PL6129B3 - Sposób wyrobu klisz do duplikatorów. - Google Patents
Sposób wyrobu klisz do duplikatorów. Download PDFInfo
- Publication number
- PL6129B3 PL6129B3 PL6129A PL612923A PL6129B3 PL 6129 B3 PL6129 B3 PL 6129B3 PL 6129 A PL6129 A PL 6129A PL 612923 A PL612923 A PL 612923A PL 6129 B3 PL6129 B3 PL 6129B3
- Authority
- PL
- Poland
- Prior art keywords
- tartrate
- added
- fact
- stearic acid
- amount
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 9
- URAYPUMNDPQOKB-UHFFFAOYSA-N triacetin Chemical compound CC(=O)OCC(OC(C)=O)COC(C)=O URAYPUMNDPQOKB-UHFFFAOYSA-N 0.000 claims description 8
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 claims description 4
- VDFMIRNWHJTMSP-UHFFFAOYSA-N 2,3-dihydroxy-4-oxo-4-pentoxybutanoic acid Chemical compound CCCCCOC(=O)C(O)C(O)C(O)=O VDFMIRNWHJTMSP-UHFFFAOYSA-N 0.000 claims description 4
- DCXXMTOCNZCJGO-UHFFFAOYSA-N Glycerol trioctadecanoate Natural products CCCCCCCCCCCCCCCCCC(=O)OCC(OC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCC DCXXMTOCNZCJGO-UHFFFAOYSA-N 0.000 claims description 4
- 235000021355 Stearic acid Nutrition 0.000 claims description 4
- 235000013773 glyceryl triacetate Nutrition 0.000 claims description 4
- 239000001087 glyceryl triacetate Substances 0.000 claims description 4
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 claims description 4
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 claims description 4
- 239000008117 stearic acid Substances 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 4
- 229960002622 triacetin Drugs 0.000 claims description 4
- NKMZBGMEVYDZSR-UHFFFAOYSA-N 4-butoxy-2,3-dihydroxy-4-oxobutanoic acid Chemical compound CCCCOC(=O)C(O)C(O)C(O)=O NKMZBGMEVYDZSR-UHFFFAOYSA-N 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 239000011248 coating agent Substances 0.000 claims 2
- 238000000576 coating method Methods 0.000 claims 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- 239000000835 fiber Substances 0.000 description 1
Description
Najdluzszy czas trwania patentu do 26 stycznia 1941 r.Wynalazek niniejszy dotyczy sposobu wyrobu klisz, inaczej szablonów, uzywa¬ nych w aparacie uwielokratniajacym, we¬ dlug patentu Nr 4040.Nowy sposób pozwala wytwarzac ar¬ kusze znacznie wieksze i zarazem trwal¬ sze. Cel ten osiagamy przez dodanie do kapieli blonnika pewnej ilosci kwasu stea¬ rynowego (stearyny) tudziez trójacetyny.Ostatnia te substancje mozna wreszcie za¬ stapic winianem butylowym lub winianem amylowym.Dodatek stearyny powieksza gietkosc arkusza, pozostale zas, wskazane powyzej, substancje sluza do podtrzymywania dlu¬ zej gietkosci arkusza.Tytulem jedynie przykladu przytacza¬ my nastepujaca recepte: do rozpuszczone¬ go kolodjum dodaje sie 4% kwasu steary¬ nowego i 3% trójacetyny.Te same stosunki nadaja sie i w wy¬ padku zastapienia trójacetyny winianem butylowym lub winianem amylowym. PL PL
Claims (5)
1. Zastrzezenia patentowe. 1. Sposób wyrobu klisz do duplikato¬ rów (do aparatów uwielokratniajacych) wedlug patentu Nr 4040, znamienny tern, ze do powloki klisz dodaje sie kwasu stea¬ rynowego (stearyny).
2. Sposób wedlug zastrz. 1, znamien¬ ny tern, ze do wytwarzajacej powloke sub-stancji oprócz stearyny dodaje sie jeszcze trojacetyny.
3. , Sposób wedlug zastrz. 1, znamien¬ ny tern, ze do substancji powloki obok kwasu stearynowego dodaje sie jeszcze winian butylu lub winian amylu,
4. Sposób wedlug zastrz. 2, znamien¬ ny tern, ze ilosc kwasu stearynowego wy¬ nosi 4%, a trójacetyny 3%,
5. Sposób wedlug zastrz. 3, znamien¬ ny tern, ze ilosc kwasu stearynowego wy¬ nosi 4%, a winianu butylowego lub winia¬ nu amylowego 3%. Paul Campion. Zastepca: M. Skrzypkowski, rzecznik patentowy. Druk L. Boguslawskiego, Warszawa. PL PL
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL6129B3 true PL6129B3 (pl) | 1926-11-30 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL6129B3 (pl) | Sposób wyrobu klisz do duplikatorów. | |
| CH539906A (de) | Mehrschichtiges Flächengebilde | |
| DE898909C (de) | Verfahren zum Herstellen von Abziehbildern fuer den keramischen Druck | |
| DE409378C (de) | Biegsame Lichtdruckplatte zum direkten Druck auf Glas usw. und unebene Gegenstaende und Verfahren zu deren Herstellung | |
| DE425770C (de) | Verfahren zur Herstellung von Kautschuk mit einer grossen Anzahl mikroskopisch kleiner Poren | |
| DE614696C (de) | Verfahren zum Herstellen von Metallabformungen, insbesondere Druckformen von Kolloidreliefs | |
| DE1046710B (de) | Galvanisches primaeres Trockenelement mit einem Scheider aus einem Film aus Alkylcelluloseaether und Verfahren zur Herstellung des Films | |
| DE402765C (de) | Verfahren zum Abziehen der Bildschicht von Negativen | |
| US134470A (en) | Improvement in printing-forms | |
| DE383621C (de) | Verfahren zur Herstellung photographischer UEberzuege | |
| DE590438C (de) | Verfahren zum Herstellen von Stereotypiematerntafeln | |
| DE549379C (de) | Verfahren zur Herstellung von Druckformen aus Chromatgelatine mit Hilfe von Raster- oder Strichnegativen | |
| DE481734C (de) | Verfahren zur Herstellung von Abziehbildern, die bestehen aus einem als Druck-unterlage dienenden Papierblatt und einer von diesem zusammen mit der Be-druckung abloesbaren, als Traeger fuer letztere dienenden Haut | |
| DE330947C (de) | Flachdruckverfahren | |
| AT31194B (de) | Verfahren zur Herstellung von Stereotypiematrizen. | |
| DE208799C (pl) | ||
| GB563302A (en) | Method of making metal gauze, or perforated metal sheets | |
| AT25499B (de) | Verfahren zur Zerlegung der Halbtöne für photomechanische Reproduktion. | |
| US1771165A (en) | Art of stencil manufacture | |
| CH242950A (de) | Verfahren zur Herstellung eines N-substituierten Imino-di-fettsäureamides. | |
| AT122520B (de) | Verfahren zum Herstellen von durch trockene Wärme abzuziehenden Abziehbildern. | |
| US1357816A (en) | Etching process | |
| DE477321C (de) | Verfahren zur Herstellung von nicht endlosen Tiefdruckformen | |
| DE514878C (de) | Verfahren zum Giessen von Folien jeder Staerke aus in organischen Loesungsmitteln geloessten Stoffen | |
| DE445441C (de) | Verfahren zur Herstellung von Schablonenblaettern fuer Vervielfaeltigungszwecke |