PL66474B1 - - Google Patents
Download PDFInfo
- Publication number
- PL66474B1 PL66474B1 PL141794A PL14179470A PL66474B1 PL 66474 B1 PL66474 B1 PL 66474B1 PL 141794 A PL141794 A PL 141794A PL 14179470 A PL14179470 A PL 14179470A PL 66474 B1 PL66474 B1 PL 66474B1
- Authority
- PL
- Poland
- Prior art keywords
- phenol
- formaldehyde
- parts
- chromium
- weight
- Prior art date
Links
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 21
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 11
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 10
- 239000000047 product Substances 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 8
- 150000001844 chromium Chemical class 0.000 claims description 7
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052804 chromium Inorganic materials 0.000 claims description 6
- 239000011651 chromium Substances 0.000 claims description 6
- 239000000203 mixture Substances 0.000 claims description 6
- 229920002705 flavono-ellagitannin Polymers 0.000 claims description 5
- 229920005989 resin Polymers 0.000 claims description 5
- 239000011347 resin Substances 0.000 claims description 5
- 238000006277 sulfonation reaction Methods 0.000 claims description 4
- 238000009833 condensation Methods 0.000 claims description 3
- 230000005494 condensation Effects 0.000 claims description 3
- 229920003986 novolac Polymers 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 239000007864 aqueous solution Substances 0.000 claims description 2
- 230000018044 dehydration Effects 0.000 claims 1
- 238000006297 dehydration reaction Methods 0.000 claims 1
- SLGWESQGEUXWJQ-UHFFFAOYSA-N formaldehyde;phenol Chemical class O=C.OC1=CC=CC=C1 SLGWESQGEUXWJQ-UHFFFAOYSA-N 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 claims 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 239000000243 solution Substances 0.000 description 6
- 239000007859 condensation product Substances 0.000 description 5
- QDOXWKRWXJOMAK-UHFFFAOYSA-N dichromium trioxide Chemical compound O=[Cr]O[Cr]=O QDOXWKRWXJOMAK-UHFFFAOYSA-N 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 4
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 4
- 229920001864 tannin Polymers 0.000 description 4
- 235000018553 tannin Nutrition 0.000 description 4
- 239000001648 tannin Substances 0.000 description 4
- 239000002253 acid Substances 0.000 description 3
- 235000015217 chromium(III) sulphate Nutrition 0.000 description 3
- 239000011696 chromium(III) sulphate Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- -1 phenol sulfones Chemical class 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 229950011260 betanaphthol Drugs 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 150000004696 coordination complex Chemical class 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000010985 leather Substances 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- LGRFSURHDFAFJT-UHFFFAOYSA-N phthalic anhydride Chemical compound C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 2
- 238000006068 polycondensation reaction Methods 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- UDSAIICHUKSCKT-UHFFFAOYSA-N bromophenol blue Chemical compound C1=C(Br)C(O)=C(Br)C=C1C1(C=2C=C(Br)C(O)=C(Br)C=2)C2=CC=CC=C2S(=O)(=O)O1 UDSAIICHUKSCKT-UHFFFAOYSA-N 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 150000001734 carboxylic acid salts Chemical class 0.000 description 1
- DSHWASKZZBZKOE-UHFFFAOYSA-K chromium(3+);hydroxide;sulfate Chemical compound [OH-].[Cr+3].[O-]S([O-])(=O)=O DSHWASKZZBZKOE-UHFFFAOYSA-K 0.000 description 1
- GRWVQDDAKZFPFI-UHFFFAOYSA-H chromium(III) sulfate Chemical compound [Cr+3].[Cr+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRWVQDDAKZFPFI-UHFFFAOYSA-H 0.000 description 1
- VQWFNAGFNGABOH-UHFFFAOYSA-K chromium(iii) hydroxide Chemical compound [OH-].[OH-].[OH-].[Cr+3] VQWFNAGFNGABOH-UHFFFAOYSA-K 0.000 description 1
- 150000001896 cresols Chemical class 0.000 description 1
- SMMXVEBDYAIABS-UHFFFAOYSA-N dinaphthalen-1-ylmethanesulfonic acid Chemical class C1=CC=C2C(C(C=3C4=CC=CC=C4C=CC=3)S(=O)(=O)O)=CC=CC2=C1 SMMXVEBDYAIABS-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000000873 masking effect Effects 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 229940061610 sulfonated phenol Drugs 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL66474B1 true PL66474B1 (enFirst) | 1972-06-30 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1113457B (de) | Verfahren zur Herstellung lichtechter Kondensationsprodukte durch Umsetzung sulfonierter Phenole mit Harnstoff und Formaldehyd | |
| PL66474B1 (enFirst) | ||
| DE1142173B (de) | Verfahren zur Herstellung lichtechter Kondensationsprodukte aus Phenolsulfonsaeuren, Phenolen, Harnstoff und Formaldehyd | |
| US3973904A (en) | Water-soluble synthetic tanning agents | |
| PL57542B1 (enFirst) | ||
| PL59419B1 (enFirst) | ||
| US2843564A (en) | Condensation products | |
| US1948667A (en) | Phenol ethers and process of preparing them | |
| DE596716C (de) | Verfahren zur Herstellung wasserloeslicher, hochmolekularer Kondensationsprodukte | |
| US2136997A (en) | Tanning agents | |
| US2218996A (en) | Tanning material | |
| SU59417A1 (ru) | Способ дублени шкур | |
| DE1935006A1 (de) | Verfahren zur Herstellung gerbend wirkender Kondensationsprodukte | |
| PL47841B1 (enFirst) | ||
| AT226872B (de) | Verfahren zur Herstellung lichtechter Kondensationsprodukte | |
| US2011573A (en) | Resinous complexes and compositions of synthetic origin containing sulphur and process of making same | |
| GB595211A (en) | Manufacture of condensation products having a tanning action from dihydroxy-diphenyl and dihydroxy-ditolyl sulphones | |
| DE1669341B1 (de) | Pulverfoermige Gerbstoffe | |
| AT233160B (de) | Verfahren zur Herstellung lichtechter Kondensationsprodukte | |
| DE969114C (de) | Verfahren zur Herstellung von festen Gerbstoffharzen | |
| DE910592C (de) | Verfahren zur Herstellung von hoehermolekularen, haertbaren, in Wasser loeslichen bzw. dispergierbaren Kondensationsprodukten | |
| CN111826482A (zh) | 一种含铬磺甲基化双酚s的水溶性合成鞣剂的制备方法 | |
| CH395134A (de) | Verfahren zur Herstellung lichtechter Kondensationsprodukte | |
| CH160653A (de) | Verfahren zur Darstellung einer hochmolekularen Sulfosäure. | |
| PL37685B1 (enFirst) |