PL36863B1 - - Google Patents
Download PDFInfo
- Publication number
- PL36863B1 PL36863B1 PL36863A PL3686353A PL36863B1 PL 36863 B1 PL36863 B1 PL 36863B1 PL 36863 A PL36863 A PL 36863A PL 3686353 A PL3686353 A PL 3686353A PL 36863 B1 PL36863 B1 PL 36863B1
- Authority
- PL
- Poland
- Prior art keywords
- acid
- toluenesulfamide
- sodium acetate
- acetate solution
- sulfamidobenzoic
- Prior art date
Links
- 239000002253 acid Substances 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 6
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 claims description 5
- 239000001632 sodium acetate Substances 0.000 claims description 5
- 235000017281 sodium acetate Nutrition 0.000 claims description 5
- 230000003647 oxidation Effects 0.000 claims description 4
- 238000007254 oxidation reaction Methods 0.000 claims description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- 159000000007 calcium salts Chemical class 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- 235000005985 organic acids Nutrition 0.000 claims description 2
- 239000011591 potassium Substances 0.000 claims description 2
- 229910052700 potassium Inorganic materials 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 238000002386 leaching Methods 0.000 claims 2
- FNMPWSYBWQWZSF-UHFFFAOYSA-N 4-carbamoylbenzenesulfonic acid Chemical compound NC(=O)C1=CC=C(S(O)(=O)=O)C=C1 FNMPWSYBWQWZSF-UHFFFAOYSA-N 0.000 claims 1
- CVHZOJJKTDOEJC-UHFFFAOYSA-N saccharin Chemical compound C1=CC=C2C(=O)NS(=O)(=O)C2=C1 CVHZOJJKTDOEJC-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 239000012286 potassium permanganate Substances 0.000 description 3
- 229940081974 saccharin Drugs 0.000 description 3
- 235000019204 saccharin Nutrition 0.000 description 3
- 239000000901 saccharin and its Na,K and Ca salt Substances 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- ZMPRRFPMMJQXPP-UHFFFAOYSA-N 2-sulfobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1S(O)(=O)=O ZMPRRFPMMJQXPP-UHFFFAOYSA-N 0.000 description 1
- HLIYJBPIVVVYRR-UHFFFAOYSA-N 4-(sulfoamino)benzoic acid Chemical compound OC(=O)C1=CC=C(NS(O)(=O)=O)C=C1 HLIYJBPIVVVYRR-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 235000021395 porridge Nutrition 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL36863B1 true PL36863B1 (cg-RX-API-DMAC10.html) | 1954-02-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL36863B1 (cg-RX-API-DMAC10.html) | ||
| US3002815A (en) | Process for the production of chromium trioxide | |
| US2415147A (en) | Process for oxidation of heterocyclic nitrogen compounds | |
| DE951929C (de) | Verfahren zur Herstellung von 6-(p-Amino-benzolsulfonamido)-3-halogenpyridazinen | |
| CN106674098A (zh) | N‑(3‑氰基‑4‑烷氧基苯基)吡啶甲酰胺类化合物及其用途 | |
| US2302204A (en) | Process for the manufacture and purification of uric acid | |
| DE488606C (de) | Verfahren zur Darstellung von Benzanthronen | |
| US2863909A (en) | Process of extracting 1, 4-dicaffeyl-quinic acid | |
| US2358366A (en) | Heterocyclic substituted aryl sulphonamido compounds and methods of obtaining the same | |
| DE677327C (de) | Verfahren zur Darstellung von 1, 4-Dichloranthrachinon und seinen Substitutionsprodukten | |
| DE2428411C2 (de) | Verfahren zur Herstellung einer Sorbinsäure-Kaliumsorbat-Additionsverbindung (Kaliumdisorbat) | |
| US2230970A (en) | Purification of crude isocytosine | |
| DE547643C (de) | Verfahren zur Darstellung von Ringketonen der Acenaphthenreihe | |
| DE516286C (de) | Verfahren zur Darstellung von 1-Oxy-4-chloranthrachinon-2-carbonsaeure | |
| DE488682C (de) | Verfahren zur Darstellung der N-Oxyaethylderivate des 2-Amino-1-oxybenzols | |
| DE436516C (de) | Verfahren zur Darstellung von Derivaten des 6-Alkoxy-4-methylchinolins | |
| AT215421B (de) | Verfahren zur Herstellung von 4-(Pyridincarbonsäureamido- bzw. -alkylamido)-1-phenyl-2,3-dimethylpyrazolonen-(5) | |
| PL43208B1 (cg-RX-API-DMAC10.html) | ||
| DE619755C (de) | Verfahren zur Darstellung von Aminochrysensulfonsaeuren | |
| DE335304C (de) | Verfahren zur Gewinnung von Schwefelsaeure aus Kalirohsalzen | |
| SU210163A1 (ru) | СПОСОБ ПОЛУЧЕНИЯ 5- и 8-НИТРОХИНОЛИНОВ | |
| US2745840A (en) | Recovery and purification of saccharin | |
| PL437851A1 (pl) | Sposób wytwarzania pigmentów żelazowych | |
| PL56429B1 (cg-RX-API-DMAC10.html) | ||
| AT38350B (de) | Verfahren zur Darstellung der Anhydride von Azylsalizylsäuren. |