PL152165B1 - The method of manufacture of the constant component of the catalyst of magnesium halide type/titanium halide for olefins polymerization/ - Google Patents
The method of manufacture of the constant component of the catalyst of magnesium halide type/titanium halide for olefins polymerization/Info
- Publication number
- PL152165B1 PL152165B1 PL1987266319A PL26631987A PL152165B1 PL 152165 B1 PL152165 B1 PL 152165B1 PL 1987266319 A PL1987266319 A PL 1987266319A PL 26631987 A PL26631987 A PL 26631987A PL 152165 B1 PL152165 B1 PL 152165B1
- Authority
- PL
- Poland
- Prior art keywords
- magnesium
- titanium
- compound
- catalyst
- halide
- Prior art date
Links
- 239000010936 titanium Substances 0.000 title claims abstract description 41
- 229910052719 titanium Inorganic materials 0.000 title claims abstract description 29
- 239000011777 magnesium Substances 0.000 title claims description 51
- 238000000034 method Methods 0.000 title claims description 38
- 229910052749 magnesium Inorganic materials 0.000 title claims description 34
- -1 magnesium halide Chemical class 0.000 title claims description 31
- 238000006116 polymerization reaction Methods 0.000 title claims description 17
- 238000004519 manufacturing process Methods 0.000 title claims description 13
- 239000003054 catalyst Substances 0.000 title abstract description 45
- 150000001336 alkenes Chemical class 0.000 title description 4
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims abstract description 23
- 150000002681 magnesium compounds Chemical class 0.000 claims abstract description 21
- 239000011949 solid catalyst Substances 0.000 claims abstract description 9
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 6
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 4
- 150000002366 halogen compounds Chemical class 0.000 claims abstract description 4
- 150000001875 compounds Chemical class 0.000 claims description 27
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 25
- 150000002430 hydrocarbons Chemical class 0.000 claims description 16
- 229930195733 hydrocarbon Natural products 0.000 claims description 14
- 239000004215 Carbon black (E152) Substances 0.000 claims description 12
- 150000003609 titanium compounds Chemical class 0.000 claims description 12
- 238000006243 chemical reaction Methods 0.000 claims description 10
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 claims description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 7
- 238000005406 washing Methods 0.000 claims description 5
- 238000010438 heat treatment Methods 0.000 claims description 2
- 229910003074 TiCl4 Inorganic materials 0.000 claims 1
- 239000007787 solid Substances 0.000 abstract description 13
- 229920000098 polyolefin Polymers 0.000 abstract description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 48
- 239000000243 solution Substances 0.000 description 26
- 229920000642 polymer Polymers 0.000 description 22
- 239000000047 product Substances 0.000 description 22
- 239000013078 crystal Substances 0.000 description 17
- 239000000203 mixture Substances 0.000 description 16
- 230000003197 catalytic effect Effects 0.000 description 14
- 239000000460 chlorine Substances 0.000 description 13
- 230000000694 effects Effects 0.000 description 13
- 239000007788 liquid Substances 0.000 description 12
- 230000008569 process Effects 0.000 description 12
- 239000003795 chemical substances by application Substances 0.000 description 11
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 10
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 10
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 10
- 238000010992 reflux Methods 0.000 description 10
- 238000005658 halogenation reaction Methods 0.000 description 9
- 238000002360 preparation method Methods 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 8
- 229910052801 chlorine Inorganic materials 0.000 description 7
- 230000026030 halogenation Effects 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 239000002245 particle Substances 0.000 description 7
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 7
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 229910052782 aluminium Inorganic materials 0.000 description 6
- 230000000052 comparative effect Effects 0.000 description 6
- MTZQAGJQAFMTAQ-UHFFFAOYSA-N ethyl benzoate Chemical compound CCOC(=O)C1=CC=CC=C1 MTZQAGJQAFMTAQ-UHFFFAOYSA-N 0.000 description 6
- 229910052736 halogen Inorganic materials 0.000 description 6
- 150000002367 halogens Chemical class 0.000 description 6
- 230000001105 regulatory effect Effects 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 5
- 150000004820 halides Chemical class 0.000 description 5
- 239000002243 precursor Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 4
- 230000008901 benefit Effects 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 239000003085 diluting agent Substances 0.000 description 4
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 4
- QWTDNUCVQCZILF-UHFFFAOYSA-N isopentane Chemical compound CCC(C)C QWTDNUCVQCZILF-UHFFFAOYSA-N 0.000 description 4
- 239000007791 liquid phase Substances 0.000 description 4
- 229910001629 magnesium chloride Inorganic materials 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 229920001155 polypropylene Polymers 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- 239000004743 Polypropylene Substances 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 239000000872 buffer Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 238000012685 gas phase polymerization Methods 0.000 description 3
- 150000008282 halocarbons Chemical class 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 238000010587 phase diagram Methods 0.000 description 3
- 230000007704 transition Effects 0.000 description 3
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 description 3
- HRAQMGWTPNOILP-UHFFFAOYSA-N 4-Ethoxy ethylbenzoate Chemical compound CCOC(=O)C1=CC=C(OCC)C=C1 HRAQMGWTPNOILP-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- QPJVMBTYPHYUOC-UHFFFAOYSA-N Methyl benzoate Natural products COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 230000003213 activating effect Effects 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 230000003139 buffering effect Effects 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- MGWAVDBGNNKXQV-UHFFFAOYSA-N diisobutyl phthalate Chemical compound CC(C)COC(=O)C1=CC=CC=C1C(=O)OCC(C)C MGWAVDBGNNKXQV-UHFFFAOYSA-N 0.000 description 2
- AFABGHUZZDYHJO-UHFFFAOYSA-N dimethyl butane Natural products CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 2
- 239000003792 electrolyte Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 150000005826 halohydrocarbons Chemical class 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 229920001580 isotactic polymer Polymers 0.000 description 2
- CRGZYKWWYNQGEC-UHFFFAOYSA-N magnesium;methanolate Chemical compound [Mg+2].[O-]C.[O-]C CRGZYKWWYNQGEC-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 2
- 239000002574 poison Substances 0.000 description 2
- 231100000614 poison Toxicity 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 150000003377 silicon compounds Chemical class 0.000 description 2
- 239000012798 spherical particle Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 230000000707 stereoselective effect Effects 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 229920000576 tactic polymer Polymers 0.000 description 2
- MCULRUJILOGHCJ-UHFFFAOYSA-N triisobutylaluminium Chemical compound CC(C)C[Al](CC(C)C)CC(C)C MCULRUJILOGHCJ-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- AVGQTJUPLKNPQP-UHFFFAOYSA-N 1,1,1-trichloropropane Chemical compound CCC(Cl)(Cl)Cl AVGQTJUPLKNPQP-UHFFFAOYSA-N 0.000 description 1
- HVKCZUVMQPUWSX-UHFFFAOYSA-N 1-bromo-2,3-dichlorobenzene Chemical compound ClC1=CC=CC(Br)=C1Cl HVKCZUVMQPUWSX-UHFFFAOYSA-N 0.000 description 1
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- SQCZQTSHSZLZIQ-UHFFFAOYSA-N 1-chloropentane Chemical compound CCCCCCl SQCZQTSHSZLZIQ-UHFFFAOYSA-N 0.000 description 1
- UZGKAASZIMOAMU-UHFFFAOYSA-N 124177-85-1 Chemical class NP(=O)=O UZGKAASZIMOAMU-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical class [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 1
- UDSFAEKRVUSQDD-UHFFFAOYSA-N Dimethyl adipate Chemical compound COC(=O)CCCCC(=O)OC UDSFAEKRVUSQDD-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000002879 Lewis base Substances 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- YZCKVEUIGOORGS-IGMARMGPSA-N Protium Chemical compound [1H] YZCKVEUIGOORGS-IGMARMGPSA-N 0.000 description 1
- 229910003902 SiCl 4 Inorganic materials 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- CJWANOYUFBSCHS-UHFFFAOYSA-L [Br-].[Br-].CCO[Ti+2]OCC Chemical compound [Br-].[Br-].CCO[Ti+2]OCC CJWANOYUFBSCHS-UHFFFAOYSA-L 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 238000010669 acid-base reaction Methods 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 229940037003 alum Drugs 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- RBFQJDQYXXHULB-UHFFFAOYSA-N arsane Chemical class [AsH3] RBFQJDQYXXHULB-UHFFFAOYSA-N 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- FYXKZNLBZKRYSS-UHFFFAOYSA-N benzene-1,2-dicarbonyl chloride Chemical compound ClC(=O)C1=CC=CC=C1C(Cl)=O FYXKZNLBZKRYSS-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 238000001354 calcination Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229910002090 carbon oxide Inorganic materials 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000012295 chemical reaction liquid Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 229960001701 chloroform Drugs 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012967 coordination catalyst Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 230000002542 deteriorative effect Effects 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- BUMGIEFFCMBQDG-UHFFFAOYSA-N dichlorosilicon Chemical compound Cl[Si]Cl BUMGIEFFCMBQDG-UHFFFAOYSA-N 0.000 description 1
- HBGGXOJOCNVPFY-UHFFFAOYSA-N diisononyl phthalate Chemical compound CC(C)CCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCC(C)C HBGGXOJOCNVPFY-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229910001254 electrum Inorganic materials 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 1
- NWPWRAWAUYIELB-UHFFFAOYSA-N ethyl 4-methylbenzoate Chemical group CCOC(=O)C1=CC=C(C)C=C1 NWPWRAWAUYIELB-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- XXOYNJXVWVNOOJ-UHFFFAOYSA-N fenuron Chemical compound CN(C)C(=O)NC1=CC=CC=C1 XXOYNJXVWVNOOJ-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- FUKUFMFMCZIRNT-UHFFFAOYSA-N hydron;methanol;chloride Chemical compound Cl.OC FUKUFMFMCZIRNT-UHFFFAOYSA-N 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000007527 lewis bases Chemical class 0.000 description 1
- IXUQHZKXQCGDFB-UHFFFAOYSA-M magnesium;2-methylpropan-1-olate;chloride Chemical compound [Mg+2].[Cl-].CC(C)C[O-] IXUQHZKXQCGDFB-UHFFFAOYSA-M 0.000 description 1
- OLCJPTDFZLXESX-UHFFFAOYSA-N magnesium;chloromethanolate Chemical class [Mg+2].[O-]CCl.[O-]CCl OLCJPTDFZLXESX-UHFFFAOYSA-N 0.000 description 1
- SWMSUKCRKOWDGN-UHFFFAOYSA-M magnesium;ethanolate;bromide Chemical compound [Br-].CCO[Mg+] SWMSUKCRKOWDGN-UHFFFAOYSA-M 0.000 description 1
- KRTCPMDBLDWJQY-UHFFFAOYSA-M magnesium;ethanolate;chloride Chemical compound [Mg+2].[Cl-].CC[O-] KRTCPMDBLDWJQY-UHFFFAOYSA-M 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000005649 metathesis reaction Methods 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 229940095102 methyl benzoate Drugs 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 230000000877 morphologic effect Effects 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- ZEYHEAKUIGZSGI-UHFFFAOYSA-N para-methoxy benzoic acid Natural products COC1=CC=C(C(O)=O)C=C1 ZEYHEAKUIGZSGI-UHFFFAOYSA-N 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003003 phosphines Chemical class 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 1
- 239000004810 polytetrafluoroethylene Substances 0.000 description 1
- AGTBCWRZVYHRTC-UHFFFAOYSA-N propan-2-yl naphthalene-1-carboxylate Chemical compound C1=CC=C2C(C(=O)OC(C)C)=CC=CC2=C1 AGTBCWRZVYHRTC-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000007670 refining Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 150000004756 silanes Chemical class 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000005049 silicon tetrachloride Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003464 sulfur compounds Chemical class 0.000 description 1
- 238000010557 suspension polymerization reaction Methods 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- ZLMGMVJGEULFPP-UHFFFAOYSA-J titanium(4+) trichloride phenoxide Chemical compound Cl[Ti](Cl)(Cl)OC1=CC=CC=C1 ZLMGMVJGEULFPP-UHFFFAOYSA-J 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- CNWZYDSEVLFSMS-UHFFFAOYSA-N tripropylalumane Chemical compound CCC[Al](CCC)CCC CNWZYDSEVLFSMS-UHFFFAOYSA-N 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L23/00—Compositions of homopolymers or copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond; Compositions of derivatives of such polymers
- C08L23/02—Compositions of homopolymers or copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond; Compositions of derivatives of such polymers not modified by chemical after-treatment
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C31/00—Saturated compounds having hydroxy or O-metal groups bound to acyclic carbon atoms
- C07C31/28—Metal alcoholates
- C07C31/30—Alkali metal or alkaline earth metal alcoholates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
- Catalysts (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Sampling And Sample Adjustment (AREA)
- Reinforced Plastic Materials (AREA)
- Analysing Materials By The Use Of Radiation (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/875,845 US4710482A (en) | 1986-06-18 | 1986-06-18 | Olefin polymerization catalyst component |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PL266319A1 PL266319A1 (en) | 1988-08-18 |
| PL152165B1 true PL152165B1 (en) | 1990-11-30 |
Family
ID=25366457
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1987266319A PL152165B1 (en) | 1986-06-18 | 1987-06-17 | The method of manufacture of the constant component of the catalyst of magnesium halide type/titanium halide for olefins polymerization/ |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US4710482A (enFirst) |
| EP (1) | EP0250244B1 (enFirst) |
| JP (1) | JP2534264B2 (enFirst) |
| KR (1) | KR950015138B1 (enFirst) |
| CN (1) | CN1009646B (enFirst) |
| AT (1) | ATE67215T1 (enFirst) |
| AU (1) | AU594162B2 (enFirst) |
| BR (1) | BR8703049A (enFirst) |
| CA (1) | CA1294949C (enFirst) |
| CS (1) | CS451287A2 (enFirst) |
| DD (1) | DD268958A5 (enFirst) |
| DE (1) | DE3772865D1 (enFirst) |
| ES (1) | ES2025660T3 (enFirst) |
| FI (1) | FI88926C (enFirst) |
| GR (1) | GR3003304T3 (enFirst) |
| HU (1) | HU205151B (enFirst) |
| IN (1) | IN171402B (enFirst) |
| MY (1) | MY101565A (enFirst) |
| NO (1) | NO168589C (enFirst) |
| NZ (1) | NZ220734A (enFirst) |
| PL (1) | PL152165B1 (enFirst) |
| ZA (1) | ZA874250B (enFirst) |
Families Citing this family (55)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5077357A (en) * | 1990-10-22 | 1991-12-31 | Shell Oil Company | Olefin polymerization catalyst |
| US5066737A (en) * | 1990-10-22 | 1991-11-19 | Shell Oil Company | Olefin polymerization catalyst |
| US5082907A (en) * | 1990-10-18 | 1992-01-21 | Shell Oil Company | Olefin polymerization catalyst |
| US5151399A (en) * | 1990-10-18 | 1992-09-29 | Shell Oil Company | Olefin polymerization catalyst |
| US5106806A (en) * | 1990-10-18 | 1992-04-21 | Shell Oil Company | Olefin polymerization catalyst |
| US4804648A (en) * | 1986-06-18 | 1989-02-14 | Shell Oil Company | Crystalline olefin polymerization catalyst component |
| US4902761A (en) * | 1986-11-20 | 1990-02-20 | Mitsubishi Kasei Corporation | Method for producing an olefin polymer |
| US4727051A (en) * | 1986-12-15 | 1988-02-23 | Stauffer Chemical Company | Production of halide-and alkoxy-containing magnesium compositions |
| DE3888145T2 (de) * | 1987-12-26 | 1994-06-01 | Toho Titanium Co Ltd | Katalysator-Feststoff für Olefinpolymerisation und Olefinpolymerisationskatalysator. |
| US5225385A (en) * | 1988-08-26 | 1993-07-06 | Shell Oil Company | Solid alkene polymerization catalyst components and process for their preparation |
| CA1334961C (en) * | 1988-09-06 | 1995-03-28 | Robert Charles Job | Process for producing a supported polymerization catalyst component |
| US4876230A (en) * | 1988-09-06 | 1989-10-24 | Shell Oil Company | Magnesium alkoxide polymerization catalyst by boiling in organic solvents |
| US4874737A (en) * | 1988-09-06 | 1989-10-17 | Shell Oil Company | Silicate-modified magnesium alkoxide polymerization catalysts |
| US4959336A (en) * | 1989-04-07 | 1990-09-25 | Shell Oil Company | Silicate-modified magnesium ethoxide polymerization catalysts |
| US5270276A (en) * | 1989-04-25 | 1993-12-14 | Shell Oil Company | Process for the production of elastomeric, primarily syndiotactic polypropylene and catalysts for use in said process |
| US5270410A (en) * | 1989-04-25 | 1993-12-14 | Shell Oil Company | Process for the production of elastomeric, primarily syndiotactic polypropylene and catalysts for use in said process |
| GB8915531D0 (en) * | 1989-07-06 | 1989-08-23 | Ass Octel | Alkaline earth,transition and lanthanide metal inorganic salt complexes |
| US4971936A (en) * | 1989-07-10 | 1990-11-20 | Shell Oil Company | Catalyst component for making primarily isotactic elastomeric polypropylene or polybutene |
| US5556820A (en) * | 1989-12-28 | 1996-09-17 | Idemitsu Petrochemical Co., Ltd. | Catalyst component for olefin polymerization and process for producing polyolefins |
| JP3204688B2 (ja) * | 1991-06-25 | 2001-09-04 | 出光石油化学株式会社 | エチレン重合体の製造方法 |
| JP2509767B2 (ja) * | 1991-06-28 | 1996-06-26 | 出光石油化学株式会社 | オレフィン重合体の製造法 |
| US5118767A (en) * | 1990-02-26 | 1992-06-02 | Shell Oil Company | Process for producing mildly elastomeric primarily isotatic polypropylene and poly-1-butene |
| US5089573A (en) * | 1990-02-26 | 1992-02-18 | Shell Oil Company | Process for the production of elastomeric, primarily isotactic polyolefins and catalysts for use in said process |
| US5118649A (en) * | 1990-02-26 | 1992-06-02 | Shell Oil Company | Process for the production of elastomeric primarily isotactic polyolefins and catalysts for use in said process |
| US4960475A (en) * | 1990-03-20 | 1990-10-02 | Cranney Don H | Surfactant for gassed emulsion explosive |
| US5164352A (en) * | 1990-05-11 | 1992-11-17 | Shell Oil Company | Process for the production of elastomeric, primarily isotactic polyolefins and catalysts for use in said process |
| US5118768A (en) * | 1990-05-11 | 1992-06-02 | Shell Oil Company | Process for the production of elastomeric, primarily isotactic polyolefins and catalysts for use in said process |
| US5034361A (en) * | 1990-05-24 | 1991-07-23 | Shell Oil Company | Catalyst precursor production |
| US5229342A (en) * | 1990-10-18 | 1993-07-20 | Shell Oil Company | Olefin polymerization catalyst |
| US5229344A (en) * | 1990-10-18 | 1993-07-20 | Shell Oil Company | Olefin polymerization catalyst |
| US5124298A (en) * | 1990-10-22 | 1992-06-23 | Shell Oil Company | Olefin polymerization catalyst |
| US5132263A (en) * | 1990-10-22 | 1992-07-21 | Shell Oil Company | Olefin polymerization catalyst |
| US5122494A (en) * | 1991-02-19 | 1992-06-16 | Shell Oil Company | Olefin polymerization catalyst |
| EP0544006B1 (en) * | 1991-06-17 | 1996-11-06 | Idemitsu Petrochemical Co. Ltd. | Production of a component of olefin polymerization catalyst |
| JP2534414B2 (ja) * | 1991-06-27 | 1996-09-18 | 出光石油化学株式会社 | ポリプロピレン系樹脂 |
| JP2534415B2 (ja) * | 1991-06-28 | 1996-09-18 | 出光石油化学株式会社 | ポリプロピレン系樹脂 |
| IT1262935B (it) * | 1992-01-31 | 1996-07-22 | Montecatini Tecnologie Srl | Componenti e catalizzatori per la polimerizzazione di olefine |
| IT1262934B (it) * | 1992-01-31 | 1996-07-22 | Montecatini Tecnologie Srl | Componenti e catalizzatori per la polimerizzazione di olefine |
| WO1994010210A1 (en) * | 1992-10-30 | 1994-05-11 | Shell Oil Company | Olefin polymerization catalyst |
| US6066701A (en) | 1996-12-31 | 2000-05-23 | Exxon Chemical Patents Inc. | Multistage method for manufacturing polyolefins |
| US6124507A (en) * | 1997-12-10 | 2000-09-26 | Union Carbide Chemicals & Plastics Technology Corporation | Electron donors |
| US5968865A (en) * | 1997-12-10 | 1999-10-19 | Union Carbide Chemicals & Plastics Technology Corporation | Electron donor containing compositions |
| US5962361A (en) * | 1998-10-14 | 1999-10-05 | Union Carbide Chemicals & Plastics Technology Corporation | Methods of making and using catalyst precursor |
| US6593506B1 (en) | 2000-10-12 | 2003-07-15 | Exxonmobil Chemical Patents Inc. | Olefin recovery in a polyolefin production process |
| US6495609B1 (en) | 2000-11-03 | 2002-12-17 | Exxonmobil Chemical Patents Inc. | Carbon dioxide recovery in an ethylene to ethylene oxide production process |
| US6841633B2 (en) | 2000-11-29 | 2005-01-11 | Reliance Industries Limited | Lower α-alkene polymerization heterogeneous solid catalyst |
| US20030022786A1 (en) * | 2001-05-03 | 2003-01-30 | Epstein Ronald A. | Catalyst for propylene polymerization |
| US20060223956A1 (en) * | 2003-09-23 | 2006-10-05 | Linfeng Chen | Catalyst composition with mixed sca and propylene polymerization process |
| CN101450976B (zh) * | 2007-11-30 | 2011-06-15 | 北京三聚环保新材料股份有限公司 | 一种改进的聚烯烃催化剂制备工艺 |
| MX2011007155A (es) | 2008-12-31 | 2011-09-26 | Dow Global Technologies Llc | Polimero a base de propileno, articulos y procesos para producir el mismo. |
| EP2373702B1 (en) | 2008-12-31 | 2018-03-21 | W.R. Grace & Co.-Conn. | Procatalyst composition with substituted 1,2-phenylene aromatic diester internal donor and method |
| MY183040A (en) | 2009-12-02 | 2021-02-08 | Grace W R & Co | Two atom bridged dicarbonate compounds as internal donors in catalysts for polypropylene manufacture |
| WO2011068775A1 (en) | 2009-12-02 | 2011-06-09 | Dow Global Technologies Inc. | Three and four atom bridged dicarbonate compounds as internal donors in catalysts for polypropylene manufacture |
| WO2017140580A1 (en) * | 2016-02-15 | 2017-08-24 | Basell Poliolefine GmbH | Preactivated catalyst component for the polymerization of olefins |
| US20250109218A1 (en) | 2023-09-29 | 2025-04-03 | Formosa Plastics Corporation, U.S.A. | Method for preparing catalyst component for polymerization of polyolefin without the use of internal electron donors |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3135809A (en) * | 1960-07-21 | 1964-06-02 | Southern Res Inst | Isomerization process |
| JPS603323B2 (ja) * | 1978-12-11 | 1985-01-28 | 三井化学株式会社 | オレフイン類の重合方法 |
| EP0019312B1 (en) * | 1979-04-30 | 1983-08-17 | Shell Internationale Researchmaatschappij B.V. | Olefin polymerization catalyst compositions and a process for the polymerization of olefins employing such compositions |
| CA1141093A (en) * | 1979-05-17 | 1983-02-08 | Brian L. Goodall | Olefin polymerization catalyst compositions and a process for the polymerization of olefins employing such compositions |
| GB2101610A (en) * | 1981-07-14 | 1983-01-19 | Ici Plc | Catalyst composition, production and use |
| EP0072128B1 (en) * | 1981-08-07 | 1986-03-19 | Imperial Chemical Industries Plc | Spraying solid |
| US4451688A (en) * | 1981-12-03 | 1984-05-29 | Nippon Oil Company, Limited | Process for preparing polyolefins |
| US4478952A (en) * | 1983-03-18 | 1984-10-23 | E. I. Du Pont De Nemours And Company | Supported catalyst for olefin polymerization |
| GB2143834B (en) * | 1983-07-20 | 1987-06-03 | Toho Titanium Co Ltd | Polymerization catalyst |
| JPS6023404A (ja) * | 1983-07-20 | 1985-02-06 | Toho Titanium Co Ltd | オレフィン類重合用触媒成分 |
| US4540679A (en) * | 1984-03-23 | 1985-09-10 | Amoco Corporation | Magnesium hydrocarbyl carbonate supports |
-
1986
- 1986-06-18 US US06/875,845 patent/US4710482A/en not_active Expired - Lifetime
-
1987
- 1987-06-09 IN IN497/DEL/87A patent/IN171402B/en unknown
- 1987-06-12 ZA ZA874250A patent/ZA874250B/xx unknown
- 1987-06-13 MY MYPI87000806A patent/MY101565A/en unknown
- 1987-06-15 AU AU74220/87A patent/AU594162B2/en not_active Ceased
- 1987-06-17 BR BR8703049A patent/BR8703049A/pt not_active IP Right Cessation
- 1987-06-17 NZ NZ220734A patent/NZ220734A/xx unknown
- 1987-06-17 DD DD87303901A patent/DD268958A5/de not_active IP Right Cessation
- 1987-06-17 NO NO872539A patent/NO168589C/no unknown
- 1987-06-17 PL PL1987266319A patent/PL152165B1/pl unknown
- 1987-06-17 FI FI872711A patent/FI88926C/fi not_active IP Right Cessation
- 1987-06-17 KR KR1019870006158A patent/KR950015138B1/ko not_active Expired - Lifetime
- 1987-06-18 CA CA000539967A patent/CA1294949C/en not_active Expired - Lifetime
- 1987-06-18 CN CN87104645A patent/CN1009646B/zh not_active Expired
- 1987-06-18 AT AT87305424T patent/ATE67215T1/de not_active IP Right Cessation
- 1987-06-18 HU HU872788A patent/HU205151B/hu unknown
- 1987-06-18 EP EP87305424A patent/EP0250244B1/en not_active Expired - Lifetime
- 1987-06-18 JP JP62150330A patent/JP2534264B2/ja not_active Expired - Fee Related
- 1987-06-18 DE DE8787305424T patent/DE3772865D1/de not_active Expired - Lifetime
- 1987-06-18 CS CS874512A patent/CS451287A2/cs unknown
- 1987-06-18 ES ES198787305424T patent/ES2025660T3/es not_active Expired - Lifetime
-
1991
- 1991-12-11 GR GR91401928T patent/GR3003304T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI872711A0 (fi) | 1987-06-17 |
| MY101565A (en) | 1991-12-17 |
| CN1009646B (zh) | 1990-09-19 |
| DE3772865D1 (de) | 1991-10-17 |
| ATE67215T1 (de) | 1991-09-15 |
| DD268958A5 (de) | 1989-06-14 |
| PL266319A1 (en) | 1988-08-18 |
| HUT48648A (en) | 1989-06-28 |
| FI88926B (fi) | 1993-04-15 |
| NO168589B (no) | 1991-12-02 |
| HU205151B (en) | 1992-03-30 |
| CA1294949C (en) | 1992-01-28 |
| GR3003304T3 (en) | 1993-02-17 |
| IN171402B (enFirst) | 1992-10-03 |
| EP0250244A3 (en) | 1989-03-15 |
| ES2025660T3 (es) | 1992-04-01 |
| BR8703049A (pt) | 1988-03-08 |
| FI88926C (fi) | 1993-07-26 |
| NZ220734A (en) | 1989-03-29 |
| EP0250244B1 (en) | 1991-09-11 |
| JP2534264B2 (ja) | 1996-09-11 |
| EP0250244A2 (en) | 1987-12-23 |
| AU7422087A (en) | 1987-12-24 |
| CS451287A2 (en) | 1991-06-11 |
| KR950015138B1 (ko) | 1995-12-22 |
| US4710482A (en) | 1987-12-01 |
| NO872539L (no) | 1987-12-21 |
| CN87104645A (zh) | 1988-01-20 |
| NO168589C (no) | 1992-03-11 |
| NO872539D0 (no) | 1987-06-17 |
| AU594162B2 (en) | 1990-03-01 |
| FI872711L (fi) | 1987-12-19 |
| KR880000507A (ko) | 1988-03-26 |
| JPS6354404A (ja) | 1988-03-08 |
| ZA874250B (en) | 1988-02-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL152165B1 (en) | The method of manufacture of the constant component of the catalyst of magnesium halide type/titanium halide for olefins polymerization/ | |
| US6388028B2 (en) | Components and catalysts for the polymerization of olefins | |
| EP2610272B1 (en) | Catalyst component | |
| US5082907A (en) | Olefin polymerization catalyst | |
| EP0481748B1 (en) | Olefin polymerization catalyst | |
| EP2610270A1 (en) | Catalyst component | |
| US5413979A (en) | Method for the preparation of a catalyst component for the polymerization of olefins, a polymerization catalyst component produced by the method and use of the same | |
| KR20180044341A (ko) | 올레핀 중합용 촉매 성분의 제조 방법 | |
| PL153625B1 (en) | Method for manufacturing the solid componenet of an olefines polymerization catalyst | |
| US4914069A (en) | Preparation of olefin polymerization catalyst component | |
| US20010039241A1 (en) | Magnesium/titanium alkoxide compounds and method of preparation | |
| JP2007506816A (ja) | 多孔性エチレンポリマーの製造方法およびそれにより得られるポリマー | |
| US4948770A (en) | Method for crystallizing magnesium chloride and method for using in a catalyst composition | |
| US5141910A (en) | Olefin polymerization catalyst | |
| US4804648A (en) | Crystalline olefin polymerization catalyst component | |
| US4855371A (en) | Process for polymerizing olefins with a crystalline magnesium catalyst component | |
| JP3340729B2 (ja) | α−オレフィンの重合方法 | |
| HUT53028A (en) | Process for cristallizing magnesium-chloride for utilizing in catalyst compositions | |
| US4870040A (en) | Olefin polymerization catalysts from soluble magnesium alkoxides made from alkyl or aryl magnesium mixed with a branched or aromatic aldehyde | |
| HU212871B (en) | Process for producing catalyst-component and an olefin polymerisation catalyst containing it, and method for olefin polymerization |