dyestuffs | |
| US3278563A (en) | 1-phenoxy-and 1-phenylthio-anilino-4-hydroxy-anthraquinone dyes | |
| DE1130951B (de) | Verfahren zur Herstellung blauer Dispersionsfarbstoffe der Anthrachinonreihe | |
| US3925427A (en) | Manufacture of anthraquinonoid disperse dyes containing bromine | |
| DE844451C (de) | Verfahren zur Herstellung von Halogenaminoanthrachinonen | |
| US3809705A (en) | Process for the deacylation of aroylamino-dianthrimides | |
| US2685591A (en) | 1-diphenoylamino-6-fluoranthraquinone | |
| US2719840A (en) | Bis-anthraquinoneazoles of azobiphenyldicarboxylic acid | |
| US1990841A (en) | Condensation product and process of making same | |
| JPS5855985B2 (ja) | ハロゲン−ガンユウアントラキノンガタカゴウブツノ セイゾウホウホウ | |
| US2719841A (en) | Azobiphenylcarbonylaminoanthraquinone compounds | |
| DE897898C (de) | Verfahren zur Herstellung von Anthrachinonfarbstoffen | |
| US1791215A (en) | Dibromodibenzanthrone | |
| US2363069A (en) | Anthraquinone dyes for animal and related fibers | |
| US3576015A (en) | Anthraquinone dyestuffs | |
| DE628124C (de) | Verfahren zur Herstellung von Kuepenfarbstoffen der Anthrachinonreihe | |
| US2663708A (en) | 4-hydroxy-7, 8-phthaloyl-cinnolines and process of preparing same |